Commit de89d3bc26ed4c38ede739bc49b741816a76e354
0 parents
Initial commit.
Showing
24 changed files
with
14550 additions
and
0 deletions
Show diff stats
1 | +++ a/CMakeLists.txt | ||
1 | +# CMake project file for our t-matrix framework | ||
2 | +cmake_minimum_required (VERSION 2.8) | ||
3 | +project (ms-tmatrix) | ||
4 | +enable_language(Fortran) | ||
5 | + | ||
6 | +find_package(PythonInterp REQUIRED) | ||
7 | + | ||
8 | +#find any non-standard modules | ||
9 | +set(CMAKE_MODULE_PATH ${CMAKE_MODULE_PATH} "${CMAKE_SOURCE_DIR}") | ||
10 | +find_package(Matplotlib REQUIRED) | ||
11 | +find_package(PyQt4) | ||
12 | + | ||
13 | +#copy all of the front-end scripts to the binary directory | ||
14 | +file(GLOB PY_SCRIPTS RELATIVE "${CMAKE_CURRENT_SOURCE_DIR}" "${CMAKE_CURRENT_SOURCE_DIR}/*.py") | ||
15 | +add_custom_target( frontend-scripts ALL DEPENDS ${CMAKE_CURRENT_BINARY_DIR}/${PY_SCRIPTS}) | ||
16 | +foreach(PY_SCRIPT ${PY_SCRIPTS}) | ||
17 | + add_custom_command(OUTPUT ${CMAKE_CURRENT_BINARY_DIR}/${PY_SCRIPT} | ||
18 | + COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_CURRENT_SOURCE_DIR}/${PY_SCRIPT} ${CMAKE_CURRENT_BINARY_DIR}/${PY_SCRIPT} | ||
19 | + DEPENDS ${CMAKE_CURRENT_SOURCE_DIR}/${PY_SCRIPTS} | ||
20 | + ) | ||
21 | +endforeach(PY_SCRIPT) | ||
22 | + | ||
23 | +#copy default input data | ||
24 | +configure_file(msinput.inp ${CMAKE_CURRENT_BINARY_DIR}/msinput.inp @ONLY) | ||
25 | +configure_file(cube27.pos ${CMAKE_CURRENT_BINARY_DIR}/cube27.pos @ONLY) | ||
26 | +configure_file(cyl3000fvp5.pos ${CMAKE_CURRENT_BINARY_DIR}/cyl3000fvp5.pos @ONLY) | ||
27 | +configure_file(cylslab3000.pos ${CMAKE_CURRENT_BINARY_DIR}/cylslab3000.pos @ONLY) | ||
28 | +configure_file(etaGold.txt ${CMAKE_CURRENT_BINARY_DIR}/etaGold.txt @ONLY) | ||
29 | +configure_file(etaSilver.txt ${CMAKE_CURRENT_BINARY_DIR}/etaSilver.txt @ONLY) | ||
30 | +configure_file(mstm_guiwindow.ui ${CMAKE_CURRENT_BINARY_DIR}/mstm_guiwindow.ui @ONLY) | ||
31 | + | ||
32 | + | ||
33 | +#compile the FORTRAN code | ||
34 | +file(GLOB SRC "mpidefs-serial.f90" "mstm-intrinsics.f90" "mstm-modules-v2.2.f90" "mstm-main-v2.2.f90") | ||
35 | +add_executable(ms-tmatrix ${SRC}) | ||
0 | \ No newline at end of file | 36 | \ No newline at end of file |
1 | +++ a/FindMatplotlib.cmake | ||
1 | +# - Find the matplotlib libraries | ||
2 | +# This module finds IF matplotlib is installed, and sets the following variables | ||
3 | +# indicating where it is. | ||
4 | +# | ||
5 | +# MATPLOTLIB_FOUND - was matplotlib found | ||
6 | +# MATPLOTLIB_VERSION - the version of matplotlib found as a string | ||
7 | +# MATPLOTLIB_VERSION_MAJOR - the major version number of matplotlib | ||
8 | +# MATPLOTLIB_VERSION_MINOR - the minor version number of matplotlib | ||
9 | +# MATPLOTLIB_VERSION_PATCH - the patch version number of matplotlib | ||
10 | +# MATPLOTLIB_PATH_DIRS - path to the matplotlib include files | ||
11 | + | ||
12 | +IF(PYTHONINTERP_FOUND) | ||
13 | + # Try to import matplotlib into Python interpreter. Python | ||
14 | + # interpreter was found previously as required package, so | ||
15 | + # don't take care about this. | ||
16 | + execute_process(COMMAND "${PYTHON_EXECUTABLE}" "-c" | ||
17 | + "import matplotlib as m; print(m.__version__); print(m.__path__[0]);" | ||
18 | + RESULT_VARIABLE _MATPLOTLIB_SEARCH_SUCCESS | ||
19 | + OUTPUT_VARIABLE _MATPLOTLIB_VALUES | ||
20 | + ERROR_VARIABLE _MATPLOTLIB_ERROR_VALUE | ||
21 | + OUTPUT_STRIP_TRAILING_WHITESPACE) | ||
22 | + | ||
23 | + IF(_MATPLOTLIB_SEARCH_SUCCESS MATCHES 0) | ||
24 | + set(MATPLOTLIB_FOUND TRUE) | ||
25 | + | ||
26 | + # Convert the process output into a list | ||
27 | + string(REGEX REPLACE ";" "\\\\;" _MATPLOTLIB_VALUES ${_MATPLOTLIB_VALUES}) | ||
28 | + string(REGEX REPLACE "\n" ";" _MATPLOTLIB_VALUES ${_MATPLOTLIB_VALUES}) | ||
29 | + list(GET _MATPLOTLIB_VALUES 0 MATPLOTLIB_VERSION) | ||
30 | + list(GET _MATPLOTLIB_VALUES 1 MATPLOTLIB_PATH_DIRS) | ||
31 | + | ||
32 | + # Make sure all directory separators are '/' | ||
33 | + string(REGEX REPLACE "\\\\" "/" MATPLOTLIB_PATH_DIRS ${MATPLOTLIB_PATH_DIRS}) | ||
34 | + | ||
35 | + # Get the major and minor version numbers | ||
36 | + string(REGEX REPLACE "\\." ";" _MATPLOTLIB_VERSION_LIST ${MATPLOTLIB_VERSION}) | ||
37 | + list(GET _MATPLOTLIB_VERSION_LIST 0 MATPLOTLIB_VERSION_MAJOR) | ||
38 | + list(GET _MATPLOTLIB_VERSION_LIST 1 MATPLOTLIB_VERSION_MINOR) | ||
39 | + list(GET _MATPLOTLIB_VERSION_LIST 2 MATPLOTLIB_VERSION_PATCH) | ||
40 | + ELSE() | ||
41 | + set(MATPLOTLIB_FOUND FALSE) | ||
42 | + ENDIF() | ||
43 | +ELSE() | ||
44 | + set(MATPLOTLIB_FOUND FALSE) | ||
45 | +ENDIF() | ||
0 | \ No newline at end of file | 46 | \ No newline at end of file |
1 | +++ a/FindPyQt4.cmake | ||
1 | +# Find PyQt4 | ||
2 | +# ~~~~~~~~~~ | ||
3 | +# Copyright (c) 2007-2008, Simon Edwards <simon@simonzone.com> | ||
4 | +# Redistribution and use is allowed according to the terms of the BSD license. | ||
5 | +# For details see the accompanying COPYING-CMAKE-SCRIPTS file. | ||
6 | +# | ||
7 | +# PyQt4 website: http://www.riverbankcomputing.co.uk/pyqt/index.php | ||
8 | +# | ||
9 | +# Find the installed version of PyQt4. FindPyQt4 should only be called after | ||
10 | +# Python has been found. | ||
11 | +# | ||
12 | +# This file defines the following variables: | ||
13 | +# | ||
14 | +# PYQT4_VERSION - The version of PyQt4 found expressed as a 6 digit hex number | ||
15 | +# suitable for comparision as a string | ||
16 | +# | ||
17 | +# PYQT4_VERSION_STR - The version of PyQt4 as a human readable string. | ||
18 | +# | ||
19 | +# PYQT4_VERSION_TAG - The PyQt version tag using by PyQt's sip files. | ||
20 | +# | ||
21 | +# PYQT4_SIP_DIR - The directory holding the PyQt4 .sip files. | ||
22 | +# | ||
23 | +# PYQT4_SIP_FLAGS - The SIP flags used to build PyQt. | ||
24 | + | ||
25 | +IF(EXISTS PYQT4_VERSION) | ||
26 | + # Already in cache, be silent | ||
27 | + SET(PYQT4_FOUND TRUE) | ||
28 | +ELSE(EXISTS PYQT4_VERSION) | ||
29 | + | ||
30 | + FIND_FILE(_find_pyqt_py FindPyQt.py PATHS ${CMAKE_MODULE_PATH}) | ||
31 | + | ||
32 | + EXECUTE_PROCESS(COMMAND ${PYTHON_EXECUTABLE} ${_find_pyqt_py} OUTPUT_VARIABLE pyqt_config) | ||
33 | + IF(pyqt_config) | ||
34 | + STRING(REGEX REPLACE "^pyqt_version:([^\n]+).*$" "\\1" PYQT4_VERSION ${pyqt_config}) | ||
35 | + STRING(REGEX REPLACE ".*\npyqt_version_str:([^\n]+).*$" "\\1" PYQT4_VERSION_STR ${pyqt_config}) | ||
36 | + STRING(REGEX REPLACE ".*\npyqt_version_tag:([^\n]+).*$" "\\1" PYQT4_VERSION_TAG ${pyqt_config}) | ||
37 | + STRING(REGEX REPLACE ".*\npyqt_sip_dir:([^\n]+).*$" "\\1" PYQT4_SIP_DIR ${pyqt_config}) | ||
38 | + STRING(REGEX REPLACE ".*\npyqt_sip_flags:([^\n]+).*$" "\\1" PYQT4_SIP_FLAGS ${pyqt_config}) | ||
39 | + | ||
40 | + SET(PYQT4_FOUND TRUE) | ||
41 | + ENDIF(pyqt_config) | ||
42 | + | ||
43 | + IF(PYQT4_FOUND) | ||
44 | + IF(NOT PYQT4_FIND_QUIETLY) | ||
45 | + MESSAGE(STATUS "Found PyQt4 version: ${PYQT4_VERSION_STR}") | ||
46 | + ENDIF(NOT PYQT4_FIND_QUIETLY) | ||
47 | + ELSE(PYQT4_FOUND) | ||
48 | + IF(PYQT4_FIND_REQUIRED) | ||
49 | + MESSAGE(FATAL_ERROR "Could not find Python") | ||
50 | + ENDIF(PYQT4_FIND_REQUIRED) | ||
51 | + ENDIF(PYQT4_FOUND) | ||
52 | + | ||
53 | +ENDIF(EXISTS PYQT4_VERSION) |
1 | +++ a/README.md | ||
1 | +This software is designed to be used with CMake, so we recommend using it to build the application. | ||
2 | + | ||
3 | +The MSTM application requires a Fortran compiler and OpenMP. | ||
4 | + | ||
5 | +In addition, the GUI requires: | ||
6 | + | ||
7 | +Python -- http://www.python.org/ | ||
8 | +Qt4 (user interface library) -- http://qt-project.org/ | ||
9 | +PyQt4 (Python library for Qt4) -- http://wiki.python.org/moin/PyQt4 | ||
10 | +matlibplot (Plotting library for Python) -- http://matplotlib.org/ | ||
11 | + | ||
12 | +These should be available easily through most Linux package managers and can be downloaded individually for Windows systems. If they are installed through Linux, CMake should be able to find them without any problems. Windows users may have to point CMake to the installed locations. | ||
0 | \ No newline at end of file | 13 | \ No newline at end of file |
1 | +++ a/cube27.pos | ||
1 | +1. -2. -2. -2. 1. 1. | ||
2 | +1. -2. -2. 0 1. 1. | ||
3 | +1. -2. -2. 2. 1. 1. | ||
4 | +1. -2. 0 -2. 1. 1. | ||
5 | +1. -2. 0 0 1. 1. | ||
6 | +1. -2. 0 2. 1. 1. | ||
7 | +1. -2. 2. -2. 1. 1. | ||
8 | +1. -2. 2. 0 1. 1. | ||
9 | +1. -2. 2. 2. 1. 1. | ||
10 | +1. 0 -2. -2. 1. 1. | ||
11 | +1. 0 -2. 0 1. 1. | ||
12 | +1. 0 -2. 2. 1. 1. | ||
13 | +1. 0 0 -2. 1. 1. | ||
14 | +1. 0 0 0 1. 1. | ||
15 | +1. 0 0 2. 1. 1. | ||
16 | +1. 0 2. -2. 1. 1. | ||
17 | +1. 0 2. 0 1. 1. | ||
18 | +1. 0 2. 2. 1. 1. | ||
19 | +1. 2. -2. -2. 1. 1. | ||
20 | +1. 2. -2. 0 1. 1. | ||
21 | +1. 2. -2. 2. 1. 1. | ||
22 | +1. 2. 0 -2. 1. 1. | ||
23 | +1. 2. 0 0 1. 1. | ||
24 | +1. 2. 0 2. 1. 1. | ||
25 | +1. 2. 2. -2. 1. 1. | ||
26 | +1. 2. 2. 0 1. 1. | ||
27 | +1. 2. 2. 2. 1. 1. |
1 | +++ a/cyl3000fvp5.pos | ||
1 | + 1. -0.12965E+02 -0.93624E+01 -0.99941E+01 | ||
2 | + 1. 0.85070E+01 0.16922E+02 -0.99904E+01 | ||
3 | + 1. 0.35559E+01 0.13697E+02 -0.99814E+01 | ||
4 | + 1. -0.21028E+01 -0.40664E+01 -0.99752E+01 | ||
5 | + 1. 0.16388E+02 0.24331E+01 -0.99732E+01 | ||
6 | + 1. 0.12191E+02 -0.53233E+01 -0.99640E+01 | ||
7 | + 1. -0.63155E+01 0.54762E+00 -0.99566E+01 | ||
8 | + 1. -0.16808E+02 -0.66680E+01 -0.99510E+01 | ||
9 | + 1. -0.38971E+01 0.16950E+02 -0.99405E+01 | ||
10 | + 1. 0.14536E+02 -0.75087E+00 -0.99361E+01 | ||
11 | + 1. 0.10011E+02 0.12734E+02 -0.99304E+01 | ||
12 | + 1. 0.19577E+02 0.19602E+01 -0.99235E+01 | ||
13 | + 1. -0.38874E+01 0.66963E+01 -0.99166E+01 | ||
14 | + 1. -0.16619E+02 0.77769E+01 -0.99108E+01 | ||
15 | + 1. -0.19262E+01 0.29369E+00 -0.99008E+01 | ||
16 | + 1. -0.45367E+01 -0.14913E+02 -0.98994E+01 | ||
17 | + 1. -0.76987E+01 -0.63255E+01 -0.98870E+01 | ||
18 | + 1. -0.69447E+00 -0.74946E+01 -0.98822E+01 | ||
19 | + 1. -0.19576E+02 0.63091E+00 -0.98789E+01 | ||
20 | + 1. 0.12397E+02 0.15573E+02 -0.98702E+01 | ||
21 | + 1. -0.15526E+02 0.44510E+01 -0.98611E+01 | ||
22 | + 1. 0.43635E+01 0.11015E+02 -0.98534E+01 | ||
23 | + 1. -0.88401E+01 0.44805E+01 -0.98514E+01 | ||
24 | + 1. 0.11902E+02 -0.15124E+02 -0.98434E+01 | ||
25 | + 1. 0.14525E+02 0.12588E+02 -0.98395E+01 | ||
26 | + 1. -0.11177E+02 0.13433E+02 -0.98273E+01 | ||
27 | + 1. -0.12716E+00 0.15386E+02 -0.98207E+01 | ||
28 | + 1. 0.67438E+01 -0.67611E+01 -0.98138E+01 | ||
29 | + 1. -0.96134E+01 0.15372E+02 -0.98114E+01 | ||
30 | + 1. -0.12177E+02 -0.24229E+01 -0.98009E+01 | ||
31 | + 1. -0.12666E+02 -0.48327E+01 -0.97974E+01 | ||
32 | + 1. 0.58753E+01 -0.27347E+01 -0.97919E+01 | ||
33 | + 1. -0.15659E+02 -0.21863E+01 -0.97862E+01 | ||
34 | + 1. 0.71397E+01 -0.10003E+02 -0.97758E+01 | ||
35 | + 1. -0.13601E+00 0.55659E+01 -0.97677E+01 | ||
36 | + 1. -0.77498E+01 0.85131E+01 -0.97647E+01 | ||
37 | + 1. -0.98243E+01 0.10896E+02 -0.97566E+01 | ||
38 | + 1. 0.70499E+01 -0.15910E+02 -0.97477E+01 | ||
39 | + 1. -0.15316E+01 -0.12234E+02 -0.97461E+01 | ||
40 | + 1. 0.16559E+02 0.87679E+01 -0.97363E+01 | ||
41 | + 1. 0.13209E+02 0.39911E+01 -0.97309E+01 | ||
42 | + 1. 0.46898E+01 -0.15977E+02 -0.97266E+01 | ||
43 | + 1. -0.11894E+02 0.63805E+00 -0.97197E+01 | ||
44 | + 1. -0.10899E+02 -0.10216E+02 -0.97107E+01 | ||
45 | + 1. 0.15537E+01 -0.12742E+02 -0.97040E+01 | ||
46 | + 1. 0.95296E+01 -0.13359E+02 -0.96995E+01 | ||
47 | + 1. 0.14894E+02 -0.46716E+01 -0.96904E+01 | ||
48 | + 1. 0.41886E+01 -0.98142E+01 -0.96866E+01 | ||
49 | + 1. 0.15893E+02 -0.93592E+01 -0.96734E+01 | ||
50 | + 1. 0.13701E+02 -0.72705E+01 -0.96695E+01 | ||
51 | + 1. -0.84370E+01 -0.16242E+02 -0.96618E+01 | ||
52 | + 1. -0.57945E+01 0.16151E+02 -0.96545E+01 | ||
53 | + 1. 0.53057E+01 -0.13966E+02 -0.96501E+01 | ||
54 | + 1. 0.12104E+02 0.12289E+02 -0.96464E+01 | ||
55 | + 1. 0.90752E+01 0.14213E+01 -0.96377E+01 | ||
56 | + 1. 0.41127E+00 -0.18735E+02 -0.96332E+01 | ||
57 | + 1. -0.62457E+01 0.58332E+01 -0.96266E+01 | ||
58 | + 1. -0.78919E+01 0.24838E+01 -0.96148E+01 | ||
59 | + 1. 0.53353E+01 0.19207E+02 -0.96111E+01 | ||
60 | + 1. 0.26592E+00 -0.66718E+00 -0.96051E+01 | ||
61 | + 1. -0.42934E+01 0.95216E+01 -0.95991E+01 | ||
62 | + 1. -0.21728E+01 0.53178E+01 -0.95897E+01 | ||
63 | + 1. -0.19033E+02 0.60782E+01 -0.95817E+01 | ||
64 | + 1. -0.56455E+01 -0.60247E+01 -0.95739E+01 | ||
65 | + 1. 0.37324E+01 0.72618E+00 -0.95696E+01 | ||
66 | + 1. -0.70891E+01 -0.17799E+02 -0.95655E+01 | ||
67 | + 1. 0.15303E+02 -0.12749E+02 -0.95552E+01 | ||
68 | + 1. -0.68308E+01 0.14032E+02 -0.95518E+01 | ||
69 | + 1. -0.17202E+01 0.84350E+01 -0.95446E+01 | ||
70 | + 1. 0.23021E+01 -0.47083E+01 -0.95348E+01 | ||
71 | + 1. -0.61204E+00 0.12671E+02 -0.95307E+01 | ||
72 | + 1. 0.36889E+01 0.48344E+01 -0.95215E+01 | ||
73 | + 1. 0.14339E+02 0.70811E+01 -0.95167E+01 | ||
74 | + 1. -0.55337E+01 -0.21995E+01 -0.95100E+01 | ||
75 | + 1. 0.16382E+02 -0.32772E+01 -0.95061E+01 | ||
76 | + 1. -0.17172E+01 -0.17904E+02 -0.94970E+01 | ||
77 | + 1. -0.17184E+02 -0.42935E+01 -0.94907E+01 | ||
78 | + 1. 0.45522E+01 -0.45899E+01 -0.94828E+01 | ||
79 | + 1. 0.12125E+02 -0.10435E+02 -0.94743E+01 | ||
80 | + 1. 0.15970E+02 0.10790E+02 -0.94729E+01 | ||
81 | + 1. 0.16473E+02 0.17185E+00 -0.94630E+01 | ||
82 | + 1. 0.12650E+02 -0.18238E+01 -0.94545E+01 | ||
83 | + 1. -0.15189E+02 -0.81921E+01 -0.94471E+01 | ||
84 | + 1. -0.17909E+02 -0.85967E+01 -0.94443E+01 | ||
85 | + 1. 0.94085E+01 -0.17749E+01 -0.94379E+01 | ||
86 | + 1. 0.86253E+01 -0.61852E+01 -0.94295E+01 | ||
87 | + 1. 0.18235E+02 0.75681E+01 -0.94237E+01 | ||
88 | + 1. -0.12852E+02 -0.74127E+01 -0.94154E+01 | ||
89 | + 1. -0.12068E+02 0.72710E+01 -0.94098E+01 | ||
90 | + 1. -0.82542E+01 -0.10638E+02 -0.94066E+01 | ||
91 | + 1. 0.10740E+02 0.25815E+01 -0.93953E+01 | ||
92 | + 1. 0.58269E+01 -0.61338E-01 -0.93893E+01 | ||
93 | + 1. -0.59887E+01 0.31064E+01 -0.93820E+01 | ||
94 | + 1. -0.16136E+02 0.11566E+01 -0.93789E+01 | ||
95 | + 1. 0.12673E+02 0.93274E+01 -0.93671E+01 | ||
96 | + 1. -0.76655E+01 -0.23670E+01 -0.93602E+01 | ||
97 | + 1. 0.17239E+02 0.43301E+01 -0.93536E+01 | ||
98 | + 1. -0.14090E+02 0.86260E+00 -0.93523E+01 | ||
99 | + 1. -0.36694E+01 -0.13088E+02 -0.93425E+01 | ||
100 | + 1. -0.15033E+02 0.12883E+02 -0.93364E+01 | ||
101 | + 1. 0.54747E+01 0.73678E+01 -0.93273E+01 | ||
102 | + 1. 0.11184E+02 -0.70293E+01 -0.93225E+01 | ||
103 | + 1. -0.62900E+01 0.10415E+02 -0.93190E+01 | ||
104 | + 1. -0.61622E+00 -0.27437E+01 -0.93087E+01 | ||
105 | + 1. 0.16535E+01 0.13153E+02 -0.93066E+01 | ||
106 | + 1. 0.72539E+00 0.22450E+01 -0.92948E+01 | ||
107 | + 1. 0.14297E+01 0.67372E+01 -0.92933E+01 | ||
108 | + 1. 0.10418E+02 -0.11470E+02 -0.92841E+01 | ||
109 | + 1. 0.28941E+01 -0.27008E+01 -0.92780E+01 | ||
110 | + 1. -0.73668E+01 -0.87661E+01 -0.92721E+01 | ||
111 | + 1. 0.13623E+02 0.12116E+01 -0.92655E+01 | ||
112 | + 1. 0.66149E+01 0.12475E+02 -0.92598E+01 | ||
113 | + 1. -0.12678E+02 0.15442E+02 -0.92524E+01 | ||
114 | + 1. -0.28672E+01 0.33557E+01 -0.92443E+01 | ||
115 | + 1. -0.12854E+02 -0.14593E+02 -0.92353E+01 | ||
116 | + 1. -0.49908E+01 -0.17075E+02 -0.92329E+01 | ||
117 | + 1. -0.14031E+02 -0.33746E+01 -0.92211E+01 | ||
118 | + 1. 0.15814E+01 0.10803E+02 -0.92195E+01 | ||
119 | + 1. 0.98881E+01 -0.44901E+01 -0.92113E+01 | ||
120 | + 1. 0.86778E+01 0.10863E+02 -0.92020E+01 | ||
121 | + 1. 0.58363E+01 0.40170E+01 -0.91975E+01 | ||
122 | + 1. -0.41879E+01 -0.73750E+01 -0.91898E+01 | ||
123 | + 1. 0.14852E+02 0.50703E+01 -0.91853E+01 | ||
124 | + 1. -0.40961E+01 0.19042E+02 -0.91773E+01 | ||
125 | + 1. -0.51800E+00 -0.96622E+01 -0.91686E+01 | ||
126 | + 1. 0.14617E+02 -0.10887E+02 -0.91613E+01 | ||
127 | + 1. 0.11199E+01 -0.63856E+01 -0.91547E+01 | ||
128 | + 1. -0.98372E+01 0.21105E+01 -0.91522E+01 | ||
129 | + 1. -0.10287E+02 -0.51245E+00 -0.91401E+01 | ||
130 | + 1. 0.67853E+01 -0.45976E+01 -0.91395E+01 | ||
131 | + 1. 0.37715E+01 0.15622E+02 -0.91325E+01 | ||
132 | + 1. 0.76988E+01 0.88123E+01 -0.91226E+01 | ||
133 | + 1. -0.41771E+01 0.14191E+02 -0.91157E+01 | ||
134 | + 1. 0.98434E+01 -0.88095E+01 -0.91124E+01 | ||
135 | + 1. -0.13552E+02 0.38767E+01 -0.91048E+01 | ||
136 | + 1. -0.10001E+02 -0.15063E+02 -0.90977E+01 | ||
137 | + 1. 0.24919E+01 -0.15923E+02 -0.90909E+01 | ||
138 | + 1. -0.96944E+01 -0.77051E+01 -0.90826E+01 | ||
139 | + 1. -0.75942E+01 0.17006E+02 -0.90744E+01 | ||
140 | + 1. -0.86421E+01 -0.46246E+01 -0.90670E+01 | ||
141 | + 1. -0.20268E+01 0.14451E+02 -0.90622E+01 | ||
142 | + 1. 0.25649E+01 0.18175E+02 -0.90562E+01 | ||
143 | + 1. -0.10462E+02 0.54579E+01 -0.90499E+01 | ||
144 | + 1. -0.15684E+02 -0.11313E+02 -0.90453E+01 | ||
145 | + 1. 0.13924E+02 -0.14125E+02 -0.90334E+01 | ||
146 | + 1. 0.10806E+02 -0.25169E+00 -0.90293E+01 | ||
147 | + 1. 0.86059E+01 -0.17910E+02 -0.90222E+01 | ||
148 | + 1. 0.12093E+02 0.58994E+01 -0.90139E+01 | ||
149 | + 1. -0.35407E+01 -0.58539E+00 -0.90115E+01 | ||
150 | + 1. 0.60208E+01 0.99562E+01 -0.90001E+01 | ||
151 | + 1. 0.30316E+01 0.88095E+01 -0.89944E+01 | ||
152 | + 1. -0.17377E+02 0.47615E+01 -0.89920E+01 | ||
153 | + 1. 0.43469E+01 -0.76060E+01 -0.89841E+01 | ||
154 | + 1. -0.10709E+02 -0.52675E+01 -0.89795E+01 | ||
155 | + 1. -0.11972E+02 0.11564E+02 -0.89686E+01 | ||
156 | + 1. -0.81731E+00 -0.54869E+01 -0.89629E+01 | ||
157 | + 1. -0.14050E+02 0.65784E+01 -0.89535E+01 | ||
158 | + 1. 0.19905E+02 -0.96167E+00 -0.89508E+01 | ||
159 | + 1. -0.12822E+02 -0.11130E+02 -0.89458E+01 | ||
160 | + 1. 0.12430E+00 0.17839E+02 -0.89367E+01 | ||
161 | + 1. 0.24154E+01 -0.10731E+02 -0.89331E+01 | ||
162 | + 1. -0.44862E+01 -0.40489E+01 -0.89234E+01 | ||
163 | + 1. -0.17380E+02 -0.16030E+01 -0.89143E+01 | ||
164 | + 1. -0.15379E+02 -0.55455E+01 -0.89133E+01 | ||
165 | + 1. -0.44002E+01 0.15541E+01 -0.89002E+01 | ||
166 | + 1. -0.40603E+01 0.11832E+02 -0.88936E+01 | ||
167 | + 1. -0.21719E+01 0.10892E+02 -0.88921E+01 | ||
168 | + 1. 0.19628E+02 -0.33844E+01 -0.88821E+01 | ||
169 | + 1. -0.19330E+02 -0.46178E+01 -0.88742E+01 | ||
170 | + 1. 0.16926E+02 -0.54990E+01 -0.88728E+01 | ||
171 | + 1. -0.10048E+01 -0.16082E+02 -0.88604E+01 | ||
172 | + 1. 0.81468E+01 0.48332E+01 -0.88569E+01 | ||
173 | + 1. -0.16978E+02 0.96853E+01 -0.88506E+01 | ||
174 | + 1. -0.13778E+02 0.91493E+01 -0.88465E+01 | ||
175 | + 1. 0.17832E+02 -0.88284E+01 -0.88388E+01 | ||
176 | + 1. -0.24500E+01 -0.10694E+02 -0.88302E+01 | ||
177 | + 1. 0.14492E+02 -0.27149E+01 -0.88246E+01 | ||
178 | + 1. -0.75461E+01 0.12232E+02 -0.88145E+01 | ||
179 | + 1. -0.71187E+01 -0.12235E+02 -0.88100E+01 | ||
180 | + 1. 0.74122E+01 -0.14045E+02 -0.88035E+01 | ||
181 | + 1. -0.63399E+01 -0.15118E+02 -0.87934E+01 | ||
182 | + 1. 0.24190E+01 -0.18373E+02 -0.87884E+01 | ||
183 | + 1. -0.11234E+02 0.35494E+01 -0.87845E+01 | ||
184 | + 1. -0.81761E+01 0.67723E+01 -0.87750E+01 | ||
185 | + 1. 0.91350E+01 0.74105E+01 -0.87696E+01 | ||
186 | + 1. 0.38679E+01 0.28890E+01 -0.87607E+01 | ||
187 | + 1. -0.94179E+01 0.92015E+01 -0.87588E+01 | ||
188 | + 1. 0.68910E+01 0.17163E+02 -0.87521E+01 | ||
189 | + 1. 0.32649E+01 -0.13943E+02 -0.87441E+01 | ||
190 | + 1. 0.11483E+02 -0.13379E+02 -0.87378E+01 | ||
191 | + 1. 0.20543E+01 -0.90770E+00 -0.87302E+01 | ||
192 | + 1. 0.13476E+02 0.14071E+02 -0.87201E+01 | ||
193 | + 1. -0.19466E+01 0.17580E+02 -0.87185E+01 | ||
194 | + 1. 0.10189E+02 -0.15122E+02 -0.87080E+01 | ||
195 | + 1. 0.87027E+01 0.14008E+02 -0.87056E+01 | ||
196 | + 1. -0.17640E+02 0.26597E+01 -0.86973E+01 | ||
197 | + 1. 0.11674E+02 -0.36610E+01 -0.86890E+01 | ||
198 | + 1. 0.13900E+02 0.10811E+02 -0.86828E+01 | ||
199 | + 1. 0.18278E+02 0.88575E+00 -0.86761E+01 | ||
200 | + 1. -0.43653E+01 0.46751E+01 -0.86674E+01 | ||
201 | + 1. 0.76140E+01 -0.25575E+01 -0.86665E+01 | ||
202 | + 1. -0.14197E+02 0.11117E+02 -0.86585E+01 | ||
203 | + 1. 0.34402E-01 0.89502E+01 -0.86482E+01 | ||
204 | + 1. 0.11197E+02 0.14086E+02 -0.86412E+01 | ||
205 | + 1. -0.21110E+01 -0.14193E+02 -0.86352E+01 | ||
206 | + 1. 0.10357E+02 0.92557E+01 -0.86326E+01 | ||
207 | + 1. 0.47724E+01 -0.17669E+02 -0.86237E+01 | ||
208 | + 1. 0.13358E+01 0.47061E+01 -0.86172E+01 | ||
209 | + 1. -0.50046E+01 -0.10772E+02 -0.86078E+01 | ||
210 | + 1. -0.41061E+01 -0.19181E+02 -0.86046E+01 | ||
211 | + 1. -0.89085E+01 -0.13224E+02 -0.85938E+01 | ||
212 | + 1. 0.79173E+01 -0.11550E+02 -0.85898E+01 | ||
213 | + 1. 0.18881E+02 -0.62745E+01 -0.85804E+01 | ||
214 | + 1. 0.14976E+02 0.30291E+01 -0.85790E+01 | ||
215 | + 1. 0.14031E+01 0.15042E+02 -0.85668E+01 | ||
216 | + 1. -0.17295E+01 -0.19929E+02 -0.85630E+01 | ||
217 | + 1. 0.18424E+02 0.28866E+01 -0.85596E+01 | ||
218 | + 1. -0.10665E+02 -0.11917E+02 -0.85495E+01 | ||
219 | + 1. 0.73102E+01 -0.83652E+01 -0.85461E+01 | ||
220 | + 1. 0.99508E+01 0.17196E+02 -0.85381E+01 | ||
221 | + 1. 0.60374E+01 0.15201E+02 -0.85326E+01 | ||
222 | + 1. 0.72906E+01 0.10016E+01 -0.85266E+01 | ||
223 | + 1. -0.10037E+02 -0.16977E+02 -0.85141E+01 | ||
224 | + 1. -0.52988E+01 0.74435E+01 -0.85092E+01 | ||
225 | + 1. -0.95700E+01 0.13332E+02 -0.85039E+01 | ||
226 | + 1. 0.17484E+00 -0.11879E+02 -0.84936E+01 | ||
227 | + 1. 0.71191E+00 -0.17101E+02 -0.84913E+01 | ||
228 | + 1. -0.21364E+01 -0.75803E+01 -0.84818E+01 | ||
229 | + 1. 0.12778E+02 -0.88022E+01 -0.84755E+01 | ||
230 | + 1. 0.48148E+01 -0.11941E+02 -0.84729E+01 | ||
231 | + 1. -0.67166E+01 -0.45744E+01 -0.84640E+01 | ||
232 | + 1. -0.17708E+01 0.17423E+01 -0.84574E+01 | ||
233 | + 1. -0.10138E+02 0.17147E+02 -0.84521E+01 | ||
234 | + 1. -0.11992E+01 0.19598E+02 -0.84406E+01 | ||
235 | + 1. -0.15498E+02 -0.50427E+00 -0.84336E+01 | ||
236 | + 1. -0.19765E+02 0.21570E+01 -0.84317E+01 | ||
237 | + 1. 0.32091E+00 -0.14286E+02 -0.84239E+01 | ||
238 | + 1. 0.13132E+01 -0.91410E+01 -0.84167E+01 | ||
239 | + 1. 0.18336E+02 0.57850E+01 -0.84122E+01 | ||
240 | + 1. 0.17863E+02 -0.11144E+01 -0.84048E+01 | ||
241 | + 1. -0.73414E+01 0.45137E+01 -0.83966E+01 | ||
242 | + 1. -0.83738E+01 0.34437E+00 -0.83894E+01 | ||
243 | + 1. -0.17991E+02 0.75537E+01 -0.83850E+01 | ||
244 | + 1. -0.60142E+01 0.18592E+02 -0.83777E+01 | ||
245 | + 1. -0.12787E+02 0.21140E+01 -0.83712E+01 | ||
246 | + 1. 0.71931E+01 0.66350E+01 -0.83607E+01 | ||
247 | + 1. -0.18038E+02 -0.63271E+01 -0.83600E+01 | ||
248 | + 1. 0.47326E+01 -0.19394E+01 -0.83493E+01 | ||
249 | + 1. -0.12906E+02 0.13541E+02 -0.83435E+01 | ||
250 | + 1. -0.17975E+02 0.50683E+00 -0.83362E+01 | ||
251 | + 1. -0.15205E+01 -0.95566E+00 -0.83282E+01 | ||
252 | + 1. 0.47613E+01 0.13671E+02 -0.83211E+01 | ||
253 | + 1. 0.10373E+01 -0.34373E+01 -0.83177E+01 | ||
254 | + 1. -0.25973E+01 -0.26473E+01 -0.83108E+01 | ||
255 | + 1. 0.15028E+02 -0.61197E+01 -0.83042E+01 | ||
256 | + 1. -0.81094E+01 0.15021E+02 -0.82971E+01 | ||
257 | + 1. -0.31900E+01 -0.55276E+01 -0.82917E+01 | ||
258 | + 1. 0.15112E+02 0.89344E+01 -0.82820E+01 | ||
259 | + 1. -0.12272E+01 0.41319E+01 -0.82782E+01 | ||
260 | + 1. -0.54286E+01 -0.13304E+02 -0.82709E+01 | ||
261 | + 1. -0.95435E+01 -0.95597E+01 -0.82656E+01 | ||
262 | + 1. 0.10279E+02 0.42993E+01 -0.82551E+01 | ||
263 | + 1. -0.27258E+00 0.11021E+02 -0.82481E+01 | ||
264 | + 1. -0.19925E+01 0.69056E+01 -0.82402E+01 | ||
265 | + 1. 0.16305E+02 0.62390E+01 -0.82390E+01 | ||
266 | + 1. 0.57555E+01 -0.98817E+01 -0.82330E+01 | ||
267 | + 1. -0.11748E+02 0.88725E+01 -0.82232E+01 | ||
268 | + 1. 0.10715E+02 0.11590E+02 -0.82188E+01 | ||
269 | + 1. -0.12884E+02 -0.68941E+00 -0.82093E+01 | ||
270 | + 1. 0.16143E+02 -0.78386E+01 -0.82054E+01 | ||
271 | + 1. 0.35767E+01 0.11985E+02 -0.81995E+01 | ||
272 | + 1. 0.11890E+02 0.78088E+01 -0.81870E+01 | ||
273 | + 1. -0.13700E+02 -0.87684E+01 -0.81834E+01 | ||
274 | + 1. -0.15391E+02 0.33080E+01 -0.81776E+01 | ||
275 | + 1. 0.15731E+01 0.19760E+02 -0.81675E+01 | ||
276 | + 1. -0.56295E+01 0.13097E+02 -0.81641E+01 | ||
277 | + 1. 0.11850E+02 0.12920E+01 -0.81592E+01 | ||
278 | + 1. 0.45174E+01 0.18015E+02 -0.81477E+01 | ||
279 | + 1. -0.16027E+02 0.67457E+01 -0.81435E+01 | ||
280 | + 1. 0.15659E+02 0.12324E+02 -0.81395E+01 | ||
281 | + 1. -0.65313E+01 0.15638E+01 -0.81316E+01 | ||
282 | + 1. -0.10210E+02 -0.34459E+01 -0.81234E+01 | ||
283 | + 1. -0.19825E+02 -0.45991E+00 -0.81136E+01 | ||
284 | + 1. -0.44308E+01 0.16088E+02 -0.81129E+01 | ||
285 | + 1. -0.32345E+01 -0.15956E+02 -0.81051E+01 | ||
286 | + 1. -0.15917E+02 -0.35863E+01 -0.80970E+01 | ||
287 | + 1. -0.65927E+01 -0.70832E+00 -0.80916E+01 | ||
288 | + 1. -0.14298E+02 -0.12614E+02 -0.80852E+01 | ||
289 | + 1. -0.12309E+02 -0.34906E+01 -0.80769E+01 | ||
290 | + 1. -0.10082E+02 0.72194E+01 -0.80688E+01 | ||
291 | + 1. 0.54895E+01 -0.60893E+01 -0.80613E+01 | ||
292 | + 1. -0.11658E+02 -0.84580E+01 -0.80541E+01 | ||
293 | + 1. 0.17670E+02 0.91994E+01 -0.80503E+01 | ||
294 | + 1. 0.29389E+01 0.60787E+01 -0.80457E+01 | ||
295 | + 1. 0.91241E+01 0.26722E+01 -0.80341E+01 | ||
296 | + 1. -0.21673E+01 0.12741E+02 -0.80301E+01 | ||
297 | + 1. 0.13740E+02 -0.45909E+01 -0.80218E+01 | ||
298 | + 1. -0.12509E+02 0.52973E+01 -0.80165E+01 | ||
299 | + 1. 0.30955E+01 -0.60832E+01 -0.80081E+01 | ||
300 | + 1. 0.82690E+01 0.15886E+02 -0.80002E+01 | ||
301 | + 1. 0.59213E+00 0.68252E+00 -0.80000E+01 | ||
302 | + 1. -0.18988E+02 -0.27237E+01 -0.79930E+01 | ||
303 | + 1. -0.75414E+01 0.94685E+01 -0.79849E+01 | ||
304 | + 1. -0.75211E+01 -0.71355E+01 -0.79793E+01 | ||
305 | + 1. 0.14225E+02 -0.48232E+00 -0.79673E+01 | ||
306 | + 1. -0.28471E+01 0.90489E+01 -0.79664E+01 | ||
307 | + 1. -0.54978E+01 -0.85248E+01 -0.79537E+01 | ||
308 | + 1. -0.17188E+02 -0.10231E+02 -0.79495E+01 | ||
309 | + 1. 0.16396E+02 -0.10243E+02 -0.79465E+01 | ||
310 | + 1. -0.19758E+00 -0.78737E+01 -0.79378E+01 | ||
311 | + 1. -0.11727E+02 -0.13503E+02 -0.79333E+01 | ||
312 | + 1. 0.56761E+01 0.24035E+01 -0.79219E+01 | ||
313 | + 1. 0.64636E+00 -0.19921E+02 -0.79179E+01 | ||
314 | + 1. -0.10563E+02 0.15156E+02 -0.79072E+01 | ||
315 | + 1. 0.51727E+01 -0.14981E+02 -0.79000E+01 | ||
316 | + 1. -0.19160E+02 0.49698E+01 -0.78960E+01 | ||
317 | + 1. 0.95624E+01 -0.71136E+01 -0.78885E+01 | ||
318 | + 1. 0.11649E+02 -0.55853E+01 -0.78820E+01 | ||
319 | + 1. -0.11812E+02 -0.16071E+02 -0.78740E+01 | ||
320 | + 1. 0.85457E+01 -0.16173E+02 -0.78721E+01 | ||
321 | + 1. 0.69381E+01 -0.17864E+02 -0.78628E+01 | ||
322 | + 1. -0.89174E+01 -0.15112E+01 -0.78543E+01 | ||
323 | + 1. 0.11940E+02 -0.15726E+02 -0.78531E+01 | ||
324 | + 1. 0.12399E+02 0.40743E+01 -0.78420E+01 | ||
325 | + 1. 0.30231E+00 0.13369E+02 -0.78344E+01 | ||
326 | + 1. 0.35252E+01 -0.92540E+01 -0.78302E+01 | ||
327 | + 1. -0.13121E+02 -0.58179E+01 -0.78235E+01 | ||
328 | + 1. 0.12933E+02 -0.12024E+02 -0.78168E+01 | ||
329 | + 1. 0.83967E+01 -0.50084E+01 -0.78080E+01 | ||
330 | + 1. 0.51216E+01 0.56930E+01 -0.78004E+01 | ||
331 | + 1. -0.32167E+00 0.16254E+02 -0.77956E+01 | ||
332 | + 1. -0.57685E+01 -0.18292E+02 -0.77920E+01 | ||
333 | + 1. -0.16066E+02 0.11440E+02 -0.77829E+01 | ||
334 | + 1. 0.10109E+02 -0.26874E+01 -0.77743E+01 | ||
335 | + 1. 0.86523E+01 -0.71006E+00 -0.77687E+01 | ||
336 | + 1. -0.79867E+01 -0.17475E+02 -0.77603E+01 | ||
337 | + 1. -0.16472E+02 -0.79900E+01 -0.77593E+01 | ||
338 | + 1. 0.17435E+02 -0.30463E+01 -0.77484E+01 | ||
339 | + 1. -0.11400E+02 0.68375E+00 -0.77414E+01 | ||
340 | + 1. -0.26559E+01 -0.12377E+02 -0.77374E+01 | ||
341 | + 1. -0.88018E+01 0.11060E+02 -0.77304E+01 | ||
342 | + 1. 0.48016E+01 0.85515E+01 -0.77261E+01 | ||
343 | + 1. 0.16781E+02 0.18208E+01 -0.77185E+01 | ||
344 | + 1. 0.28977E+01 0.11469E+01 -0.77116E+01 | ||
345 | + 1. 0.96957E+01 -0.12720E+02 -0.77030E+01 | ||
346 | + 1. 0.30617E+01 -0.40592E+01 -0.76942E+01 | ||
347 | + 1. 0.11438E+02 0.15844E+02 -0.76933E+01 | ||
348 | + 1. -0.77825E+00 -0.18263E+02 -0.76842E+01 | ||
349 | + 1. -0.87829E+01 0.31137E+01 -0.76796E+01 | ||
350 | + 1. 0.96070E+01 -0.10399E+02 -0.76730E+01 | ||
351 | + 1. -0.54990E+01 0.94154E+01 -0.76617E+01 | ||
352 | + 1. 0.72023E+01 0.11203E+02 -0.76545E+01 | ||
353 | + 1. 0.15662E+02 -0.40166E+01 -0.76507E+01 | ||
354 | + 1. 0.39304E+01 -0.19317E+02 -0.76417E+01 | ||
355 | + 1. 0.13908E+02 0.63981E+01 -0.76359E+01 | ||
356 | + 1. -0.51401E+01 -0.60315E+01 -0.76310E+01 | ||
357 | + 1. -0.35040E+01 -0.93864E+01 -0.76214E+01 | ||
358 | + 1. 0.47579E+01 0.31293E+00 -0.76192E+01 | ||
359 | + 1. -0.57072E+01 -0.29198E+01 -0.76095E+01 | ||
360 | + 1. 0.77312E-01 0.67751E+01 -0.76038E+01 | ||
361 | + 1. 0.56242E+01 -0.36166E+01 -0.75952E+01 | ||
362 | + 1. 0.24741E+01 0.16734E+02 -0.75922E+01 | ||
363 | + 1. 0.17754E+01 -0.12663E+02 -0.75861E+01 | ||
364 | + 1. 0.12730E+02 0.12139E+02 -0.75765E+01 | ||
365 | + 1. -0.70928E+01 -0.10197E+02 -0.75695E+01 | ||
366 | + 1. -0.14810E+02 0.52121E+01 -0.75661E+01 | ||
367 | + 1. -0.14854E+02 0.14601E+01 -0.75559E+01 | ||
368 | + 1. -0.79079E+01 -0.15236E+02 -0.75476E+01 | ||
369 | + 1. -0.90033E+01 -0.11345E+02 -0.75422E+01 | ||
370 | + 1. 0.14494E+01 0.29337E+01 -0.75373E+01 | ||
371 | + 1. -0.61453E+01 0.14932E+02 -0.75302E+01 | ||
372 | + 1. -0.85088E+01 0.17947E+02 -0.75265E+01 | ||
373 | + 1. -0.40522E+01 0.29621E+01 -0.75196E+01 | ||
374 | + 1. -0.29905E+01 -0.17903E+02 -0.75073E+01 | ||
375 | + 1. -0.59610E+01 0.57769E+01 -0.75033E+01 | ||
376 | + 1. -0.10748E+02 -0.66328E+01 -0.74986E+01 | ||
377 | + 1. -0.30780E+01 0.19424E+02 -0.74885E+01 | ||
378 | + 1. -0.82561E+00 -0.37629E+01 -0.74842E+01 | ||
379 | + 1. 0.15902E+02 -0.15405E+01 -0.74762E+01 | ||
380 | + 1. 0.49219E+01 0.10662E+02 -0.74696E+01 | ||
381 | + 1. 0.29467E+01 0.14108E+02 -0.74624E+01 | ||
382 | + 1. 0.66231E+01 -0.12606E+01 -0.74562E+01 | ||
383 | + 1. 0.34481E+01 0.19649E+02 -0.74529E+01 | ||
384 | + 1. 0.13355E+02 -0.70547E+01 -0.74448E+01 | ||
385 | + 1. 0.15291E+02 -0.12379E+02 -0.74369E+01 | ||
386 | + 1. 0.11597E+02 -0.10140E+02 -0.74285E+01 | ||
387 | + 1. 0.13855E+02 -0.10250E+02 -0.74207E+01 | ||
388 | + 1. 0.19794E+02 0.16951E+01 -0.74196E+01 | ||
389 | + 1. 0.11957E+02 0.98078E+01 -0.74084E+01 | ||
390 | + 1. 0.16561E+02 0.39446E+01 -0.74042E+01 | ||
391 | + 1. -0.17607E+02 -0.45296E+01 -0.73955E+01 | ||
392 | + 1. -0.14083E+02 -0.21434E+01 -0.73874E+01 | ||
393 | + 1. 0.13119E+02 -0.21317E+01 -0.73867E+01 | ||
394 | + 1. 0.16622E+01 0.80371E+01 -0.73758E+01 | ||
395 | + 1. 0.89610E+01 0.12270E+02 -0.73686E+01 | ||
396 | + 1. -0.46671E+01 -0.10028E+01 -0.73636E+01 | ||
397 | + 1. -0.28338E+01 0.52586E+01 -0.73576E+01 | ||
398 | + 1. -0.10632E+02 0.11807E+02 -0.73527E+01 | ||
399 | + 1. 0.36796E+01 -0.16442E+02 -0.73459E+01 | ||
400 | + 1. 0.87508E+01 0.95956E+01 -0.73362E+01 | ||
401 | + 1. -0.11241E+02 -0.17827E+01 -0.73272E+01 | ||
402 | + 1. -0.23384E+01 0.15469E+02 -0.73253E+01 | ||
403 | + 1. 0.10443E+01 -0.52727E+01 -0.73138E+01 | ||
404 | + 1. 0.13876E+02 0.17674E+01 -0.73091E+01 | ||
405 | + 1. 0.20744E+01 0.10405E+02 -0.73018E+01 | ||
406 | + 1. 0.19372E+02 0.42051E+01 -0.72979E+01 | ||
407 | + 1. 0.18991E+02 -0.47495E+01 -0.72893E+01 | ||
408 | + 1. -0.11448E+01 -0.10682E+02 -0.72832E+01 | ||
409 | + 1. 0.63650E+01 0.18639E+02 -0.72799E+01 | ||
410 | + 1. -0.14079E+02 -0.10547E+02 -0.72718E+01 | ||
411 | + 1. 0.59831E+01 -0.13149E+02 -0.72635E+01 | ||
412 | + 1. 0.11475E+02 -0.78694E+01 -0.72589E+01 | ||
413 | + 1. -0.12954E+02 0.74808E+01 -0.72526E+01 | ||
414 | + 1. -0.55913E+01 -0.16337E+02 -0.72426E+01 | ||
415 | + 1. -0.62964E+01 0.11365E+02 -0.72386E+01 | ||
416 | + 1. 0.86038E+01 0.17923E+02 -0.72317E+01 | ||
417 | + 1. 0.22462E+01 -0.14816E+02 -0.72205E+01 | ||
418 | + 1. -0.15475E+02 0.84730E+01 -0.72183E+01 | ||
419 | + 1. 0.73120E+01 0.13640E+02 -0.72105E+01 | ||
420 | + 1. -0.36663E+01 0.72712E+01 -0.72015E+01 | ||
421 | + 1. 0.94555E+01 0.60158E+01 -0.71978E+01 | ||
422 | + 1. 0.32368E-01 -0.16011E+01 -0.71870E+01 | ||
423 | + 1. -0.14881E+02 0.13005E+02 -0.71858E+01 | ||
424 | + 1. 0.18271E+02 -0.75849E+01 -0.71761E+01 | ||
425 | + 1. 0.98494E+01 0.14623E+02 -0.71733E+01 | ||
426 | + 1. -0.12928E+02 0.10266E+02 -0.71607E+01 | ||
427 | + 1. 0.35868E+01 0.41848E+01 -0.71539E+01 | ||
428 | + 1. -0.69858E+01 0.77292E+01 -0.71512E+01 | ||
429 | + 1. -0.17542E+02 0.39414E+01 -0.71460E+01 | ||
430 | + 1. 0.67259E+01 0.43597E+01 -0.71349E+01 | ||
431 | + 1. 0.16402E+02 0.10708E+02 -0.71331E+01 | ||
432 | + 1. 0.31087E+01 -0.20278E+01 -0.71248E+01 | ||
433 | + 1. -0.88037E+01 0.51148E+01 -0.71173E+01 | ||
434 | + 1. -0.28238E+01 -0.18749E-01 -0.71106E+01 | ||
435 | + 1. -0.85834E+01 -0.50941E+01 -0.71026E+01 | ||
436 | + 1. 0.55200E+01 -0.78985E+01 -0.70967E+01 | ||
437 | + 1. 0.77170E+01 -0.98178E+01 -0.70883E+01 | ||
438 | + 1. 0.55726E+01 0.16679E+02 -0.70830E+01 | ||
439 | + 1. -0.97784E+01 -0.14637E+02 -0.70747E+01 | ||
440 | + 1. 0.10921E+02 -0.78991E+00 -0.70732E+01 | ||
441 | + 1. 0.13023E+02 -0.13972E+02 -0.70646E+01 | ||
442 | + 1. -0.37138E+01 0.14029E+02 -0.70564E+01 | ||
443 | + 1. -0.14344E+02 -0.43347E+01 -0.70480E+01 | ||
444 | + 1. -0.95568E+00 -0.14965E+02 -0.70413E+01 | ||
445 | + 1. -0.32639E+01 0.11066E+02 -0.70375E+01 | ||
446 | + 1. -0.11263E+02 -0.10662E+02 -0.70312E+01 | ||
447 | + 1. 0.74363E+00 0.18045E+02 -0.70208E+01 | ||
448 | + 1. 0.14505E+01 -0.10714E+02 -0.70171E+01 | ||
449 | + 1. -0.11320E+02 0.26188E+01 -0.70124E+01 | ||
450 | + 1. -0.13530E+02 0.34172E+01 -0.70052E+01 | ||
451 | + 1. 0.14446E+02 0.13498E+02 -0.69943E+01 | ||
452 | + 1. 0.19845E+02 -0.17525E+01 -0.69902E+01 | ||
453 | + 1. -0.16042E+02 -0.18093E+01 -0.69850E+01 | ||
454 | + 1. -0.48345E+01 0.10748E+01 -0.69784E+01 | ||
455 | + 1. -0.15743E+02 -0.11670E+02 -0.69684E+01 | ||
456 | + 1. -0.58789E+01 0.35805E+01 -0.69604E+01 | ||
457 | + 1. -0.58919E+01 0.17041E+02 -0.69591E+01 | ||
458 | + 1. -0.17467E+02 0.91785E+01 -0.69516E+01 | ||
459 | + 1. 0.12392E+02 0.14234E+02 -0.69467E+01 | ||
460 | + 1. -0.40167E+01 -0.14005E+02 -0.69367E+01 | ||
461 | + 1. 0.67448E+01 0.91378E+01 -0.69321E+01 | ||
462 | + 1. -0.80091E+01 0.13259E+02 -0.69243E+01 | ||
463 | + 1. 0.14348E+02 0.39702E+01 -0.69158E+01 | ||
464 | + 1. -0.33020E+01 -0.39947E+01 -0.69085E+01 | ||
465 | + 1. 0.96580E+01 0.83376E+00 -0.69040E+01 | ||
466 | + 1. 0.19121E+01 -0.17794E+02 -0.68944E+01 | ||
467 | + 1. -0.77314E+01 -0.13342E+02 -0.68879E+01 | ||
468 | + 1. -0.12359E+01 -0.56307E+01 -0.68859E+01 | ||
469 | + 1. 0.35610E+01 -0.11122E+02 -0.68736E+01 | ||
470 | + 1. -0.10838E+02 0.48866E+01 -0.68679E+01 | ||
471 | + 1. -0.15426E+02 -0.65133E+01 -0.68661E+01 | ||
472 | + 1. 0.17411E+02 0.73878E+01 -0.68575E+01 | ||
473 | + 1. 0.40132E+01 -0.13629E+02 -0.68514E+01 | ||
474 | + 1. -0.13715E+02 -0.14393E+02 -0.68458E+01 | ||
475 | + 1. -0.17351E+01 -0.87784E+01 -0.68347E+01 | ||
476 | + 1. -0.94285E+01 -0.81157E+01 -0.68275E+01 | ||
477 | + 1. -0.12722E+02 0.15055E+02 -0.68217E+01 | ||
478 | + 1. -0.76009E+01 -0.31767E+01 -0.68197E+01 | ||
479 | + 1. -0.58066E+01 -0.11533E+02 -0.68092E+01 | ||
480 | + 1. 0.17090E+01 -0.73952E+01 -0.68003E+01 | ||
481 | + 1. 0.16852E+02 -0.53917E+01 -0.67974E+01 | ||
482 | + 1. 0.10404E+02 0.80109E+01 -0.67878E+01 | ||
483 | + 1. -0.32767E+01 0.17226E+02 -0.67826E+01 | ||
484 | + 1. 0.75688E+01 -0.14707E+02 -0.67784E+01 | ||
485 | + 1. -0.17374E+02 0.18735E+01 -0.67681E+01 | ||
486 | + 1. 0.18144E+01 0.12471E+02 -0.67628E+01 | ||
487 | + 1. -0.10178E+02 0.96669E+01 -0.67599E+01 | ||
488 | + 1. -0.30469E+01 -0.68186E+01 -0.67479E+01 | ||
489 | + 1. 0.15562E+02 0.55766E+00 -0.67413E+01 | ||
490 | + 1. 0.96032E+01 -0.14521E+02 -0.67366E+01 | ||
491 | + 1. 0.11403E+02 0.56438E+01 -0.67287E+01 | ||
492 | + 1. -0.52090E+00 -0.12910E+02 -0.67201E+01 | ||
493 | + 1. 0.10141E+02 -0.43883E+01 -0.67134E+01 | ||
494 | + 1. 0.11503E+02 0.26692E+01 -0.67097E+01 | ||
495 | + 1. -0.19161E+02 -0.57064E+01 -0.67032E+01 | ||
496 | + 1. 0.18535E+02 0.98620E-01 -0.66987E+01 | ||
497 | + 1. -0.11552E+02 -0.48205E+01 -0.66870E+01 | ||
498 | + 1. 0.18965E-01 0.19936E+02 -0.66860E+01 | ||
499 | + 1. -0.49916E+01 0.18955E+02 -0.66750E+01 | ||
500 | + 1. -0.94228E+01 0.56521E+00 -0.66677E+01 | ||
501 | + 1. 0.77771E+01 0.16205E+01 -0.66603E+01 | ||
502 | + 1. -0.18521E+02 -0.92628E+00 -0.66568E+01 | ||
503 | + 1. 0.60708E+00 0.49262E+01 -0.66483E+01 | ||
504 | + 1. 0.14150E+02 0.10182E+02 -0.66461E+01 | ||
505 | + 1. -0.12400E+02 0.12503E+02 -0.66393E+01 | ||
506 | + 1. -0.69158E+00 0.88270E+01 -0.66314E+01 | ||
507 | + 1. 0.13361E+02 0.80722E+01 -0.66223E+01 | ||
508 | + 1. 0.10280E+02 -0.16804E+02 -0.66181E+01 | ||
509 | + 1. 0.72809E+00 0.14976E+02 -0.66070E+01 | ||
510 | + 1. -0.12576E+02 -0.12198E+02 -0.66010E+01 | ||
511 | + 1. -0.78414E+00 0.20687E+01 -0.65953E+01 | ||
512 | + 1. 0.71900E+01 -0.61352E+01 -0.65927E+01 | ||
513 | + 1. 0.21949E+01 -0.19761E+02 -0.65851E+01 | ||
514 | + 1. -0.19645E+02 0.32465E+01 -0.65767E+01 | ||
515 | + 1. 0.56229E+01 -0.19085E+02 -0.65683E+01 | ||
516 | + 1. 0.14542E+02 -0.85328E+01 -0.65640E+01 | ||
517 | + 1. -0.17829E+01 -0.19898E+02 -0.65549E+01 | ||
518 | + 1. 0.49514E+01 0.14677E+02 -0.65473E+01 | ||
519 | + 1. 0.78970E+01 -0.26307E+01 -0.65465E+01 | ||
520 | + 1. 0.92947E+01 -0.86602E+01 -0.65348E+01 | ||
521 | + 1. -0.11449E+01 0.11854E+02 -0.65273E+01 | ||
522 | + 1. 0.57248E+01 -0.16573E+02 -0.65250E+01 | ||
523 | + 1. -0.15761E+02 -0.94820E+01 -0.65167E+01 | ||
524 | + 1. -0.18111E+02 -0.79791E+01 -0.65108E+01 | ||
525 | + 1. 0.55297E+01 -0.10891E+02 -0.65018E+01 | ||
526 | + 1. -0.85134E+01 0.15880E+02 -0.64944E+01 | ||
527 | + 1. -0.18612E+02 0.72510E+01 -0.64897E+01 | ||
528 | + 1. 0.12594E+02 -0.39881E+01 -0.64832E+01 | ||
529 | + 1. 0.90149E+01 0.40904E+01 -0.64745E+01 | ||
530 | + 1. 0.34381E+01 0.77871E+01 -0.64712E+01 | ||
531 | + 1. -0.99651E+01 -0.17135E+02 -0.64627E+01 | ||
532 | + 1. -0.43907E+01 -0.18891E+02 -0.64541E+01 | ||
533 | + 1. -0.10397E+02 0.16551E+02 -0.64530E+01 | ||
534 | + 1. -0.13067E+02 0.15388E+01 -0.64436E+01 | ||
535 | + 1. -0.12683E+02 -0.77203E+01 -0.64365E+01 | ||
536 | + 1. 0.15234E+01 -0.35986E+00 -0.64307E+01 | ||
537 | + 1. 0.15428E+02 0.79489E+01 -0.64261E+01 | ||
538 | + 1. 0.32329E+00 -0.16587E+02 -0.64187E+01 | ||
539 | + 1. -0.65478E+01 -0.51759E+01 -0.64107E+01 | ||
540 | + 1. -0.89387E+01 0.72420E+01 -0.64006E+01 | ||
541 | + 1. 0.36333E+01 -0.78128E+01 -0.63966E+01 | ||
542 | + 1. 0.10259E+02 0.17126E+02 -0.63903E+01 | ||
543 | + 1. -0.27884E+01 -0.19867E+01 -0.63835E+01 | ||
544 | + 1. 0.57827E+01 0.12219E+02 -0.63774E+01 | ||
545 | + 1. 0.17522E+02 -0.96229E+01 -0.63686E+01 | ||
546 | + 1. 0.80804E+01 -0.11974E+02 -0.63640E+01 | ||
547 | + 1. -0.30841E+01 -0.10887E+02 -0.63580E+01 | ||
548 | + 1. -0.73949E+01 -0.86136E+01 -0.63496E+01 | ||
549 | + 1. 0.60930E+01 0.67968E+01 -0.63407E+01 | ||
550 | + 1. 0.42327E+01 -0.53033E+01 -0.63377E+01 | ||
551 | + 1. -0.65649E+01 0.28585E+00 -0.63306E+01 | ||
552 | + 1. -0.86865E+00 0.35375E-02 -0.63201E+01 | ||
553 | + 1. -0.15063E+02 0.10500E+02 -0.63140E+01 | ||
554 | + 1. -0.16898E+01 0.38852E+01 -0.63093E+01 | ||
555 | + 1. 0.12520E+02 0.20843E+00 -0.63026E+01 | ||
556 | + 1. 0.49111E+01 -0.12405E+01 -0.62970E+01 | ||
557 | + 1. 0.16433E+02 0.56419E+01 -0.62877E+01 | ||
558 | + 1. 0.12452E+01 -0.35625E+01 -0.62825E+01 | ||
559 | + 1. -0.13422E+01 0.17638E+02 -0.62743E+01 | ||
560 | + 1. 0.11419E+02 -0.12934E+02 -0.62732E+01 | ||
561 | + 1. -0.97908E+01 -0.27088E+01 -0.62621E+01 | ||
562 | + 1. 0.14894E+02 -0.55901E+01 -0.62586E+01 | ||
563 | + 1. -0.13407E+01 0.13848E+02 -0.62486E+01 | ||
564 | + 1. 0.82385E+01 -0.17424E+02 -0.62420E+01 | ||
565 | + 1. -0.15377E+02 0.31793E-01 -0.62373E+01 | ||
566 | + 1. -0.13795E+01 0.63954E+01 -0.62331E+01 | ||
567 | + 1. -0.49546E+01 -0.74651E+01 -0.62201E+01 | ||
568 | + 1. 0.41088E+01 0.19142E+01 -0.62176E+01 | ||
569 | + 1. 0.10498E+02 0.10472E+02 -0.62116E+01 | ||
570 | + 1. -0.39773E+01 0.93196E+01 -0.62019E+01 | ||
571 | + 1. 0.85097E+01 0.75527E+01 -0.61986E+01 | ||
572 | + 1. -0.15422E+02 0.35609E+01 -0.61912E+01 | ||
573 | + 1. -0.11305E+02 0.79298E+01 -0.61828E+01 | ||
574 | + 1. -0.27892E+01 -0.15487E+02 -0.61764E+01 | ||
575 | + 1. -0.17172E+02 0.58495E+01 -0.61718E+01 | ||
576 | + 1. 0.74049E+01 0.15762E+02 -0.61655E+01 | ||
577 | + 1. -0.12735E+02 -0.30214E+01 -0.61583E+01 | ||
578 | + 1. 0.14726E+02 -0.27534E+01 -0.61496E+01 | ||
579 | + 1. 0.38786E+01 0.17460E+02 -0.61453E+01 | ||
580 | + 1. -0.19155E+02 -0.37236E+01 -0.61397E+01 | ||
581 | + 1. 0.15672E+02 -0.10812E+02 -0.61281E+01 | ||
582 | + 1. -0.54454E+01 0.13006E+02 -0.61216E+01 | ||
583 | + 1. 0.17946E+02 0.32140E+01 -0.61144E+01 | ||
584 | + 1. -0.67632E+01 0.95791E+01 -0.61070E+01 | ||
585 | + 1. -0.78040E+01 0.18937E+01 -0.61064E+01 | ||
586 | + 1. 0.17643E+02 -0.17725E+01 -0.60941E+01 | ||
587 | + 1. -0.46386E+01 0.15601E+02 -0.60889E+01 | ||
588 | + 1. 0.20587E+01 0.63730E+01 -0.60806E+01 | ||
589 | + 1. 0.19027E+02 0.61374E+01 -0.60758E+01 | ||
590 | + 1. 0.59621E+01 0.96394E+00 -0.60670E+01 | ||
591 | + 1. -0.15014E+02 0.67030E+01 -0.60637E+01 | ||
592 | + 1. -0.10257E+02 0.14062E+02 -0.60547E+01 | ||
593 | + 1. 0.25565E+00 -0.93911E+01 -0.60512E+01 | ||
594 | + 1. -0.10471E+02 -0.12725E+02 -0.60401E+01 | ||
595 | + 1. -0.19283E+02 0.13246E+01 -0.60398E+01 | ||
596 | + 1. -0.16124E+02 -0.40788E+01 -0.60322E+01 | ||
597 | + 1. -0.69963E+01 -0.18063E+02 -0.60202E+01 | ||
598 | + 1. 0.36744E+01 0.12687E+02 -0.60151E+01 | ||
599 | + 1. -0.11562E+02 -0.14901E+02 -0.60120E+01 | ||
600 | + 1. 0.22083E+00 -0.19060E+02 -0.60021E+01 | ||
601 | + 1. -0.58167E+01 -0.14585E+02 -0.59942E+01 | ||
602 | + 1. 0.56768E+00 0.10603E+02 -0.59919E+01 | ||
603 | + 1. 0.13739E+02 -0.12326E+02 -0.59823E+01 | ||
604 | + 1. -0.44784E+01 0.56451E+01 -0.59763E+01 | ||
605 | + 1. -0.12483E+02 0.56827E+01 -0.59715E+01 | ||
606 | + 1. -0.82096E+01 -0.11410E+01 -0.59651E+01 | ||
607 | + 1. -0.13013E+02 -0.92352E+00 -0.59595E+01 | ||
608 | + 1. 0.10437E+02 -0.11004E+02 -0.59492E+01 | ||
609 | + 1. 0.16426E+02 -0.77490E+01 -0.59448E+01 | ||
610 | + 1. 0.12622E+02 -0.59415E+01 -0.59364E+01 | ||
611 | + 1. 0.10300E+02 0.12898E+02 -0.59269E+01 | ||
612 | + 1. 0.11716E+01 0.16430E+01 -0.59229E+01 | ||
613 | + 1. 0.36793E+01 0.97609E+01 -0.59169E+01 | ||
614 | + 1. -0.40523E+00 -0.73008E+01 -0.59098E+01 | ||
615 | + 1. 0.15105E+02 0.11898E+02 -0.59042E+01 | ||
616 | + 1. 0.36338E+01 -0.18231E+02 -0.58949E+01 | ||
617 | + 1. 0.78608E+01 -0.48704E+00 -0.58931E+01 | ||
618 | + 1. -0.71894E+01 0.47856E+01 -0.58823E+01 | ||
619 | + 1. -0.79412E+01 -0.10947E+02 -0.58755E+01 | ||
620 | + 1. 0.21849E+01 0.19264E+02 -0.58673E+01 | ||
621 | + 1. -0.61866E+01 -0.18526E+01 -0.58660E+01 | ||
622 | + 1. 0.14265E+02 -0.70501E+00 -0.58561E+01 | ||
623 | + 1. -0.11138E+02 -0.88799E+01 -0.58520E+01 | ||
624 | + 1. 0.95298E+01 -0.65942E+01 -0.58442E+01 | ||
625 | + 1. -0.29697E+01 0.22334E+01 -0.58380E+01 | ||
626 | + 1. 0.82744E+01 0.10924E+02 -0.58327E+01 | ||
627 | + 1. 0.17422E+02 0.92300E+01 -0.58203E+01 | ||
628 | + 1. -0.90606E+01 0.11858E+02 -0.58198E+01 | ||
629 | + 1. 0.68436E+01 -0.42837E+01 -0.58085E+01 | ||
630 | + 1. -0.42639E+01 -0.54698E+01 -0.58036E+01 | ||
631 | + 1. -0.47590E+01 -0.94370E+01 -0.57951E+01 | ||
632 | + 1. -0.95918E+01 0.34564E+01 -0.57925E+01 | ||
633 | + 1. 0.58487E+01 0.29882E+01 -0.57828E+01 | ||
634 | + 1. 0.10643E+01 -0.13923E+02 -0.57749E+01 | ||
635 | + 1. -0.16241E+01 -0.17070E+02 -0.57719E+01 | ||
636 | + 1. 0.12131E+02 -0.15286E+02 -0.57646E+01 | ||
637 | + 1. 0.28174E+01 0.15169E+02 -0.57585E+01 | ||
638 | + 1. 0.41963E+01 -0.15344E+02 -0.57496E+01 | ||
639 | + 1. 0.12979E+02 -0.95761E+01 -0.57410E+01 | ||
640 | + 1. -0.86509E+01 -0.66022E+01 -0.57374E+01 | ||
641 | + 1. 0.44929E+01 0.53488E+01 -0.57289E+01 | ||
642 | + 1. -0.53671E+01 0.75920E+01 -0.57219E+01 | ||
643 | + 1. -0.11209E+02 0.46631E+00 -0.57176E+01 | ||
644 | + 1. -0.13547E+02 0.87958E+01 -0.57110E+01 | ||
645 | + 1. 0.70392E+01 -0.84097E+01 -0.57048E+01 | ||
646 | + 1. 0.18938E+02 -0.33802E+01 -0.56941E+01 | ||
647 | + 1. 0.39737E+01 -0.34184E+01 -0.56890E+01 | ||
648 | + 1. -0.73925E+01 0.18468E+02 -0.56852E+01 | ||
649 | + 1. -0.97657E+00 -0.26064E+01 -0.56745E+01 | ||
650 | + 1. 0.15832E+02 0.31904E+01 -0.56686E+01 | ||
651 | + 1. -0.28821E+01 -0.12783E+02 -0.56624E+01 | ||
652 | + 1. -0.83847E+01 -0.15827E+02 -0.56548E+01 | ||
653 | + 1. 0.49759E+01 0.19156E+02 -0.56474E+01 | ||
654 | + 1. -0.13331E+02 -0.58427E+01 -0.56450E+01 | ||
655 | + 1. 0.13891E+02 0.60039E+01 -0.56378E+01 | ||
656 | + 1. 0.18614E+01 0.35075E+01 -0.56321E+01 | ||
657 | + 1. -0.17130E+02 -0.59926E+01 -0.56216E+01 | ||
658 | + 1. 0.26111E+01 -0.12532E+02 -0.56191E+01 | ||
659 | + 1. 0.19301E+01 0.17042E+02 -0.56133E+01 | ||
660 | + 1. 0.12729E+02 0.11494E+02 -0.56039E+01 | ||
661 | + 1. 0.22133E+01 -0.57505E+01 -0.55965E+01 | ||
662 | + 1. 0.12803E+02 0.40393E+01 -0.55908E+01 | ||
663 | + 1. -0.20939E+01 0.19434E+02 -0.55816E+01 | ||
664 | + 1. 0.12133E+02 -0.16821E+01 -0.55739E+01 | ||
665 | + 1. 0.16553E+02 -0.33754E+01 -0.55701E+01 | ||
666 | + 1. 0.74079E+01 0.18016E+02 -0.55602E+01 | ||
667 | + 1. -0.13082E+02 -0.97763E+01 -0.55600E+01 | ||
668 | + 1. -0.28807E+01 0.12627E+02 -0.55525E+01 | ||
669 | + 1. 0.18966E+02 -0.61007E+01 -0.55450E+01 | ||
670 | + 1. -0.16573E+02 0.79650E+01 -0.55343E+01 | ||
671 | + 1. -0.66423E+01 0.15105E+02 -0.55322E+01 | ||
672 | + 1. -0.14652E+02 -0.12937E+02 -0.55232E+01 | ||
673 | + 1. 0.22350E+01 -0.15968E+02 -0.55150E+01 | ||
674 | + 1. 0.96245E+01 -0.28180E+01 -0.55120E+01 | ||
675 | + 1. -0.44268E+01 0.36432E+01 -0.55054E+01 | ||
676 | + 1. 0.11099E+02 0.15163E+02 -0.54935E+01 | ||
677 | + 1. 0.45051E+00 0.74981E+01 -0.54925E+01 | ||
678 | + 1. -0.49357E+01 -0.33721E+01 -0.54860E+01 | ||
679 | + 1. -0.43874E+01 -0.16920E+02 -0.54766E+01 | ||
680 | + 1. 0.76787E+01 0.53271E+01 -0.54723E+01 | ||
681 | + 1. -0.11799E+02 0.10384E+02 -0.54645E+01 | ||
682 | + 1. -0.17248E+02 0.11471E+00 -0.54559E+01 | ||
683 | + 1. -0.98509E+01 -0.10385E+02 -0.54491E+01 | ||
684 | + 1. 0.92675E+01 0.22207E+01 -0.54462E+01 | ||
685 | + 1. 0.51253E+01 -0.90290E+01 -0.54355E+01 | ||
686 | + 1. 0.88507E+01 0.14430E+02 -0.54269E+01 | ||
687 | + 1. -0.14645E+02 -0.20426E+01 -0.54266E+01 | ||
688 | + 1. -0.46030E+01 -0.30754E+00 -0.54151E+01 | ||
689 | + 1. 0.31829E+01 0.17736E+00 -0.54069E+01 | ||
690 | + 1. -0.17305E+02 -0.25475E+01 -0.54013E+01 | ||
691 | + 1. -0.16384E+02 -0.78712E+01 -0.53992E+01 | ||
692 | + 1. 0.55747E+01 -0.13803E+02 -0.53887E+01 | ||
693 | + 1. 0.11081E+02 -0.86790E+01 -0.53826E+01 | ||
694 | + 1. 0.12445E+02 0.94806E+01 -0.53789E+01 | ||
695 | + 1. -0.16876E+02 0.10469E+02 -0.53689E+01 | ||
696 | + 1. -0.46682E+01 0.11068E+02 -0.53662E+01 | ||
697 | + 1. -0.14053E+02 0.12331E+02 -0.53568E+01 | ||
698 | + 1. 0.19709E+02 0.20681E+01 -0.53493E+01 | ||
699 | + 1. -0.19183E+01 0.98248E+01 -0.53440E+01 | ||
700 | + 1. -0.99713E+01 -0.46270E+01 -0.53335E+01 | ||
701 | + 1. 0.17022E+02 0.64437E+00 -0.53271E+01 | ||
702 | + 1. 0.97779E+01 -0.78267E+00 -0.53217E+01 | ||
703 | + 1. 0.22839E+01 -0.91238E+01 -0.53179E+01 | ||
704 | + 1. 0.22237E+01 -0.19283E+01 -0.53085E+01 | ||
705 | + 1. 0.13263E+02 0.20520E+01 -0.53059E+01 | ||
706 | + 1. 0.11644E+02 0.71196E+01 -0.52940E+01 | ||
707 | + 1. -0.13680E+01 0.15745E+02 -0.52905E+01 | ||
708 | + 1. 0.19031E+01 0.90416E+01 -0.52849E+01 | ||
709 | + 1. 0.85945E+01 -0.15564E+02 -0.52746E+01 | ||
710 | + 1. -0.12426E+02 0.30698E+01 -0.52724E+01 | ||
711 | + 1. -0.13038E+01 -0.10588E+02 -0.52626E+01 | ||
712 | + 1. 0.59173E+01 0.10167E+02 -0.52564E+01 | ||
713 | + 1. 0.56502E+01 -0.63349E+01 -0.52486E+01 | ||
714 | + 1. 0.35968E+00 0.12953E+02 -0.52461E+01 | ||
715 | + 1. -0.32575E+01 0.72957E+01 -0.52359E+01 | ||
716 | + 1. 0.19862E+02 -0.71126E+00 -0.52328E+01 | ||
717 | + 1. -0.18950E+02 0.56332E+01 -0.52258E+01 | ||
718 | + 1. -0.66342E+01 -0.12707E+02 -0.52183E+01 | ||
719 | + 1. -0.17836E+02 0.33705E+01 -0.52072E+01 | ||
720 | + 1. -0.23619E+01 -0.57377E+01 -0.52035E+01 | ||
721 | + 1. -0.90060E+01 0.88952E+01 -0.51970E+01 | ||
722 | + 1. 0.73475E+01 0.13126E+02 -0.51899E+01 | ||
723 | + 1. -0.46968E+01 -0.11970E+02 -0.51842E+01 | ||
724 | + 1. -0.96728E+01 0.56553E+01 -0.51734E+01 | ||
725 | + 1. 0.98129E+01 0.57489E+01 -0.51730E+01 | ||
726 | + 1. -0.11405E+02 -0.62656E+01 -0.51611E+01 | ||
727 | + 1. 0.13340E+02 0.14235E+02 -0.51578E+01 | ||
728 | + 1. -0.74789E+01 0.66741E+01 -0.51521E+01 | ||
729 | + 1. -0.45476E+01 0.17569E+02 -0.51464E+01 | ||
730 | + 1. 0.69929E+01 -0.10781E+02 -0.51348E+01 | ||
731 | + 1. 0.89730E+01 -0.13494E+02 -0.51296E+01 | ||
732 | + 1. -0.52037E+00 -0.49601E+01 -0.51221E+01 | ||
733 | + 1. 0.55862E+01 0.16123E+02 -0.51184E+01 | ||
734 | + 1. -0.19617E+02 -0.17961E+01 -0.51112E+01 | ||
735 | + 1. -0.25711E+01 -0.20476E-01 -0.51035E+01 | ||
736 | + 1. 0.70237E+01 -0.18549E+02 -0.50957E+01 | ||
737 | + 1. -0.11212E+02 -0.17326E+01 -0.50878E+01 | ||
738 | + 1. -0.14378E+02 -0.79279E+01 -0.50866E+01 | ||
739 | + 1. -0.12643E+01 -0.14085E+02 -0.50762E+01 | ||
740 | + 1. 0.63266E+01 -0.22817E+01 -0.50715E+01 | ||
741 | + 1. -0.24958E+01 -0.77871E+01 -0.50658E+01 | ||
742 | + 1. -0.60178E+01 0.20140E+01 -0.50536E+01 | ||
743 | + 1. -0.16582E+02 -0.11034E+02 -0.50496E+01 | ||
744 | + 1. 0.13626E+02 -0.74356E+01 -0.50404E+01 | ||
745 | + 1. -0.13036E+02 0.14104E+02 -0.50398E+01 | ||
746 | + 1. -0.78905E+01 -0.40344E+01 -0.50314E+01 | ||
747 | + 1. -0.85747E+01 -0.13534E+02 -0.50255E+01 | ||
748 | + 1. -0.65552E+01 -0.71409E+01 -0.50172E+01 | ||
749 | + 1. -0.63062E+01 -0.16361E+02 -0.50118E+01 | ||
750 | + 1. 0.63594E-01 0.18761E+02 -0.50024E+01 | ||
751 | + 1. 0.10709E+02 0.39684E+01 -0.49946E+01 | ||
752 | + 1. -0.66056E+01 0.11563E+02 -0.49911E+01 | ||
753 | + 1. -0.15410E+02 0.18246E+01 -0.49835E+01 | ||
754 | + 1. 0.69017E+01 0.83338E+01 -0.49797E+01 | ||
755 | + 1. 0.10921E+02 -0.52378E+01 -0.49693E+01 | ||
756 | + 1. 0.19298E+02 0.42136E+01 -0.49628E+01 | ||
757 | + 1. 0.98186E+01 0.87658E+01 -0.49564E+01 | ||
758 | + 1. -0.11380E+02 0.15488E+02 -0.49490E+01 | ||
759 | + 1. -0.75949E-02 0.37522E+01 -0.49429E+01 | ||
760 | + 1. -0.91193E+01 0.17477E+02 -0.49348E+01 | ||
761 | + 1. -0.10963E+02 0.12450E+02 -0.49311E+01 | ||
762 | + 1. 0.16399E+00 -0.12050E+02 -0.49240E+01 | ||
763 | + 1. -0.31333E+01 -0.18600E+02 -0.49168E+01 | ||
764 | + 1. 0.13903E+02 -0.42715E+01 -0.49105E+01 | ||
765 | + 1. -0.15189E+02 -0.56562E+01 -0.49028E+01 | ||
766 | + 1. -0.14035E+02 0.49815E+01 -0.48984E+01 | ||
767 | + 1. -0.12672E+02 -0.13647E+02 -0.48880E+01 | ||
768 | + 1. 0.14429E+02 0.89155E+01 -0.48831E+01 | ||
769 | + 1. 0.89330E+01 0.16575E+02 -0.48736E+01 | ||
770 | + 1. -0.22612E+01 0.52070E+01 -0.48678E+01 | ||
771 | + 1. 0.46794E+01 -0.11706E+02 -0.48623E+01 | ||
772 | + 1. -0.27308E+01 -0.37865E+01 -0.48592E+01 | ||
773 | + 1. -0.11037E+02 -0.16589E+02 -0.48472E+01 | ||
774 | + 1. -0.39440E+01 -0.14508E+02 -0.48408E+01 | ||
775 | + 1. -0.83491E+01 0.14278E+02 -0.48339E+01 | ||
776 | + 1. 0.46086E+01 0.82600E+01 -0.48275E+01 | ||
777 | + 1. 0.16463E+02 0.10696E+02 -0.48266E+01 | ||
778 | + 1. 0.11314E+02 0.13284E+01 -0.48151E+01 | ||
779 | + 1. 0.17249E+02 -0.51869E+01 -0.48099E+01 | ||
780 | + 1. 0.17277E+02 0.69474E+01 -0.48057E+01 | ||
781 | + 1. 0.13649E+02 -0.14139E+02 -0.47957E+01 | ||
782 | + 1. 0.15241E+02 -0.91565E+01 -0.47902E+01 | ||
783 | + 1. 0.21782E+01 0.11970E+02 -0.47848E+01 | ||
784 | + 1. -0.86981E+01 -0.88637E+01 -0.47759E+01 | ||
785 | + 1. -0.58277E+01 -0.19136E+02 -0.47718E+01 | ||
786 | + 1. -0.11448E+02 -0.11528E+02 -0.47608E+01 | ||
787 | + 1. 0.41424E+01 0.33168E+01 -0.47547E+01 | ||
788 | + 1. -0.94341E+01 0.14404E+01 -0.47468E+01 | ||
789 | + 1. -0.34380E+01 0.14632E+02 -0.47450E+01 | ||
790 | + 1. -0.87340E+01 -0.17643E+02 -0.47349E+01 | ||
791 | + 1. 0.66373E+01 -0.16068E+02 -0.47301E+01 | ||
792 | + 1. 0.16031E+02 -0.14122E+01 -0.47245E+01 | ||
793 | + 1. -0.17798E+02 -0.91162E+01 -0.47175E+01 | ||
794 | + 1. 0.18213E+02 -0.78721E+01 -0.47113E+01 | ||
795 | + 1. 0.10480E+02 -0.16172E+02 -0.47044E+01 | ||
796 | + 1. -0.16028E+02 0.50782E+01 -0.46962E+01 | ||
797 | + 1. 0.87943E+01 -0.47851E+01 -0.46883E+01 | ||
798 | + 1. 0.68399E+00 0.15682E+02 -0.46841E+01 | ||
799 | + 1. 0.20181E+01 -0.17929E+02 -0.46746E+01 | ||
800 | + 1. 0.10013E+00 -0.57815E+00 -0.46668E+01 | ||
801 | + 1. 0.12475E+02 -0.11207E+02 -0.46662E+01 | ||
802 | + 1. 0.48117E+01 -0.17169E+02 -0.46562E+01 | ||
803 | + 1. -0.18932E+02 -0.52410E+01 -0.46474E+01 | ||
804 | + 1. -0.70604E+00 0.14558E+01 -0.46441E+01 | ||
805 | + 1. 0.93320E+01 -0.93490E+01 -0.46338E+01 | ||
806 | + 1. 0.15596E+02 -0.12206E+02 -0.46319E+01 | ||
807 | + 1. -0.14294E+02 -0.38713E+01 -0.46245E+01 | ||
808 | + 1. -0.12312E+02 -0.42534E+01 -0.46142E+01 | ||
809 | + 1. -0.79700E-01 -0.17630E+02 -0.46069E+01 | ||
810 | + 1. 0.77267E+01 -0.65005E+01 -0.46040E+01 | ||
811 | + 1. 0.53713E+01 0.13139E+02 -0.45996E+01 | ||
812 | + 1. -0.62159E+01 -0.10396E+02 -0.45933E+01 | ||
813 | + 1. -0.40455E+01 0.19436E+02 -0.45809E+01 | ||
814 | + 1. -0.15080E+02 0.94342E+01 -0.45736E+01 | ||
815 | + 1. 0.17192E+02 0.44294E+01 -0.45671E+01 | ||
816 | + 1. -0.22085E+00 0.58118E+01 -0.45611E+01 | ||
817 | + 1. -0.76520E+01 0.50942E+00 -0.45580E+01 | ||
818 | + 1. -0.14405E+01 0.78421E+01 -0.45501E+01 | ||
819 | + 1. 0.11090E+02 -0.14055E+02 -0.45424E+01 | ||
820 | + 1. 0.15141E+02 0.56478E+00 -0.45338E+01 | ||
821 | + 1. -0.26092E+01 0.17374E+02 -0.45325E+01 | ||
822 | + 1. 0.15478E+02 -0.65814E+01 -0.45234E+01 | ||
823 | + 1. -0.11241E+02 0.45699E+01 -0.45187E+01 | ||
824 | + 1. 0.74896E+01 0.21925E+01 -0.45120E+01 | ||
825 | + 1. 0.31983E+01 -0.72983E+01 -0.45005E+01 | ||
826 | + 1. 0.71024E+01 -0.12714E+02 -0.44962E+01 | ||
827 | + 1. 0.10845E+01 -0.77069E+01 -0.44924E+01 | ||
828 | + 1. -0.13568E+02 0.55452E+00 -0.44864E+01 | ||
829 | + 1. -0.74554E+01 0.32801E+01 -0.44746E+01 | ||
830 | + 1. -0.19593E+02 0.26354E+01 -0.44717E+01 | ||
831 | + 1. 0.15190E+02 0.70968E+01 -0.44604E+01 | ||
832 | + 1. -0.52990E+01 0.93030E+01 -0.44586E+01 | ||
833 | + 1. 0.60864E+01 0.46542E+01 -0.44508E+01 | ||
834 | + 1. -0.12343E+01 0.11845E+02 -0.44463E+01 | ||
835 | + 1. 0.41515E+01 0.11347E+02 -0.44370E+01 | ||
836 | + 1. 0.64474E+01 -0.14215E+00 -0.44269E+01 | ||
837 | + 1. -0.14542E+02 -0.10567E+02 -0.44215E+01 | ||
838 | + 1. -0.63226E+01 0.16940E+02 -0.44174E+01 | ||
839 | + 1. 0.33976E+00 -0.15556E+02 -0.44077E+01 | ||
840 | + 1. 0.96921E+01 0.11633E+02 -0.44044E+01 | ||
841 | + 1. -0.36982E+01 -0.18672E+01 -0.43976E+01 | ||
842 | + 1. 0.52368E+01 -0.19294E+02 -0.43877E+01 | ||
843 | + 1. -0.30436E+01 -0.99989E+01 -0.43807E+01 | ||
844 | + 1. -0.12169E+02 0.74054E+01 -0.43739E+01 | ||
845 | + 1. 0.11763E+02 0.12819E+02 -0.43698E+01 | ||
846 | + 1. 0.17069E+02 -0.10078E+02 -0.43654E+01 | ||
847 | + 1. 0.13031E+02 0.26343E+00 -0.43557E+01 | ||
848 | + 1. -0.12444E+02 -0.80920E+01 -0.43528E+01 | ||
849 | + 1. 0.31692E+01 0.65014E+01 -0.43414E+01 | ||
850 | + 1. 0.14561E+02 0.45955E+01 -0.43360E+01 | ||
851 | + 1. 0.13614E+02 -0.22518E+01 -0.43275E+01 | ||
852 | + 1. 0.17537E+01 -0.40252E+01 -0.43238E+01 | ||
853 | + 1. -0.19096E+02 0.37266E-01 -0.43164E+01 | ||
854 | + 1. 0.34590E+01 0.19334E+02 -0.43097E+01 | ||
855 | + 1. -0.43255E+01 -0.70660E+01 -0.43030E+01 | ||
856 | + 1. 0.87280E+01 -0.17782E+02 -0.42939E+01 | ||
857 | + 1. 0.43238E+01 -0.12428E+01 -0.42900E+01 | ||
858 | + 1. -0.18181E+02 0.77948E+01 -0.42840E+01 | ||
859 | + 1. 0.29336E+01 -0.19682E+02 -0.42750E+01 | ||
860 | + 1. -0.60866E+01 0.54833E+01 -0.42720E+01 | ||
861 | + 1. 0.14992E+02 0.13099E+02 -0.42665E+01 | ||
862 | + 1. -0.53993E+01 0.14132E+02 -0.42588E+01 | ||
863 | + 1. -0.16055E+02 -0.11942E+01 -0.42506E+01 | ||
864 | + 1. 0.11813E+02 -0.33790E+01 -0.42455E+01 | ||
865 | + 1. -0.10663E+02 -0.14022E+02 -0.42382E+01 | ||
866 | + 1. 0.71527E+01 0.11368E+02 -0.42293E+01 | ||
867 | + 1. 0.49987E+01 -0.45388E+01 -0.42235E+01 | ||
868 | + 1. -0.10906E+02 0.89954E+01 -0.42141E+01 | ||
869 | + 1. -0.74830E+01 -0.20477E+01 -0.42114E+01 | ||
870 | + 1. 0.83398E+01 -0.17965E+01 -0.42033E+01 | ||
871 | + 1. 0.51798E+01 0.14290E+01 -0.41985E+01 | ||
872 | + 1. -0.14172E+02 0.70150E+01 -0.41895E+01 | ||
873 | + 1. 0.94701E+00 -0.10272E+02 -0.41844E+01 | ||
874 | + 1. 0.14233E+02 0.10843E+02 -0.41791E+01 | ||
875 | + 1. 0.11604E+02 -0.70132E+01 -0.41692E+01 | ||
876 | + 1. 0.33059E+01 0.13654E+02 -0.41656E+01 | ||
877 | + 1. -0.53013E+01 -0.49467E+01 -0.41544E+01 | ||
878 | + 1. -0.95952E+01 -0.30384E+01 -0.41512E+01 | ||
879 | + 1. 0.28982E+01 0.18329E+01 -0.41433E+01 | ||
880 | + 1. -0.16760E+02 -0.42849E+01 -0.41393E+01 | ||
881 | + 1. -0.22190E+01 -0.15850E+02 -0.41306E+01 | ||
882 | + 1. 0.18867E+02 -0.21335E+01 -0.41246E+01 | ||
883 | + 1. -0.75361E+01 0.99208E+01 -0.41153E+01 | ||
884 | + 1. 0.74515E+01 0.15411E+02 -0.41070E+01 | ||
885 | + 1. 0.34842E+01 0.16710E+02 -0.41053E+01 | ||
886 | + 1. 0.18664E+02 0.57620E+00 -0.40964E+01 | ||
887 | + 1. -0.15681E+02 0.11827E+02 -0.40889E+01 | ||
888 | + 1. 0.12375E+02 0.55239E+01 -0.40847E+01 | ||
889 | + 1. 0.16868E+02 0.22926E+01 -0.40781E+01 | ||
890 | + 1. 0.84972E+01 0.39044E+01 -0.40726E+01 | ||
891 | + 1. 0.24216E+01 -0.14558E+02 -0.40602E+01 | ||
892 | + 1. 0.84209E+01 0.73713E+01 -0.40538E+01 | ||
893 | + 1. -0.10399E+02 -0.77045E+01 -0.40495E+01 | ||
894 | + 1. -0.99952E+01 -0.36575E+00 -0.40467E+01 | ||
895 | + 1. -0.82207E+00 -0.86832E+01 -0.40356E+01 | ||
896 | + 1. 0.48108E+00 0.98288E+01 -0.40314E+01 | ||
897 | + 1. 0.94101E+01 0.74559E+00 -0.40249E+01 | ||
898 | + 1. -0.17744E+02 -0.71446E+01 -0.40154E+01 | ||
899 | + 1. 0.58890E+01 0.68495E+01 -0.40074E+01 | ||
900 | + 1. -0.90150E+01 -0.11731E+02 -0.40013E+01 | ||
901 | + 1. -0.13335E+02 0.10970E+02 -0.39977E+01 | ||
902 | + 1. -0.65330E+00 0.14291E+02 -0.39885E+01 | ||
903 | + 1. -0.17502E+02 0.14889E+01 -0.39813E+01 | ||
904 | + 1. 0.99833E+01 -0.11141E+02 -0.39766E+01 | ||
905 | + 1. 0.34290E+01 -0.10173E+02 -0.39681E+01 | ||
906 | + 1. -0.39563E+01 0.21156E+01 -0.39633E+01 | ||
907 | + 1. -0.32450E+01 0.92329E+01 -0.39583E+01 | ||
908 | + 1. 0.57608E+00 -0.19415E+02 -0.39481E+01 | ||
909 | + 1. -0.20412E+01 0.30476E+01 -0.39465E+01 | ||
910 | + 1. -0.11421E+02 0.17911E+01 -0.39363E+01 | ||
911 | + 1. -0.13126E+02 -0.21070E+01 -0.39290E+01 | ||
912 | + 1. 0.23280E+01 0.45372E+01 -0.39258E+01 | ||
913 | + 1. 0.11289E+02 0.10369E+02 -0.39162E+01 | ||
914 | + 1. 0.57610E+01 0.17998E+02 -0.39109E+01 | ||
915 | + 1. -0.98954E+01 0.11081E+02 -0.39052E+01 | ||
916 | + 1. -0.16484E+01 -0.14443E+01 -0.38954E+01 | ||
917 | + 1. 0.16499E+02 0.88526E+01 -0.38909E+01 | ||
918 | + 1. -0.88559E+01 -0.56457E+01 -0.38837E+01 | ||
919 | + 1. -0.67953E+01 -0.14538E+02 -0.38757E+01 | ||
920 | + 1. 0.19096E+02 -0.46457E+01 -0.38693E+01 | ||
921 | + 1. -0.92812E+01 -0.15715E+02 -0.38657E+01 | ||
922 | + 1. 0.11043E+02 0.16651E+02 -0.38551E+01 | ||
923 | + 1. 0.11142E+02 -0.59623E+00 -0.38474E+01 | ||
924 | + 1. 0.44182E+01 -0.14625E+02 -0.38432E+01 | ||
925 | + 1. -0.61856E+01 0.75666E+01 -0.38350E+01 | ||
926 | + 1. -0.10242E+02 0.70635E+01 -0.38281E+01 | ||
927 | + 1. -0.14615E+01 -0.19298E+02 -0.38208E+01 | ||
928 | + 1. -0.15505E+01 -0.12552E+02 -0.38154E+01 | ||
929 | + 1. 0.13468E+02 -0.93385E+01 -0.38078E+01 | ||
930 | + 1. 0.84115E+01 0.97452E+01 -0.38038E+01 | ||
931 | + 1. -0.52123E+00 0.17071E+02 -0.37984E+01 | ||
932 | + 1. -0.59110E+01 -0.38195E+00 -0.37907E+01 | ||
933 | + 1. -0.37433E+01 0.12194E+02 -0.37806E+01 | ||
934 | + 1. -0.65603E+01 0.18847E+02 -0.37753E+01 | ||
935 | + 1. 0.70663E+01 -0.36290E+01 -0.37713E+01 | ||
936 | + 1. 0.95161E+01 -0.69187E+01 -0.37610E+01 | ||
937 | + 1. 0.64689E+01 -0.85565E+01 -0.37576E+01 | ||
938 | + 1. -0.94902E+01 0.37801E+01 -0.37524E+01 | ||
939 | + 1. -0.42967E+01 0.63193E+01 -0.37422E+01 | ||
940 | + 1. -0.11577E+01 -0.66819E+01 -0.37390E+01 | ||
941 | + 1. 0.15766E+02 -0.42643E+01 -0.37277E+01 | ||
942 | + 1. -0.15497E+02 -0.12516E+02 -0.37232E+01 | ||
943 | + 1. 0.21511E+01 -0.55584E+00 -0.37154E+01 | ||
944 | + 1. -0.80380E+01 0.15992E+02 -0.37085E+01 | ||
945 | + 1. -0.80205E+01 0.12255E+02 -0.37058E+01 | ||
946 | + 1. -0.10140E+02 0.14286E+02 -0.36955E+01 | ||
947 | + 1. -0.14505E+02 0.34547E+01 -0.36890E+01 | ||
948 | + 1. 0.64576E+00 -0.24856E+01 -0.36836E+01 | ||
949 | + 1. 0.18968E+02 0.62621E+01 -0.36763E+01 | ||
950 | + 1. 0.13074E+01 0.79303E+01 -0.36704E+01 | ||
951 | + 1. 0.19758E+01 -0.12067E+02 -0.36617E+01 | ||
952 | + 1. -0.13610E+02 -0.58874E+01 -0.36559E+01 | ||
953 | + 1. -0.46671E+01 -0.89898E+01 -0.36506E+01 | ||
954 | + 1. 0.13695E+02 -0.59621E+01 -0.36404E+01 | ||
955 | + 1. -0.37552E+01 0.42223E+01 -0.36393E+01 | ||
956 | + 1. 0.11525E+02 -0.97795E+01 -0.36283E+01 | ||
957 | + 1. 0.12456E+02 0.33256E+01 -0.36242E+01 | ||
958 | + 1. 0.88354E+01 0.13313E+02 -0.36188E+01 | ||
959 | + 1. -0.68455E+01 -0.17773E+02 -0.36080E+01 | ||
960 | + 1. -0.11182E+02 -0.97814E+01 -0.36041E+01 | ||
961 | + 1. -0.15880E+02 -0.91244E+01 -0.35973E+01 | ||
962 | + 1. -0.19660E+02 -0.35127E+01 -0.35870E+01 | ||
963 | + 1. -0.46675E+01 -0.16318E+02 -0.35826E+01 | ||
964 | + 1. -0.19960E+01 0.19402E+02 -0.35785E+01 | ||
965 | + 1. 0.14697E+01 0.19546E+02 -0.35683E+01 | ||
966 | + 1. -0.11983E+01 -0.34308E+01 -0.35635E+01 | ||
967 | + 1. 0.13091E+02 0.82373E+01 -0.35599E+01 | ||
968 | + 1. 0.36792E+01 -0.30823E+01 -0.35477E+01 | ||
969 | + 1. -0.79454E+01 0.50552E+01 -0.35465E+01 | ||
970 | + 1. 0.51410E+01 0.14877E+02 -0.35377E+01 | ||
971 | + 1. 0.20160E+00 -0.13674E+02 -0.35306E+01 | ||
972 | + 1. 0.10599E+02 0.14477E+02 -0.35265E+01 | ||
973 | + 1. -0.43911E+01 0.16045E+02 -0.35179E+01 | ||
974 | + 1. 0.10632E+02 0.76106E+01 -0.35100E+01 | ||
975 | + 1. -0.17227E+02 0.94156E+01 -0.35029E+01 | ||
976 | + 1. 0.99826E+01 -0.29572E+01 -0.34988E+01 | ||
977 | + 1. -0.43220E+01 -0.19485E+02 -0.34906E+01 | ||
978 | + 1. 0.29093E+01 -0.16536E+02 -0.34840E+01 | ||
979 | + 1. -0.17284E+02 0.61054E+01 -0.34739E+01 | ||
980 | + 1. -0.44296E+01 -0.12982E+02 -0.34687E+01 | ||
981 | + 1. 0.79137E+01 -0.14486E+02 -0.34632E+01 | ||
982 | + 1. -0.34050E+01 -0.50643E+01 -0.34580E+01 | ||
983 | + 1. -0.14267E+02 0.13538E+02 -0.34467E+01 | ||
984 | + 1. 0.59913E+01 -0.11178E+02 -0.34450E+01 | ||
985 | + 1. 0.16667E+02 -0.79286E+01 -0.34387E+01 | ||
986 | + 1. 0.79686E+01 -0.10288E+02 -0.34284E+01 | ||
987 | + 1. -0.13299E+02 -0.11990E+02 -0.34253E+01 | ||
988 | + 1. 0.17510E+01 -0.60728E+01 -0.34164E+01 | ||
989 | + 1. -0.77993E+01 -0.74496E+01 -0.34100E+01 | ||
990 | + 1. 0.31437E+01 0.98427E+01 -0.34024E+01 | ||
991 | + 1. 0.18720E+02 0.26276E+01 -0.33947E+01 | ||
992 | + 1. -0.18200E+02 -0.18696E+01 -0.33905E+01 | ||
993 | + 1. -0.12050E+02 -0.15597E+02 -0.33840E+01 | ||
994 | + 1. 0.12585E+02 0.15078E+02 -0.33741E+01 | ||
995 | + 1. -0.51330E+01 -0.29210E+01 -0.33684E+01 | ||
996 | + 1. 0.56940E+01 0.94583E+01 -0.33619E+01 | ||
997 | + 1. -0.15679E+02 -0.68585E+01 -0.33566E+01 | ||
998 | + 1. 0.12670E+02 -0.15390E+02 -0.33497E+01 | ||
999 | + 1. -0.13949E+02 -0.14291E+02 -0.33422E+01 | ||
1000 | + 1. 0.12827E+02 -0.12876E+02 -0.33345E+01 | ||
1001 | + 1. -0.35110E+01 -0.13187E+00 -0.33321E+01 | ||
1002 | + 1. -0.19381E+02 0.49295E+01 -0.33247E+01 | ||
1003 | + 1. 0.78998E+00 0.89018E+00 -0.33140E+01 | ||
1004 | + 1. 0.13880E+01 0.13247E+02 -0.33074E+01 | ||
1005 | + 1. 0.15134E+02 -0.10646E+02 -0.33040E+01 | ||
1006 | + 1. 0.79390E+01 0.17675E+02 -0.32996E+01 | ||
1007 | + 1. -0.57989E+01 0.36343E+01 -0.32895E+01 | ||
1008 | + 1. -0.12809E+02 0.54764E+01 -0.32867E+01 | ||
1009 | + 1. 0.16105E+02 0.56154E+01 -0.32743E+01 | ||
1010 | + 1. -0.15316E+02 0.68704E+00 -0.32672E+01 | ||
1011 | + 1. -0.77401E+01 -0.97776E+01 -0.32620E+01 | ||
1012 | + 1. 0.14491E+02 0.24547E+01 -0.32568E+01 | ||
1013 | + 1. -0.10699E+02 -0.47546E+01 -0.32475E+01 | ||
1014 | + 1. 0.10216E+02 0.30081E+01 -0.32462E+01 | ||
1015 | + 1. -0.17266E+02 0.33716E+01 -0.32346E+01 | ||
1016 | + 1. -0.10464E+02 0.16629E+02 -0.32279E+01 | ||
1017 | + 1. -0.12446E+02 0.15246E+02 -0.32261E+01 | ||
1018 | + 1. -0.23357E+01 0.15471E+02 -0.32138E+01 | ||
1019 | + 1. 0.49710E+01 -0.70887E+01 -0.32096E+01 | ||
1020 | + 1. 0.78593E+01 0.55953E+01 -0.32050E+01 | ||
1021 | + 1. -0.72167E+01 -0.12441E+02 -0.31991E+01 | ||
1022 | + 1. -0.87439E+01 0.83880E+01 -0.31913E+01 | ||
1023 | + 1. 0.17270E+02 -0.96117E+00 -0.31833E+01 | ||
1024 | + 1. 0.21149E+01 -0.88238E+01 -0.31789E+01 | ||
1025 | + 1. 0.11809E+02 -0.51169E+01 -0.31671E+01 | ||
1026 | + 1. -0.69537E+00 -0.10795E+02 -0.31636E+01 | ||
1027 | + 1. 0.43054E+01 0.50272E+01 -0.31584E+01 | ||
1028 | + 1. -0.72963E+01 -0.43500E+01 -0.31472E+01 | ||
1029 | + 1. 0.65859E+01 -0.56826E+01 -0.31425E+01 | ||
1030 | + 1. 0.61905E+01 -0.17667E+02 -0.31355E+01 | ||
1031 | + 1. 0.18414E+02 -0.63875E+01 -0.31329E+01 | ||
1032 | + 1. -0.15278E+01 0.10093E+02 -0.31258E+01 | ||
1033 | + 1. -0.11735E+02 0.13089E+02 -0.31151E+01 | ||
1034 | + 1. 0.10139E+02 0.55961E+01 -0.31079E+01 | ||
1035 | + 1. 0.14632E+02 -0.78397E+01 -0.31016E+01 | ||
1036 | + 1. -0.84328E+01 0.21817E+01 -0.30952E+01 | ||
1037 | + 1. 0.15765E+02 0.11574E+02 -0.30914E+01 | ||
1038 | + 1. -0.21895E+01 0.63076E+01 -0.30802E+01 | ||
1039 | + 1. 0.49252E+01 -0.12846E+02 -0.30748E+01 | ||
1040 | + 1. 0.14599E+02 -0.70901E+00 -0.30687E+01 | ||
1041 | + 1. 0.67695E+01 0.13689E+02 -0.30630E+01 | ||
1042 | + 1. -0.39110E+01 0.18064E+02 -0.30580E+01 | ||
1043 | + 1. -0.30481E+01 -0.17457E+02 -0.30530E+01 | ||
1044 | + 1. 0.10063E+01 0.31022E+01 -0.30429E+01 | ||
1045 | + 1. -0.57368E+01 0.11842E+02 -0.30394E+01 | ||
1046 | + 1. 0.19214E+01 0.16002E+02 -0.30300E+01 | ||
1047 | + 1. -0.13624E+02 -0.90506E+01 -0.30212E+01 | ||
1048 | + 1. -0.74870E+00 0.46526E+01 -0.30151E+01 | ||
1049 | + 1. -0.15484E+02 0.82407E+01 -0.30076E+01 | ||
1050 | + 1. 0.56643E+01 0.31563E+01 -0.30064E+01 | ||
1051 | + 1. -0.87885E+01 -0.13704E+02 -0.29979E+01 | ||
1052 | + 1. -0.19411E+01 0.13108E+02 -0.29920E+01 | ||
1053 | + 1. 0.88106E+01 -0.12504E+02 -0.29812E+01 | ||
1054 | + 1. -0.11852E+02 -0.59169E+00 -0.29744E+01 | ||
1055 | + 1. -0.73640E+00 -0.16566E+02 -0.29676E+01 | ||
1056 | + 1. -0.15109E+02 -0.24086E+01 -0.29620E+01 | ||
1057 | + 1. 0.98771E+01 -0.14412E+02 -0.29594E+01 | ||
1058 | + 1. -0.16204E+01 0.55894E+00 -0.29498E+01 | ||
1059 | + 1. 0.63759E+01 -0.18000E+01 -0.29431E+01 | ||
1060 | + 1. -0.29435E+01 -0.81139E+01 -0.29347E+01 | ||
1061 | + 1. 0.92495E+01 -0.16375E+02 -0.29288E+01 | ||
1062 | + 1. -0.84459E+01 0.17832E+02 -0.29217E+01 | ||
1063 | + 1. -0.12667E+02 0.88319E+01 -0.29169E+01 | ||
1064 | + 1. 0.78334E+01 -0.16264E-01 -0.29104E+01 | ||
1065 | + 1. -0.15270E+02 -0.49101E+01 -0.29001E+01 | ||
1066 | + 1. -0.65993E+01 0.14075E+01 -0.28941E+01 | ||
1067 | + 1. 0.34794E+01 -0.51637E+01 -0.28892E+01 | ||
1068 | + 1. 0.13312E+02 0.12326E+02 -0.28827E+01 | ||
1069 | + 1. -0.15095E+02 0.57411E+01 -0.28747E+01 | ||
1070 | + 1. 0.90781E+01 0.15679E+02 -0.28671E+01 | ||
1071 | + 1. 0.17462E+02 -0.34217E+01 -0.28634E+01 | ||
1072 | + 1. -0.12685E+02 0.32992E+01 -0.28598E+01 | ||
1073 | + 1. -0.11932E+02 -0.67508E+01 -0.28467E+01 | ||
1074 | + 1. -0.70356E+01 0.13943E+02 -0.28454E+01 | ||
1075 | + 1. 0.19844E+02 -0.88318E+00 -0.28355E+01 | ||
1076 | + 1. -0.19508E+02 0.14317E+01 -0.28297E+01 | ||
1077 | + 1. 0.38494E+01 -0.18254E+02 -0.28219E+01 | ||
1078 | + 1. 0.11915E+02 0.10294E+01 -0.28168E+01 | ||
1079 | + 1. 0.30706E+01 0.12078E+02 -0.28088E+01 | ||
1080 | + 1. 0.17431E+02 0.72970E+01 -0.28001E+01 | ||
1081 | + 1. -0.11556E+02 -0.29976E+01 -0.27988E+01 | ||
1082 | + 1. 0.94681E+00 0.57447E+01 -0.27918E+01 | ||
1083 | + 1. 0.13307E-01 0.11405E+02 -0.27806E+01 | ||
1084 | + 1. -0.11056E+02 -0.12538E+02 -0.27738E+01 | ||
1085 | + 1. -0.30871E+01 -0.14472E+02 -0.27671E+01 | ||
1086 | + 1. 0.88855E+01 -0.85558E+01 -0.27644E+01 | ||
1087 | + 1. 0.52174E+01 0.11574E+02 -0.27596E+01 | ||
1088 | + 1. 0.96953E+01 -0.50361E+01 -0.27522E+01 | ||
1089 | + 1. -0.95256E+01 -0.17493E+02 -0.27403E+01 | ||
1090 | + 1. 0.45793E+01 0.10395E+00 -0.27338E+01 | ||
1091 | + 1. 0.16286E+02 -0.60551E+01 -0.27284E+01 | ||
1092 | + 1. 0.36478E+01 0.79969E+01 -0.27203E+01 | ||
1093 | + 1. -0.14754E+02 0.10171E+02 -0.27198E+01 | ||
1094 | + 1. 0.14986E+02 -0.26703E+01 -0.27078E+01 | ||
1095 | + 1. 0.16697E+01 -0.18183E+02 -0.27036E+01 | ||
1096 | + 1. -0.18138E+02 -0.45569E+01 -0.26936E+01 | ||
1097 | + 1. 0.13946E+02 0.63373E+01 -0.26893E+01 | ||
1098 | + 1. 0.14874E+02 -0.12794E+02 -0.26823E+01 | ||
1099 | + 1. -0.27518E+01 -0.11404E+02 -0.26770E+01 | ||
1100 | + 1. 0.55334E+01 -0.15829E+02 -0.26733E+01 | ||
1101 | + 1. -0.13420E+02 -0.37520E+01 -0.26617E+01 | ||
1102 | + 1. -0.30371E+01 -0.26905E+01 -0.26563E+01 | ||
1103 | + 1. -0.75369E+01 -0.77412E+00 -0.26503E+01 | ||
1104 | + 1. 0.49376E+01 0.19357E+02 -0.26455E+01 | ||
1105 | + 1. -0.52354E+01 -0.62482E+01 -0.26335E+01 | ||
1106 | + 1. 0.17738E+02 0.45518E+01 -0.26268E+01 | ||
1107 | + 1. 0.33634E+00 -0.49005E+01 -0.26247E+01 | ||
1108 | + 1. 0.71018E+01 0.80336E+01 -0.26195E+01 | ||
1109 | + 1. 0.27739E+01 0.17939E+02 -0.26070E+01 | ||
1110 | + 1. -0.49234E+01 0.10068E+02 -0.26022E+01 | ||
1111 | + 1. -0.58480E+01 -0.10978E+02 -0.25954E+01 | ||
1112 | + 1. 0.36792E+01 0.28555E+01 -0.25921E+01 | ||
1113 | + 1. -0.98656E+00 0.81160E+01 -0.25824E+01 | ||
1114 | + 1. 0.12789E+02 0.10211E+02 -0.25752E+01 | ||
1115 | + 1. -0.46411E+01 0.80537E+01 -0.25674E+01 | ||
1116 | + 1. 0.11006E+02 0.12235E+02 -0.25646E+01 | ||
1117 | + 1. -0.17716E+02 -0.87762E+01 -0.25539E+01 | ||
1118 | + 1. -0.16957E+02 -0.47682E+00 -0.25533E+01 | ||
1119 | + 1. -0.16700E+02 -0.10931E+02 -0.25448E+01 | ||
1120 | + 1. -0.37352E+01 0.14111E+02 -0.25353E+01 | ||
1121 | + 1. 0.14706E+02 0.91405E+01 -0.25281E+01 | ||
1122 | + 1. 0.76832E+01 0.25152E+01 -0.25234E+01 | ||
1123 | + 1. 0.12124E+02 -0.23723E+01 -0.25177E+01 | ||
1124 | + 1. 0.10140E+02 0.94523E+01 -0.25129E+01 | ||
1125 | + 1. 0.48272E+01 -0.94249E+01 -0.25051E+01 | ||
1126 | + 1. -0.10843E+02 0.49651E+01 -0.24968E+01 | ||
1127 | + 1. -0.13161E+02 0.10011E+01 -0.24882E+01 | ||
1128 | + 1. 0.11580E+02 -0.11502E+02 -0.24859E+01 | ||
1129 | + 1. -0.12797E-01 -0.77459E+00 -0.24746E+01 | ||
1130 | + 1. -0.30020E+00 0.19204E+02 -0.24691E+01 | ||
1131 | + 1. -0.96068E+01 -0.88590E+01 -0.24621E+01 | ||
1132 | + 1. 0.16130E+02 0.13294E+01 -0.24574E+01 | ||
1133 | + 1. -0.10231E+02 0.96620E+01 -0.24481E+01 | ||
1134 | + 1. 0.96559E+01 -0.12504E+01 -0.24455E+01 | ||
1135 | + 1. 0.60636E+00 -0.73980E+01 -0.24388E+01 | ||
1136 | + 1. 0.11687E+02 -0.81225E+01 -0.24304E+01 | ||
1137 | + 1. -0.99788E+01 0.96227E+00 -0.24229E+01 | ||
1138 | + 1. -0.97102E+01 0.12777E+02 -0.24165E+01 | ||
1139 | + 1. -0.19967E+02 -0.10744E+01 -0.24093E+01 | ||
1140 | + 1. 0.49092E+01 0.16533E+02 -0.24049E+01 | ||
1141 | + 1. -0.78179E+01 -0.15735E+02 -0.23950E+01 | ||
1142 | + 1. 0.80264E+01 0.11679E+02 -0.23928E+01 | ||
1143 | + 1. -0.78711E+01 0.67325E+01 -0.23848E+01 | ||
1144 | + 1. 0.31366E+01 -0.13720E+02 -0.23735E+01 | ||
1145 | + 1. 0.54792E+01 -0.38359E+01 -0.23714E+01 | ||
1146 | + 1. -0.59172E+01 0.61952E+01 -0.23660E+01 | ||
1147 | + 1. -0.57233E+01 0.17302E+02 -0.23563E+01 | ||
1148 | + 1. 0.14603E+00 0.15149E+02 -0.23497E+01 | ||
1149 | + 1. 0.25845E+01 0.88440E+00 -0.23405E+01 | ||
1150 | + 1. 0.17362E+02 -0.95715E+01 -0.23397E+01 | ||
1151 | + 1. 0.11534E+01 -0.16223E+02 -0.23296E+01 | ||
1152 | + 1. -0.84089E+01 -0.25905E+01 -0.23263E+01 | ||
1153 | + 1. 0.19541E+02 -0.32501E+01 -0.23188E+01 | ||
1154 | + 1. -0.11802E+02 0.11108E+02 -0.23116E+01 | ||
1155 | + 1. -0.27006E+01 -0.19745E+02 -0.23011E+01 | ||
1156 | + 1. -0.98518E+01 -0.64725E+01 -0.22952E+01 | ||
1157 | + 1. 0.81614E+01 -0.66429E+01 -0.22914E+01 | ||
1158 | + 1. -0.71254E+01 0.92173E+01 -0.22824E+01 | ||
1159 | + 1. 0.21287E+01 -0.34574E+01 -0.22792E+01 | ||
1160 | + 1. 0.11896E+02 0.63557E+01 -0.22681E+01 | ||
1161 | + 1. -0.97526E+01 -0.10871E+02 -0.22611E+01 | ||
1162 | + 1. -0.11700E+02 0.68331E+01 -0.22570E+01 | ||
1163 | + 1. 0.30662E+01 0.14458E+02 -0.22505E+01 | ||
1164 | + 1. 0.14171E+02 -0.45685E+01 -0.22430E+01 | ||
1165 | + 1. -0.18821E+02 0.66664E+01 -0.22398E+01 | ||
1166 | + 1. -0.57863E+01 -0.15355E+02 -0.22318E+01 | ||
1167 | + 1. 0.14780E+02 0.42095E+01 -0.22222E+01 | ||
1168 | + 1. 0.35268E+01 -0.11662E+02 -0.22156E+01 | ||
1169 | + 1. -0.90335E+01 0.15043E+02 -0.22118E+01 | ||
1170 | + 1. -0.10680E+02 0.29071E+01 -0.22026E+01 | ||
1171 | + 1. -0.16442E+01 0.17573E+02 -0.21949E+01 | ||
1172 | + 1. -0.12463E+02 -0.10635E+02 -0.21911E+01 | ||
1173 | + 1. 0.17123E+02 0.10066E+02 -0.21818E+01 | ||
1174 | + 1. -0.16514E+01 -0.54798E+01 -0.21796E+01 | ||
1175 | + 1. -0.30526E+01 0.11100E+02 -0.21728E+01 | ||
1176 | + 1. -0.18562E+02 -0.69968E+01 -0.21608E+01 | ||
1177 | + 1. -0.12060E+01 -0.14141E+02 -0.21562E+01 | ||
1178 | + 1. -0.29388E+01 0.29829E+01 -0.21524E+01 | ||
1179 | + 1. -0.84594E+01 0.11046E+02 -0.21410E+01 | ||
1180 | + 1. -0.89089E+00 0.23152E+01 -0.21379E+01 | ||
1181 | + 1. 0.31645E+00 -0.93736E+01 -0.21318E+01 | ||
1182 | + 1. 0.32641E+01 -0.73992E+01 -0.21265E+01 | ||
1183 | + 1. 0.11351E+02 0.42815E+01 -0.21142E+01 | ||
1184 | + 1. -0.44070E+01 0.12476E+01 -0.21077E+01 | ||
1185 | + 1. 0.68816E+01 0.15566E+02 -0.21014E+01 | ||
1186 | + 1. -0.13837E+02 -0.72561E+01 -0.20966E+01 | ||
1187 | + 1. 0.99827E+01 0.96543E+00 -0.20915E+01 | ||
1188 | + 1. 0.60253E+01 0.52506E+01 -0.20814E+01 | ||
1189 | + 1. -0.57319E+01 -0.18867E+02 -0.20744E+01 | ||
1190 | + 1. -0.13774E+02 0.11831E+02 -0.20712E+01 | ||
1191 | + 1. 0.19376E+02 0.10053E+01 -0.20656E+01 | ||
1192 | + 1. 0.64990E+01 -0.13958E+02 -0.20556E+01 | ||
1193 | + 1. 0.13347E+02 -0.10291E+02 -0.20493E+01 | ||
1194 | + 1. -0.53116E+01 -0.13152E+01 -0.20404E+01 | ||
1195 | + 1. -0.31852E+00 -0.18973E+02 -0.20338E+01 | ||
1196 | + 1. -0.63674E+01 -0.85854E+01 -0.20287E+01 | ||
1197 | + 1. -0.14709E+02 -0.11624E+02 -0.20212E+01 | ||
1198 | + 1. -0.15401E+02 0.26950E+01 -0.20181E+01 | ||
1199 | + 1. 0.13769E+02 0.79632E+00 -0.20089E+01 | ||
1200 | + 1. 0.12702E+01 0.94158E+01 -0.20035E+01 | ||
1201 | + 1. 0.88371E+01 0.69889E+01 -0.19978E+01 | ||
1202 | + 1. 0.96308E+01 -0.10546E+02 -0.19924E+01 | ||
1203 | + 1. 0.52091E+00 -0.12373E+02 -0.19863E+01 | ||
1204 | + 1. -0.10426E+02 -0.14339E+02 -0.19773E+01 | ||
1205 | + 1. -0.19600E+02 0.34461E+01 -0.19675E+01 | ||
1206 | + 1. -0.16625E+02 0.48110E+01 -0.19642E+01 | ||
1207 | + 1. 0.70920E+00 0.17273E+02 -0.19552E+01 | ||
1208 | + 1. 0.31287E+01 -0.11133E+01 -0.19494E+01 | ||
1209 | + 1. -0.16854E+02 0.10642E+02 -0.19452E+01 | ||
1210 | + 1. 0.64720E+01 0.18168E+02 -0.19400E+01 | ||
1211 | + 1. 0.11074E+02 0.15795E+02 -0.19318E+01 | ||
1212 | + 1. 0.11805E+02 0.84020E+01 -0.19210E+01 | ||
1213 | + 1. -0.17318E+02 0.17475E+01 -0.19174E+01 | ||
1214 | + 1. 0.11506E+02 -0.16261E+02 -0.19123E+01 | ||
1215 | + 1. -0.13567E+02 -0.16535E+01 -0.19030E+01 | ||
1216 | + 1. -0.85160E+01 0.40444E+01 -0.18943E+01 | ||
1217 | + 1. 0.12025E+02 -0.14096E+02 -0.18881E+01 | ||
1218 | + 1. -0.12829E+02 -0.13187E+02 -0.18866E+01 | ||
1219 | + 1. -0.17152E+02 -0.29506E+01 -0.18756E+01 | ||
1220 | + 1. -0.39411E+01 0.53099E+01 -0.18674E+01 | ||
1221 | + 1. 0.28579E+01 0.63375E+01 -0.18608E+01 | ||
1222 | + 1. 0.14865E+02 0.13204E+02 -0.18595E+01 | ||
1223 | + 1. 0.10136E+02 -0.70004E+01 -0.18494E+01 | ||
1224 | + 1. -0.11652E+02 -0.84992E+01 -0.18447E+01 | ||
1225 | + 1. 0.79544E+01 -0.45258E+01 -0.18334E+01 | ||
1226 | + 1. 0.95655E+01 0.13945E+02 -0.18315E+01 | ||
1227 | + 1. 0.84807E+01 -0.17910E+02 -0.18226E+01 | ||
1228 | + 1. -0.16833E+01 -0.91925E+01 -0.18167E+01 | ||
1229 | + 1. 0.70810E+01 -0.83661E+01 -0.18103E+01 | ||
1230 | + 1. -0.56690E+01 -0.13146E+02 -0.18048E+01 | ||
1231 | + 1. -0.51936E+01 -0.42906E+01 -0.17981E+01 | ||
1232 | + 1. 0.12810E+02 0.25966E+01 -0.17905E+01 | ||
1233 | + 1. 0.22759E+01 0.41709E+01 -0.17827E+01 | ||
1234 | + 1. 0.12371E+01 -0.14247E+02 -0.17777E+01 | ||
1235 | + 1. 0.68936E+01 0.99620E+01 -0.17729E+01 | ||
1236 | + 1. 0.96696E+01 0.17472E+02 -0.17666E+01 | ||
1237 | + 1. 0.68955E+01 -0.10598E+02 -0.17542E+01 | ||
1238 | + 1. 0.75292E+01 -0.16026E+02 -0.17500E+01 | ||
1239 | + 1. 0.19742E+02 0.31243E+01 -0.17461E+01 | ||
1240 | + 1. -0.26289E+01 0.90267E+01 -0.17382E+01 | ||
1241 | + 1. -0.64141E+01 0.15505E+02 -0.17327E+01 | ||
1242 | + 1. 0.11969E+02 0.13967E+02 -0.17264E+01 | ||
1243 | + 1. -0.37429E+01 -0.97176E+01 -0.17158E+01 | ||
1244 | + 1. -0.79247E+01 -0.61267E+01 -0.17067E+01 | ||
1245 | + 1. -0.10007E+02 -0.11162E+01 -0.17040E+01 | ||
1246 | + 1. 0.16569E+02 0.32101E+01 -0.16965E+01 | ||
1247 | + 1. 0.12967E+02 -0.66305E+01 -0.16922E+01 | ||
1248 | + 1. -0.25932E+01 0.19812E+02 -0.16806E+01 | ||
1249 | + 1. 0.79823E+01 -0.23769E+01 -0.16799E+01 | ||
1250 | + 1. 0.15105E+02 -0.92270E+01 -0.16733E+01 | ||
1251 | + 1. -0.45385E+00 -0.30404E+01 -0.16657E+01 | ||
1252 | + 1. -0.13870E+02 0.72486E+01 -0.16581E+01 | ||
1253 | + 1. -0.11114E+02 -0.16615E+02 -0.16532E+01 | ||
1254 | + 1. -0.13049E+02 0.13986E+02 -0.16432E+01 | ||
1255 | + 1. 0.16187E+02 -0.11059E+02 -0.16366E+01 | ||
1256 | + 1. 0.26743E+01 -0.19635E+02 -0.16290E+01 | ||
1257 | + 1. -0.17019E+02 0.73401E+01 -0.16261E+01 | ||
1258 | + 1. -0.38585E+01 0.16386E+02 -0.16142E+01 | ||
1259 | + 1. 0.87263E+01 0.40035E+01 -0.16081E+01 | ||
1260 | + 1. 0.53954E+01 0.13790E+02 -0.16013E+01 | ||
1261 | + 1. 0.18572E+02 0.61562E+01 -0.15971E+01 | ||
1262 | + 1. -0.16758E+02 -0.57908E+01 -0.15926E+01 | ||
1263 | + 1. -0.15663E+02 -0.93332E+01 -0.15833E+01 | ||
1264 | + 1. 0.43272E+01 0.95065E+01 -0.15773E+01 | ||
1265 | + 1. -0.97762E+01 -0.39957E+01 -0.15673E+01 | ||
1266 | + 1. -0.76198E+01 -0.17659E+02 -0.15647E+01 | ||
1267 | + 1. 0.33637E+01 -0.16214E+02 -0.15581E+01 | ||
1268 | + 1. -0.42316E+01 -0.16747E+02 -0.15497E+01 | ||
1269 | + 1. 0.15650E+02 0.76445E+01 -0.15423E+01 | ||
1270 | + 1. 0.15421E+01 0.19430E+02 -0.15366E+01 | ||
1271 | + 1. -0.79251E+01 -0.11348E+02 -0.15325E+01 | ||
1272 | + 1. 0.52464E+01 -0.18935E+02 -0.15252E+01 | ||
1273 | + 1. 0.23204E+01 -0.10140E+02 -0.15137E+01 | ||
1274 | + 1. 0.64660E+01 0.12889E+01 -0.15114E+01 | ||
1275 | + 1. 0.10288E+02 -0.33649E+01 -0.15050E+01 | ||
1276 | + 1. -0.19183E+02 -0.32493E+01 -0.14945E+01 | ||
1277 | + 1. -0.54347E+01 0.13626E+02 -0.14873E+01 | ||
1278 | + 1. 0.17892E+02 -0.49917E+01 -0.14846E+01 | ||
1279 | + 1. -0.97241E+01 0.63921E+01 -0.14742E+01 | ||
1280 | + 1. -0.13859E+02 0.42874E+01 -0.14674E+01 | ||
1281 | + 1. -0.11058E+02 0.14094E+02 -0.14640E+01 | ||
1282 | + 1. 0.16803E+02 -0.76363E+01 -0.14588E+01 | ||
1283 | + 1. 0.17630E+02 0.15080E+00 -0.14485E+01 | ||
1284 | + 1. 0.47746E+01 -0.59322E+01 -0.14430E+01 | ||
1285 | + 1. -0.56984E+01 0.26492E+01 -0.14335E+01 | ||
1286 | + 1. -0.21811E+01 -0.71414E+00 -0.14320E+01 | ||
1287 | + 1. -0.46269E+00 0.13394E+02 -0.14243E+01 | ||
1288 | + 1. -0.12745E+02 -0.15331E+02 -0.14149E+01 | ||
1289 | + 1. -0.12086E+02 -0.50587E+01 -0.14099E+01 | ||
1290 | + 1. 0.21218E+01 -0.56893E+01 -0.14039E+01 | ||
1291 | + 1. 0.18099E+02 -0.19202E+01 -0.13968E+01 | ||
1292 | + 1. -0.33627E+01 -0.64127E+01 -0.13889E+01 | ||
1293 | + 1. -0.11704E+02 0.16137E+02 -0.13833E+01 | ||
1294 | + 1. -0.14856E+02 0.14788E-01 -0.13774E+01 | ||
1295 | + 1. 0.11331E+02 -0.56047E+00 -0.13671E+01 | ||
1296 | + 1. 0.98624E+01 0.11103E+02 -0.13638E+01 | ||
1297 | + 1. 0.10843E+01 0.72153E+01 -0.13592E+01 | ||
1298 | + 1. -0.20093E+01 -0.17873E+02 -0.13500E+01 | ||
1299 | + 1. 0.16362E+01 0.12780E+02 -0.13461E+01 | ||
1300 | + 1. -0.15270E+02 -0.35704E+01 -0.13356E+01 | ||
1301 | + 1. -0.41672E+01 -0.11841E+02 -0.13269E+01 | ||
1302 | + 1. -0.21776E+01 -0.15755E+02 -0.13204E+01 | ||
1303 | + 1. -0.65615E+01 0.11084E+02 -0.13168E+01 | ||
1304 | + 1. -0.47169E+01 0.19264E+02 -0.13085E+01 | ||
1305 | + 1. 0.93956E+00 0.16197E+01 -0.13023E+01 | ||
1306 | + 1. 0.49735E+01 0.67723E+01 -0.12993E+01 | ||
1307 | + 1. -0.16535E+01 0.15715E+02 -0.12868E+01 | ||
1308 | + 1. 0.48559E+01 -0.22043E+01 -0.12816E+01 | ||
1309 | + 1. -0.11598E+01 0.62842E+01 -0.12761E+01 | ||
1310 | + 1. 0.14163E+02 -0.14086E+02 -0.12709E+01 | ||
1311 | + 1. 0.16153E+02 0.54784E+01 -0.12626E+01 | ||
1312 | + 1. -0.12049E+01 -0.11323E+02 -0.12562E+01 | ||
1313 | + 1. 0.16299E+02 -0.37665E+01 -0.12521E+01 | ||
1314 | + 1. 0.12168E+02 -0.41319E+01 -0.12439E+01 | ||
1315 | + 1. -0.11367E+01 0.10845E+02 -0.12395E+01 | ||
1316 | + 1. 0.13550E+02 -0.10425E+01 -0.12274E+01 | ||
1317 | + 1. -0.18566E+02 -0.13430E+00 -0.12240E+01 | ||
1318 | + 1. -0.81618E+01 0.10534E+01 -0.12147E+01 | ||
1319 | + 1. 0.84728E+01 -0.13960E+02 -0.12096E+01 | ||
1320 | + 1. -0.95176E+01 -0.12563E+02 -0.12061E+01 | ||
1321 | + 1. -0.11583E+01 -0.72036E+01 -0.11957E+01 | ||
1322 | + 1. 0.14923E+02 -0.62968E+01 -0.11876E+01 | ||
1323 | + 1. 0.15409E+02 -0.45714E-01 -0.11824E+01 | ||
1324 | + 1. -0.14339E+02 -0.54240E+01 -0.11754E+01 | ||
1325 | + 1. -0.66718E+01 -0.27065E+01 -0.11707E+01 | ||
1326 | + 1. -0.11711E+02 0.14926E+01 -0.11617E+01 | ||
1327 | + 1. -0.68879E+01 0.18768E+02 -0.11571E+01 | ||
1328 | + 1. -0.78874E+01 -0.13730E+02 -0.11481E+01 | ||
1329 | + 1. 0.28341E+00 0.42193E+01 -0.11426E+01 | ||
1330 | + 1. -0.13414E+02 0.96085E+01 -0.11345E+01 | ||
1331 | + 1. 0.10439E+02 -0.12679E+02 -0.11330E+01 | ||
1332 | + 1. 0.14323E+02 0.11290E+02 -0.11231E+01 | ||
1333 | + 1. -0.86610E+01 0.16950E+02 -0.11199E+01 | ||
1334 | + 1. -0.30408E+01 0.69641E+01 -0.11111E+01 | ||
1335 | + 1. -0.15611E+02 0.90018E+01 -0.11063E+01 | ||
1336 | + 1. 0.75562E+01 0.13896E+02 -0.10955E+01 | ||
1337 | + 1. 0.41446E+01 0.13378E+01 -0.10908E+01 | ||
1338 | + 1. -0.86038E+01 0.82292E+01 -0.10856E+01 | ||
1339 | + 1. 0.11375E+02 -0.10065E+02 -0.10787E+01 | ||
1340 | + 1. 0.13671E+02 0.77269E+01 -0.10726E+01 | ||
1341 | + 1. -0.62550E+01 0.16613E+00 -0.10643E+01 | ||
1342 | + 1. 0.29527E+01 0.16340E+02 -0.10551E+01 | ||
1343 | + 1. 0.13282E+02 -0.12038E+02 -0.10523E+01 | ||
1344 | + 1. -0.15634E+02 0.11963E+02 -0.10436E+01 | ||
1345 | + 1. 0.84268E+01 0.88612E+01 -0.10366E+01 | ||
1346 | + 1. 0.66697E+01 -0.76473E+00 -0.10313E+01 | ||
1347 | + 1. 0.13051E+02 -0.85369E+01 -0.10264E+01 | ||
1348 | + 1. -0.82151E+01 0.13222E+02 -0.10159E+01 | ||
1349 | + 1. -0.24579E+01 0.13478E+02 -0.10083E+01 | ||
1350 | + 1. 0.10139E+02 0.54854E+01 -0.10062E+01 | ||
1351 | + 1. -0.10820E+02 0.84131E+01 -0.99655E+00 | ||
1352 | + 1. 0.37696E+01 0.19595E+02 -0.98742E+00 | ||
1353 | + 1. 0.33643E+01 0.11176E+02 -0.98219E+00 | ||
1354 | + 1. 0.45778E+01 -0.14061E+02 -0.97710E+00 | ||
1355 | + 1. 0.42068E+01 0.41049E+01 -0.96992E+00 | ||
1356 | + 1. -0.24250E+01 -0.36394E+01 -0.96204E+00 | ||
1357 | + 1. -0.19189E+02 -0.53520E+01 -0.95752E+00 | ||
1358 | + 1. -0.41403E+01 -0.25622E+01 -0.95108E+00 | ||
1359 | + 1. -0.83570E+01 -0.80208E+01 -0.94279E+00 | ||
1360 | + 1. -0.13596E+02 0.22226E+01 -0.93392E+00 | ||
1361 | + 1. 0.55176E+01 -0.16975E+02 -0.93197E+00 | ||
1362 | + 1. -0.13737E+02 -0.94448E+01 -0.92252E+00 | ||
1363 | + 1. 0.98267E+01 -0.15623E+02 -0.91429E+00 | ||
1364 | + 1. 0.64507E+01 0.12067E+02 -0.91002E+00 | ||
1365 | + 1. 0.83904E+01 0.13274E+01 -0.90447E+00 | ||
1366 | + 1. -0.59027E+01 0.76663E+01 -0.89713E+00 | ||
1367 | + 1. 0.84773E+01 -0.11921E+02 -0.88689E+00 | ||
1368 | + 1. 0.14109E+02 -0.30673E+01 -0.88273E+00 | ||
1369 | + 1. 0.50128E+01 -0.81358E+01 -0.87672E+00 | ||
1370 | + 1. 0.13107E+02 0.51292E+01 -0.87199E+00 | ||
1371 | + 1. -0.40023E+01 -0.14374E+02 -0.86044E+00 | ||
1372 | + 1. 0.12632E+01 -0.11434E+01 -0.85353E+00 | ||
1373 | + 1. -0.15468E+02 0.63206E+01 -0.85088E+00 | ||
1374 | + 1. 0.60641E+01 -0.12368E+02 -0.84664E+00 | ||
1375 | + 1. 0.77003E+01 0.16939E+02 -0.83994E+00 | ||
1376 | + 1. 0.64362E+01 0.33544E+01 -0.83265E+00 | ||
1377 | + 1. -0.31456E+00 -0.16663E+02 -0.82594E+00 | ||
1378 | + 1. 0.11836E+02 0.11674E+02 -0.81415E+00 | ||
1379 | + 1. -0.27845E+01 0.10935E+01 -0.80757E+00 | ||
1380 | + 1. 0.34565E+01 -0.40830E+01 -0.80624E+00 | ||
1381 | + 1. -0.18711E+02 0.48534E+01 -0.79693E+00 | ||
1382 | + 1. -0.63282E+01 0.47967E+01 -0.78797E+00 | ||
1383 | + 1. -0.14546E+02 -0.13629E+02 -0.78543E+00 | ||
1384 | + 1. 0.26467E+01 0.84305E+01 -0.77744E+00 | ||
1385 | + 1. -0.10424E+02 -0.97034E+01 -0.77125E+00 | ||
1386 | + 1. -0.11819E+02 -0.22091E+01 -0.76263E+00 | ||
1387 | + 1. -0.93974E+01 -0.15552E+02 -0.75761E+00 | ||
1388 | + 1. 0.89241E+01 -0.81866E+01 -0.75318E+00 | ||
1389 | + 1. -0.11848E+02 0.53271E+01 -0.74388E+00 | ||
1390 | + 1. 0.17464E+02 0.84898E+01 -0.73690E+00 | ||
1391 | + 1. -0.56967E+01 -0.72015E+01 -0.72934E+00 | ||
1392 | + 1. -0.15869E+02 -0.16874E+01 -0.72483E+00 | ||
1393 | + 1. 0.41523E+01 -0.10263E+02 -0.71914E+00 | ||
1394 | + 1. 0.21018E+01 -0.12667E+02 -0.70693E+00 | ||
1395 | + 1. -0.99451E+01 0.11244E+02 -0.70197E+00 | ||
1396 | + 1. -0.11403E+02 -0.11469E+02 -0.69944E+00 | ||
1397 | + 1. -0.55147E+01 -0.10061E+02 -0.68674E+00 | ||
1398 | + 1. -0.49959E+00 0.87712E+01 -0.68084E+00 | ||
1399 | + 1. -0.17772E+02 0.89625E+01 -0.67793E+00 | ||
1400 | + 1. 0.14707E+02 0.21098E+01 -0.66825E+00 | ||
1401 | + 1. 0.96653E+01 -0.53916E+01 -0.66188E+00 | ||
1402 | + 1. 0.10934E+02 0.23993E+01 -0.65943E+00 | ||
1403 | + 1. 0.71875E+01 0.63998E+01 -0.65224E+00 | ||
1404 | + 1. -0.68596E+01 -0.47983E+01 -0.64465E+00 | ||
1405 | + 1. -0.40821E+00 -0.48718E+01 -0.63668E+00 | ||
1406 | + 1. 0.93179E+01 0.15728E+02 -0.62706E+00 | ||
1407 | + 1. -0.41618E+01 0.10437E+02 -0.62334E+00 | ||
1408 | + 1. -0.16884E+02 -0.77650E+01 -0.61493E+00 | ||
1409 | + 1. 0.13821E+01 0.14694E+02 -0.60875E+00 | ||
1410 | + 1. 0.22953E+01 -0.17769E+02 -0.60564E+00 | ||
1411 | + 1. 0.19924E+02 -0.68720E+00 -0.59637E+00 | ||
1412 | + 1. 0.54482E+01 0.15558E+02 -0.59106E+00 | ||
1413 | + 1. -0.38492E+01 -0.19055E+02 -0.58393E+00 | ||
1414 | + 1. 0.17236E+01 -0.80640E+01 -0.57762E+00 | ||
1415 | + 1. -0.18906E+02 0.19775E+01 -0.57165E+00 | ||
1416 | + 1. 0.91243E+01 -0.55956E+00 -0.56029E+00 | ||
1417 | + 1. 0.65017E+01 0.83231E+01 -0.55455E+00 | ||
1418 | + 1. 0.64712E+01 -0.51713E+01 -0.55116E+00 | ||
1419 | + 1. -0.69816E+01 -0.15772E+02 -0.54068E+00 | ||
1420 | + 1. -0.23406E+01 -0.13005E+02 -0.53902E+00 | ||
1421 | + 1. -0.10981E+02 -0.67026E+01 -0.52923E+00 | ||
1422 | + 1. -0.24876E+01 0.46774E+01 -0.52269E+00 | ||
1423 | + 1. -0.92122E+00 0.19541E+02 -0.51594E+00 | ||
1424 | + 1. 0.10172E+02 0.74345E+01 -0.51126E+00 | ||
1425 | + 1. 0.18636E+02 -0.70323E+01 -0.50284E+00 | ||
1426 | + 1. -0.30790E+01 0.18058E+02 -0.49919E+00 | ||
1427 | + 1. -0.15989E+02 -0.11512E+02 -0.48671E+00 | ||
1428 | + 1. 0.10549E+01 0.10875E+02 -0.48443E+00 | ||
1429 | + 1. -0.16188E+01 -0.19864E+02 -0.47625E+00 | ||
1430 | + 1. 0.11118E+02 0.98138E+01 -0.46843E+00 | ||
1431 | + 1. -0.12952E+02 -0.37376E+00 -0.46620E+00 | ||
1432 | + 1. 0.69531E+01 -0.18449E+02 -0.45521E+00 | ||
1433 | + 1. -0.17265E+02 -0.98187E+01 -0.44970E+00 | ||
1434 | + 1. -0.41877E+01 -0.46531E+00 -0.44117E+00 | ||
1435 | + 1. -0.12208E+02 0.12205E+02 -0.43914E+00 | ||
1436 | + 1. -0.95536E+01 -0.17536E+02 -0.42876E+00 | ||
1437 | + 1. -0.96184E+01 0.27661E+01 -0.42355E+00 | ||
1438 | + 1. -0.40804E+01 0.32477E+01 -0.41590E+00 | ||
1439 | + 1. 0.19123E+02 -0.38051E+01 -0.40843E+00 | ||
1440 | + 1. -0.82307E+01 -0.12733E+01 -0.40559E+00 | ||
1441 | + 1. -0.16944E+02 0.34875E+01 -0.39543E+00 | ||
1442 | + 1. -0.74559E+01 0.28851E+01 -0.39258E+00 | ||
1443 | + 1. -0.19947E+02 -0.13942E+01 -0.38307E+00 | ||
1444 | + 1. 0.15718E+02 0.96288E+01 -0.37679E+00 | ||
1445 | + 1. 0.18309E+02 0.27444E+01 -0.37078E+00 | ||
1446 | + 1. -0.14797E+02 -0.77365E+01 -0.36068E+00 | ||
1447 | + 1. 0.12426E+02 0.15459E+02 -0.35622E+00 | ||
1448 | + 1. -0.56955E+01 0.17340E+02 -0.35237E+00 | ||
1449 | + 1. 0.16237E+02 0.11567E+02 -0.34018E+00 | ||
1450 | + 1. 0.37607E+00 -0.19833E+02 -0.33349E+00 | ||
1451 | + 1. -0.77789E+01 0.63598E+01 -0.32705E+00 | ||
1452 | + 1. 0.14337E+01 -0.37201E+01 -0.32518E+00 | ||
1453 | + 1. 0.10217E+02 0.12781E+02 -0.31660E+00 | ||
1454 | + 1. -0.16956E+02 -0.41970E+01 -0.31187E+00 | ||
1455 | + 1. 0.18164E+01 0.54453E+01 -0.30476E+00 | ||
1456 | + 1. 0.19587E+01 -0.15552E+02 -0.29737E+00 | ||
1457 | + 1. 0.80261E+00 -0.10614E+02 -0.29068E+00 | ||
1458 | + 1. -0.16574E+02 0.81301E+00 -0.28259E+00 | ||
1459 | + 1. 0.35473E+01 0.14216E+02 -0.27542E+00 | ||
1460 | + 1. -0.41506E+00 -0.14667E+02 -0.27217E+00 | ||
1461 | + 1. -0.30350E+01 -0.84992E+01 -0.26332E+00 | ||
1462 | + 1. 0.65598E+01 -0.31484E+01 -0.25465E+00 | ||
1463 | + 1. -0.83455E+01 -0.34022E+01 -0.24824E+00 | ||
1464 | + 1. 0.81343E+01 0.10994E+02 -0.24433E+00 | ||
1465 | + 1. 0.14308E+02 -0.10496E+02 -0.23746E+00 | ||
1466 | + 1. -0.84384E+00 -0.17046E+01 -0.22911E+00 | ||
1467 | + 1. -0.11426E+02 -0.13918E+02 -0.22655E+00 | ||
1468 | + 1. 0.17229E+02 -0.99238E+01 -0.21648E+00 | ||
1469 | + 1. 0.48868E+01 0.17789E+02 -0.21168E+00 | ||
1470 | + 1. -0.99811E+01 0.41277E+00 -0.20349E+00 | ||
1471 | + 1. -0.83421E-01 0.16573E+02 -0.19493E+00 | ||
1472 | + 1. 0.19926E+02 0.15267E+01 -0.18691E+00 | ||
1473 | + 1. -0.14090E+02 0.13048E+02 -0.18632E+00 | ||
1474 | + 1. -0.82683E+01 0.10086E+02 -0.17994E+00 | ||
1475 | + 1. -0.13232E+02 -0.12089E+02 -0.17027E+00 | ||
1476 | + 1. 0.67067E+01 -0.14667E+02 -0.16349E+00 | ||
1477 | + 1. -0.56522E+01 -0.17465E+02 -0.15818E+00 | ||
1478 | + 1. -0.37376E+01 0.14767E+02 -0.14780E+00 | ||
1479 | + 1. -0.18404E+02 0.69140E+01 -0.14586E+00 | ||
1480 | + 1. 0.13808E+02 0.13032E+02 -0.13808E+00 | ||
1481 | + 1. 0.12920E+02 0.77095E+00 -0.13332E+00 | ||
1482 | + 1. 0.11166E+02 -0.79063E+01 -0.12188E+00 | ||
1483 | + 1. 0.11712E+02 -0.22519E+01 -0.11345E+00 | ||
1484 | + 1. -0.99683E+01 0.15389E+02 -0.11155E+00 | ||
1485 | + 1. 0.29411E+01 -0.31446E+00 -0.10330E+00 | ||
1486 | + 1. -0.17833E+02 -0.21032E+01 -0.96015E-01 | ||
1487 | + 1. -0.43016E+01 0.12636E+02 -0.92979E-01 | ||
1488 | + 1. -0.93134E+01 -0.54113E+01 -0.83324E-01 | ||
1489 | + 1. 0.16910E+01 0.32271E+01 -0.78401E-01 | ||
1490 | + 1. -0.68112E+00 0.12961E+01 -0.67867E-01 | ||
1491 | + 1. 0.12726E+02 -0.15139E+02 -0.64059E-01 | ||
1492 | + 1. -0.41427E+01 -0.48671E+01 -0.57850E-01 | ||
1493 | + 1. 0.75879E+01 -0.67789E+01 -0.51261E-01 | ||
1494 | + 1. 0.56460E+01 0.10182E+02 -0.43949E-01 | ||
1495 | + 1. 0.14026E+01 0.17923E+02 -0.39997E-01 | ||
1496 | + 1. 0.40139E+01 -0.19535E+02 -0.30328E-01 | ||
1497 | + 1. -0.12492E+02 0.74426E+01 -0.25239E-01 | ||
1498 | + 1. -0.99543E+01 0.48661E+01 -0.13476E-01 | ||
1499 | + 1. -0.78053E+00 -0.89605E+01 -0.10096E-01 | ||
1500 | + 1. 0.14702E+02 0.63516E+01 -0.53276E-02 | ||
1501 | + 1. 0.14684E+02 0.40336E+01 0.47004E-02 | ||
1502 | + 1. -0.64731E+01 0.14469E+02 0.95324E-02 | ||
1503 | + 1. -0.26692E+01 -0.10803E+02 0.14102E-01 | ||
1504 | + 1. 0.16602E+02 -0.60727E+01 0.26419E-01 | ||
1505 | + 1. 0.41675E+01 -0.12357E+02 0.28076E-01 | ||
1506 | + 1. 0.16387E+02 -0.16681E+01 0.36083E-01 | ||
1507 | + 1. 0.56278E+01 0.51874E+01 0.42367E-01 | ||
1508 | + 1. -0.66936E+01 -0.12553E+02 0.49625E-01 | ||
1509 | + 1. 0.18893E+02 0.49731E+01 0.56476E-01 | ||
1510 | + 1. 0.70405E+01 -0.96728E+01 0.62090E-01 | ||
1511 | + 1. -0.12676E+02 -0.76622E+01 0.73267E-01 | ||
1512 | + 1. 0.84926E+01 -0.17141E+02 0.77894E-01 | ||
1513 | + 1. -0.11639E+02 0.32626E+01 0.81661E-01 | ||
1514 | + 1. 0.17446E+02 0.63670E+01 0.87488E-01 | ||
1515 | + 1. 0.96043E+01 -0.10586E+02 0.98967E-01 | ||
1516 | + 1. 0.15326E+02 -0.12850E+02 0.10291E+00 | ||
1517 | + 1. 0.84668E+01 -0.38188E+01 0.10984E+00 | ||
1518 | + 1. -0.11203E+02 -0.39994E+01 0.11343E+00 | ||
1519 | + 1. 0.11963E+02 -0.13209E+02 0.12504E+00 | ||
1520 | + 1. -0.20386E+01 -0.57926E+01 0.13234E+00 | ||
1521 | + 1. 0.13374E+02 -0.56184E+01 0.13704E+00 | ||
1522 | + 1. -0.16889E+02 0.10610E+02 0.14223E+00 | ||
1523 | + 1. -0.13670E+02 0.56278E+01 0.14756E+00 | ||
1524 | + 1. 0.15705E+02 -0.86737E+01 0.15694E+00 | ||
1525 | + 1. -0.13724E+02 -0.39707E+01 0.16039E+00 | ||
1526 | + 1. 0.52382E+01 -0.39454E-01 0.17121E+00 | ||
1527 | + 1. 0.45448E+01 0.84802E+01 0.17757E+00 | ||
1528 | + 1. 0.16772E+02 0.10398E+01 0.18059E+00 | ||
1529 | + 1. 0.46765E+01 0.12161E+02 0.19258E+00 | ||
1530 | + 1. -0.12540E+02 0.14651E+02 0.19906E+00 | ||
1531 | + 1. -0.47360E+01 0.59210E+01 0.20148E+00 | ||
1532 | + 1. -0.11889E+01 0.12338E+02 0.20903E+00 | ||
1533 | + 1. -0.14397E+02 0.10859E+02 0.21533E+00 | ||
1534 | + 1. 0.11186E+02 0.41827E+01 0.22469E+00 | ||
1535 | + 1. 0.82061E+01 0.31823E+01 0.23281E+00 | ||
1536 | + 1. 0.13308E+02 0.10083E+02 0.23735E+00 | ||
1537 | + 1. -0.83480E+01 -0.97235E+01 0.24258E+00 | ||
1538 | + 1. -0.20571E+01 0.27983E+01 0.25096E+00 | ||
1539 | + 1. 0.11968E+02 0.79430E+01 0.25709E+00 | ||
1540 | + 1. -0.10474E+01 0.14338E+02 0.26271E+00 | ||
1541 | + 1. -0.23850E+01 0.90014E+01 0.27076E+00 | ||
1542 | + 1. -0.11748E+02 0.10275E+02 0.27330E+00 | ||
1543 | + 1. -0.53517E+01 0.13677E+01 0.28483E+00 | ||
1544 | + 1. 0.32592E+01 -0.69261E+01 0.28781E+00 | ||
1545 | + 1. -0.16411E+02 0.78020E+01 0.29849E+00 | ||
1546 | + 1. 0.11412E+01 -0.62580E+01 0.30330E+00 | ||
1547 | + 1. -0.15875E+02 -0.60014E+01 0.30698E+00 | ||
1548 | + 1. 0.10602E+02 0.58315E+00 0.31364E+00 | ||
1549 | + 1. -0.34922E+01 -0.16027E+02 0.32257E+00 | ||
1550 | + 1. -0.11390E+02 -0.16224E+02 0.33084E+00 | ||
1551 | + 1. 0.39195E+01 -0.16738E+02 0.33552E+00 | ||
1552 | + 1. -0.10326E+02 0.12999E+02 0.34264E+00 | ||
1553 | + 1. 0.73779E+01 0.15300E+02 0.35101E+00 | ||
1554 | + 1. -0.55932E+01 -0.14645E+02 0.35578E+00 | ||
1555 | + 1. -0.14737E+02 0.33560E+01 0.36240E+00 | ||
1556 | + 1. -0.60505E+01 -0.15094E+01 0.36755E+00 | ||
1557 | + 1. 0.36236E+01 0.66112E+01 0.37732E+00 | ||
1558 | + 1. 0.16798E+00 -0.12608E+02 0.38247E+00 | ||
1559 | + 1. 0.72871E+01 0.18490E+02 0.38790E+00 | ||
1560 | + 1. 0.16714E+02 0.43102E+01 0.39731E+00 | ||
1561 | + 1. 0.37126E+01 -0.23776E+01 0.40403E+00 | ||
1562 | + 1. -0.61330E+01 0.94868E+01 0.41019E+00 | ||
1563 | + 1. -0.76002E+01 -0.18203E+02 0.41765E+00 | ||
1564 | + 1. -0.63071E+01 0.12468E+02 0.42348E+00 | ||
1565 | + 1. -0.18381E+02 -0.68252E+01 0.43028E+00 | ||
1566 | + 1. 0.10681E+02 0.16787E+02 0.43453E+00 | ||
1567 | + 1. -0.19613E+02 -0.36885E+01 0.44030E+00 | ||
1568 | + 1. -0.32458E+00 0.55653E+01 0.44869E+00 | ||
1569 | + 1. 0.99011E+01 -0.13864E+02 0.45427E+00 | ||
1570 | + 1. 0.15091E+02 -0.44620E+01 0.46212E+00 | ||
1571 | + 1. -0.19899E+02 0.46211E+00 0.46907E+00 | ||
1572 | + 1. -0.10583E+01 -0.17987E+02 0.47645E+00 | ||
1573 | + 1. -0.99373E+01 -0.20810E+01 0.48502E+00 | ||
1574 | + 1. 0.42519E+01 0.26895E+01 0.49092E+00 | ||
1575 | + 1. -0.12426E+02 -0.56166E+01 0.49592E+00 | ||
1576 | + 1. 0.96419E+01 -0.22406E+01 0.50543E+00 | ||
1577 | + 1. 0.11276E+02 -0.49564E+01 0.51254E+00 | ||
1578 | + 1. -0.43035E+01 0.82712E+01 0.51951E+00 | ||
1579 | + 1. 0.87562E+01 0.57190E+01 0.52255E+00 | ||
1580 | + 1. -0.98103E+01 -0.80439E+01 0.52973E+00 | ||
1581 | + 1. 0.93003E+00 0.78673E+01 0.53374E+00 | ||
1582 | + 1. 0.17197E+02 -0.40408E+01 0.54489E+00 | ||
1583 | + 1. -0.76030E+01 -0.63109E+01 0.54785E+00 | ||
1584 | + 1. -0.19658E+01 0.16518E+02 0.55657E+00 | ||
1585 | + 1. -0.77571E+01 0.15939E+02 0.56500E+00 | ||
1586 | + 1. -0.47939E+01 -0.12097E+02 0.57170E+00 | ||
1587 | + 1. -0.96747E+01 0.69260E+01 0.57331E+00 | ||
1588 | + 1. 0.25352E+01 -0.99273E+01 0.58339E+00 | ||
1589 | + 1. -0.77733E+01 0.18056E+02 0.58819E+00 | ||
1590 | + 1. 0.10591E+02 -0.16850E+02 0.59576E+00 | ||
1591 | + 1. 0.69011E+01 0.13546E+01 0.60206E+00 | ||
1592 | + 1. -0.49182E+01 -0.85008E+01 0.61193E+00 | ||
1593 | + 1. 0.85278E+01 0.13440E+02 0.61435E+00 | ||
1594 | + 1. 0.18312E+02 -0.14200E+01 0.62641E+00 | ||
1595 | + 1. -0.14728E+02 0.64829E+00 0.63167E+00 | ||
1596 | + 1. 0.20568E+01 0.19765E+02 0.63357E+00 | ||
1597 | + 1. -0.14391E+02 -0.14058E+01 0.64521E+00 | ||
1598 | + 1. -0.93148E+01 -0.13763E+02 0.65280E+00 | ||
1599 | + 1. -0.57821E+01 0.19136E+02 0.65763E+00 | ||
1600 | + 1. 0.82697E+01 0.76702E+01 0.66629E+00 | ||
1601 | + 1. 0.10761E+01 0.39150E+00 0.67038E+00 | ||
1602 | + 1. 0.47870E+01 -0.47635E+01 0.67600E+00 | ||
1603 | + 1. 0.17081E+01 0.13021E+02 0.68262E+00 | ||
1604 | + 1. 0.12251E+02 -0.96847E+01 0.68914E+00 | ||
1605 | + 1. -0.19579E+02 0.34247E+01 0.69628E+00 | ||
1606 | + 1. -0.15279E+02 -0.96918E+01 0.70511E+00 | ||
1607 | + 1. -0.17988E+01 0.70343E+01 0.71293E+00 | ||
1608 | + 1. -0.76158E+01 0.90402E+00 0.71591E+00 | ||
1609 | + 1. -0.13343E+02 -0.14286E+02 0.72559E+00 | ||
1610 | + 1. -0.77009E+01 0.45528E+01 0.73123E+00 | ||
1611 | + 1. -0.11897E+02 -0.96075E+01 0.73896E+00 | ||
1612 | + 1. 0.13877E+02 -0.79018E+01 0.74452E+00 | ||
1613 | + 1. -0.17147E+02 0.51800E+01 0.74926E+00 | ||
1614 | + 1. 0.76375E+01 -0.92609E+00 0.75732E+00 | ||
1615 | + 1. 0.13576E+02 -0.13376E+01 0.76306E+00 | ||
1616 | + 1. -0.27824E+01 -0.23441E+01 0.76765E+00 | ||
1617 | + 1. 0.71138E+01 -0.11667E+02 0.77511E+00 | ||
1618 | + 1. 0.19086E+02 -0.54367E+01 0.78346E+00 | ||
1619 | + 1. -0.52939E+00 0.10322E+02 0.79140E+00 | ||
1620 | + 1. 0.21300E+01 -0.19440E+02 0.79403E+00 | ||
1621 | + 1. 0.30733E+01 0.10226E+02 0.80210E+00 | ||
1622 | + 1. -0.54885E+01 -0.35066E+01 0.81181E+00 | ||
1623 | + 1. 0.94158E+01 0.93509E+01 0.81756E+00 | ||
1624 | + 1. -0.39287E+01 0.16802E+02 0.82515E+00 | ||
1625 | + 1. -0.24279E+01 -0.11650E+00 0.82947E+00 | ||
1626 | + 1. -0.84699E+01 0.12344E+02 0.83856E+00 | ||
1627 | + 1. 0.36541E+01 0.15887E+02 0.84347E+00 | ||
1628 | + 1. -0.24727E+01 0.19486E+02 0.84804E+00 | ||
1629 | + 1. -0.99432E+01 -0.11857E+02 0.85713E+00 | ||
1630 | + 1. 0.29110E+01 -0.13692E+02 0.86305E+00 | ||
1631 | + 1. -0.85051E+01 -0.16421E+02 0.87231E+00 | ||
1632 | + 1. 0.12330E+02 0.24014E+01 0.87905E+00 | ||
1633 | + 1. -0.78797E+00 -0.34643E+01 0.88183E+00 | ||
1634 | + 1. -0.15572E+02 -0.31422E+01 0.89276E+00 | ||
1635 | + 1. -0.14138E+02 0.88907E+01 0.89556E+00 | ||
1636 | + 1. 0.12109E+02 0.59059E+01 0.90206E+00 | ||
1637 | + 1. 0.17329E+02 0.97619E+01 0.91131E+00 | ||
1638 | + 1. -0.23017E+01 -0.14390E+02 0.91385E+00 | ||
1639 | + 1. -0.98075E+01 0.93410E+01 0.92630E+00 | ||
1640 | + 1. 0.56942E+01 -0.70238E+01 0.93288E+00 | ||
1641 | + 1. 0.43256E+01 -0.86887E+01 0.93642E+00 | ||
1642 | + 1. -0.11443E+02 -0.64201E+00 0.94258E+00 | ||
1643 | + 1. -0.56014E+01 0.34083E+01 0.94874E+00 | ||
1644 | + 1. 0.15753E+02 0.78257E+01 0.95518E+00 | ||
1645 | + 1. -0.11281E+02 0.16499E+02 0.96655E+00 | ||
1646 | + 1. -0.54511E+01 -0.19167E+02 0.96988E+00 | ||
1647 | + 1. 0.14935E+02 0.58566E+00 0.97460E+00 | ||
1648 | + 1. 0.11784E+02 0.13020E+02 0.98134E+00 | ||
1649 | + 1. 0.65673E+01 0.13147E+02 0.98825E+00 | ||
1650 | + 1. 0.56804E+01 -0.17762E+02 0.99900E+00 | ||
1651 | + 1. -0.17999E+02 0.13659E+00 0.10065E+01 | ||
1652 | + 1. -0.78856E+01 0.81557E+01 0.10088E+01 | ||
1653 | + 1. 0.95583E+01 -0.65313E+01 0.10147E+01 | ||
1654 | + 1. -0.25175E+01 0.11051E+02 0.10211E+01 | ||
1655 | + 1. 0.15930E+02 -0.11032E+02 0.10324E+01 | ||
1656 | + 1. -0.17718E+02 0.22984E+01 0.10383E+01 | ||
1657 | + 1. 0.46983E+00 -0.16496E+02 0.10409E+01 | ||
1658 | + 1. 0.50458E+01 -0.14813E+02 0.10469E+01 | ||
1659 | + 1. -0.64371E+01 -0.10822E+02 0.10540E+01 | ||
1660 | + 1. -0.54238E+01 -0.63352E+01 0.10631E+01 | ||
1661 | + 1. 0.69438E+00 -0.15534E+01 0.10710E+01 | ||
1662 | + 1. -0.14929E+02 -0.12558E+02 0.10792E+01 | ||
1663 | + 1. -0.12029E+02 0.15196E+01 0.10853E+01 | ||
1664 | + 1. 0.34185E+01 0.47143E+01 0.10900E+01 | ||
1665 | + 1. 0.14771E+02 0.11376E+02 0.10988E+01 | ||
1666 | + 1. 0.62356E+01 0.16805E+02 0.11009E+01 | ||
1667 | + 1. -0.15569E+02 0.12364E+02 0.11113E+01 | ||
1668 | + 1. 0.87100E+01 0.17163E+02 0.11165E+01 | ||
1669 | + 1. 0.24450E+01 -0.46926E+01 0.11262E+01 | ||
1670 | + 1. -0.31581E+00 0.18132E+02 0.11310E+01 | ||
1671 | + 1. 0.88008E+01 -0.89787E+01 0.11397E+01 | ||
1672 | + 1. 0.79135E+01 -0.13611E+02 0.11428E+01 | ||
1673 | + 1. 0.60332E+01 0.33627E+01 0.11525E+01 | ||
1674 | + 1. -0.38089E+01 -0.17881E+02 0.11595E+01 | ||
1675 | + 1. 0.49042E+01 -0.10614E+02 0.11624E+01 | ||
1676 | + 1. 0.12918E+02 -0.36282E+01 0.11676E+01 | ||
1677 | + 1. 0.26228E+01 0.16562E+01 0.11736E+01 | ||
1678 | + 1. 0.37839E+01 0.18748E+02 0.11836E+01 | ||
1679 | + 1. -0.16309E+02 -0.11938E+01 0.11882E+01 | ||
1680 | + 1. -0.49425E+01 0.10941E+02 0.11960E+01 | ||
1681 | + 1. 0.19805E+02 -0.26366E+01 0.12049E+01 | ||
1682 | + 1. -0.34991E+01 -0.68905E+01 0.12090E+01 | ||
1683 | + 1. 0.16159E+01 0.15915E+02 0.12181E+01 | ||
1684 | + 1. 0.71639E+01 -0.16149E+02 0.12221E+01 | ||
1685 | + 1. 0.13461E+02 0.14559E+02 0.12326E+01 | ||
1686 | + 1. 0.49150E+01 0.14292E+02 0.12358E+01 | ||
1687 | + 1. 0.17331E+02 -0.77288E+01 0.12429E+01 | ||
1688 | + 1. -0.11464E+02 0.56796E+01 0.12525E+01 | ||
1689 | + 1. 0.72258E+01 0.96775E+01 0.12554E+01 | ||
1690 | + 1. -0.57305E+01 0.15956E+02 0.12654E+01 | ||
1691 | + 1. 0.13142E+02 -0.11891E+02 0.12732E+01 | ||
1692 | + 1. 0.19154E+02 0.36278E+00 0.12783E+01 | ||
1693 | + 1. 0.99251E+01 0.22224E+01 0.12850E+01 | ||
1694 | + 1. -0.73325E+01 -0.83213E+01 0.12920E+01 | ||
1695 | + 1. 0.10015E+02 0.14660E+02 0.12959E+01 | ||
1696 | + 1. 0.13947E+02 -0.14338E+02 0.13037E+01 | ||
1697 | + 1. -0.93093E+01 0.16981E+02 0.13082E+01 | ||
1698 | + 1. 0.18377E+02 0.76569E+01 0.13149E+01 | ||
1699 | + 1. -0.10035E+01 -0.11205E+02 0.13263E+01 | ||
1700 | + 1. -0.37092E+01 0.22726E+01 0.13315E+01 | ||
1701 | + 1. 0.27230E+01 0.82708E+01 0.13399E+01 | ||
1702 | + 1. 0.64214E+01 0.71747E+01 0.13445E+01 | ||
1703 | + 1. -0.99934E+01 0.17796E+01 0.13495E+01 | ||
1704 | + 1. -0.14186E+02 -0.62746E+01 0.13574E+01 | ||
1705 | + 1. 0.20980E+01 -0.11830E+02 0.13626E+01 | ||
1706 | + 1. 0.10811E+02 0.11201E+02 0.13695E+01 | ||
1707 | + 1. -0.30741E+01 0.56367E+01 0.13734E+01 | ||
1708 | + 1. -0.12159E+02 -0.27735E+01 0.13858E+01 | ||
1709 | + 1. -0.28163E+01 0.13779E+02 0.13903E+01 | ||
1710 | + 1. 0.12134E+02 -0.69284E+01 0.13964E+01 | ||
1711 | + 1. 0.14227E+01 -0.82672E+01 0.14002E+01 | ||
1712 | + 1. 0.43870E+00 0.25745E+01 0.14111E+01 | ||
1713 | + 1. -0.15291E+02 0.62942E+01 0.14175E+01 | ||
1714 | + 1. 0.15135E+02 -0.24375E+01 0.14210E+01 | ||
1715 | + 1. 0.55007E+01 -0.22459E+01 0.14268E+01 | ||
1716 | + 1. 0.68673E+01 -0.53113E+01 0.14375E+01 | ||
1717 | + 1. 0.19285E+02 0.30074E+01 0.14430E+01 | ||
1718 | + 1. -0.16757E+02 -0.83185E+01 0.14527E+01 | ||
1719 | + 1. 0.91503E+01 -0.15505E+02 0.14546E+01 | ||
1720 | + 1. 0.15815E+02 0.24880E+01 0.14623E+01 | ||
1721 | + 1. -0.19501E+01 -0.82840E+01 0.14682E+01 | ||
1722 | + 1. -0.19047E+02 -0.18416E+01 0.14775E+01 | ||
1723 | + 1. -0.12054E+02 -0.12059E+02 0.14848E+01 | ||
1724 | + 1. 0.57592E+01 -0.12983E+02 0.14907E+01 | ||
1725 | + 1. -0.12987E+02 0.37027E+01 0.14936E+01 | ||
1726 | + 1. -0.11983E+02 0.86789E+01 0.15031E+01 | ||
1727 | + 1. -0.17574E+02 -0.51030E+01 0.15132E+01 | ||
1728 | + 1. -0.12726E+02 0.11681E+02 0.15169E+01 | ||
1729 | + 1. -0.41805E+01 -0.13748E+02 0.15211E+01 | ||
1730 | + 1. -0.90869E+01 0.14625E+02 0.15267E+01 | ||
1731 | + 1. -0.16551E+02 -0.11091E+02 0.15350E+01 | ||
1732 | + 1. -0.88997E+01 -0.46846E+00 0.15461E+01 | ||
1733 | + 1. -0.14852E+01 -0.16223E+02 0.15490E+01 | ||
1734 | + 1. 0.13469E+02 0.76462E+01 0.15574E+01 | ||
1735 | + 1. -0.55261E+01 -0.16406E+02 0.15645E+01 | ||
1736 | + 1. 0.99083E+01 -0.12043E+02 0.15680E+01 | ||
1737 | + 1. -0.67586E+01 0.62549E+01 0.15752E+01 | ||
1738 | + 1. -0.91701E+01 -0.36830E+01 0.15860E+01 | ||
1739 | + 1. 0.11841E+02 -0.60123E+00 0.15932E+01 | ||
1740 | + 1. -0.37880E+01 -0.10046E+02 0.15939E+01 | ||
1741 | + 1. -0.45807E+01 -0.14216E+00 0.16047E+01 | ||
1742 | + 1. 0.81308E+00 -0.14388E+02 0.16110E+01 | ||
1743 | + 1. -0.73735E+01 0.10761E+02 0.16192E+01 | ||
1744 | + 1. -0.10763E+02 -0.65571E+01 0.16228E+01 | ||
1745 | + 1. -0.19102E+02 0.56933E+01 0.16281E+01 | ||
1746 | + 1. 0.23160E+01 -0.16003E+02 0.16351E+01 | ||
1747 | + 1. -0.29761E+01 -0.48063E+01 0.16414E+01 | ||
1748 | + 1. -0.17747E+02 0.84244E+01 0.16521E+01 | ||
1749 | + 1. 0.14044E+02 0.51623E+01 0.16543E+01 | ||
1750 | + 1. -0.67271E+00 -0.65840E+01 0.16619E+01 | ||
1751 | + 1. -0.27556E+01 -0.19720E+02 0.16690E+01 | ||
1752 | + 1. 0.35141E+00 -0.18987E+02 0.16755E+01 | ||
1753 | + 1. -0.71019E+01 -0.13749E+02 0.16811E+01 | ||
1754 | + 1. -0.15064E+01 0.43280E+01 0.16894E+01 | ||
1755 | + 1. 0.11589E+02 -0.15148E+02 0.16980E+01 | ||
1756 | + 1. -0.10419E+02 0.11366E+02 0.17046E+01 | ||
1757 | + 1. 0.20803E+01 0.60973E+01 0.17093E+01 | ||
1758 | + 1. 0.10244E+02 0.74750E+01 0.17177E+01 | ||
1759 | + 1. 0.16191E+02 0.58225E+01 0.17257E+01 | ||
1760 | + 1. 0.14648E+02 -0.60433E+01 0.17288E+01 | ||
1761 | + 1. 0.12063E+02 0.94930E+01 0.17335E+01 | ||
1762 | + 1. -0.28373E+01 -0.12206E+02 0.17427E+01 | ||
1763 | + 1. -0.13534E+02 -0.10731E+02 0.17483E+01 | ||
1764 | + 1. -0.13701E+02 0.13663E+02 0.17559E+01 | ||
1765 | + 1. -0.50876E-01 0.13354E+02 0.17606E+01 | ||
1766 | + 1. -0.11385E+02 0.13918E+02 0.17710E+01 | ||
1767 | + 1. 0.95938E+01 0.42007E+01 0.17792E+01 | ||
1768 | + 1. 0.95956E+01 -0.46837E+01 0.17847E+01 | ||
1769 | + 1. 0.96835E+01 -0.41425E+00 0.17924E+01 | ||
1770 | + 1. 0.10601E+01 0.11475E+02 0.17957E+01 | ||
1771 | + 1. 0.82088E+01 0.11641E+02 0.18014E+01 | ||
1772 | + 1. 0.38578E+01 -0.26728E+00 0.18131E+01 | ||
1773 | + 1. 0.39566E+01 -0.18422E+02 0.18182E+01 | ||
1774 | + 1. -0.15971E+02 0.99680E+01 0.18233E+01 | ||
1775 | + 1. 0.17262E+02 -0.38195E-01 0.18283E+01 | ||
1776 | + 1. 0.10516E+02 -0.81615E+01 0.18398E+01 | ||
1777 | + 1. -0.99651E+01 0.37746E+01 0.18419E+01 | ||
1778 | + 1. -0.76116E+01 -0.20816E+01 0.18474E+01 | ||
1779 | + 1. -0.68471E+00 0.24914E+00 0.18563E+01 | ||
1780 | + 1. 0.58651E+01 0.11111E+02 0.18630E+01 | ||
1781 | + 1. -0.70755E+01 -0.45879E+01 0.18726E+01 | ||
1782 | + 1. -0.78266E+01 0.26593E+01 0.18754E+01 | ||
1783 | + 1. -0.58486E+01 0.13975E+02 0.18841E+01 | ||
1784 | + 1. 0.14762E+02 -0.94847E+01 0.18887E+01 | ||
1785 | + 1. 0.14626E+02 0.93362E+01 0.18980E+01 | ||
1786 | + 1. -0.10240E+02 -0.96876E+01 0.19055E+01 | ||
1787 | + 1. 0.73287E+01 0.51589E+01 0.19082E+01 | ||
1788 | + 1. -0.81457E+01 -0.11662E+02 0.19134E+01 | ||
1789 | + 1. -0.10723E+02 -0.14903E+02 0.19228E+01 | ||
1790 | + 1. -0.13279E+02 -0.82716E+01 0.19286E+01 | ||
1791 | + 1. -0.15518E+02 0.20516E+01 0.19386E+01 | ||
1792 | + 1. 0.45182E+00 0.19877E+02 0.19447E+01 | ||
1793 | + 1. 0.18141E+02 0.49964E+01 0.19506E+01 | ||
1794 | + 1. 0.41057E+01 -0.61912E+01 0.19597E+01 | ||
1795 | + 1. -0.64284E+00 0.81459E+01 0.19604E+01 | ||
1796 | + 1. 0.74624E+01 -0.73081E+01 0.19713E+01 | ||
1797 | + 1. 0.36834E+01 0.12119E+02 0.19753E+01 | ||
1798 | + 1. 0.84213E+01 -0.17775E+02 0.19826E+01 | ||
1799 | + 1. -0.17303E+02 -0.31720E+01 0.19870E+01 | ||
1800 | + 1. 0.61340E+00 -0.44335E+01 0.19989E+01 | ||
1801 | + 1. -0.13379E+02 0.64149E+01 0.20002E+01 | ||
1802 | + 1. 0.21608E+01 -0.28130E+01 0.20091E+01 | ||
1803 | + 1. 0.16741E+01 0.40584E+01 0.20198E+01 | ||
1804 | + 1. 0.76130E+01 -0.30041E+01 0.20206E+01 | ||
1805 | + 1. 0.45363E+01 0.94099E+01 0.20279E+01 | ||
1806 | + 1. 0.79086E+01 0.23602E+01 0.20396E+01 | ||
1807 | + 1. -0.10022E+02 -0.17278E+02 0.20415E+01 | ||
1808 | + 1. -0.15615E+02 0.41148E+01 0.20477E+01 | ||
1809 | + 1. 0.62576E+01 0.74038E-01 0.20568E+01 | ||
1810 | + 1. 0.17768E+02 -0.28617E+01 0.20656E+01 | ||
1811 | + 1. -0.19792E+02 0.16767E+01 0.20699E+01 | ||
1812 | + 1. -0.40597E+01 0.18756E+02 0.20743E+01 | ||
1813 | + 1. 0.11713E+02 0.16013E+02 0.20841E+01 | ||
1814 | + 1. 0.62725E+01 -0.91195E+01 0.20898E+01 | ||
1815 | + 1. 0.13013E+02 0.11660E+02 0.20935E+01 | ||
1816 | + 1. -0.87368E+00 -0.13196E+02 0.21036E+01 | ||
1817 | + 1. 0.31165E+01 0.14186E+02 0.21126E+01 | ||
1818 | + 1. 0.16579E+02 -0.51297E+01 0.21141E+01 | ||
1819 | + 1. -0.64979E+01 0.17788E+02 0.21213E+01 | ||
1820 | + 1. -0.34746E+01 0.91649E+01 0.21315E+01 | ||
1821 | + 1. -0.13866E+02 -0.36620E+01 0.21335E+01 | ||
1822 | + 1. -0.40996E+00 0.15515E+02 0.21412E+01 | ||
1823 | + 1. 0.24411E+01 0.17578E+02 0.21515E+01 | ||
1824 | + 1. -0.61170E+01 0.80648E+01 0.21547E+01 | ||
1825 | + 1. 0.14862E+02 0.13281E+02 0.21621E+01 | ||
1826 | + 1. 0.11065E+02 -0.10428E+02 0.21696E+01 | ||
1827 | + 1. -0.43434E+01 -0.22662E+01 0.21748E+01 | ||
1828 | + 1. -0.10932E+01 -0.17424E+01 0.21839E+01 | ||
1829 | + 1. -0.15141E+01 0.22118E+01 0.21916E+01 | ||
1830 | + 1. 0.98961E-01 -0.95634E+01 0.21949E+01 | ||
1831 | + 1. 0.17051E+02 -0.94867E+01 0.22034E+01 | ||
1832 | + 1. 0.48711E+01 0.60535E+01 0.22128E+01 | ||
1833 | + 1. -0.89493E+01 0.59041E+01 0.22186E+01 | ||
1834 | + 1. 0.14896E+02 -0.12457E+02 0.22259E+01 | ||
1835 | + 1. 0.13426E+02 0.13655E+01 0.22310E+01 | ||
1836 | + 1. -0.11064E+02 -0.43774E+01 0.22391E+01 | ||
1837 | + 1. 0.12188E+02 0.40600E+01 0.22444E+01 | ||
1838 | + 1. 0.11533E+02 -0.25535E+01 0.22476E+01 | ||
1839 | + 1. -0.68599E+01 -0.14743E+00 0.22539E+01 | ||
1840 | + 1. 0.54741E+01 0.18747E+02 0.22623E+01 | ||
1841 | + 1. -0.19883E+01 0.17970E+02 0.22731E+01 | ||
1842 | + 1. -0.13040E+02 0.23678E+00 0.22758E+01 | ||
1843 | + 1. -0.40738E+01 0.15378E+02 0.22845E+01 | ||
1844 | + 1. -0.86138E+01 -0.60501E+01 0.22878E+01 | ||
1845 | + 1. 0.78804E+01 0.15689E+02 0.22977E+01 | ||
1846 | + 1. 0.14115E+00 0.61610E+01 0.23007E+01 | ||
1847 | + 1. 0.16260E+02 0.10739E+02 0.23092E+01 | ||
1848 | + 1. 0.48490E+01 0.18184E+01 0.23151E+01 | ||
1849 | + 1. -0.65921E+01 -0.18126E+02 0.23213E+01 | ||
1850 | + 1. -0.41149E+01 0.12483E+02 0.23288E+01 | ||
1851 | + 1. -0.16083E+02 -0.65537E+01 0.23397E+01 | ||
1852 | + 1. 0.77332E+01 -0.10577E+02 0.23431E+01 | ||
1853 | + 1. -0.44999E+01 0.45343E+01 0.23499E+01 | ||
1854 | + 1. 0.12844E+01 -0.64655E+01 0.23588E+01 | ||
1855 | + 1. -0.12675E+01 0.11873E+02 0.23655E+01 | ||
1856 | + 1. -0.18389E+01 -0.18041E+02 0.23714E+01 | ||
1857 | + 1. 0.10845E+01 0.92539E+01 0.23748E+01 | ||
1858 | + 1. 0.74691E+01 0.18367E+02 0.23857E+01 | ||
1859 | + 1. 0.39308E+01 -0.11917E+02 0.23913E+01 | ||
1860 | + 1. -0.15241E+02 0.80387E+01 0.23955E+01 | ||
1861 | + 1. 0.50544E+01 -0.16291E+02 0.24003E+01 | ||
1862 | + 1. -0.43407E+01 0.70176E+01 0.24107E+01 | ||
1863 | + 1. -0.10434E+02 -0.18153E+01 0.24145E+01 | ||
1864 | + 1. 0.11349E+02 0.12561E+01 0.24214E+01 | ||
1865 | + 1. -0.10064E+02 0.78412E+01 0.24296E+01 | ||
1866 | + 1. -0.18592E+02 -0.66910E+01 0.24375E+01 | ||
1867 | + 1. -0.55864E+01 -0.78730E+01 0.24416E+01 | ||
1868 | + 1. -0.57615E+01 0.20131E+01 0.24482E+01 | ||
1869 | + 1. -0.17875E+02 0.38405E+01 0.24580E+01 | ||
1870 | + 1. 0.84474E+01 0.86212E+01 0.24600E+01 | ||
1871 | + 1. 0.11186E+02 -0.13335E+02 0.24685E+01 | ||
1872 | + 1. -0.55701E+01 -0.12473E+02 0.24786E+01 | ||
1873 | + 1. 0.13016E+02 -0.86189E+01 0.24805E+01 | ||
1874 | + 1. 0.19542E+01 0.18663E+00 0.24903E+01 | ||
1875 | + 1. -0.48594E+01 -0.47839E+01 0.24950E+01 | ||
1876 | + 1. 0.31858E+01 -0.81132E+01 0.25048E+01 | ||
1877 | + 1. 0.14481E+02 -0.84746E+00 0.25132E+01 | ||
1878 | + 1. 0.65496E+01 -0.18776E+02 0.25169E+01 | ||
1879 | + 1. 0.18950E+02 -0.12457E+01 0.25218E+01 | ||
1880 | + 1. -0.13383E+02 0.10000E+02 0.25303E+01 | ||
1881 | + 1. 0.95009E+01 0.13040E+02 0.25362E+01 | ||
1882 | + 1. -0.37418E+01 -0.16274E+02 0.25429E+01 | ||
1883 | + 1. -0.72772E+01 0.15518E+02 0.25482E+01 | ||
1884 | + 1. 0.53940E+01 -0.41554E+01 0.25545E+01 | ||
1885 | + 1. 0.17853E+02 0.19790E+01 0.25620E+01 | ||
1886 | + 1. -0.12593E+02 0.15500E+02 0.25690E+01 | ||
1887 | + 1. 0.11761E+02 -0.52701E+01 0.25755E+01 | ||
1888 | + 1. -0.13327E+02 -0.13437E+02 0.25835E+01 | ||
1889 | + 1. -0.19452E+02 -0.43408E+01 0.25932E+01 | ||
1890 | + 1. -0.65222E+01 0.41486E+01 0.25954E+01 | ||
1891 | + 1. -0.12752E+02 -0.55963E+01 0.26010E+01 | ||
1892 | + 1. 0.48868E+01 0.16080E+02 0.26092E+01 | ||
1893 | + 1. 0.36768E+01 -0.14520E+02 0.26191E+01 | ||
1894 | + 1. 0.91161E+01 0.60675E+01 0.26247E+01 | ||
1895 | + 1. -0.94499E+01 -0.13474E+02 0.26279E+01 | ||
1896 | + 1. -0.11019E+02 0.43284E+00 0.26394E+01 | ||
1897 | + 1. -0.76934E+01 0.13078E+02 0.26423E+01 | ||
1898 | + 1. -0.14997E+02 -0.20535E+01 0.26506E+01 | ||
1899 | + 1. 0.19127E+02 -0.46016E+01 0.26534E+01 | ||
1900 | + 1. 0.48259E+01 0.39753E+01 0.26601E+01 | ||
1901 | + 1. -0.55020E+01 -0.99609E+01 0.26691E+01 | ||
1902 | + 1. -0.17068E+02 0.58466E+01 0.26753E+01 | ||
1903 | + 1. 0.15359E+02 0.40272E+01 0.26854E+01 | ||
1904 | + 1. 0.16768E+02 0.75197E+01 0.26925E+01 | ||
1905 | + 1. -0.15449E+02 -0.92488E+01 0.26976E+01 | ||
1906 | + 1. 0.12123E+02 0.14075E+02 0.27036E+01 | ||
1907 | + 1. -0.78629E+01 -0.15718E+02 0.27088E+01 | ||
1908 | + 1. -0.91617E+01 0.99868E+01 0.27164E+01 | ||
1909 | + 1. -0.22572E+01 0.69578E+01 0.27244E+01 | ||
1910 | + 1. -0.15600E+02 -0.11104E+00 0.27297E+01 | ||
1911 | + 1. 0.20344E+01 -0.10319E+02 0.27347E+01 | ||
1912 | + 1. 0.20796E+01 -0.18884E+02 0.27410E+01 | ||
1913 | + 1. -0.17455E+02 0.12836E+01 0.27478E+01 | ||
1914 | + 1. -0.21358E+01 -0.98918E+01 0.27536E+01 | ||
1915 | + 1. 0.77904E+01 -0.10075E+01 0.27642E+01 | ||
1916 | + 1. -0.12964E+01 -0.45846E+01 0.27708E+01 | ||
1917 | + 1. 0.42583E+00 0.17228E+02 0.27766E+01 | ||
1918 | + 1. 0.14968E+02 -0.39824E+01 0.27842E+01 | ||
1919 | + 1. 0.15987E+02 -0.74988E+01 0.27900E+01 | ||
1920 | + 1. 0.18544E+02 -0.70933E+01 0.27985E+01 | ||
1921 | + 1. -0.79387E+01 -0.97576E+01 0.28051E+01 | ||
1922 | + 1. -0.53591E+01 -0.14809E+02 0.28105E+01 | ||
1923 | + 1. 0.62050E+01 0.14081E+02 0.28188E+01 | ||
1924 | + 1. -0.46828E+01 -0.19225E+02 0.28258E+01 | ||
1925 | + 1. -0.28433E+01 0.57114E+00 0.28305E+01 | ||
1926 | + 1. -0.88330E+00 0.99367E+01 0.28342E+01 | ||
1927 | + 1. -0.10612E+02 0.15422E+02 0.28439E+01 | ||
1928 | + 1. 0.20058E+01 -0.13316E+02 0.28467E+01 | ||
1929 | + 1. 0.11445E+02 0.59065E+01 0.28546E+01 | ||
1930 | + 1. -0.10640E+02 -0.11592E+02 0.28608E+01 | ||
1931 | + 1. 0.71881E+01 -0.14586E+02 0.28694E+01 | ||
1932 | + 1. -0.18809E+02 -0.33211E+00 0.28767E+01 | ||
1933 | + 1. -0.15019E+02 0.11504E+02 0.28857E+01 | ||
1934 | + 1. 0.97087E+01 0.10453E+02 0.28926E+01 | ||
1935 | + 1. 0.82465E+01 -0.12651E+02 0.28951E+01 | ||
1936 | + 1. -0.15697E+02 -0.46430E+01 0.29006E+01 | ||
1937 | + 1. 0.99166E+01 -0.16735E+02 0.29094E+01 | ||
1938 | + 1. 0.14821E+02 0.70569E+01 0.29161E+01 | ||
1939 | + 1. -0.21396E+01 0.19875E+02 0.29260E+01 | ||
1940 | + 1. 0.62990E+01 0.90152E+01 0.29321E+01 | ||
1941 | + 1. 0.52390E+00 -0.17279E+02 0.29369E+01 | ||
1942 | + 1. 0.28061E+00 -0.11455E+02 0.29439E+01 | ||
1943 | + 1. 0.13198E+02 -0.10737E+02 0.29480E+01 | ||
1944 | + 1. -0.18494E+01 -0.14729E+02 0.29568E+01 | ||
1945 | + 1. -0.60073E+01 0.11908E+02 0.29665E+01 | ||
1946 | + 1. 0.15733E+02 0.97219E+00 0.29675E+01 | ||
1947 | + 1. -0.15228E+02 -0.11621E+02 0.29779E+01 | ||
1948 | + 1. -0.11354E+02 0.24404E+01 0.29850E+01 | ||
1949 | + 1. 0.81726E+01 -0.56397E+01 0.29873E+01 | ||
1950 | + 1. 0.95693E+01 -0.20185E+01 0.29938E+01 | ||
1951 | + 1. -0.19876E+01 0.14623E+02 0.30034E+01 | ||
1952 | + 1. 0.27537E+01 0.19773E+02 0.30078E+01 | ||
1953 | + 1. -0.11882E+02 0.45864E+01 0.30166E+01 | ||
1954 | + 1. 0.28131E+01 0.10155E+02 0.30265E+01 | ||
1955 | + 1. -0.12530E+02 -0.15239E+02 0.30332E+01 | ||
1956 | + 1. 0.10098E+02 -0.65581E+01 0.30386E+01 | ||
1957 | + 1. -0.90779E+01 0.11031E+01 0.30418E+01 | ||
1958 | + 1. -0.32689E+01 -0.79323E+01 0.30490E+01 | ||
1959 | + 1. 0.33186E+01 0.70269E+01 0.30573E+01 | ||
1960 | + 1. -0.11569E+02 -0.80732E+01 0.30621E+01 | ||
1961 | + 1. 0.60583E+01 -0.63004E+01 0.30710E+01 | ||
1962 | + 1. -0.62785E+01 -0.29723E+01 0.30755E+01 | ||
1963 | + 1. 0.21201E+01 0.23203E+01 0.30840E+01 | ||
1964 | + 1. 0.26479E+01 -0.50621E+01 0.30920E+01 | ||
1965 | + 1. 0.13124E+02 -0.13727E+02 0.30960E+01 | ||
1966 | + 1. -0.80884E+01 0.78197E+01 0.31011E+01 | ||
1967 | + 1. 0.13312E+01 0.14733E+02 0.31070E+01 | ||
1968 | + 1. -0.13106E+02 0.80749E+01 0.31149E+01 | ||
1969 | + 1. 0.43977E+01 -0.10069E+02 0.31219E+01 | ||
1970 | + 1. 0.13356E+02 -0.24245E+01 0.31330E+01 | ||
1971 | + 1. 0.19854E+02 0.11587E+01 0.31337E+01 | ||
1972 | + 1. 0.15841E+02 -0.10885E+02 0.31444E+01 | ||
1973 | + 1. -0.83532E+01 0.17922E+02 0.31475E+01 | ||
1974 | + 1. 0.13449E+02 -0.67740E+01 0.31564E+01 | ||
1975 | + 1. 0.10144E+02 0.16785E+02 0.31627E+01 | ||
1976 | + 1. 0.93468E+01 0.13062E+01 0.31723E+01 | ||
1977 | + 1. 0.86329E+01 -0.86652E+01 0.31765E+01 | ||
1978 | + 1. -0.85711E+01 -0.78868E+01 0.31820E+01 | ||
1979 | + 1. 0.50200E+00 -0.10723E+01 0.31893E+01 | ||
1980 | + 1. -0.13357E+02 0.25404E+01 0.31999E+01 | ||
1981 | + 1. -0.12382E+02 -0.14741E+01 0.32064E+01 | ||
1982 | + 1. -0.51129E+01 0.97384E+01 0.32096E+01 | ||
1983 | + 1. -0.96108E+01 0.12566E+02 0.32196E+01 | ||
1984 | + 1. 0.21073E+01 0.12568E+02 0.32235E+01 | ||
1985 | + 1. -0.26028E+01 -0.26405E+01 0.32274E+01 | ||
1986 | + 1. -0.22651E+00 0.43610E+01 0.32362E+01 | ||
1987 | + 1. 0.93359E+01 -0.14602E+02 0.32405E+01 | ||
1988 | + 1. 0.50355E+01 -0.12255E+01 0.32488E+01 | ||
1989 | + 1. -0.17168E+02 -0.10163E+02 0.32544E+01 | ||
1990 | + 1. 0.16435E+02 -0.12161E+01 0.32649E+01 | ||
1991 | + 1. 0.11286E+02 0.11891E+02 0.32689E+01 | ||
1992 | + 1. -0.86888E+00 -0.19865E+02 0.32787E+01 | ||
1993 | + 1. -0.11804E+02 0.12386E+02 0.32816E+01 | ||
1994 | + 1. -0.84513E+01 -0.18010E+02 0.32871E+01 | ||
1995 | + 1. 0.18722E+02 0.67674E+01 0.32952E+01 | ||
1996 | + 1. -0.66976E+01 -0.61500E+01 0.33031E+01 | ||
1997 | + 1. -0.44618E+01 0.17063E+02 0.33103E+01 | ||
1998 | + 1. -0.14171E+02 -0.68801E+01 0.33195E+01 | ||
1999 | + 1. 0.94226E+01 0.14919E+02 0.33221E+01 | ||
2000 | + 1. -0.11480E+02 0.99443E+01 0.33306E+01 | ||
2001 | + 1. -0.34928E+01 0.24126E+01 0.33398E+01 | ||
2002 | + 1. 0.19069E+00 -0.15341E+02 0.33433E+01 | ||
2003 | + 1. 0.11446E+02 0.84671E+01 0.33469E+01 | ||
2004 | + 1. 0.68542E+01 0.67636E+01 0.33572E+01 | ||
2005 | + 1. -0.71807E-01 -0.77101E+01 0.33610E+01 | ||
2006 | + 1. 0.10614E+02 0.30148E+01 0.33719E+01 | ||
2007 | + 1. -0.32618E+01 -0.58775E+01 0.33775E+01 | ||
2008 | + 1. -0.38065E+01 -0.10974E+02 0.33828E+01 | ||
2009 | + 1. -0.85089E+01 -0.30943E+01 0.33873E+01 | ||
2010 | + 1. 0.54609E+01 -0.13576E+02 0.33964E+01 | ||
2011 | + 1. -0.18621E+02 0.69901E+01 0.34041E+01 | ||
2012 | + 1. 0.35582E+01 -0.17216E+02 0.34110E+01 | ||
2013 | + 1. -0.12092E+02 -0.10155E+02 0.34137E+01 | ||
2014 | + 1. 0.79815E+01 0.39831E+01 0.34257E+01 | ||
2015 | + 1. 0.72104E+01 0.10749E+02 0.34307E+01 | ||
2016 | + 1. 0.64899E+01 -0.11772E+02 0.34354E+01 | ||
2017 | + 1. -0.16964E+02 -0.80348E+01 0.34422E+01 | ||
2018 | + 1. 0.35876E+01 -0.28444E+01 0.34523E+01 | ||
2019 | + 1. 0.49800E-01 0.13609E+01 0.34560E+01 | ||
2020 | + 1. -0.16802E+02 0.89484E+01 0.34616E+01 | ||
2021 | + 1. 0.14706E+02 0.11669E+02 0.34699E+01 | ||
2022 | + 1. 0.19592E+02 0.38912E+01 0.34780E+01 | ||
2023 | + 1. -0.19786E+02 -0.19731E+01 0.34826E+01 | ||
2024 | + 1. -0.14756E+02 0.55716E+01 0.34882E+01 | ||
2025 | + 1. -0.87913E+01 -0.90671E+00 0.34998E+01 | ||
2026 | + 1. -0.97784E+01 -0.15831E+02 0.35060E+01 | ||
2027 | + 1. -0.88465E+01 0.37619E+01 0.35103E+01 | ||
2028 | + 1. 0.46353E+01 0.11183E+02 0.35133E+01 | ||
2029 | + 1. 0.71258E+01 -0.16597E+02 0.35233E+01 | ||
2030 | + 1. -0.27136E+01 0.44191E+01 0.35292E+01 | ||
2031 | + 1. -0.17576E+02 -0.52954E+01 0.35363E+01 | ||
2032 | + 1. 0.15992E+02 0.91820E+01 0.35415E+01 | ||
2033 | + 1. -0.34370E+01 -0.12944E+02 0.35511E+01 | ||
2034 | + 1. 0.96474E+01 -0.10917E+02 0.35570E+01 | ||
2035 | + 1. 0.11201E+02 -0.97363E+00 0.35660E+01 | ||
2036 | + 1. 0.69128E+01 0.14835E+01 0.35693E+01 | ||
2037 | + 1. 0.13648E+02 0.85810E+01 0.35760E+01 | ||
2038 | + 1. -0.58314E+01 -0.16597E+02 0.35814E+01 | ||
2039 | + 1. -0.10112E+02 -0.64320E+01 0.35901E+01 | ||
2040 | + 1. -0.77932E+01 -0.12691E+02 0.35969E+01 | ||
2041 | + 1. -0.16346E+02 0.29773E+01 0.36009E+01 | ||
2042 | + 1. 0.90604E+01 -0.38896E+01 0.36118E+01 | ||
2043 | + 1. -0.66577E+01 0.62703E+01 0.36147E+01 | ||
2044 | + 1. -0.76907E+01 0.11004E+02 0.36226E+01 | ||
2045 | + 1. -0.17286E+02 -0.17338E+01 0.36286E+01 | ||
2046 | + 1. 0.39318E+00 -0.31110E+01 0.36366E+01 | ||
2047 | + 1. -0.10899E+02 0.64246E+01 0.36430E+01 | ||
2048 | + 1. 0.11207E+02 -0.88555E+01 0.36473E+01 | ||
2049 | + 1. -0.45085E+01 -0.72715E+00 0.36568E+01 | ||
2050 | + 1. -0.24816E+01 0.16574E+02 0.36655E+01 | ||
2051 | + 1. -0.19425E+02 0.43655E+01 0.36673E+01 | ||
2052 | + 1. 0.17137E+02 0.49085E+01 0.36794E+01 | ||
2053 | + 1. 0.51243E+01 -0.81151E+01 0.36838E+01 | ||
2054 | + 1. 0.35361E+01 0.99607E+00 0.36893E+01 | ||
2055 | + 1. -0.28429E+01 -0.19261E+02 0.36967E+01 | ||
2056 | + 1. 0.13311E+02 0.48852E+01 0.37004E+01 | ||
2057 | + 1. 0.28749E+01 0.16338E+02 0.37083E+01 | ||
2058 | + 1. 0.11289E+01 0.76456E+01 0.37133E+01 | ||
2059 | + 1. -0.14789E+02 0.13330E+02 0.37260E+01 | ||
2060 | + 1. -0.21336E+00 0.18968E+02 0.37332E+01 | ||
2061 | + 1. 0.21164E+01 -0.15845E+02 0.37391E+01 | ||
2062 | + 1. 0.77844E+01 0.12876E+02 0.37401E+01 | ||
2063 | + 1. 0.29854E+01 0.46678E+01 0.37475E+01 | ||
2064 | + 1. -0.42133E+01 0.13897E+02 0.37535E+01 | ||
2065 | + 1. -0.25057E+01 0.10963E+02 0.37640E+01 | ||
2066 | + 1. -0.11639E+02 -0.13550E+02 0.37716E+01 | ||
2067 | + 1. 0.11321E+02 -0.14896E+02 0.37758E+01 | ||
2068 | + 1. 0.43943E+01 -0.19064E+02 0.37844E+01 | ||
2069 | + 1. -0.18831E+02 0.23718E+01 0.37930E+01 | ||
2070 | + 1. 0.39867E+00 0.11520E+02 0.37984E+01 | ||
2071 | + 1. 0.17230E+02 -0.38277E+01 0.38012E+01 | ||
2072 | + 1. 0.13071E+02 0.26012E+01 0.38121E+01 | ||
2073 | + 1. -0.49318E+01 0.19286E+02 0.38165E+01 | ||
2074 | + 1. -0.12225E+02 -0.38140E+01 0.38202E+01 | ||
2075 | + 1. -0.74097E+01 0.20249E+01 0.38309E+01 | ||
2076 | + 1. 0.12945E+02 0.10559E+02 0.38360E+01 | ||
2077 | + 1. 0.57397E+01 0.17474E+02 0.38440E+01 | ||
2078 | + 1. 0.19439E+02 -0.29056E+01 0.38501E+01 | ||
2079 | + 1. 0.50140E+01 0.77706E+01 0.38569E+01 | ||
2080 | + 1. -0.53567E+00 0.13349E+02 0.38603E+01 | ||
2081 | + 1. -0.14884E+01 -0.51965E+00 0.38706E+01 | ||
2082 | + 1. -0.12122E+01 -0.16833E+02 0.38779E+01 | ||
2083 | + 1. -0.22901E+01 0.89006E+01 0.38850E+01 | ||
2084 | + 1. -0.15360E+01 -0.12153E+02 0.38901E+01 | ||
2085 | + 1. 0.64707E+01 -0.28752E+01 0.38953E+01 | ||
2086 | + 1. 0.17847E+02 0.44621E+00 0.39056E+01 | ||
2087 | + 1. 0.12970E+02 0.70104E-01 0.39107E+01 | ||
2088 | + 1. 0.39819E+01 0.14640E+02 0.39180E+01 | ||
2089 | + 1. 0.11434E+02 -0.11780E+02 0.39214E+01 | ||
2090 | + 1. 0.97207E+01 0.75886E+01 0.39272E+01 | ||
2091 | + 1. 0.38055E+01 0.18332E+02 0.39342E+01 | ||
2092 | + 1. 0.82844E+01 0.17022E+02 0.39402E+01 | ||
2093 | + 1. -0.90483E+01 0.14625E+02 0.39509E+01 | ||
2094 | + 1. 0.14306E+00 -0.53330E+01 0.39557E+01 | ||
2095 | + 1. 0.13892E+02 0.14149E+02 0.39629E+01 | ||
2096 | + 1. -0.13895E+02 -0.90039E+01 0.39714E+01 | ||
2097 | + 1. -0.68171E+01 -0.85069E+01 0.39746E+01 | ||
2098 | + 1. 0.17920E+02 0.86509E+01 0.39853E+01 | ||
2099 | + 1. -0.14798E+02 0.93057E+01 0.39876E+01 | ||
2100 | + 1. -0.14922E+02 0.14292E+01 0.39963E+01 | ||
2101 | + 1. 0.17451E+02 -0.85469E+01 0.40037E+01 | ||
2102 | + 1. 0.16124E+02 -0.56488E+01 0.40085E+01 | ||
2103 | + 1. 0.15449E+02 -0.90764E+01 0.40199E+01 | ||
2104 | + 1. 0.17509E+01 0.18151E+02 0.40225E+01 | ||
2105 | + 1. 0.65252E+01 -0.98550E+01 0.40295E+01 | ||
2106 | + 1. -0.12910E+02 -0.11987E+02 0.40389E+01 | ||
2107 | + 1. 0.13256E+02 -0.48521E+01 0.40430E+01 | ||
2108 | + 1. 0.10083E+02 0.49620E+01 0.40505E+01 | ||
2109 | + 1. -0.10077E+02 -0.95996E+01 0.40573E+01 | ||
2110 | + 1. -0.63243E+01 0.16847E+02 0.40620E+01 | ||
2111 | + 1. 0.27630E+01 -0.10674E+01 0.40700E+01 | ||
2112 | + 1. -0.10253E+02 -0.43920E+01 0.40768E+01 | ||
2113 | + 1. -0.64823E+01 0.85027E+01 0.40826E+01 | ||
2114 | + 1. 0.18891E+01 -0.87425E+01 0.40868E+01 | ||
2115 | + 1. 0.91982E-01 -0.13421E+02 0.40993E+01 | ||
2116 | + 1. 0.12141E+02 0.15643E+02 0.41014E+01 | ||
2117 | + 1. 0.35756E+01 -0.68182E+01 0.41077E+01 | ||
2118 | + 1. 0.14123E+02 -0.12321E+02 0.41136E+01 | ||
2119 | + 1. 0.30508E+01 -0.11417E+02 0.41216E+01 | ||
2120 | + 1. -0.68604E+01 -0.14532E+02 0.41317E+01 | ||
2121 | + 1. -0.66218E+00 0.65206E+01 0.41365E+01 | ||
2122 | + 1. 0.53397E+01 0.26881E+01 0.41455E+01 | ||
2123 | + 1. -0.37458E+01 -0.14993E+02 0.41527E+01 | ||
2124 | + 1. -0.35909E+01 0.63568E+01 0.41542E+01 | ||
2125 | + 1. -0.12421E+02 0.14238E+02 0.41621E+01 | ||
2126 | + 1. -0.39437E+01 -0.41340E+01 0.41676E+01 | ||
2127 | + 1. 0.16553E+02 0.25238E+01 0.41749E+01 | ||
2128 | + 1. 0.57465E+01 0.51689E+01 0.41831E+01 | ||
2129 | + 1. -0.64921E+01 0.13565E+02 0.41925E+01 | ||
2130 | + 1. -0.13438E+02 0.11619E+02 0.41970E+01 | ||
2131 | + 1. -0.16437E+02 0.10933E+02 0.42061E+01 | ||
2132 | + 1. 0.49349E+01 -0.15397E+02 0.42078E+01 | ||
2133 | + 1. 0.44649E+01 -0.49314E+01 0.42169E+01 | ||
2134 | + 1. 0.10827E+02 -0.31402E+01 0.42237E+01 | ||
2135 | + 1. -0.14712E+02 -0.13533E+02 0.42316E+01 | ||
2136 | + 1. -0.14639E+01 0.24646E+01 0.42375E+01 | ||
2137 | + 1. -0.14106E+02 -0.29044E+01 0.42406E+01 | ||
2138 | + 1. -0.65360E+01 -0.19806E+00 0.42530E+01 | ||
2139 | + 1. -0.13388E+02 0.15814E+00 0.42552E+01 | ||
2140 | + 1. -0.87562E+01 0.60112E+01 0.42649E+01 | ||
2141 | + 1. -0.18512E+00 0.15765E+02 0.42685E+01 | ||
2142 | + 1. -0.56736E+01 0.29157E+01 0.42751E+01 | ||
2143 | + 1. 0.74879E+01 -0.18476E+02 0.42820E+01 | ||
2144 | + 1. 0.15250E+02 0.52699E+01 0.42897E+01 | ||
2145 | + 1. -0.64193E+00 -0.97361E+01 0.42992E+01 | ||
2146 | + 1. 0.18199E+02 -0.56508E+01 0.43031E+01 | ||
2147 | + 1. 0.19905E+02 -0.48703E+00 0.43092E+01 | ||
2148 | + 1. -0.67716E+01 -0.10864E+02 0.43162E+01 | ||
2149 | + 1. -0.16308E+02 0.72106E+01 0.43214E+01 | ||
2150 | + 1. 0.69592E+01 0.15306E+02 0.43295E+01 | ||
2151 | + 1. -0.65060E+01 -0.18355E+02 0.43354E+01 | ||
2152 | + 1. -0.18351E+02 -0.34904E+01 0.43428E+01 | ||
2153 | + 1. -0.10078E+02 0.17219E+02 0.43469E+01 | ||
2154 | + 1. -0.12254E+02 -0.66496E+01 0.43548E+01 | ||
2155 | + 1. -0.49346E+01 -0.65079E+01 0.43636E+01 | ||
2156 | + 1. -0.39012E+01 -0.17601E+02 0.43679E+01 | ||
2157 | + 1. 0.10867E+02 0.13574E+02 0.43748E+01 | ||
2158 | + 1. -0.25167E+01 0.18501E+02 0.43810E+01 | ||
2159 | + 1. -0.96711E+01 0.80350E+01 0.43869E+01 | ||
2160 | + 1. -0.73540E+01 -0.44324E+01 0.43951E+01 | ||
2161 | + 1. -0.52522E+01 0.48770E+01 0.44020E+01 | ||
2162 | + 1. -0.89145E+01 -0.11231E+02 0.44082E+01 | ||
2163 | + 1. 0.91814E+01 -0.35350E+00 0.44190E+01 | ||
2164 | + 1. 0.13369E+02 -0.91272E+01 0.44251E+01 | ||
2165 | + 1. 0.75807E+01 -0.71277E+01 0.44283E+01 | ||
2166 | + 1. 0.40658E+00 -0.18733E+02 0.44380E+01 | ||
2167 | + 1. -0.42280E+01 -0.90147E+01 0.44430E+01 | ||
2168 | + 1. 0.14577E+01 0.58016E+01 0.44503E+01 | ||
2169 | + 1. 0.11900E+02 -0.63470E+01 0.44551E+01 | ||
2170 | + 1. -0.13422E+02 0.42842E+01 0.44636E+01 | ||
2171 | + 1. -0.17859E+01 -0.69751E+01 0.44682E+01 | ||
2172 | + 1. -0.10554E+02 -0.22500E+01 0.44746E+01 | ||
2173 | + 1. 0.31863E+01 0.85749E+01 0.44834E+01 | ||
2174 | + 1. 0.66583E+01 -0.50259E+01 0.44925E+01 | ||
2175 | + 1. 0.95818E+01 -0.12996E+02 0.44957E+01 | ||
2176 | + 1. -0.16562E+02 0.48676E+01 0.45052E+01 | ||
2177 | + 1. 0.76852E+01 0.88567E+01 0.45070E+01 | ||
2178 | + 1. -0.45574E+01 0.11863E+02 0.45134E+01 | ||
2179 | + 1. -0.14301E+02 -0.49983E+01 0.45225E+01 | ||
2180 | + 1. 0.31650E+01 -0.13543E+02 0.45318E+01 | ||
2181 | + 1. -0.18718E+02 -0.67564E+01 0.45344E+01 | ||
2182 | + 1. 0.68686E+01 -0.70480E+00 0.45447E+01 | ||
2183 | + 1. -0.98466E+01 0.10418E+02 0.45521E+01 | ||
2184 | + 1. 0.55583E+01 0.12957E+02 0.45557E+01 | ||
2185 | + 1. 0.14519E+02 -0.13550E+01 0.45602E+01 | ||
2186 | + 1. -0.12926E+02 0.66142E+01 0.45703E+01 | ||
2187 | + 1. 0.14571E+02 0.12812E+01 0.45750E+01 | ||
2188 | + 1. 0.21375E+01 -0.37426E+01 0.45820E+01 | ||
2189 | + 1. -0.11254E+02 -0.56813E-01 0.45894E+01 | ||
2190 | + 1. 0.12101E+02 0.69907E+01 0.45941E+01 | ||
2191 | + 1. -0.92368E+01 -0.14136E+02 0.46043E+01 | ||
2192 | + 1. 0.88470E+01 -0.16242E+02 0.46121E+01 | ||
2193 | + 1. -0.98487E+01 0.22918E+01 0.46173E+01 | ||
2194 | + 1. -0.15491E+02 -0.10458E+02 0.46208E+01 | ||
2195 | + 1. -0.68918E+01 0.18726E+02 0.46321E+01 | ||
2196 | + 1. -0.16194E+02 -0.66075E+01 0.46339E+01 | ||
2197 | + 1. -0.10508E+02 0.42645E+01 0.46437E+01 | ||
2198 | + 1. 0.16731E+02 0.71084E+01 0.46533E+01 | ||
2199 | + 1. -0.17902E+02 0.43332E+00 0.46584E+01 | ||
2200 | + 1. -0.15270E+02 -0.91046E+00 0.46629E+01 | ||
2201 | + 1. 0.90963E+01 0.27549E+01 0.46700E+01 | ||
2202 | + 1. 0.11216E+02 0.14641E+01 0.46751E+01 | ||
2203 | + 1. -0.52401E+01 -0.12732E+02 0.46864E+01 | ||
2204 | + 1. 0.14047E+01 0.95485E+01 0.46928E+01 | ||
2205 | + 1. 0.23446E+01 -0.18180E+02 0.46983E+01 | ||
2206 | + 1. 0.51573E+01 0.96497E+01 0.47058E+01 | ||
2207 | + 1. 0.18974E+02 0.24043E+01 0.47075E+01 | ||
2208 | + 1. 0.88290E+01 0.10655E+02 0.47166E+01 | ||
2209 | + 1. 0.10050E+02 -0.52644E+01 0.47226E+01 | ||
2210 | + 1. -0.19664E+01 -0.44296E+01 0.47291E+01 | ||
2211 | + 1. 0.72784E+01 -0.13275E+02 0.47336E+01 | ||
2212 | + 1. 0.80307E+01 0.56025E+01 0.47412E+01 | ||
2213 | + 1. 0.13358E+02 -0.14864E+02 0.47521E+01 | ||
2214 | + 1. 0.54604E+01 -0.17296E+02 0.47534E+01 | ||
2215 | + 1. -0.80569E+01 -0.16588E+02 0.47644E+01 | ||
2216 | + 1. -0.80696E+01 -0.64154E+01 0.47671E+01 | ||
2217 | + 1. -0.16028E+02 -0.30428E+01 0.47796E+01 | ||
2218 | + 1. -0.34767E+01 0.68691E+00 0.47819E+01 | ||
2219 | + 1. -0.75791E+01 -0.19847E+01 0.47901E+01 | ||
2220 | + 1. 0.18473E+01 0.82793E+00 0.47943E+01 | ||
2221 | + 1. 0.96860E+00 0.27866E+01 0.48024E+01 | ||
2222 | + 1. 0.30673E+01 0.11547E+02 0.48128E+01 | ||
2223 | + 1. -0.26630E+01 0.13105E+02 0.48181E+01 | ||
2224 | + 1. 0.13327E+02 0.12265E+02 0.48265E+01 | ||
2225 | + 1. 0.14971E+02 -0.34545E+01 0.48274E+01 | ||
2226 | + 1. 0.49546E+01 0.13882E+00 0.48390E+01 | ||
2227 | + 1. 0.10765E+02 0.10051E+02 0.48442E+01 | ||
2228 | + 1. -0.47496E+01 0.78372E+01 0.48468E+01 | ||
2229 | + 1. -0.10797E+02 0.13289E+02 0.48591E+01 | ||
2230 | + 1. 0.84003E+01 -0.98775E+01 0.48611E+01 | ||
2231 | + 1. 0.14329E+02 -0.74192E+01 0.48722E+01 | ||
2232 | + 1. 0.18741E+02 0.54297E+01 0.48789E+01 | ||
2233 | + 1. -0.54971E+01 -0.24861E+01 0.48808E+01 | ||
2234 | + 1. -0.11607E+02 0.84282E+01 0.48879E+01 | ||
2235 | + 1. 0.69249E+01 0.18751E+02 0.48980E+01 | ||
2236 | + 1. 0.11653E+01 0.13139E+02 0.49033E+01 | ||
2237 | + 1. -0.53689E+01 0.15161E+02 0.49111E+01 | ||
2238 | + 1. 0.13892E+01 -0.65668E+01 0.49185E+01 | ||
2239 | + 1. -0.86002E+00 0.10424E+02 0.49222E+01 | ||
2240 | + 1. -0.11816E+02 -0.16127E+02 0.49305E+01 | ||
2241 | + 1. -0.61556E+01 0.10640E+02 0.49334E+01 | ||
2242 | + 1. -0.11975E+02 0.26214E+01 0.49462E+01 | ||
2243 | + 1. 0.17033E+02 0.10378E+02 0.49522E+01 | ||
2244 | + 1. 0.10331E+02 0.15859E+02 0.49590E+01 | ||
2245 | + 1. -0.87979E+01 0.50541E+00 0.49662E+01 | ||
2246 | + 1. 0.16000E+02 -0.11724E+02 0.49696E+01 | ||
2247 | + 1. 0.14860E+02 0.33535E+01 0.49781E+01 | ||
2248 | + 1. -0.86587E+01 0.12919E+02 0.49816E+01 | ||
2249 | + 1. -0.10678E+02 0.15398E+02 0.49925E+01 | ||
2250 | + 1. 0.12040E+01 -0.11413E+02 0.49958E+01 | ||
2251 | + 1. 0.17532E+02 -0.14838E+01 0.50037E+01 | ||
2252 | + 1. -0.35752E+01 -0.18943E+01 0.50131E+01 | ||
2253 | + 1. -0.74140E+01 0.37066E+01 0.50136E+01 | ||
2254 | + 1. 0.12768E+02 -0.28607E+01 0.50233E+01 | ||
2255 | + 1. 0.11830E+02 0.46584E+01 0.50319E+01 | ||
2256 | + 1. -0.16495E+01 -0.14505E+02 0.50397E+01 | ||
2257 | + 1. 0.14553E+02 0.71379E+01 0.50425E+01 | ||
2258 | + 1. -0.14204E+01 0.45689E+01 0.50492E+01 | ||
2259 | + 1. 0.48907E+01 -0.11295E+02 0.50592E+01 | ||
2260 | + 1. -0.17917E+02 0.84880E+01 0.50648E+01 | ||
2261 | + 1. -0.25493E+01 -0.10470E+02 0.50699E+01 | ||
2262 | + 1. -0.39871E+01 0.98479E+01 0.50745E+01 | ||
2263 | + 1. -0.11258E+02 -0.82623E+01 0.50853E+01 | ||
2264 | + 1. -0.17050E+02 -0.92153E+01 0.50923E+01 | ||
2265 | + 1. -0.10877E+02 -0.11231E+02 0.50965E+01 | ||
2266 | + 1. -0.33734E+01 0.15289E+02 0.51018E+01 | ||
2267 | + 1. 0.37991E+01 -0.92525E+01 0.51071E+01 | ||
2268 | + 1. -0.18984E+02 0.60159E+01 0.51183E+01 | ||
2269 | + 1. 0.19252E+01 0.19869E+02 0.51245E+01 | ||
2270 | + 1. 0.71303E+01 0.28287E+01 0.51268E+01 | ||
2271 | + 1. 0.37260E+01 0.63706E+01 0.51356E+01 | ||
2272 | + 1. 0.44518E+01 -0.21820E+01 0.51420E+01 | ||
2273 | + 1. 0.68429E+01 -0.15282E+02 0.51533E+01 | ||
2274 | + 1. -0.89798E+00 -0.26070E+01 0.51598E+01 | ||
2275 | + 1. -0.74596E+01 0.15566E+02 0.51630E+01 | ||
2276 | + 1. 0.20005E+01 0.15211E+02 0.51711E+01 | ||
2277 | + 1. -0.16813E+01 -0.18442E+02 0.51784E+01 | ||
2278 | + 1. -0.61505E+00 0.17496E+02 0.51830E+01 | ||
2279 | + 1. 0.16297E+02 0.26930E+00 0.51922E+01 | ||
2280 | + 1. -0.49109E+01 0.17780E+02 0.51997E+01 | ||
2281 | + 1. 0.52761E+01 -0.65452E+01 0.52019E+01 | ||
2282 | + 1. 0.12435E+02 0.88986E+01 0.52079E+01 | ||
2283 | + 1. -0.43647E+01 -0.19379E+02 0.52197E+01 | ||
2284 | + 1. 0.29259E+00 -0.16582E+02 0.52244E+01 | ||
2285 | + 1. 0.90902E+00 -0.90663E+00 0.52324E+01 | ||
2286 | + 1. -0.82495E+01 -0.91099E+01 0.52355E+01 | ||
2287 | + 1. 0.94675E+01 -0.78973E+01 0.52454E+01 | ||
2288 | + 1. -0.19145E+02 -0.12594E+01 0.52493E+01 | ||
2289 | + 1. 0.42712E+01 0.41979E+01 0.52540E+01 | ||
2290 | + 1. 0.10942E+02 -0.10162E+02 0.52630E+01 | ||
2291 | + 1. -0.31606E+01 0.28700E+01 0.52727E+01 | ||
2292 | + 1. 0.11834E+02 -0.13534E+02 0.52735E+01 | ||
2293 | + 1. 0.11229E+02 -0.16320E+02 0.52847E+01 | ||
2294 | + 1. 0.89253E+01 0.13573E+02 0.52929E+01 | ||
2295 | + 1. -0.15269E+02 0.31127E+01 0.52950E+01 | ||
2296 | + 1. -0.13336E+02 -0.14521E+02 0.53038E+01 | ||
2297 | + 1. 0.15028E+02 0.10147E+02 0.53077E+01 | ||
2298 | + 1. 0.50252E+01 0.16319E+02 0.53180E+01 | ||
2299 | + 1. 0.80075E+01 -0.35334E+01 0.53223E+01 | ||
2300 | + 1. 0.63451E+01 0.74362E+01 0.53290E+01 | ||
2301 | + 1. 0.33442E+01 -0.16246E+02 0.53357E+01 | ||
2302 | + 1. -0.69828E+00 0.93557E+00 0.53435E+01 | ||
2303 | + 1. 0.16801E+02 -0.70368E+01 0.53487E+01 | ||
2304 | + 1. -0.11767E+02 0.11028E+02 0.53564E+01 | ||
2305 | + 1. -0.12502E+02 -0.21116E+01 0.53617E+01 | ||
2306 | + 1. -0.14203E+02 -0.75803E+01 0.53713E+01 | ||
2307 | + 1. -0.73656E+01 0.71645E+01 0.53785E+01 | ||
2308 | + 1. -0.18225E+02 0.39502E+01 0.53822E+01 | ||
2309 | + 1. 0.14529E+01 -0.14514E+02 0.53922E+01 | ||
2310 | + 1. -0.17822E+00 0.85486E+01 0.54000E+01 | ||
2311 | + 1. -0.23054E+01 0.73483E+01 0.54036E+01 | ||
2312 | + 1. -0.13088E+02 -0.10236E+02 0.54123E+01 | ||
2313 | + 1. 0.53070E+01 -0.13412E+02 0.54142E+01 | ||
2314 | + 1. -0.78381E+01 0.92708E+01 0.54239E+01 | ||
2315 | + 1. 0.13485E+02 -0.10851E+02 0.54324E+01 | ||
2316 | + 1. -0.13953E+02 0.81907E+01 0.54345E+01 | ||
2317 | + 1. 0.34828E+01 0.20872E+01 0.54445E+01 | ||
2318 | + 1. -0.19869E+02 0.93699E+00 0.54526E+01 | ||
2319 | + 1. -0.37943E+00 -0.81158E+01 0.54595E+01 | ||
2320 | + 1. 0.70156E+01 -0.11315E+02 0.54612E+01 | ||
2321 | + 1. 0.18554E+02 -0.38739E+01 0.54715E+01 | ||
2322 | + 1. 0.28557E+01 0.17294E+02 0.54766E+01 | ||
2323 | + 1. -0.14378E+02 -0.11926E+02 0.54827E+01 | ||
2324 | + 1. -0.54102E+01 -0.15537E+02 0.54882E+01 | ||
2325 | + 1. 0.65431E+01 0.10949E+02 0.54956E+01 | ||
2326 | + 1. 0.77465E+01 0.82053E+00 0.55030E+01 | ||
2327 | + 1. -0.10807E+02 -0.58672E+01 0.55075E+01 | ||
2328 | + 1. -0.15465E+02 0.12589E+02 0.55186E+01 | ||
2329 | + 1. -0.19215E+02 -0.50573E+01 0.55243E+01 | ||
2330 | + 1. -0.98988E+01 -0.17259E+02 0.55317E+01 | ||
2331 | + 1. 0.11910E+02 -0.81447E+01 0.55383E+01 | ||
2332 | + 1. 0.58105E+01 -0.85733E+01 0.55410E+01 | ||
2333 | + 1. -0.14537E+01 0.14699E+02 0.55494E+01 | ||
2334 | + 1. -0.50934E+01 -0.10785E+02 0.55534E+01 | ||
2335 | + 1. 0.10933E+02 -0.13541E+01 0.55625E+01 | ||
2336 | + 1. 0.17247E+02 -0.10080E+02 0.55703E+01 | ||
2337 | + 1. -0.14886E+02 0.58015E+01 0.55752E+01 | ||
2338 | + 1. 0.15608E+02 0.12062E+02 0.55845E+01 | ||
2339 | + 1. 0.17248E+02 0.38851E+01 0.55899E+01 | ||
2340 | + 1. -0.89985E+01 -0.40145E+01 0.55935E+01 | ||
2341 | + 1. -0.23464E+01 -0.16603E+02 0.56041E+01 | ||
2342 | + 1. -0.13709E+02 0.13657E+02 0.56106E+01 | ||
2343 | + 1. -0.75945E+01 -0.12197E+02 0.56161E+01 | ||
2344 | + 1. 0.10114E+02 0.11997E+02 0.56249E+01 | ||
2345 | + 1. 0.14770E+02 -0.53870E+01 0.56271E+01 | ||
2346 | + 1. -0.62799E+01 -0.74153E+01 0.56356E+01 | ||
2347 | + 1. 0.10346E+02 0.62643E+01 0.56416E+01 | ||
2348 | + 1. 0.10053E+02 -0.14651E+02 0.56491E+01 | ||
2349 | + 1. -0.72674E-01 0.19615E+02 0.56595E+01 | ||
2350 | + 1. 0.58054E+01 -0.19117E+02 0.56665E+01 | ||
2351 | + 1. -0.29872E+01 -0.12750E+02 0.56720E+01 | ||
2352 | + 1. -0.10652E+02 0.68428E+01 0.56768E+01 | ||
2353 | + 1. -0.34609E+01 -0.74682E+01 0.56833E+01 | ||
2354 | + 1. 0.13686E+02 0.54051E+01 0.56912E+01 | ||
2355 | + 1. 0.28874E+01 -0.53099E+01 0.56961E+01 | ||
2356 | + 1. -0.13722E+02 0.18418E+01 0.57020E+01 | ||
2357 | + 1. 0.20799E+01 0.74191E+01 0.57102E+01 | ||
2358 | + 1. -0.14140E+02 0.10263E+02 0.57170E+01 | ||
2359 | + 1. -0.16352E+02 -0.49332E+01 0.57239E+01 | ||
2360 | + 1. -0.67925E+00 0.12491E+02 0.57311E+01 | ||
2361 | + 1. 0.49922E+01 0.18400E+02 0.57366E+01 | ||
2362 | + 1. 0.41495E+01 0.13763E+02 0.57412E+01 | ||
2363 | + 1. -0.66399E+01 0.16505E+01 0.57494E+01 | ||
2364 | + 1. 0.95077E+00 0.11287E+02 0.57534E+01 | ||
2365 | + 1. 0.94892E+01 0.83576E+01 0.57605E+01 | ||
2366 | + 1. 0.35929E+00 -0.45137E+01 0.57698E+01 | ||
2367 | + 1. -0.51492E+00 -0.12140E+02 0.57769E+01 | ||
2368 | + 1. -0.10826E+02 -0.13210E+02 0.57834E+01 | ||
2369 | + 1. -0.36451E+01 0.19456E+02 0.57897E+01 | ||
2370 | + 1. 0.13021E+02 0.21941E+01 0.57978E+01 | ||
2371 | + 1. -0.16885E+02 0.20252E+01 0.58043E+01 | ||
2372 | + 1. 0.22176E+01 0.43149E+01 0.58085E+01 | ||
2373 | + 1. 0.73774E+01 0.16963E+02 0.58164E+01 | ||
2374 | + 1. -0.52985E+01 -0.50907E+01 0.58221E+01 | ||
2375 | + 1. 0.19708E+02 0.82542E+00 0.58291E+01 | ||
2376 | + 1. 0.80989E+01 -0.55110E+01 0.58375E+01 | ||
2377 | + 1. 0.11608E+02 -0.46412E+01 0.58441E+01 | ||
2378 | + 1. -0.11729E+02 -0.40399E+01 0.58486E+01 | ||
2379 | + 1. -0.34844E+01 0.52421E+01 0.58549E+01 | ||
2380 | + 1. -0.19387E+01 -0.91815E+00 0.58660E+01 | ||
2381 | + 1. -0.17082E+02 -0.12215E+01 0.58694E+01 | ||
2382 | + 1. 0.54765E+01 -0.39663E+01 0.58793E+01 | ||
2383 | + 1. -0.52316E+01 -0.61956E+00 0.58842E+01 | ||
2384 | + 1. 0.26718E+01 -0.19817E+02 0.58890E+01 | ||
2385 | + 1. 0.12427E+02 0.14007E+02 0.58938E+01 | ||
2386 | + 1. 0.98056E+00 -0.95433E+01 0.59015E+01 | ||
2387 | + 1. -0.45411E+01 0.13489E+02 0.59077E+01 | ||
2388 | + 1. -0.86104E+01 0.17911E+02 0.59154E+01 | ||
2389 | + 1. 0.19739E+02 -0.22903E+01 0.59232E+01 | ||
2390 | + 1. 0.70754E+01 0.13004E+02 0.59320E+01 | ||
2391 | + 1. 0.16647E+02 -0.30510E+01 0.59336E+01 | ||
2392 | + 1. -0.55670E+01 0.63560E+01 0.59444E+01 | ||
2393 | + 1. 0.12793E+02 -0.62270E+00 0.59472E+01 | ||
2394 | + 1. 0.80994E+01 -0.14094E+01 0.59574E+01 | ||
2395 | + 1. 0.26377E+01 -0.17491E+01 0.59644E+01 | ||
2396 | + 1. 0.75263E+01 -0.17294E+02 0.59713E+01 | ||
2397 | + 1. 0.10164E+02 0.39043E+01 0.59789E+01 | ||
2398 | + 1. 0.14740E+02 -0.13348E+02 0.59832E+01 | ||
2399 | + 1. 0.17553E+02 0.86217E+01 0.59900E+01 | ||
2400 | + 1. 0.14992E+02 -0.95256E+01 0.59985E+01 | ||
2401 | + 1. 0.33897E+01 0.98651E+01 0.60043E+01 | ||
2402 | + 1. -0.97236E+01 -0.93512E+00 0.60077E+01 | ||
2403 | + 1. -0.15937E+02 0.87263E+01 0.60158E+01 | ||
2404 | + 1. -0.31300E+01 -0.54562E+01 0.60257E+01 | ||
2405 | + 1. -0.73176E+01 -0.15108E+02 0.60280E+01 | ||
2406 | + 1. -0.17283E+02 0.65833E+01 0.60390E+01 | ||
2407 | + 1. -0.12281E+02 0.52046E+01 0.60432E+01 | ||
2408 | + 1. -0.68129E+01 0.12169E+02 0.60468E+01 | ||
2409 | + 1. 0.30643E+00 0.49330E+01 0.60560E+01 | ||
2410 | + 1. 0.12061E+02 0.11212E+02 0.60621E+01 | ||
2411 | + 1. 0.18658E+02 -0.64733E+01 0.60679E+01 | ||
2412 | + 1. 0.96805E+01 0.12204E+01 0.60751E+01 | ||
2413 | + 1. 0.27104E+01 -0.76285E+01 0.60816E+01 | ||
2414 | + 1. 0.44125E+01 0.81280E+01 0.60928E+01 | ||
2415 | + 1. -0.96010E+01 -0.74183E+01 0.60999E+01 | ||
2416 | + 1. -0.10176E+02 -0.15175E+02 0.61017E+01 | ||
2417 | + 1. -0.31831E+01 0.17265E+02 0.61099E+01 | ||
2418 | + 1. -0.15655E+02 0.41544E+00 0.61194E+01 | ||
2419 | + 1. -0.10846E+02 0.11911E+01 0.61250E+01 | ||
2420 | + 1. 0.89562E+01 -0.11885E+02 0.61313E+01 | ||
2421 | + 1. 0.95682E+01 0.17398E+02 0.61368E+01 | ||
2422 | + 1. 0.65529E+01 0.54176E+01 0.61452E+01 | ||
2423 | + 1. -0.90539E+01 0.44267E+01 0.61483E+01 | ||
2424 | + 1. -0.29879E+01 0.11210E+02 0.61551E+01 | ||
2425 | + 1. -0.50176E+01 0.36248E+01 0.61640E+01 | ||
2426 | + 1. -0.98132E+01 0.11606E+02 0.61669E+01 | ||
2427 | + 1. -0.99200E+01 0.89945E+01 0.61795E+01 | ||
2428 | + 1. -0.14608E+02 -0.27542E+01 0.61863E+01 | ||
2429 | + 1. 0.28338E+01 -0.11288E+02 0.61915E+01 | ||
2430 | + 1. -0.69468E+01 -0.33772E+01 0.61988E+01 | ||
2431 | + 1. -0.76308E+01 -0.17957E+02 0.62050E+01 | ||
2432 | + 1. -0.17288E+02 -0.75009E+01 0.62111E+01 | ||
2433 | + 1. 0.53419E+01 0.22028E+01 0.62179E+01 | ||
2434 | + 1. -0.54891E+01 -0.17570E+02 0.62234E+01 | ||
2435 | + 1. -0.59478E+01 0.90567E+01 0.62328E+01 | ||
2436 | + 1. 0.98855E+00 0.16657E+02 0.62373E+01 | ||
2437 | + 1. 0.13034E+02 -0.63975E+01 0.62452E+01 | ||
2438 | + 1. -0.41204E+01 -0.34640E+01 0.62487E+01 | ||
2439 | + 1. -0.86186E-01 -0.19787E+02 0.62547E+01 | ||
2440 | + 1. 0.16884E+02 0.57703E+01 0.62632E+01 | ||
2441 | + 1. 0.95768E+01 -0.17323E+02 0.62683E+01 | ||
2442 | + 1. 0.60696E+01 0.14756E+02 0.62742E+01 | ||
2443 | + 1. -0.13567E+02 -0.18238E+00 0.62860E+01 | ||
2444 | + 1. -0.12928E+02 -0.60536E+01 0.62928E+01 | ||
2445 | + 1. 0.60360E+01 -0.17241E+01 0.62936E+01 | ||
2446 | + 1. -0.97082E+00 -0.98923E+01 0.63036E+01 | ||
2447 | + 1. 0.18684E+02 0.69763E+01 0.63129E+01 | ||
2448 | + 1. 0.98192E+01 -0.35963E+01 0.63189E+01 | ||
2449 | + 1. -0.91287E+01 0.15709E+02 0.63257E+01 | ||
2450 | + 1. 0.14490E+02 0.13766E+02 0.63302E+01 | ||
2451 | + 1. -0.18870E+02 -0.32561E+01 0.63344E+01 | ||
2452 | + 1. -0.88930E+01 -0.10720E+02 0.63440E+01 | ||
2453 | + 1. 0.75502E+01 -0.78256E+01 0.63482E+01 | ||
2454 | + 1. 0.82264E+01 0.42991E+01 0.63561E+01 | ||
2455 | + 1. -0.16431E+02 -0.11120E+02 0.63654E+01 | ||
2456 | + 1. -0.16354E+02 0.10737E+02 0.63681E+01 | ||
2457 | + 1. -0.62453E+01 0.16714E+02 0.63771E+01 | ||
2458 | + 1. 0.39570E+01 -0.18361E+02 0.63812E+01 | ||
2459 | + 1. 0.11993E+02 0.15896E+02 0.63910E+01 | ||
2460 | + 1. -0.72940E+01 -0.13621E+00 0.63982E+01 | ||
2461 | + 1. -0.11087E+01 -0.61001E+01 0.64028E+01 | ||
2462 | + 1. 0.50592E+01 -0.15678E+02 0.64084E+01 | ||
2463 | + 1. 0.15210E+02 0.19635E+01 0.64177E+01 | ||
2464 | + 1. 0.18813E+01 -0.17181E+02 0.64217E+01 | ||
2465 | + 1. 0.17502E+02 0.20754E+01 0.64304E+01 | ||
2466 | + 1. 0.42949E+00 0.14381E+02 0.64397E+01 | ||
2467 | + 1. 0.78398E+01 0.97331E+01 0.64452E+01 | ||
2468 | + 1. 0.32212E+01 0.24793E+00 0.64475E+01 | ||
2469 | + 1. 0.15541E+02 0.84640E+01 0.64537E+01 | ||
2470 | + 1. -0.56291E+01 -0.13634E+02 0.64664E+01 | ||
2471 | + 1. -0.71802E+01 -0.54305E+01 0.64729E+01 | ||
2472 | + 1. 0.19266E+02 0.38814E+01 0.64772E+01 | ||
2473 | + 1. -0.85429E+01 0.19716E+01 0.64828E+01 | ||
2474 | + 1. -0.68898E+01 -0.10009E+02 0.64894E+01 | ||
2475 | + 1. 0.14749E+02 -0.20862E+01 0.64947E+01 | ||
2476 | + 1. -0.13285E+01 0.30371E+01 0.65017E+01 | ||
2477 | + 1. 0.12738E+02 0.70961E+01 0.65126E+01 | ||
2478 | + 1. -0.88189E+01 -0.13541E+02 0.65154E+01 | ||
2479 | + 1. -0.11470E+02 0.14207E+02 0.65204E+01 | ||
2480 | + 1. -0.49297E+01 -0.88500E+01 0.65330E+01 | ||
2481 | + 1. 0.32860E+01 -0.13420E+02 0.65354E+01 | ||
2482 | + 1. -0.32942E+01 -0.14579E+02 0.65422E+01 | ||
2483 | + 1. 0.16618E+02 -0.50928E+01 0.65474E+01 | ||
2484 | + 1. -0.12205E+02 -0.11726E+02 0.65551E+01 | ||
2485 | + 1. 0.33118E+00 0.69044E+01 0.65624E+01 | ||
2486 | + 1. 0.13975E+01 0.16948E+01 0.65727E+01 | ||
2487 | + 1. -0.19741E+02 0.31229E+01 0.65740E+01 | ||
2488 | + 1. 0.10713E+02 -0.63275E+01 0.65815E+01 | ||
2489 | + 1. 0.84060E+01 0.15339E+02 0.65874E+01 | ||
2490 | + 1. -0.27949E+01 -0.19377E+02 0.65996E+01 | ||
2491 | + 1. -0.13543E+02 0.37036E+01 0.66016E+01 | ||
2492 | + 1. 0.13563E+02 -0.39381E+01 0.66118E+01 | ||
2493 | + 1. 0.33081E+01 0.19461E+02 0.66178E+01 | ||
2494 | + 1. -0.55872E+01 0.19031E+02 0.66243E+01 | ||
2495 | + 1. -0.12900E+02 -0.84732E+01 0.66310E+01 | ||
2496 | + 1. -0.48478E+00 -0.14202E+02 0.66382E+01 | ||
2497 | + 1. -0.15485E+01 -0.38916E+01 0.66419E+01 | ||
2498 | + 1. -0.14568E+02 -0.48542E+01 0.66531E+01 | ||
2499 | + 1. -0.14639E+02 -0.98736E+01 0.66578E+01 | ||
2500 | + 1. 0.10989E+02 -0.11783E+02 0.66636E+01 | ||
2501 | + 1. -0.16874E+01 0.92729E+01 0.66669E+01 | ||
2502 | + 1. 0.18427E+02 -0.84109E+00 0.66747E+01 | ||
2503 | + 1. 0.70659E+01 -0.13697E+02 0.66825E+01 | ||
2504 | + 1. 0.26221E+01 0.12418E+02 0.66876E+01 | ||
2505 | + 1. -0.12856E+02 0.12065E+02 0.66985E+01 | ||
2506 | + 1. -0.39582E+01 0.76726E+01 0.67050E+01 | ||
2507 | + 1. -0.40202E+01 0.80039E+00 0.67077E+01 | ||
2508 | + 1. -0.66713E+01 0.14089E+02 0.67166E+01 | ||
2509 | + 1. 0.10233E+02 0.14509E+02 0.67237E+01 | ||
2510 | + 1. 0.12051E+02 -0.15203E+02 0.67283E+01 | ||
2511 | + 1. -0.18043E+02 0.35617E+00 0.67363E+01 | ||
2512 | + 1. 0.97553E+01 0.10267E+02 0.67425E+01 | ||
2513 | + 1. 0.11833E+01 0.92794E+01 0.67484E+01 | ||
2514 | + 1. -0.10718E+02 -0.99656E+01 0.67567E+01 | ||
2515 | + 1. -0.67088E+01 0.48222E+01 0.67639E+01 | ||
2516 | + 1. -0.12204E+02 0.90323E+01 0.67708E+01 | ||
2517 | + 1. 0.30695E+00 -0.22944E+01 0.67761E+01 | ||
2518 | + 1. 0.23547E+01 -0.37154E+01 0.67856E+01 | ||
2519 | + 1. -0.10548E+02 -0.26072E+01 0.67909E+01 | ||
2520 | + 1. -0.26611E+01 -0.89302E+01 0.67979E+01 | ||
2521 | + 1. -0.16683E+02 -0.30111E+01 0.68061E+01 | ||
2522 | + 1. -0.16712E+02 0.43761E+01 0.68087E+01 | ||
2523 | + 1. 0.79945E+01 0.66878E+01 0.68174E+01 | ||
2524 | + 1. -0.17133E+01 0.56240E+01 0.68205E+01 | ||
2525 | + 1. 0.62042E+01 0.43980E+00 0.68321E+01 | ||
2526 | + 1. 0.86951E+01 -0.95428E+01 0.68390E+01 | ||
2527 | + 1. -0.10981E+02 0.38704E+01 0.68434E+01 | ||
2528 | + 1. 0.11318E+02 0.86565E+01 0.68496E+01 | ||
2529 | + 1. 0.12757E+02 0.40062E+01 0.68571E+01 | ||
2530 | + 1. 0.45639E+01 -0.99242E+01 0.68657E+01 | ||
2531 | + 1. 0.13368E+02 -0.85871E+01 0.68709E+01 | ||
2532 | + 1. 0.45900E+01 0.11669E+02 0.68734E+01 | ||
2533 | + 1. -0.51052E+01 0.11325E+02 0.68801E+01 | ||
2534 | + 1. -0.16710E+01 0.18507E+02 0.68927E+01 | ||
2535 | + 1. -0.90358E+01 0.65495E+01 0.68951E+01 | ||
2536 | + 1. -0.14551E+02 -0.13673E+02 0.69025E+01 | ||
2537 | + 1. -0.83945E+00 -0.17045E+02 0.69118E+01 | ||
2538 | + 1. -0.92430E+01 0.13737E+02 0.69162E+01 | ||
2539 | + 1. 0.16895E+02 -0.84024E+01 0.69258E+01 | ||
2540 | + 1. -0.46274E+01 0.15323E+02 0.69295E+01 | ||
2541 | + 1. 0.57089E+01 0.97497E+01 0.69394E+01 | ||
2542 | + 1. -0.81475E+01 0.10711E+02 0.69460E+01 | ||
2543 | + 1. 0.84756E+01 -0.15294E+02 0.69512E+01 | ||
2544 | + 1. 0.31491E+01 0.15123E+02 0.69540E+01 | ||
2545 | + 1. 0.17001E+02 0.10374E+02 0.69641E+01 | ||
2546 | + 1. 0.11945E+02 -0.23592E+01 0.69713E+01 | ||
2547 | + 1. -0.12055E+02 -0.14351E+02 0.69738E+01 | ||
2548 | + 1. 0.13035E+02 0.96915E+01 0.69830E+01 | ||
2549 | + 1. -0.26370E+01 0.13939E+02 0.69910E+01 | ||
2550 | + 1. 0.16306E+02 -0.11321E+02 0.69974E+01 | ||
2551 | + 1. -0.13167E+02 0.71784E+01 0.70033E+01 | ||
2552 | + 1. -0.17932E+02 -0.57730E+01 0.70083E+01 | ||
2553 | + 1. 0.14363E+02 0.11429E+02 0.70179E+01 | ||
2554 | + 1. 0.41817E+01 0.55249E+01 0.70204E+01 | ||
2555 | + 1. 0.77441E+01 0.23850E+01 0.70333E+01 | ||
2556 | + 1. 0.47923E+01 -0.55932E+01 0.70374E+01 | ||
2557 | + 1. 0.55163E+01 -0.11802E+02 0.70414E+01 | ||
2558 | + 1. 0.76688E+00 -0.11186E+02 0.70492E+01 | ||
2559 | + 1. -0.11581E+02 0.16276E+02 0.70568E+01 | ||
2560 | + 1. 0.11159E+02 0.22868E+01 0.70619E+01 | ||
2561 | + 1. 0.15107E+02 0.63048E+01 0.70693E+01 | ||
2562 | + 1. 0.14887E+02 0.41725E+01 0.70737E+01 | ||
2563 | + 1. 0.89822E+00 -0.72387E+01 0.70812E+01 | ||
2564 | + 1. 0.10988E+02 0.86812E-01 0.70867E+01 | ||
2565 | + 1. 0.25365E+01 -0.15317E+02 0.70986E+01 | ||
2566 | + 1. -0.17690E+02 0.86544E+01 0.71001E+01 | ||
2567 | + 1. -0.15232E+02 -0.79207E+01 0.71079E+01 | ||
2568 | + 1. -0.17693E+02 -0.93090E+01 0.71175E+01 | ||
2569 | + 1. 0.38158E+01 0.32294E+01 0.71223E+01 | ||
2570 | + 1. -0.11534E+01 0.16433E+02 0.71313E+01 | ||
2571 | + 1. 0.12756E+02 -0.13140E+02 0.71371E+01 | ||
2572 | + 1. 0.87512E+01 0.12212E+02 0.71403E+01 | ||
2573 | + 1. 0.42040E+01 0.16874E+02 0.71485E+01 | ||
2574 | + 1. 0.95943E+00 0.18551E+02 0.71565E+01 | ||
2575 | + 1. -0.20309E+01 -0.11451E+02 0.71651E+01 | ||
2576 | + 1. 0.48739E+01 -0.78389E+01 0.71688E+01 | ||
2577 | + 1. 0.81245E+00 -0.35497E+00 0.71748E+01 | ||
2578 | + 1. 0.75238E+01 0.18445E+02 0.71802E+01 | ||
2579 | + 1. 0.15076E+02 -0.69331E+01 0.71918E+01 | ||
2580 | + 1. -0.38225E+01 -0.16874E+02 0.71970E+01 | ||
2581 | + 1. -0.46779E+01 -0.11912E+02 0.72066E+01 | ||
2582 | + 1. -0.11407E+02 -0.72490E+01 0.72133E+01 | ||
2583 | + 1. -0.18800E+02 0.55395E+01 0.72193E+01 | ||
2584 | + 1. 0.12594E+02 -0.10625E+02 0.72236E+01 | ||
2585 | + 1. -0.17055E+01 0.11583E+01 0.72315E+01 | ||
2586 | + 1. -0.15385E+02 0.23821E+01 0.72375E+01 | ||
2587 | + 1. -0.33479E+01 -0.17415E+01 0.72427E+01 | ||
2588 | + 1. -0.79805E+01 -0.80710E+01 0.72484E+01 | ||
2589 | + 1. 0.18813E+02 -0.47591E+01 0.72550E+01 | ||
2590 | + 1. 0.16180E+02 0.30569E+00 0.72646E+01 | ||
2591 | + 1. -0.81728E+01 -0.18574E+01 0.72715E+01 | ||
2592 | + 1. 0.70765E+01 -0.33099E+01 0.72740E+01 | ||
2593 | + 1. -0.12276E+02 0.22880E+01 0.72811E+01 | ||
2594 | + 1. -0.15823E+02 0.71531E+01 0.72882E+01 | ||
2595 | + 1. -0.14361E+02 0.88030E+01 0.72961E+01 | ||
2596 | + 1. -0.19510E+02 -0.10001E+01 0.73007E+01 | ||
2597 | + 1. -0.11960E+02 -0.79937E+00 0.73094E+01 | ||
2598 | + 1. 0.40469E+01 -0.23706E+01 0.73193E+01 | ||
2599 | + 1. 0.68709E+01 -0.18697E+02 0.73256E+01 | ||
2600 | + 1. -0.43816E+01 -0.67739E+01 0.73330E+01 | ||
2601 | + 1. -0.69516E+01 0.72598E+01 0.73378E+01 | ||
2602 | + 1. -0.90325E+01 -0.52342E+01 0.73459E+01 | ||
2603 | + 1. -0.86551E+01 -0.16459E+02 0.73492E+01 | ||
2604 | + 1. 0.21491E+01 0.61509E+01 0.73577E+01 | ||
2605 | + 1. 0.10693E+02 -0.95488E+01 0.73609E+01 | ||
2606 | + 1. 0.96162E+01 0.53497E+01 0.73688E+01 | ||
2607 | + 1. 0.11250E+02 0.12820E+02 0.73789E+01 | ||
2608 | + 1. -0.70063E+01 0.29311E+01 0.73855E+01 | ||
2609 | + 1. -0.35496E+01 0.28672E+01 0.73871E+01 | ||
2610 | + 1. -0.13067E+01 0.11119E+02 0.73944E+01 | ||
2611 | + 1. 0.64482E+01 -0.91572E+01 0.74042E+01 | ||
2612 | + 1. 0.14029E+02 -0.37702E-01 0.74109E+01 | ||
2613 | + 1. -0.57988E+01 -0.15949E+02 0.74165E+01 | ||
2614 | + 1. -0.15464E+02 -0.11044E+01 0.74226E+01 | ||
2615 | + 1. 0.56714E+01 0.72955E+01 0.74317E+01 | ||
2616 | + 1. 0.56699E+01 0.39247E+01 0.74386E+01 | ||
2617 | + 1. 0.12854E+01 -0.18837E+02 0.74404E+01 | ||
2618 | + 1. -0.15243E+02 0.12104E+02 0.74493E+01 | ||
2619 | + 1. 0.82874E+01 0.33892E-01 0.74598E+01 | ||
2620 | + 1. 0.99152E+01 -0.13407E+02 0.74628E+01 | ||
2621 | + 1. -0.12968E+02 -0.38780E+01 0.74704E+01 | ||
2622 | + 1. -0.61641E+01 -0.16383E+01 0.74793E+01 | ||
2623 | + 1. 0.67100E+01 -0.59931E+01 0.74805E+01 | ||
2624 | + 1. 0.17888E+02 -0.26294E+01 0.74915E+01 | ||
2625 | + 1. 0.94228E+01 -0.20019E+01 0.74990E+01 | ||
2626 | + 1. -0.17815E+02 0.28075E+01 0.75030E+01 | ||
2627 | + 1. 0.24544E+00 0.12650E+02 0.75090E+01 | ||
2628 | + 1. -0.39483E+01 0.96767E+01 0.75178E+01 | ||
2629 | + 1. -0.94372E+01 0.45710E+00 0.75239E+01 | ||
2630 | + 1. -0.47182E+01 0.51443E+01 0.75282E+01 | ||
2631 | + 1. -0.13960E+02 -0.11868E+02 0.75399E+01 | ||
2632 | + 1. 0.26155E+01 -0.90998E+01 0.75425E+01 | ||
2633 | + 1. -0.96969E+01 0.17460E+02 0.75498E+01 | ||
2634 | + 1. -0.11073E+02 0.10888E+02 0.75557E+01 | ||
2635 | + 1. -0.11115E+02 0.60850E+01 0.75618E+01 | ||
2636 | + 1. -0.47703E+01 -0.19390E+02 0.75687E+01 | ||
2637 | + 1. -0.74355E+01 -0.11726E+02 0.75791E+01 | ||
2638 | + 1. -0.13581E+02 0.14264E+02 0.75822E+01 | ||
2639 | + 1. 0.19700E+02 0.19639E+01 0.75887E+01 | ||
2640 | + 1. 0.28221E+01 -0.59546E+01 0.75943E+01 | ||
2641 | + 1. 0.99889E+00 0.34162E+01 0.76043E+01 | ||
2642 | + 1. -0.10893E+02 -0.45146E+01 0.76104E+01 | ||
2643 | + 1. 0.58236E+01 0.13120E+02 0.76150E+01 | ||
2644 | + 1. 0.63295E+01 0.16554E+02 0.76204E+01 | ||
2645 | + 1. -0.75066E+01 0.15714E+02 0.76310E+01 | ||
2646 | + 1. 0.69413E+01 0.11429E+02 0.76354E+01 | ||
2647 | + 1. 0.52941E+01 -0.17282E+02 0.76435E+01 | ||
2648 | + 1. 0.16667E+02 0.34571E+01 0.76487E+01 | ||
2649 | + 1. 0.90239E+01 -0.64450E+01 0.76555E+01 | ||
2650 | + 1. 0.30890E+01 0.85297E+01 0.76623E+01 | ||
2651 | + 1. -0.85577E+01 0.86930E+01 0.76690E+01 | ||
2652 | + 1. -0.14463E+02 0.54314E+01 0.76771E+01 | ||
2653 | + 1. -0.10261E+02 -0.11951E+02 0.76838E+01 | ||
2654 | + 1. 0.77422E+01 -0.11396E+02 0.76890E+01 | ||
2655 | + 1. -0.11111E+02 -0.16502E+02 0.76986E+01 | ||
2656 | + 1. 0.14637E+02 -0.12296E+02 0.77063E+01 | ||
2657 | + 1. -0.58127E+01 0.81714E+00 0.77086E+01 | ||
2658 | + 1. -0.89649E+00 -0.81883E+01 0.77197E+01 | ||
2659 | + 1. -0.72194E+01 0.18388E+02 0.77207E+01 | ||
2660 | + 1. -0.42137E+01 0.17932E+02 0.77326E+01 | ||
2661 | + 1. 0.16360E+01 -0.13036E+02 0.77389E+01 | ||
2662 | + 1. 0.13241E+02 0.13077E+02 0.77462E+01 | ||
2663 | + 1. 0.13646E+02 0.20778E+01 0.77482E+01 | ||
2664 | + 1. 0.10843E+02 -0.16640E+02 0.77549E+01 | ||
2665 | + 1. 0.50255E+01 0.19305E+02 0.77618E+01 | ||
2666 | + 1. 0.97016E+01 0.78647E+01 0.77668E+01 | ||
2667 | + 1. 0.16925E+02 0.77694E+01 0.77772E+01 | ||
2668 | + 1. 0.50181E+01 -0.14076E+02 0.77826E+01 | ||
2669 | + 1. -0.49430E+01 -0.46813E+01 0.77907E+01 | ||
2670 | + 1. -0.10013E+02 0.23716E+01 0.77947E+01 | ||
2671 | + 1. -0.19722E+02 0.94273E+00 0.78032E+01 | ||
2672 | + 1. 0.15549E+02 -0.34575E+01 0.78113E+01 | ||
2673 | + 1. -0.10919E+01 -0.18932E+02 0.78184E+01 | ||
2674 | + 1. -0.53313E+01 0.13092E+02 0.78219E+01 | ||
2675 | + 1. 0.12325E+02 -0.53408E+01 0.78276E+01 | ||
2676 | + 1. -0.19813E+01 -0.15391E+02 0.78386E+01 | ||
2677 | + 1. -0.72713E+01 -0.14200E+02 0.78466E+01 | ||
2678 | + 1. 0.27967E+00 -0.50122E+01 0.78472E+01 | ||
2679 | + 1. -0.16098E+02 -0.54483E+01 0.78579E+01 | ||
2680 | + 1. 0.65117E+01 -0.15425E+02 0.78629E+01 | ||
2681 | + 1. 0.31041E+01 0.10754E+02 0.78678E+01 | ||
2682 | + 1. -0.19712E+01 0.73681E+01 0.78782E+01 | ||
2683 | + 1. 0.14182E+02 0.79178E+01 0.78820E+01 | ||
2684 | + 1. 0.83854E+01 -0.17177E+02 0.78867E+01 | ||
2685 | + 1. 0.17824E+02 -0.66685E+01 0.78976E+01 | ||
2686 | + 1. 0.10477E+02 0.16507E+02 0.79010E+01 | ||
2687 | + 1. 0.44169E+01 0.12638E+01 0.79126E+01 | ||
2688 | + 1. 0.18395E+02 0.53923E+01 0.79135E+01 | ||
2689 | + 1. 0.74991E+01 0.83651E+01 0.79219E+01 | ||
2690 | + 1. 0.23484E+01 0.17101E+02 0.79313E+01 | ||
2691 | + 1. 0.11236E+02 0.64206E+01 0.79384E+01 | ||
2692 | + 1. -0.24053E+01 -0.64508E+01 0.79463E+01 | ||
2693 | + 1. -0.12358E+02 -0.10076E+02 0.79495E+01 | ||
2694 | + 1. -0.14995E+01 -0.71630E+00 0.79541E+01 | ||
2695 | + 1. -0.13596E+02 -0.70152E+01 0.79654E+01 | ||
2696 | + 1. -0.64606E+01 0.99676E+01 0.79693E+01 | ||
2697 | + 1. 0.14695E+02 -0.96965E+01 0.79779E+01 | ||
2698 | + 1. -0.16496E+02 0.75219E+00 0.79860E+01 | ||
2699 | + 1. -0.65284E+01 -0.68852E+01 0.79876E+01 | ||
2700 | + 1. 0.10410E+02 -0.46407E+01 0.79941E+01 | ||
2701 | + 1. -0.72814E+01 0.12512E+02 0.80054E+01 | ||
2702 | + 1. -0.17589E+02 -0.13138E+01 0.80086E+01 | ||
2703 | + 1. 0.12995E+02 0.15101E+02 0.80161E+01 | ||
2704 | + 1. -0.78250E+01 -0.37582E+01 0.80234E+01 | ||
2705 | + 1. 0.11609E+02 0.10654E+02 0.80281E+01 | ||
2706 | + 1. -0.14397E+02 0.52135E+00 0.80346E+01 | ||
2707 | + 1. 0.73495E+01 0.50017E+01 0.80450E+01 | ||
2708 | + 1. 0.11935E+02 -0.77315E+01 0.80476E+01 | ||
2709 | + 1. 0.64606E+00 0.15905E+02 0.80586E+01 | ||
2710 | + 1. 0.19972E+02 -0.98587E+00 0.80611E+01 | ||
2711 | + 1. 0.76810E+01 0.14145E+02 0.80725E+01 | ||
2712 | + 1. -0.61621E+01 -0.17992E+02 0.80751E+01 | ||
2713 | + 1. 0.53792E+01 -0.10381E+01 0.80842E+01 | ||
2714 | + 1. -0.10397E+02 0.80103E+01 0.80884E+01 | ||
2715 | + 1. -0.18499E+02 -0.74231E+01 0.80989E+01 | ||
2716 | + 1. 0.81529E+00 -0.16815E+02 0.81044E+01 | ||
2717 | + 1. -0.99988E+01 0.15227E+02 0.81126E+01 | ||
2718 | + 1. 0.32984E+01 -0.17368E+02 0.81166E+01 | ||
2719 | + 1. -0.84944E+00 -0.12854E+02 0.81261E+01 | ||
2720 | + 1. -0.39974E+01 -0.10092E+02 0.81323E+01 | ||
2721 | + 1. 0.19358E+01 0.13810E+02 0.81379E+01 | ||
2722 | + 1. -0.21086E+01 0.40758E+01 0.81443E+01 | ||
2723 | + 1. 0.13154E+02 0.58252E+01 0.81469E+01 | ||
2724 | + 1. -0.94102E+01 0.11887E+02 0.81570E+01 | ||
2725 | + 1. 0.96480E+01 0.33189E+01 0.81602E+01 | ||
2726 | + 1. -0.18275E+02 -0.41171E+01 0.81729E+01 | ||
2727 | + 1. -0.95474E+01 0.49442E+01 0.81780E+01 | ||
2728 | + 1. 0.61031E+00 -0.95210E+01 0.81815E+01 | ||
2729 | + 1. -0.34285E+01 0.11572E+02 0.81898E+01 | ||
2730 | + 1. -0.97191E+00 0.14546E+02 0.81997E+01 | ||
2731 | + 1. -0.37294E+00 0.19820E+02 0.82023E+01 | ||
2732 | + 1. 0.34833E+01 -0.11745E+02 0.82092E+01 | ||
2733 | + 1. -0.45290E+01 -0.14186E+02 0.82153E+01 | ||
2734 | + 1. 0.52975E+01 -0.38454E+01 0.82203E+01 | ||
2735 | + 1. -0.95534E+01 -0.14773E+02 0.82296E+01 | ||
2736 | + 1. 0.17899E+02 0.11525E+01 0.82346E+01 | ||
2737 | + 1. -0.26012E+01 0.19731E+02 0.82425E+01 | ||
2738 | + 1. 0.38728E+00 0.80855E+01 0.82494E+01 | ||
2739 | + 1. 0.17184E+02 -0.10014E+02 0.82546E+01 | ||
2740 | + 1. 0.82981E+01 -0.46079E+01 0.82604E+01 | ||
2741 | + 1. 0.23625E+01 0.11011E+01 0.82701E+01 | ||
2742 | + 1. -0.14604E+02 -0.29336E+01 0.82773E+01 | ||
2743 | + 1. -0.41030E+00 0.51258E+01 0.82848E+01 | ||
2744 | + 1. -0.14050E+02 0.10545E+02 0.82913E+01 | ||
2745 | + 1. 0.17086E+01 -0.22770E+01 0.82933E+01 | ||
2746 | + 1. -0.27342E+01 -0.43150E+01 0.83014E+01 | ||
2747 | + 1. -0.96932E+01 -0.71513E+01 0.83101E+01 | ||
2748 | + 1. -0.15703E+02 -0.94466E+01 0.83185E+01 | ||
2749 | + 1. -0.93572E+01 -0.97315E+01 0.83240E+01 | ||
2750 | + 1. -0.17724E+02 0.69333E+01 0.83293E+01 | ||
2751 | + 1. 0.13636E+02 -0.19408E+01 0.83352E+01 | ||
2752 | + 1. -0.16234E+02 -0.11445E+02 0.83451E+01 | ||
2753 | + 1. 0.15144E+02 0.96230E+01 0.83527E+01 | ||
2754 | + 1. 0.47106E+01 -0.19237E+02 0.83562E+01 | ||
2755 | + 1. 0.17267E+00 0.10123E+02 0.83659E+01 | ||
2756 | + 1. 0.84727E+01 0.10148E+02 0.83683E+01 | ||
2757 | + 1. -0.57877E+01 0.16701E+02 0.83775E+01 | ||
2758 | + 1. 0.80359E+01 -0.13249E+02 0.83841E+01 | ||
2759 | + 1. -0.19314E+02 0.38632E+01 0.83898E+01 | ||
2760 | + 1. 0.10003E+02 0.12584E+01 0.83966E+01 | ||
2761 | + 1. -0.23919E+01 0.17405E+02 0.84051E+01 | ||
2762 | + 1. -0.16141E+02 0.92843E+01 0.84133E+01 | ||
2763 | + 1. 0.84388E+01 0.16649E+02 0.84198E+01 | ||
2764 | + 1. -0.51868E+01 0.77779E+01 0.84231E+01 | ||
2765 | + 1. 0.47060E+01 0.14805E+02 0.84308E+01 | ||
2766 | + 1. 0.14665E+02 -0.52184E+01 0.84387E+01 | ||
2767 | + 1. -0.62448E+01 -0.10072E+02 0.84424E+01 | ||
2768 | + 1. 0.20743E+01 0.19872E+02 0.84526E+01 | ||
2769 | + 1. -0.82712E+01 -0.18114E+02 0.84590E+01 | ||
2770 | + 1. 0.13349E+02 -0.14555E+02 0.84626E+01 | ||
2771 | + 1. -0.10140E+02 -0.12598E+01 0.84668E+01 | ||
2772 | + 1. 0.62761E+01 0.21009E+01 0.84756E+01 | ||
2773 | + 1. 0.15760E+02 0.12146E+02 0.84854E+01 | ||
2774 | + 1. 0.11553E+02 0.41830E+01 0.84903E+01 | ||
2775 | + 1. -0.47538E+00 -0.31657E+01 0.84997E+01 | ||
2776 | + 1. -0.81935E+01 0.16816E+01 0.85046E+01 | ||
2777 | + 1. -0.33805E+01 0.15099E+02 0.85121E+01 | ||
2778 | + 1. 0.17354E+02 -0.75941E+00 0.85133E+01 | ||
2779 | + 1. -0.11381E+02 0.13511E+02 0.85266E+01 | ||
2780 | + 1. 0.10211E+02 -0.11225E+02 0.85311E+01 | ||
2781 | + 1. -0.73898E+01 -0.35999E+00 0.85349E+01 | ||
2782 | + 1. 0.75027E+01 -0.75789E+01 0.85418E+01 | ||
2783 | + 1. 0.16778E+00 0.98004E+00 0.85508E+01 | ||
2784 | + 1. 0.97667E+01 -0.15151E+02 0.85557E+01 | ||
2785 | + 1. -0.31224E+01 0.58692E+01 0.85628E+01 | ||
2786 | + 1. -0.21445E+01 0.96754E+01 0.85721E+01 | ||
2787 | + 1. -0.12330E+02 0.45739E+01 0.85786E+01 | ||
2788 | + 1. 0.19444E+02 0.36888E+01 0.85802E+01 | ||
2789 | + 1. 0.15830E+02 0.18503E+01 0.85877E+01 | ||
2790 | + 1. 0.16893E+02 -0.49179E+01 0.85950E+01 | ||
2791 | + 1. 0.19571E+02 -0.31481E+01 0.86030E+01 | ||
2792 | + 1. -0.15734E+02 0.39372E+01 0.86114E+01 | ||
2793 | + 1. 0.12401E+02 0.41399E+00 0.86138E+01 | ||
2794 | + 1. 0.30419E+01 0.44771E+01 0.86224E+01 | ||
2795 | + 1. 0.81062E+00 -0.14704E+02 0.86273E+01 | ||
2796 | + 1. -0.75435E+01 0.55941E+01 0.86344E+01 | ||
2797 | + 1. -0.19782E+02 -0.26265E+01 0.86426E+01 | ||
2798 | + 1. -0.13759E+02 0.29716E+01 0.86487E+01 | ||
2799 | + 1. -0.50252E+01 0.34303E+01 0.86582E+01 | ||
2800 | + 1. -0.35703E+01 0.11452E+01 0.86617E+01 | ||
2801 | + 1. 0.39464E+01 0.12849E+02 0.86673E+01 | ||
2802 | + 1. 0.31059E+01 -0.37371E+01 0.86778E+01 | ||
2803 | + 1. 0.99114E+01 -0.82490E+01 0.86816E+01 | ||
2804 | + 1. -0.13057E+02 -0.14977E+02 0.86928E+01 | ||
2805 | + 1. -0.25777E+01 -0.13684E+02 0.86993E+01 | ||
2806 | + 1. -0.13596E+02 0.12562E+02 0.87009E+01 | ||
2807 | + 1. 0.10184E+02 0.14296E+02 0.87131E+01 | ||
2808 | + 1. 0.12352E+02 0.89158E+01 0.87179E+01 | ||
2809 | + 1. 0.36173E+01 0.64589E+01 0.87260E+01 | ||
2810 | + 1. -0.11448E+01 -0.10313E+02 0.87280E+01 | ||
2811 | + 1. 0.16088E+02 -0.80428E+01 0.87385E+01 | ||
2812 | + 1. 0.24707E+01 -0.19838E+02 0.87461E+01 | ||
2813 | + 1. -0.12802E+02 0.84040E+01 0.87523E+01 | ||
2814 | + 1. -0.12162E+02 0.69224E+00 0.87589E+01 | ||
2815 | + 1. -0.11803E+02 -0.13289E+02 0.87665E+01 | ||
2816 | + 1. -0.21053E+01 -0.17359E+02 0.87674E+01 | ||
2817 | + 1. -0.45376E+01 -0.24767E+01 0.87775E+01 | ||
2818 | + 1. 0.47420E+01 0.90735E+01 0.87851E+01 | ||
2819 | + 1. -0.14037E+02 -0.51713E+01 0.87916E+01 | ||
2820 | + 1. -0.28598E+01 -0.19346E+02 0.87958E+01 | ||
2821 | + 1. 0.16654E+02 0.59181E+01 0.88051E+01 | ||
2822 | + 1. 0.30707E+01 -0.82041E+00 0.88119E+01 | ||
2823 | + 1. 0.72751E+01 -0.16224E+01 0.88193E+01 | ||
2824 | + 1. -0.16196E+02 -0.72166E+01 0.88206E+01 | ||
2825 | + 1. -0.28778E+01 -0.84625E+01 0.88309E+01 | ||
2826 | + 1. 0.11382E+02 -0.13329E+02 0.88357E+01 | ||
2827 | + 1. 0.49754E+01 -0.90011E+01 0.88413E+01 | ||
2828 | + 1. 0.11767E+02 -0.32951E+01 0.88503E+01 | ||
2829 | + 1. -0.10996E+02 -0.86311E+01 0.88588E+01 | ||
2830 | + 1. -0.14473E+02 0.72257E+01 0.88653E+01 | ||
2831 | + 1. -0.12323E+02 -0.22710E+01 0.88702E+01 | ||
2832 | + 1. -0.60282E+01 -0.12597E+02 0.88757E+01 | ||
2833 | + 1. -0.42699E+00 0.17886E+02 0.88800E+01 | ||
2834 | + 1. -0.85115E+01 0.14052E+02 0.88921E+01 | ||
2835 | + 1. 0.84072E+01 -0.98582E+01 0.88992E+01 | ||
2836 | + 1. 0.13651E+02 0.11438E+02 0.89042E+01 | ||
2837 | + 1. 0.61196E+01 -0.10724E+02 0.89109E+01 | ||
2838 | + 1. 0.43680E+01 -0.69144E+01 0.89154E+01 | ||
2839 | + 1. -0.11975E+02 -0.61034E+01 0.89216E+01 | ||
2840 | + 1. 0.10887E+02 -0.11614E+01 0.89305E+01 | ||
2841 | + 1. 0.29241E+01 -0.14326E+02 0.89376E+01 | ||
2842 | + 1. 0.98643E+01 0.11923E+02 0.89454E+01 | ||
2843 | + 1. -0.17467E+02 0.49272E+01 0.89494E+01 | ||
2844 | + 1. 0.39043E+01 0.18131E+02 0.89553E+01 | ||
2845 | + 1. 0.14010E+02 -0.72096E+01 0.89664E+01 | ||
2846 | + 1. 0.60271E+01 -0.12810E+02 0.89689E+01 | ||
2847 | + 1. 0.16875E+01 -0.11259E+02 0.89743E+01 | ||
2848 | + 1. -0.16450E+02 -0.37883E+01 0.89860E+01 | ||
2849 | + 1. 0.16118E+01 -0.70353E+01 0.89871E+01 | ||
2850 | + 1. 0.86836E+01 0.62250E+01 0.89971E+01 | ||
2851 | + 1. 0.56099E+01 0.60596E+01 0.90048E+01 | ||
2852 | + 1. -0.86625E+01 0.10197E+02 0.90120E+01 | ||
2853 | + 1. -0.14479E+02 -0.13319E+02 0.90152E+01 | ||
2854 | + 1. 0.10313E+02 0.94707E+01 0.90260E+01 | ||
2855 | + 1. -0.77003E+01 -0.56401E+01 0.90332E+01 | ||
2856 | + 1. -0.51788E+01 -0.82968E+01 0.90356E+01 | ||
2857 | + 1. -0.27837E+01 -0.11649E+02 0.90407E+01 | ||
2858 | + 1. -0.25380E+01 -0.24280E+01 0.90468E+01 | ||
2859 | + 1. 0.12476E+02 -0.97108E+01 0.90573E+01 | ||
2860 | + 1. 0.16096E+01 0.11760E+02 0.90617E+01 | ||
2861 | + 1. 0.12991E+02 -0.11880E+02 0.90703E+01 | ||
2862 | + 1. -0.61023E+01 0.14588E+02 0.90773E+01 | ||
2863 | + 1. -0.57913E+00 -0.67364E+01 0.90838E+01 | ||
2864 | + 1. 0.69533E+01 0.18205E+02 0.90890E+01 | ||
2865 | + 1. -0.12056E+02 0.15586E+02 0.90997E+01 | ||
2866 | + 1. 0.53428E+01 0.11300E+02 0.91001E+01 | ||
2867 | + 1. -0.42019E+01 -0.17671E+02 0.91101E+01 | ||
2868 | + 1. 0.14602E+02 0.47885E+01 0.91182E+01 | ||
2869 | + 1. -0.99896E+01 -0.33509E+01 0.91208E+01 | ||
2870 | + 1. 0.46596E+01 -0.15946E+02 0.91290E+01 | ||
2871 | + 1. -0.16801E+01 0.12338E+02 0.91370E+01 | ||
2872 | + 1. 0.15076E+02 -0.17921E+00 0.91460E+01 | ||
2873 | + 1. -0.18182E+01 0.20350E+01 0.91522E+01 | ||
2874 | + 1. 0.19178E+02 -0.56516E+01 0.91599E+01 | ||
2875 | + 1. -0.77034E+01 0.76088E+01 0.91664E+01 | ||
2876 | + 1. -0.11162E+02 0.95951E+01 0.91730E+01 | ||
2877 | + 1. -0.82598E+01 0.17206E+02 0.91786E+01 | ||
2878 | + 1. 0.65992E+01 -0.17164E+02 0.91824E+01 | ||
2879 | + 1. -0.54070E+01 -0.51633E+00 0.91920E+01 | ||
2880 | + 1. -0.97580E+01 -0.16997E+02 0.91979E+01 | ||
2881 | + 1. 0.16813E+01 0.67816E+01 0.92007E+01 | ||
2882 | + 1. -0.53158E+01 0.19251E+02 0.92072E+01 | ||
2883 | + 1. -0.14004E+02 -0.10448E+02 0.92175E+01 | ||
2884 | + 1. -0.17527E+02 -0.93361E+01 0.92257E+01 | ||
2885 | + 1. -0.11481E+02 0.26819E+01 0.92299E+01 | ||
2886 | + 1. 0.19026E+01 0.94157E+01 0.92371E+01 | ||
2887 | + 1. 0.27865E+01 0.15512E+02 0.92429E+01 | ||
2888 | + 1. 0.15872E+02 -0.11941E+02 0.92493E+01 | ||
2889 | + 1. 0.40484E+01 0.28446E+01 0.92572E+01 | ||
2890 | + 1. -0.18697E+02 0.18786E+01 0.92633E+01 | ||
2891 | + 1. -0.73498E+01 -0.16409E+02 0.92720E+01 | ||
2892 | + 1. 0.78136E+01 0.10291E+01 0.92758E+01 | ||
2893 | + 1. 0.12350E+02 0.24167E+01 0.92832E+01 | ||
2894 | + 1. 0.90779E+01 -0.29582E+01 0.92894E+01 | ||
2895 | + 1. 0.79133E+01 -0.15537E+02 0.92993E+01 | ||
2896 | + 1. 0.90078E+01 -0.58004E+00 0.93023E+01 | ||
2897 | + 1. -0.79884E+01 0.35124E+01 0.93116E+01 | ||
2898 | + 1. -0.80398E+01 -0.85047E+01 0.93163E+01 | ||
2899 | + 1. 0.18292E+02 0.76823E+01 0.93239E+01 | ||
2900 | + 1. -0.43707E+01 -0.63726E+01 0.93327E+01 | ||
2901 | + 1. 0.11872E+02 -0.15663E+02 0.93384E+01 | ||
2902 | + 1. -0.16323E+02 0.11107E+02 0.93407E+01 | ||
2903 | + 1. 0.11966E+02 0.12903E+02 0.93483E+01 | ||
2904 | + 1. 0.32996E+00 -0.10246E+01 0.93583E+01 | ||
2905 | + 1. -0.19681E+02 -0.44055E+00 0.93623E+01 | ||
2906 | + 1. -0.15362E+02 0.19477E+01 0.93680E+01 | ||
2907 | + 1. -0.15043E+02 -0.12882E+01 0.93763E+01 | ||
2908 | + 1. 0.16760E+02 -0.27779E+01 0.93860E+01 | ||
2909 | + 1. 0.44343E+01 -0.23746E+01 0.93920E+01 | ||
2910 | + 1. -0.38794E+01 0.13234E+02 0.93996E+01 | ||
2911 | + 1. 0.33120E+00 0.13320E+02 0.94060E+01 | ||
2912 | + 1. -0.89777E+01 -0.13086E+02 0.94102E+01 | ||
2913 | + 1. 0.17787E+02 0.28096E+01 0.94135E+01 | ||
2914 | + 1. -0.57988E+01 0.11397E+02 0.94229E+01 | ||
2915 | + 1. 0.75511E+01 0.12193E+02 0.94293E+01 | ||
2916 | + 1. -0.17963E+02 0.87564E+01 0.94367E+01 | ||
2917 | + 1. 0.71310E+00 -0.18415E+02 0.94400E+01 | ||
2918 | + 1. -0.37113E+01 0.86771E+01 0.94491E+01 | ||
2919 | + 1. 0.18127E+01 0.26752E+01 0.94596E+01 | ||
2920 | + 1. -0.18865E+02 -0.57931E+01 0.94653E+01 | ||
2921 | + 1. 0.63747E+01 0.15286E+02 0.94698E+01 | ||
2922 | + 1. 0.14183E+02 0.13942E+02 0.94775E+01 | ||
2923 | + 1. 0.10319E+02 -0.63735E+01 0.94848E+01 | ||
2924 | + 1. 0.17231E+02 0.95350E+01 0.94923E+01 | ||
2925 | + 1. -0.51427E+01 0.52625E+01 0.94981E+01 | ||
2926 | + 1. 0.14923E+02 0.68598E+01 0.95041E+01 | ||
2927 | + 1. 0.68297E+01 0.37414E+01 0.95105E+01 | ||
2928 | + 1. -0.10715E+02 -0.10785E+02 0.95188E+01 | ||
2929 | + 1. -0.10223E+02 0.16701E+02 0.95263E+01 | ||
2930 | + 1. 0.21583E+01 -0.92355E+01 0.95276E+01 | ||
2931 | + 1. -0.64442E+01 -0.36629E+01 0.95350E+01 | ||
2932 | + 1. -0.58087E+01 0.17985E+01 0.95426E+01 | ||
2933 | + 1. -0.34571E+01 -0.15754E+02 0.95519E+01 | ||
2934 | + 1. 0.65394E+01 -0.59382E+01 0.95545E+01 | ||
2935 | + 1. 0.23387E+01 -0.16322E+02 0.95642E+01 | ||
2936 | + 1. -0.99534E+01 0.65662E+01 0.95709E+01 | ||
2937 | + 1. 0.19757E+02 0.36934E+00 0.95735E+01 | ||
2938 | + 1. 0.94945E+01 -0.16938E+02 0.95816E+01 | ||
2939 | + 1. -0.77168E+01 -0.10824E+02 0.95904E+01 | ||
2940 | + 1. -0.10695E+01 0.65673E+01 0.95964E+01 | ||
2941 | + 1. 0.11601E+02 0.15641E+02 0.96009E+01 | ||
2942 | + 1. -0.94415E+00 -0.15089E+02 0.96095E+01 | ||
2943 | + 1. 0.15326E+01 -0.48095E+01 0.96140E+01 | ||
2944 | + 1. 0.98785E+01 0.17372E+02 0.96259E+01 | ||
2945 | + 1. -0.10054E+02 0.76689E+00 0.96315E+01 | ||
2946 | + 1. 0.68498E+01 -0.36130E+01 0.96375E+01 | ||
2947 | + 1. -0.11528E+02 0.11575E+02 0.96453E+01 | ||
2948 | + 1. 0.15972E+01 0.18040E+02 0.96511E+01 | ||
2949 | + 1. 0.10551E+02 0.73303E+01 0.96585E+01 | ||
2950 | + 1. 0.14278E+02 -0.33016E+01 0.96627E+01 | ||
2951 | + 1. -0.12282E+00 0.33089E+01 0.96702E+01 | ||
2952 | + 1. -0.96634E+01 -0.55717E+01 0.96750E+01 | ||
2953 | + 1. 0.70241E+01 0.95811E+01 0.96836E+01 | ||
2954 | + 1. 0.50711E+01 0.59407E+00 0.96930E+01 | ||
2955 | + 1. -0.58938E+01 -0.14641E+02 0.96963E+01 | ||
2956 | + 1. -0.13228E+02 -0.79932E+01 0.97007E+01 | ||
2957 | + 1. -0.16326E+02 0.64602E+01 0.97121E+01 | ||
2958 | + 1. -0.11326E+02 -0.15860E+02 0.97191E+01 | ||
2959 | + 1. -0.13775E+02 0.14410E+02 0.97248E+01 | ||
2960 | + 1. -0.12094E+02 -0.42679E+01 0.97269E+01 | ||
2961 | + 1. -0.23223E+01 0.84320E-02 0.97381E+01 | ||
2962 | + 1. 0.41375E+00 -0.12887E+02 0.97446E+01 | ||
2963 | + 1. -0.14077E+01 0.16111E+02 0.97513E+01 | ||
2964 | + 1. -0.41466E+01 0.16942E+02 0.97548E+01 | ||
2965 | + 1. 0.12822E+02 -0.50795E+01 0.97659E+01 | ||
2966 | + 1. -0.97512E+00 -0.19447E+02 0.97689E+01 | ||
2967 | + 1. -0.12576E+02 0.65046E+01 0.97788E+01 | ||
2968 | + 1. -0.14408E+02 0.90919E+01 0.97804E+01 | ||
2969 | + 1. -0.85749E+01 -0.19920E+01 0.97920E+01 | ||
2970 | + 1. -0.14501E+02 0.53353E+01 0.97952E+01 | ||
2971 | + 1. 0.10518E+02 0.52865E+01 0.98027E+01 | ||
2972 | + 1. 0.86208E+01 0.81712E+01 0.98129E+01 | ||
2973 | + 1. -0.34374E+01 0.40442E+01 0.98198E+01 | ||
2974 | + 1. 0.19050E+02 0.53330E+01 0.98242E+01 | ||
2975 | + 1. 0.46557E+01 -0.50319E+01 0.98298E+01 | ||
2976 | + 1. 0.18167E+02 -0.75301E+01 0.98390E+01 | ||
2977 | + 1. -0.15235E+01 -0.47868E+01 0.98443E+01 | ||
2978 | + 1. -0.83172E+01 0.12299E+02 0.98484E+01 | ||
2979 | + 1. 0.14366E+02 -0.10592E+02 0.98551E+01 | ||
2980 | + 1. 0.36922E+01 -0.18330E+02 0.98641E+01 | ||
2981 | + 1. -0.60953E+01 0.91315E+01 0.98733E+01 | ||
2982 | + 1. -0.17199E+02 -0.21445E+01 0.98795E+01 | ||
2983 | + 1. 0.84098E+01 -0.11618E+02 0.98826E+01 | ||
2984 | + 1. -0.57023E+01 -0.19010E+02 0.98888E+01 | ||
2985 | + 1. 0.85363E+01 0.15040E+02 0.98954E+01 | ||
2986 | + 1. -0.16991E+02 0.27072E+00 0.99043E+01 | ||
2987 | + 1. 0.14573E+02 -0.13492E+02 0.99107E+01 | ||
2988 | + 1. 0.13045E+02 0.74086E+01 0.99198E+01 | ||
2989 | + 1. 0.19066E+02 -0.15403E+01 0.99205E+01 | ||
2990 | + 1. 0.13229E+01 0.48428E+01 0.99269E+01 | ||
2991 | + 1. -0.28709E+00 -0.89428E+01 0.99370E+01 | ||
2992 | + 1. -0.18864E+02 0.65966E+01 0.99441E+01 | ||
2993 | + 1. -0.43471E+01 -0.13196E+02 0.99473E+01 | ||
2994 | + 1. -0.12647E+02 -0.11787E+02 0.99568E+01 | ||
2995 | + 1. -0.47721E+01 -0.10785E+02 0.99631E+01 | ||
2996 | + 1. 0.14267E+02 0.28735E+01 0.99670E+01 | ||
2997 | + 1. 0.40853E+01 -0.10600E+02 0.99797E+01 | ||
2998 | + 1. -0.71554E+00 0.86857E+01 0.99816E+01 | ||
2999 | + 1. 0.10411E+02 0.24616E+01 0.99929E+01 | ||
3000 | + 1. -0.10791E+02 0.44438E+01 0.99945E+01 |
1 | +++ a/cylslab3000.pos | ||
1 | + 1. -0.12965E+02 -0.93624E+01 -0.99941E+01 | ||
2 | + 1. 0.85070E+01 0.16922E+02 -0.99904E+01 | ||
3 | + 1. 0.35559E+01 0.13697E+02 -0.99814E+01 | ||
4 | + 1. -0.21028E+01 -0.40664E+01 -0.99752E+01 | ||
5 | + 1. 0.16388E+02 0.24331E+01 -0.99732E+01 | ||
6 | + 1. 0.12191E+02 -0.53233E+01 -0.99640E+01 | ||
7 | + 1. -0.63155E+01 0.54762E+00 -0.99566E+01 | ||
8 | + 1. -0.16808E+02 -0.66680E+01 -0.99510E+01 | ||
9 | + 1. -0.38971E+01 0.16950E+02 -0.99405E+01 | ||
10 | + 1. 0.14536E+02 -0.75087E+00 -0.99361E+01 | ||
11 | + 1. 0.10011E+02 0.12734E+02 -0.99304E+01 | ||
12 | + 1. 0.19577E+02 0.19602E+01 -0.99235E+01 | ||
13 | + 1. -0.38874E+01 0.66963E+01 -0.99166E+01 | ||
14 | + 1. -0.16619E+02 0.77769E+01 -0.99108E+01 | ||
15 | + 1. -0.19262E+01 0.29369E+00 -0.99008E+01 | ||
16 | + 1. -0.45367E+01 -0.14913E+02 -0.98994E+01 | ||
17 | + 1. -0.76987E+01 -0.63255E+01 -0.98870E+01 | ||
18 | + 1. -0.69447E+00 -0.74946E+01 -0.98822E+01 | ||
19 | + 1. -0.19576E+02 0.63091E+00 -0.98789E+01 | ||
20 | + 1. 0.12397E+02 0.15573E+02 -0.98702E+01 | ||
21 | + 1. -0.15526E+02 0.44510E+01 -0.98611E+01 | ||
22 | + 1. 0.43635E+01 0.11015E+02 -0.98534E+01 | ||
23 | + 1. -0.88401E+01 0.44805E+01 -0.98514E+01 | ||
24 | + 1. 0.11902E+02 -0.15124E+02 -0.98434E+01 | ||
25 | + 1. 0.14525E+02 0.12588E+02 -0.98395E+01 | ||
26 | + 1. -0.11177E+02 0.13433E+02 -0.98273E+01 | ||
27 | + 1. -0.12716E+00 0.15386E+02 -0.98207E+01 | ||
28 | + 1. 0.67438E+01 -0.67611E+01 -0.98138E+01 | ||
29 | + 1. -0.96134E+01 0.15372E+02 -0.98114E+01 | ||
30 | + 1. -0.12177E+02 -0.24229E+01 -0.98009E+01 | ||
31 | + 1. -0.12666E+02 -0.48327E+01 -0.97974E+01 | ||
32 | + 1. 0.58753E+01 -0.27347E+01 -0.97919E+01 | ||
33 | + 1. -0.15659E+02 -0.21863E+01 -0.97862E+01 | ||
34 | + 1. 0.71397E+01 -0.10003E+02 -0.97758E+01 | ||
35 | + 1. -0.13601E+00 0.55659E+01 -0.97677E+01 | ||
36 | + 1. -0.77498E+01 0.85131E+01 -0.97647E+01 | ||
37 | + 1. -0.98243E+01 0.10896E+02 -0.97566E+01 | ||
38 | + 1. 0.70499E+01 -0.15910E+02 -0.97477E+01 | ||
39 | + 1. -0.15316E+01 -0.12234E+02 -0.97461E+01 | ||
40 | + 1. 0.16559E+02 0.87679E+01 -0.97363E+01 | ||
41 | + 1. 0.13209E+02 0.39911E+01 -0.97309E+01 | ||
42 | + 1. 0.46898E+01 -0.15977E+02 -0.97266E+01 | ||
43 | + 1. -0.11894E+02 0.63805E+00 -0.97197E+01 | ||
44 | + 1. -0.10899E+02 -0.10216E+02 -0.97107E+01 | ||
45 | + 1. 0.15537E+01 -0.12742E+02 -0.97040E+01 | ||
46 | + 1. 0.95296E+01 -0.13359E+02 -0.96995E+01 | ||
47 | + 1. 0.14894E+02 -0.46716E+01 -0.96904E+01 | ||
48 | + 1. 0.41886E+01 -0.98142E+01 -0.96866E+01 | ||
49 | + 1. 0.15893E+02 -0.93592E+01 -0.96734E+01 | ||
50 | + 1. 0.13701E+02 -0.72705E+01 -0.96695E+01 | ||
51 | + 1. -0.84370E+01 -0.16242E+02 -0.96618E+01 | ||
52 | + 1. -0.57945E+01 0.16151E+02 -0.96545E+01 | ||
53 | + 1. 0.53057E+01 -0.13966E+02 -0.96501E+01 | ||
54 | + 1. 0.12104E+02 0.12289E+02 -0.96464E+01 | ||
55 | + 1. 0.90752E+01 0.14213E+01 -0.96377E+01 | ||
56 | + 1. 0.41127E+00 -0.18735E+02 -0.96332E+01 | ||
57 | + 1. -0.62457E+01 0.58332E+01 -0.96266E+01 | ||
58 | + 1. -0.78919E+01 0.24838E+01 -0.96148E+01 | ||
59 | + 1. 0.53353E+01 0.19207E+02 -0.96111E+01 | ||
60 | + 1. 0.26592E+00 -0.66718E+00 -0.96051E+01 | ||
61 | + 1. -0.42934E+01 0.95216E+01 -0.95991E+01 | ||
62 | + 1. -0.21728E+01 0.53178E+01 -0.95897E+01 | ||
63 | + 1. -0.19033E+02 0.60782E+01 -0.95817E+01 | ||
64 | + 1. -0.56455E+01 -0.60247E+01 -0.95739E+01 | ||
65 | + 1. 0.37324E+01 0.72618E+00 -0.95696E+01 | ||
66 | + 1. -0.70891E+01 -0.17799E+02 -0.95655E+01 | ||
67 | + 1. 0.15303E+02 -0.12749E+02 -0.95552E+01 | ||
68 | + 1. -0.68308E+01 0.14032E+02 -0.95518E+01 | ||
69 | + 1. -0.17202E+01 0.84350E+01 -0.95446E+01 | ||
70 | + 1. 0.23021E+01 -0.47083E+01 -0.95348E+01 | ||
71 | + 1. -0.61204E+00 0.12671E+02 -0.95307E+01 | ||
72 | + 1. 0.36889E+01 0.48344E+01 -0.95215E+01 | ||
73 | + 1. 0.14339E+02 0.70811E+01 -0.95167E+01 | ||
74 | + 1. -0.55337E+01 -0.21995E+01 -0.95100E+01 | ||
75 | + 1. 0.16382E+02 -0.32772E+01 -0.95061E+01 | ||
76 | + 1. -0.17172E+01 -0.17904E+02 -0.94970E+01 | ||
77 | + 1. -0.17184E+02 -0.42935E+01 -0.94907E+01 | ||
78 | + 1. 0.45522E+01 -0.45899E+01 -0.94828E+01 | ||
79 | + 1. 0.12125E+02 -0.10435E+02 -0.94743E+01 | ||
80 | + 1. 0.15970E+02 0.10790E+02 -0.94729E+01 | ||
81 | + 1. 0.16473E+02 0.17185E+00 -0.94630E+01 | ||
82 | + 1. 0.12650E+02 -0.18238E+01 -0.94545E+01 | ||
83 | + 1. -0.15189E+02 -0.81921E+01 -0.94471E+01 | ||
84 | + 1. -0.17909E+02 -0.85967E+01 -0.94443E+01 | ||
85 | + 1. 0.94085E+01 -0.17749E+01 -0.94379E+01 | ||
86 | + 1. 0.86253E+01 -0.61852E+01 -0.94295E+01 | ||
87 | + 1. 0.18235E+02 0.75681E+01 -0.94237E+01 | ||
88 | + 1. -0.12852E+02 -0.74127E+01 -0.94154E+01 | ||
89 | + 1. -0.12068E+02 0.72710E+01 -0.94098E+01 | ||
90 | + 1. -0.82542E+01 -0.10638E+02 -0.94066E+01 | ||
91 | + 1. 0.10740E+02 0.25815E+01 -0.93953E+01 | ||
92 | + 1. 0.58269E+01 -0.61338E-01 -0.93893E+01 | ||
93 | + 1. -0.59887E+01 0.31064E+01 -0.93820E+01 | ||
94 | + 1. -0.16136E+02 0.11566E+01 -0.93789E+01 | ||
95 | + 1. 0.12673E+02 0.93274E+01 -0.93671E+01 | ||
96 | + 1. -0.76655E+01 -0.23670E+01 -0.93602E+01 | ||
97 | + 1. 0.17239E+02 0.43301E+01 -0.93536E+01 | ||
98 | + 1. -0.14090E+02 0.86260E+00 -0.93523E+01 | ||
99 | + 1. -0.36694E+01 -0.13088E+02 -0.93425E+01 | ||
100 | + 1. -0.15033E+02 0.12883E+02 -0.93364E+01 | ||
101 | + 1. 0.54747E+01 0.73678E+01 -0.93273E+01 | ||
102 | + 1. 0.11184E+02 -0.70293E+01 -0.93225E+01 | ||
103 | + 1. -0.62900E+01 0.10415E+02 -0.93190E+01 | ||
104 | + 1. -0.61622E+00 -0.27437E+01 -0.93087E+01 | ||
105 | + 1. 0.16535E+01 0.13153E+02 -0.93066E+01 | ||
106 | + 1. 0.72539E+00 0.22450E+01 -0.92948E+01 | ||
107 | + 1. 0.14297E+01 0.67372E+01 -0.92933E+01 | ||
108 | + 1. 0.10418E+02 -0.11470E+02 -0.92841E+01 | ||
109 | + 1. 0.28941E+01 -0.27008E+01 -0.92780E+01 | ||
110 | + 1. -0.73668E+01 -0.87661E+01 -0.92721E+01 | ||
111 | + 1. 0.13623E+02 0.12116E+01 -0.92655E+01 | ||
112 | + 1. 0.66149E+01 0.12475E+02 -0.92598E+01 | ||
113 | + 1. -0.12678E+02 0.15442E+02 -0.92524E+01 | ||
114 | + 1. -0.28672E+01 0.33557E+01 -0.92443E+01 | ||
115 | + 1. -0.12854E+02 -0.14593E+02 -0.92353E+01 | ||
116 | + 1. -0.49908E+01 -0.17075E+02 -0.92329E+01 | ||
117 | + 1. -0.14031E+02 -0.33746E+01 -0.92211E+01 | ||
118 | + 1. 0.15814E+01 0.10803E+02 -0.92195E+01 | ||
119 | + 1. 0.98881E+01 -0.44901E+01 -0.92113E+01 | ||
120 | + 1. 0.86778E+01 0.10863E+02 -0.92020E+01 | ||
121 | + 1. 0.58363E+01 0.40170E+01 -0.91975E+01 | ||
122 | + 1. -0.41879E+01 -0.73750E+01 -0.91898E+01 | ||
123 | + 1. 0.14852E+02 0.50703E+01 -0.91853E+01 | ||
124 | + 1. -0.40961E+01 0.19042E+02 -0.91773E+01 | ||
125 | + 1. -0.51800E+00 -0.96622E+01 -0.91686E+01 | ||
126 | + 1. 0.14617E+02 -0.10887E+02 -0.91613E+01 | ||
127 | + 1. 0.11199E+01 -0.63856E+01 -0.91547E+01 | ||
128 | + 1. -0.98372E+01 0.21105E+01 -0.91522E+01 | ||
129 | + 1. -0.10287E+02 -0.51245E+00 -0.91401E+01 | ||
130 | + 1. 0.67853E+01 -0.45976E+01 -0.91395E+01 | ||
131 | + 1. 0.37715E+01 0.15622E+02 -0.91325E+01 | ||
132 | + 1. 0.76988E+01 0.88123E+01 -0.91226E+01 | ||
133 | + 1. -0.41771E+01 0.14191E+02 -0.91157E+01 | ||
134 | + 1. 0.98434E+01 -0.88095E+01 -0.91124E+01 | ||
135 | + 1. -0.13552E+02 0.38767E+01 -0.91048E+01 | ||
136 | + 1. -0.10001E+02 -0.15063E+02 -0.90977E+01 | ||
137 | + 1. 0.24919E+01 -0.15923E+02 -0.90909E+01 | ||
138 | + 1. -0.96944E+01 -0.77051E+01 -0.90826E+01 | ||
139 | + 1. -0.75942E+01 0.17006E+02 -0.90744E+01 | ||
140 | + 1. -0.86421E+01 -0.46246E+01 -0.90670E+01 | ||
141 | + 1. -0.20268E+01 0.14451E+02 -0.90622E+01 | ||
142 | + 1. 0.25649E+01 0.18175E+02 -0.90562E+01 | ||
143 | + 1. -0.10462E+02 0.54579E+01 -0.90499E+01 | ||
144 | + 1. -0.15684E+02 -0.11313E+02 -0.90453E+01 | ||
145 | + 1. 0.13924E+02 -0.14125E+02 -0.90334E+01 | ||
146 | + 1. 0.10806E+02 -0.25169E+00 -0.90293E+01 | ||
147 | + 1. 0.86059E+01 -0.17910E+02 -0.90222E+01 | ||
148 | + 1. 0.12093E+02 0.58994E+01 -0.90139E+01 | ||
149 | + 1. -0.35407E+01 -0.58539E+00 -0.90115E+01 | ||
150 | + 1. 0.60208E+01 0.99562E+01 -0.90001E+01 | ||
151 | + 1. 0.30316E+01 0.88095E+01 -0.89944E+01 | ||
152 | + 1. -0.17377E+02 0.47615E+01 -0.89920E+01 | ||
153 | + 1. 0.43469E+01 -0.76060E+01 -0.89841E+01 | ||
154 | + 1. -0.10709E+02 -0.52675E+01 -0.89795E+01 | ||
155 | + 1. -0.11972E+02 0.11564E+02 -0.89686E+01 | ||
156 | + 1. -0.81731E+00 -0.54869E+01 -0.89629E+01 | ||
157 | + 1. -0.14050E+02 0.65784E+01 -0.89535E+01 | ||
158 | + 1. 0.19905E+02 -0.96167E+00 -0.89508E+01 | ||
159 | + 1. -0.12822E+02 -0.11130E+02 -0.89458E+01 | ||
160 | + 1. 0.12430E+00 0.17839E+02 -0.89367E+01 | ||
161 | + 1. 0.24154E+01 -0.10731E+02 -0.89331E+01 | ||
162 | + 1. -0.44862E+01 -0.40489E+01 -0.89234E+01 | ||
163 | + 1. -0.17380E+02 -0.16030E+01 -0.89143E+01 | ||
164 | + 1. -0.15379E+02 -0.55455E+01 -0.89133E+01 | ||
165 | + 1. -0.44002E+01 0.15541E+01 -0.89002E+01 | ||
166 | + 1. -0.40603E+01 0.11832E+02 -0.88936E+01 | ||
167 | + 1. -0.21719E+01 0.10892E+02 -0.88921E+01 | ||
168 | + 1. 0.19628E+02 -0.33844E+01 -0.88821E+01 | ||
169 | + 1. -0.19330E+02 -0.46178E+01 -0.88742E+01 | ||
170 | + 1. 0.16926E+02 -0.54990E+01 -0.88728E+01 | ||
171 | + 1. -0.10048E+01 -0.16082E+02 -0.88604E+01 | ||
172 | + 1. 0.81468E+01 0.48332E+01 -0.88569E+01 | ||
173 | + 1. -0.16978E+02 0.96853E+01 -0.88506E+01 | ||
174 | + 1. -0.13778E+02 0.91493E+01 -0.88465E+01 | ||
175 | + 1. 0.17832E+02 -0.88284E+01 -0.88388E+01 | ||
176 | + 1. -0.24500E+01 -0.10694E+02 -0.88302E+01 | ||
177 | + 1. 0.14492E+02 -0.27149E+01 -0.88246E+01 | ||
178 | + 1. -0.75461E+01 0.12232E+02 -0.88145E+01 | ||
179 | + 1. -0.71187E+01 -0.12235E+02 -0.88100E+01 | ||
180 | + 1. 0.74122E+01 -0.14045E+02 -0.88035E+01 | ||
181 | + 1. -0.63399E+01 -0.15118E+02 -0.87934E+01 | ||
182 | + 1. 0.24190E+01 -0.18373E+02 -0.87884E+01 | ||
183 | + 1. -0.11234E+02 0.35494E+01 -0.87845E+01 | ||
184 | + 1. -0.81761E+01 0.67723E+01 -0.87750E+01 | ||
185 | + 1. 0.91350E+01 0.74105E+01 -0.87696E+01 | ||
186 | + 1. 0.38679E+01 0.28890E+01 -0.87607E+01 | ||
187 | + 1. -0.94179E+01 0.92015E+01 -0.87588E+01 | ||
188 | + 1. 0.68910E+01 0.17163E+02 -0.87521E+01 | ||
189 | + 1. 0.32649E+01 -0.13943E+02 -0.87441E+01 | ||
190 | + 1. 0.11483E+02 -0.13379E+02 -0.87378E+01 | ||
191 | + 1. 0.20543E+01 -0.90770E+00 -0.87302E+01 | ||
192 | + 1. 0.13476E+02 0.14071E+02 -0.87201E+01 | ||
193 | + 1. -0.19466E+01 0.17580E+02 -0.87185E+01 | ||
194 | + 1. 0.10189E+02 -0.15122E+02 -0.87080E+01 | ||
195 | + 1. 0.87027E+01 0.14008E+02 -0.87056E+01 | ||
196 | + 1. -0.17640E+02 0.26597E+01 -0.86973E+01 | ||
197 | + 1. 0.11674E+02 -0.36610E+01 -0.86890E+01 | ||
198 | + 1. 0.13900E+02 0.10811E+02 -0.86828E+01 | ||
199 | + 1. 0.18278E+02 0.88575E+00 -0.86761E+01 | ||
200 | + 1. -0.43653E+01 0.46751E+01 -0.86674E+01 | ||
201 | + 1. 0.76140E+01 -0.25575E+01 -0.86665E+01 | ||
202 | + 1. -0.14197E+02 0.11117E+02 -0.86585E+01 | ||
203 | + 1. 0.34402E-01 0.89502E+01 -0.86482E+01 | ||
204 | + 1. 0.11197E+02 0.14086E+02 -0.86412E+01 | ||
205 | + 1. -0.21110E+01 -0.14193E+02 -0.86352E+01 | ||
206 | + 1. 0.10357E+02 0.92557E+01 -0.86326E+01 | ||
207 | + 1. 0.47724E+01 -0.17669E+02 -0.86237E+01 | ||
208 | + 1. 0.13358E+01 0.47061E+01 -0.86172E+01 | ||
209 | + 1. -0.50046E+01 -0.10772E+02 -0.86078E+01 | ||
210 | + 1. -0.41061E+01 -0.19181E+02 -0.86046E+01 | ||
211 | + 1. -0.89085E+01 -0.13224E+02 -0.85938E+01 | ||
212 | + 1. 0.79173E+01 -0.11550E+02 -0.85898E+01 | ||
213 | + 1. 0.18881E+02 -0.62745E+01 -0.85804E+01 | ||
214 | + 1. 0.14976E+02 0.30291E+01 -0.85790E+01 | ||
215 | + 1. 0.14031E+01 0.15042E+02 -0.85668E+01 | ||
216 | + 1. -0.17295E+01 -0.19929E+02 -0.85630E+01 | ||
217 | + 1. 0.18424E+02 0.28866E+01 -0.85596E+01 | ||
218 | + 1. -0.10665E+02 -0.11917E+02 -0.85495E+01 | ||
219 | + 1. 0.73102E+01 -0.83652E+01 -0.85461E+01 | ||
220 | + 1. 0.99508E+01 0.17196E+02 -0.85381E+01 | ||
221 | + 1. 0.60374E+01 0.15201E+02 -0.85326E+01 | ||
222 | + 1. 0.72906E+01 0.10016E+01 -0.85266E+01 | ||
223 | + 1. -0.10037E+02 -0.16977E+02 -0.85141E+01 | ||
224 | + 1. -0.52988E+01 0.74435E+01 -0.85092E+01 | ||
225 | + 1. -0.95700E+01 0.13332E+02 -0.85039E+01 | ||
226 | + 1. 0.17484E+00 -0.11879E+02 -0.84936E+01 | ||
227 | + 1. 0.71191E+00 -0.17101E+02 -0.84913E+01 | ||
228 | + 1. -0.21364E+01 -0.75803E+01 -0.84818E+01 | ||
229 | + 1. 0.12778E+02 -0.88022E+01 -0.84755E+01 | ||
230 | + 1. 0.48148E+01 -0.11941E+02 -0.84729E+01 | ||
231 | + 1. -0.67166E+01 -0.45744E+01 -0.84640E+01 | ||
232 | + 1. -0.17708E+01 0.17423E+01 -0.84574E+01 | ||
233 | + 1. -0.10138E+02 0.17147E+02 -0.84521E+01 | ||
234 | + 1. -0.11992E+01 0.19598E+02 -0.84406E+01 | ||
235 | + 1. -0.15498E+02 -0.50427E+00 -0.84336E+01 | ||
236 | + 1. -0.19765E+02 0.21570E+01 -0.84317E+01 | ||
237 | + 1. 0.32091E+00 -0.14286E+02 -0.84239E+01 | ||
238 | + 1. 0.13132E+01 -0.91410E+01 -0.84167E+01 | ||
239 | + 1. 0.18336E+02 0.57850E+01 -0.84122E+01 | ||
240 | + 1. 0.17863E+02 -0.11144E+01 -0.84048E+01 | ||
241 | + 1. -0.73414E+01 0.45137E+01 -0.83966E+01 | ||
242 | + 1. -0.83738E+01 0.34437E+00 -0.83894E+01 | ||
243 | + 1. -0.17991E+02 0.75537E+01 -0.83850E+01 | ||
244 | + 1. -0.60142E+01 0.18592E+02 -0.83777E+01 | ||
245 | + 1. -0.12787E+02 0.21140E+01 -0.83712E+01 | ||
246 | + 1. 0.71931E+01 0.66350E+01 -0.83607E+01 | ||
247 | + 1. -0.18038E+02 -0.63271E+01 -0.83600E+01 | ||
248 | + 1. 0.47326E+01 -0.19394E+01 -0.83493E+01 | ||
249 | + 1. -0.12906E+02 0.13541E+02 -0.83435E+01 | ||
250 | + 1. -0.17975E+02 0.50683E+00 -0.83362E+01 | ||
251 | + 1. -0.15205E+01 -0.95566E+00 -0.83282E+01 | ||
252 | + 1. 0.47613E+01 0.13671E+02 -0.83211E+01 | ||
253 | + 1. 0.10373E+01 -0.34373E+01 -0.83177E+01 | ||
254 | + 1. -0.25973E+01 -0.26473E+01 -0.83108E+01 | ||
255 | + 1. 0.15028E+02 -0.61197E+01 -0.83042E+01 | ||
256 | + 1. -0.81094E+01 0.15021E+02 -0.82971E+01 | ||
257 | + 1. -0.31900E+01 -0.55276E+01 -0.82917E+01 | ||
258 | + 1. 0.15112E+02 0.89344E+01 -0.82820E+01 | ||
259 | + 1. -0.12272E+01 0.41319E+01 -0.82782E+01 | ||
260 | + 1. -0.54286E+01 -0.13304E+02 -0.82709E+01 | ||
261 | + 1. -0.95435E+01 -0.95597E+01 -0.82656E+01 | ||
262 | + 1. 0.10279E+02 0.42993E+01 -0.82551E+01 | ||
263 | + 1. -0.27258E+00 0.11021E+02 -0.82481E+01 | ||
264 | + 1. -0.19925E+01 0.69056E+01 -0.82402E+01 | ||
265 | + 1. 0.16305E+02 0.62390E+01 -0.82390E+01 | ||
266 | + 1. 0.57555E+01 -0.98817E+01 -0.82330E+01 | ||
267 | + 1. -0.11748E+02 0.88725E+01 -0.82232E+01 | ||
268 | + 1. 0.10715E+02 0.11590E+02 -0.82188E+01 | ||
269 | + 1. -0.12884E+02 -0.68941E+00 -0.82093E+01 | ||
270 | + 1. 0.16143E+02 -0.78386E+01 -0.82054E+01 | ||
271 | + 1. 0.35767E+01 0.11985E+02 -0.81995E+01 | ||
272 | + 1. 0.11890E+02 0.78088E+01 -0.81870E+01 | ||
273 | + 1. -0.13700E+02 -0.87684E+01 -0.81834E+01 | ||
274 | + 1. -0.15391E+02 0.33080E+01 -0.81776E+01 | ||
275 | + 1. 0.15731E+01 0.19760E+02 -0.81675E+01 | ||
276 | + 1. -0.56295E+01 0.13097E+02 -0.81641E+01 | ||
277 | + 1. 0.11850E+02 0.12920E+01 -0.81592E+01 | ||
278 | + 1. 0.45174E+01 0.18015E+02 -0.81477E+01 | ||
279 | + 1. -0.16027E+02 0.67457E+01 -0.81435E+01 | ||
280 | + 1. 0.15659E+02 0.12324E+02 -0.81395E+01 | ||
281 | + 1. -0.65313E+01 0.15638E+01 -0.81316E+01 | ||
282 | + 1. -0.10210E+02 -0.34459E+01 -0.81234E+01 | ||
283 | + 1. -0.19825E+02 -0.45991E+00 -0.81136E+01 | ||
284 | + 1. -0.44308E+01 0.16088E+02 -0.81129E+01 | ||
285 | + 1. -0.32345E+01 -0.15956E+02 -0.81051E+01 | ||
286 | + 1. -0.15917E+02 -0.35863E+01 -0.80970E+01 | ||
287 | + 1. -0.65927E+01 -0.70832E+00 -0.80916E+01 | ||
288 | + 1. -0.14298E+02 -0.12614E+02 -0.80852E+01 | ||
289 | + 1. -0.12309E+02 -0.34906E+01 -0.80769E+01 | ||
290 | + 1. -0.10082E+02 0.72194E+01 -0.80688E+01 | ||
291 | + 1. 0.54895E+01 -0.60893E+01 -0.80613E+01 | ||
292 | + 1. -0.11658E+02 -0.84580E+01 -0.80541E+01 | ||
293 | + 1. 0.17670E+02 0.91994E+01 -0.80503E+01 | ||
294 | + 1. 0.29389E+01 0.60787E+01 -0.80457E+01 | ||
295 | + 1. 0.91241E+01 0.26722E+01 -0.80341E+01 | ||
296 | + 1. -0.21673E+01 0.12741E+02 -0.80301E+01 | ||
297 | + 1. 0.13740E+02 -0.45909E+01 -0.80218E+01 | ||
298 | + 1. -0.12509E+02 0.52973E+01 -0.80165E+01 | ||
299 | + 1. 0.30955E+01 -0.60832E+01 -0.80081E+01 | ||
300 | + 1. 0.82690E+01 0.15886E+02 -0.80002E+01 | ||
301 | + 1. 0.59213E+00 0.68252E+00 -0.80000E+01 | ||
302 | + 1. -0.18988E+02 -0.27237E+01 -0.79930E+01 | ||
303 | + 1. -0.75414E+01 0.94685E+01 -0.79849E+01 | ||
304 | + 1. -0.75211E+01 -0.71355E+01 -0.79793E+01 | ||
305 | + 1. 0.14225E+02 -0.48232E+00 -0.79673E+01 | ||
306 | + 1. -0.28471E+01 0.90489E+01 -0.79664E+01 | ||
307 | + 1. -0.54978E+01 -0.85248E+01 -0.79537E+01 | ||
308 | + 1. -0.17188E+02 -0.10231E+02 -0.79495E+01 | ||
309 | + 1. 0.16396E+02 -0.10243E+02 -0.79465E+01 | ||
310 | + 1. -0.19758E+00 -0.78737E+01 -0.79378E+01 | ||
311 | + 1. -0.11727E+02 -0.13503E+02 -0.79333E+01 | ||
312 | + 1. 0.56761E+01 0.24035E+01 -0.79219E+01 | ||
313 | + 1. 0.64636E+00 -0.19921E+02 -0.79179E+01 | ||
314 | + 1. -0.10563E+02 0.15156E+02 -0.79072E+01 | ||
315 | + 1. 0.51727E+01 -0.14981E+02 -0.79000E+01 | ||
316 | + 1. -0.19160E+02 0.49698E+01 -0.78960E+01 | ||
317 | + 1. 0.95624E+01 -0.71136E+01 -0.78885E+01 | ||
318 | + 1. 0.11649E+02 -0.55853E+01 -0.78820E+01 | ||
319 | + 1. -0.11812E+02 -0.16071E+02 -0.78740E+01 | ||
320 | + 1. 0.85457E+01 -0.16173E+02 -0.78721E+01 | ||
321 | + 1. 0.69381E+01 -0.17864E+02 -0.78628E+01 | ||
322 | + 1. -0.89174E+01 -0.15112E+01 -0.78543E+01 | ||
323 | + 1. 0.11940E+02 -0.15726E+02 -0.78531E+01 | ||
324 | + 1. 0.12399E+02 0.40743E+01 -0.78420E+01 | ||
325 | + 1. 0.30231E+00 0.13369E+02 -0.78344E+01 | ||
326 | + 1. 0.35252E+01 -0.92540E+01 -0.78302E+01 | ||
327 | + 1. -0.13121E+02 -0.58179E+01 -0.78235E+01 | ||
328 | + 1. 0.12933E+02 -0.12024E+02 -0.78168E+01 | ||
329 | + 1. 0.83967E+01 -0.50084E+01 -0.78080E+01 | ||
330 | + 1. 0.51216E+01 0.56930E+01 -0.78004E+01 | ||
331 | + 1. -0.32167E+00 0.16254E+02 -0.77956E+01 | ||
332 | + 1. -0.57685E+01 -0.18292E+02 -0.77920E+01 | ||
333 | + 1. -0.16066E+02 0.11440E+02 -0.77829E+01 | ||
334 | + 1. 0.10109E+02 -0.26874E+01 -0.77743E+01 | ||
335 | + 1. 0.86523E+01 -0.71006E+00 -0.77687E+01 | ||
336 | + 1. -0.79867E+01 -0.17475E+02 -0.77603E+01 | ||
337 | + 1. -0.16472E+02 -0.79900E+01 -0.77593E+01 | ||
338 | + 1. 0.17435E+02 -0.30463E+01 -0.77484E+01 | ||
339 | + 1. -0.11400E+02 0.68375E+00 -0.77414E+01 | ||
340 | + 1. -0.26559E+01 -0.12377E+02 -0.77374E+01 | ||
341 | + 1. -0.88018E+01 0.11060E+02 -0.77304E+01 | ||
342 | + 1. 0.48016E+01 0.85515E+01 -0.77261E+01 | ||
343 | + 1. 0.16781E+02 0.18208E+01 -0.77185E+01 | ||
344 | + 1. 0.28977E+01 0.11469E+01 -0.77116E+01 | ||
345 | + 1. 0.96957E+01 -0.12720E+02 -0.77030E+01 | ||
346 | + 1. 0.30617E+01 -0.40592E+01 -0.76942E+01 | ||
347 | + 1. 0.11438E+02 0.15844E+02 -0.76933E+01 | ||
348 | + 1. -0.77825E+00 -0.18263E+02 -0.76842E+01 | ||
349 | + 1. -0.87829E+01 0.31137E+01 -0.76796E+01 | ||
350 | + 1. 0.96070E+01 -0.10399E+02 -0.76730E+01 | ||
351 | + 1. -0.54990E+01 0.94154E+01 -0.76617E+01 | ||
352 | + 1. 0.72023E+01 0.11203E+02 -0.76545E+01 | ||
353 | + 1. 0.15662E+02 -0.40166E+01 -0.76507E+01 | ||
354 | + 1. 0.39304E+01 -0.19317E+02 -0.76417E+01 | ||
355 | + 1. 0.13908E+02 0.63981E+01 -0.76359E+01 | ||
356 | + 1. -0.51401E+01 -0.60315E+01 -0.76310E+01 | ||
357 | + 1. -0.35040E+01 -0.93864E+01 -0.76214E+01 | ||
358 | + 1. 0.47579E+01 0.31293E+00 -0.76192E+01 | ||
359 | + 1. -0.57072E+01 -0.29198E+01 -0.76095E+01 | ||
360 | + 1. 0.77312E-01 0.67751E+01 -0.76038E+01 | ||
361 | + 1. 0.56242E+01 -0.36166E+01 -0.75952E+01 | ||
362 | + 1. 0.24741E+01 0.16734E+02 -0.75922E+01 | ||
363 | + 1. 0.17754E+01 -0.12663E+02 -0.75861E+01 | ||
364 | + 1. 0.12730E+02 0.12139E+02 -0.75765E+01 | ||
365 | + 1. -0.70928E+01 -0.10197E+02 -0.75695E+01 | ||
366 | + 1. -0.14810E+02 0.52121E+01 -0.75661E+01 | ||
367 | + 1. -0.14854E+02 0.14601E+01 -0.75559E+01 | ||
368 | + 1. -0.79079E+01 -0.15236E+02 -0.75476E+01 | ||
369 | + 1. -0.90033E+01 -0.11345E+02 -0.75422E+01 | ||
370 | + 1. 0.14494E+01 0.29337E+01 -0.75373E+01 | ||
371 | + 1. -0.61453E+01 0.14932E+02 -0.75302E+01 | ||
372 | + 1. -0.85088E+01 0.17947E+02 -0.75265E+01 | ||
373 | + 1. -0.40522E+01 0.29621E+01 -0.75196E+01 | ||
374 | + 1. -0.29905E+01 -0.17903E+02 -0.75073E+01 | ||
375 | + 1. -0.59610E+01 0.57769E+01 -0.75033E+01 | ||
376 | + 1. -0.10748E+02 -0.66328E+01 -0.74986E+01 | ||
377 | + 1. -0.30780E+01 0.19424E+02 -0.74885E+01 | ||
378 | + 1. -0.82561E+00 -0.37629E+01 -0.74842E+01 | ||
379 | + 1. 0.15902E+02 -0.15405E+01 -0.74762E+01 | ||
380 | + 1. 0.49219E+01 0.10662E+02 -0.74696E+01 | ||
381 | + 1. 0.29467E+01 0.14108E+02 -0.74624E+01 | ||
382 | + 1. 0.66231E+01 -0.12606E+01 -0.74562E+01 | ||
383 | + 1. 0.34481E+01 0.19649E+02 -0.74529E+01 | ||
384 | + 1. 0.13355E+02 -0.70547E+01 -0.74448E+01 | ||
385 | + 1. 0.15291E+02 -0.12379E+02 -0.74369E+01 | ||
386 | + 1. 0.11597E+02 -0.10140E+02 -0.74285E+01 | ||
387 | + 1. 0.13855E+02 -0.10250E+02 -0.74207E+01 | ||
388 | + 1. 0.19794E+02 0.16951E+01 -0.74196E+01 | ||
389 | + 1. 0.11957E+02 0.98078E+01 -0.74084E+01 | ||
390 | + 1. 0.16561E+02 0.39446E+01 -0.74042E+01 | ||
391 | + 1. -0.17607E+02 -0.45296E+01 -0.73955E+01 | ||
392 | + 1. -0.14083E+02 -0.21434E+01 -0.73874E+01 | ||
393 | + 1. 0.13119E+02 -0.21317E+01 -0.73867E+01 | ||
394 | + 1. 0.16622E+01 0.80371E+01 -0.73758E+01 | ||
395 | + 1. 0.89610E+01 0.12270E+02 -0.73686E+01 | ||
396 | + 1. -0.46671E+01 -0.10028E+01 -0.73636E+01 | ||
397 | + 1. -0.28338E+01 0.52586E+01 -0.73576E+01 | ||
398 | + 1. -0.10632E+02 0.11807E+02 -0.73527E+01 | ||
399 | + 1. 0.36796E+01 -0.16442E+02 -0.73459E+01 | ||
400 | + 1. 0.87508E+01 0.95956E+01 -0.73362E+01 | ||
401 | + 1. -0.11241E+02 -0.17827E+01 -0.73272E+01 | ||
402 | + 1. -0.23384E+01 0.15469E+02 -0.73253E+01 | ||
403 | + 1. 0.10443E+01 -0.52727E+01 -0.73138E+01 | ||
404 | + 1. 0.13876E+02 0.17674E+01 -0.73091E+01 | ||
405 | + 1. 0.20744E+01 0.10405E+02 -0.73018E+01 | ||
406 | + 1. 0.19372E+02 0.42051E+01 -0.72979E+01 | ||
407 | + 1. 0.18991E+02 -0.47495E+01 -0.72893E+01 | ||
408 | + 1. -0.11448E+01 -0.10682E+02 -0.72832E+01 | ||
409 | + 1. 0.63650E+01 0.18639E+02 -0.72799E+01 | ||
410 | + 1. -0.14079E+02 -0.10547E+02 -0.72718E+01 | ||
411 | + 1. 0.59831E+01 -0.13149E+02 -0.72635E+01 | ||
412 | + 1. 0.11475E+02 -0.78694E+01 -0.72589E+01 | ||
413 | + 1. -0.12954E+02 0.74808E+01 -0.72526E+01 | ||
414 | + 1. -0.55913E+01 -0.16337E+02 -0.72426E+01 | ||
415 | + 1. -0.62964E+01 0.11365E+02 -0.72386E+01 | ||
416 | + 1. 0.86038E+01 0.17923E+02 -0.72317E+01 | ||
417 | + 1. 0.22462E+01 -0.14816E+02 -0.72205E+01 | ||
418 | + 1. -0.15475E+02 0.84730E+01 -0.72183E+01 | ||
419 | + 1. 0.73120E+01 0.13640E+02 -0.72105E+01 | ||
420 | + 1. -0.36663E+01 0.72712E+01 -0.72015E+01 | ||
421 | + 1. 0.94555E+01 0.60158E+01 -0.71978E+01 | ||
422 | + 1. 0.32368E-01 -0.16011E+01 -0.71870E+01 | ||
423 | + 1. -0.14881E+02 0.13005E+02 -0.71858E+01 | ||
424 | + 1. 0.18271E+02 -0.75849E+01 -0.71761E+01 | ||
425 | + 1. 0.98494E+01 0.14623E+02 -0.71733E+01 | ||
426 | + 1. -0.12928E+02 0.10266E+02 -0.71607E+01 | ||
427 | + 1. 0.35868E+01 0.41848E+01 -0.71539E+01 | ||
428 | + 1. -0.69858E+01 0.77292E+01 -0.71512E+01 | ||
429 | + 1. -0.17542E+02 0.39414E+01 -0.71460E+01 | ||
430 | + 1. 0.67259E+01 0.43597E+01 -0.71349E+01 | ||
431 | + 1. 0.16402E+02 0.10708E+02 -0.71331E+01 | ||
432 | + 1. 0.31087E+01 -0.20278E+01 -0.71248E+01 | ||
433 | + 1. -0.88037E+01 0.51148E+01 -0.71173E+01 | ||
434 | + 1. -0.28238E+01 -0.18749E-01 -0.71106E+01 | ||
435 | + 1. -0.85834E+01 -0.50941E+01 -0.71026E+01 | ||
436 | + 1. 0.55200E+01 -0.78985E+01 -0.70967E+01 | ||
437 | + 1. 0.77170E+01 -0.98178E+01 -0.70883E+01 | ||
438 | + 1. 0.55726E+01 0.16679E+02 -0.70830E+01 | ||
439 | + 1. -0.97784E+01 -0.14637E+02 -0.70747E+01 | ||
440 | + 1. 0.10921E+02 -0.78991E+00 -0.70732E+01 | ||
441 | + 1. 0.13023E+02 -0.13972E+02 -0.70646E+01 | ||
442 | + 1. -0.37138E+01 0.14029E+02 -0.70564E+01 | ||
443 | + 1. -0.14344E+02 -0.43347E+01 -0.70480E+01 | ||
444 | + 1. -0.95568E+00 -0.14965E+02 -0.70413E+01 | ||
445 | + 1. -0.32639E+01 0.11066E+02 -0.70375E+01 | ||
446 | + 1. -0.11263E+02 -0.10662E+02 -0.70312E+01 | ||
447 | + 1. 0.74363E+00 0.18045E+02 -0.70208E+01 | ||
448 | + 1. 0.14505E+01 -0.10714E+02 -0.70171E+01 | ||
449 | + 1. -0.11320E+02 0.26188E+01 -0.70124E+01 | ||
450 | + 1. -0.13530E+02 0.34172E+01 -0.70052E+01 | ||
451 | + 1. 0.14446E+02 0.13498E+02 -0.69943E+01 | ||
452 | + 1. 0.19845E+02 -0.17525E+01 -0.69902E+01 | ||
453 | + 1. -0.16042E+02 -0.18093E+01 -0.69850E+01 | ||
454 | + 1. -0.48345E+01 0.10748E+01 -0.69784E+01 | ||
455 | + 1. -0.15743E+02 -0.11670E+02 -0.69684E+01 | ||
456 | + 1. -0.58789E+01 0.35805E+01 -0.69604E+01 | ||
457 | + 1. -0.58919E+01 0.17041E+02 -0.69591E+01 | ||
458 | + 1. -0.17467E+02 0.91785E+01 -0.69516E+01 | ||
459 | + 1. 0.12392E+02 0.14234E+02 -0.69467E+01 | ||
460 | + 1. -0.40167E+01 -0.14005E+02 -0.69367E+01 | ||
461 | + 1. 0.67448E+01 0.91378E+01 -0.69321E+01 | ||
462 | + 1. -0.80091E+01 0.13259E+02 -0.69243E+01 | ||
463 | + 1. 0.14348E+02 0.39702E+01 -0.69158E+01 | ||
464 | + 1. -0.33020E+01 -0.39947E+01 -0.69085E+01 | ||
465 | + 1. 0.96580E+01 0.83376E+00 -0.69040E+01 | ||
466 | + 1. 0.19121E+01 -0.17794E+02 -0.68944E+01 | ||
467 | + 1. -0.77314E+01 -0.13342E+02 -0.68879E+01 | ||
468 | + 1. -0.12359E+01 -0.56307E+01 -0.68859E+01 | ||
469 | + 1. 0.35610E+01 -0.11122E+02 -0.68736E+01 | ||
470 | + 1. -0.10838E+02 0.48866E+01 -0.68679E+01 | ||
471 | + 1. -0.15426E+02 -0.65133E+01 -0.68661E+01 | ||
472 | + 1. 0.17411E+02 0.73878E+01 -0.68575E+01 | ||
473 | + 1. 0.40132E+01 -0.13629E+02 -0.68514E+01 | ||
474 | + 1. -0.13715E+02 -0.14393E+02 -0.68458E+01 | ||
475 | + 1. -0.17351E+01 -0.87784E+01 -0.68347E+01 | ||
476 | + 1. -0.94285E+01 -0.81157E+01 -0.68275E+01 | ||
477 | + 1. -0.12722E+02 0.15055E+02 -0.68217E+01 | ||
478 | + 1. -0.76009E+01 -0.31767E+01 -0.68197E+01 | ||
479 | + 1. -0.58066E+01 -0.11533E+02 -0.68092E+01 | ||
480 | + 1. 0.17090E+01 -0.73952E+01 -0.68003E+01 | ||
481 | + 1. 0.16852E+02 -0.53917E+01 -0.67974E+01 | ||
482 | + 1. 0.10404E+02 0.80109E+01 -0.67878E+01 | ||
483 | + 1. -0.32767E+01 0.17226E+02 -0.67826E+01 | ||
484 | + 1. 0.75688E+01 -0.14707E+02 -0.67784E+01 | ||
485 | + 1. -0.17374E+02 0.18735E+01 -0.67681E+01 | ||
486 | + 1. 0.18144E+01 0.12471E+02 -0.67628E+01 | ||
487 | + 1. -0.10178E+02 0.96669E+01 -0.67599E+01 | ||
488 | + 1. -0.30469E+01 -0.68186E+01 -0.67479E+01 | ||
489 | + 1. 0.15562E+02 0.55766E+00 -0.67413E+01 | ||
490 | + 1. 0.96032E+01 -0.14521E+02 -0.67366E+01 | ||
491 | + 1. 0.11403E+02 0.56438E+01 -0.67287E+01 | ||
492 | + 1. -0.52090E+00 -0.12910E+02 -0.67201E+01 | ||
493 | + 1. 0.10141E+02 -0.43883E+01 -0.67134E+01 | ||
494 | + 1. 0.11503E+02 0.26692E+01 -0.67097E+01 | ||
495 | + 1. -0.19161E+02 -0.57064E+01 -0.67032E+01 | ||
496 | + 1. 0.18535E+02 0.98620E-01 -0.66987E+01 | ||
497 | + 1. -0.11552E+02 -0.48205E+01 -0.66870E+01 | ||
498 | + 1. 0.18965E-01 0.19936E+02 -0.66860E+01 | ||
499 | + 1. -0.49916E+01 0.18955E+02 -0.66750E+01 | ||
500 | + 1. -0.94228E+01 0.56521E+00 -0.66677E+01 | ||
501 | + 1. 0.77771E+01 0.16205E+01 -0.66603E+01 | ||
502 | + 1. -0.18521E+02 -0.92628E+00 -0.66568E+01 | ||
503 | + 1. 0.60708E+00 0.49262E+01 -0.66483E+01 | ||
504 | + 1. 0.14150E+02 0.10182E+02 -0.66461E+01 | ||
505 | + 1. -0.12400E+02 0.12503E+02 -0.66393E+01 | ||
506 | + 1. -0.69158E+00 0.88270E+01 -0.66314E+01 | ||
507 | + 1. 0.13361E+02 0.80722E+01 -0.66223E+01 | ||
508 | + 1. 0.10280E+02 -0.16804E+02 -0.66181E+01 | ||
509 | + 1. 0.72809E+00 0.14976E+02 -0.66070E+01 | ||
510 | + 1. -0.12576E+02 -0.12198E+02 -0.66010E+01 | ||
511 | + 1. -0.78414E+00 0.20687E+01 -0.65953E+01 | ||
512 | + 1. 0.71900E+01 -0.61352E+01 -0.65927E+01 | ||
513 | + 1. 0.21949E+01 -0.19761E+02 -0.65851E+01 | ||
514 | + 1. -0.19645E+02 0.32465E+01 -0.65767E+01 | ||
515 | + 1. 0.56229E+01 -0.19085E+02 -0.65683E+01 | ||
516 | + 1. 0.14542E+02 -0.85328E+01 -0.65640E+01 | ||
517 | + 1. -0.17829E+01 -0.19898E+02 -0.65549E+01 | ||
518 | + 1. 0.49514E+01 0.14677E+02 -0.65473E+01 | ||
519 | + 1. 0.78970E+01 -0.26307E+01 -0.65465E+01 | ||
520 | + 1. 0.92947E+01 -0.86602E+01 -0.65348E+01 | ||
521 | + 1. -0.11449E+01 0.11854E+02 -0.65273E+01 | ||
522 | + 1. 0.57248E+01 -0.16573E+02 -0.65250E+01 | ||
523 | + 1. -0.15761E+02 -0.94820E+01 -0.65167E+01 | ||
524 | + 1. -0.18111E+02 -0.79791E+01 -0.65108E+01 | ||
525 | + 1. 0.55297E+01 -0.10891E+02 -0.65018E+01 | ||
526 | + 1. -0.85134E+01 0.15880E+02 -0.64944E+01 | ||
527 | + 1. -0.18612E+02 0.72510E+01 -0.64897E+01 | ||
528 | + 1. 0.12594E+02 -0.39881E+01 -0.64832E+01 | ||
529 | + 1. 0.90149E+01 0.40904E+01 -0.64745E+01 | ||
530 | + 1. 0.34381E+01 0.77871E+01 -0.64712E+01 | ||
531 | + 1. -0.99651E+01 -0.17135E+02 -0.64627E+01 | ||
532 | + 1. -0.43907E+01 -0.18891E+02 -0.64541E+01 | ||
533 | + 1. -0.10397E+02 0.16551E+02 -0.64530E+01 | ||
534 | + 1. -0.13067E+02 0.15388E+01 -0.64436E+01 | ||
535 | + 1. -0.12683E+02 -0.77203E+01 -0.64365E+01 | ||
536 | + 1. 0.15234E+01 -0.35986E+00 -0.64307E+01 | ||
537 | + 1. 0.15428E+02 0.79489E+01 -0.64261E+01 | ||
538 | + 1. 0.32329E+00 -0.16587E+02 -0.64187E+01 | ||
539 | + 1. -0.65478E+01 -0.51759E+01 -0.64107E+01 | ||
540 | + 1. -0.89387E+01 0.72420E+01 -0.64006E+01 | ||
541 | + 1. 0.36333E+01 -0.78128E+01 -0.63966E+01 | ||
542 | + 1. 0.10259E+02 0.17126E+02 -0.63903E+01 | ||
543 | + 1. -0.27884E+01 -0.19867E+01 -0.63835E+01 | ||
544 | + 1. 0.57827E+01 0.12219E+02 -0.63774E+01 | ||
545 | + 1. 0.17522E+02 -0.96229E+01 -0.63686E+01 | ||
546 | + 1. 0.80804E+01 -0.11974E+02 -0.63640E+01 | ||
547 | + 1. -0.30841E+01 -0.10887E+02 -0.63580E+01 | ||
548 | + 1. -0.73949E+01 -0.86136E+01 -0.63496E+01 | ||
549 | + 1. 0.60930E+01 0.67968E+01 -0.63407E+01 | ||
550 | + 1. 0.42327E+01 -0.53033E+01 -0.63377E+01 | ||
551 | + 1. -0.65649E+01 0.28585E+00 -0.63306E+01 | ||
552 | + 1. -0.86865E+00 0.35375E-02 -0.63201E+01 | ||
553 | + 1. -0.15063E+02 0.10500E+02 -0.63140E+01 | ||
554 | + 1. -0.16898E+01 0.38852E+01 -0.63093E+01 | ||
555 | + 1. 0.12520E+02 0.20843E+00 -0.63026E+01 | ||
556 | + 1. 0.49111E+01 -0.12405E+01 -0.62970E+01 | ||
557 | + 1. 0.16433E+02 0.56419E+01 -0.62877E+01 | ||
558 | + 1. 0.12452E+01 -0.35625E+01 -0.62825E+01 | ||
559 | + 1. -0.13422E+01 0.17638E+02 -0.62743E+01 | ||
560 | + 1. 0.11419E+02 -0.12934E+02 -0.62732E+01 | ||
561 | + 1. -0.97908E+01 -0.27088E+01 -0.62621E+01 | ||
562 | + 1. 0.14894E+02 -0.55901E+01 -0.62586E+01 | ||
563 | + 1. -0.13407E+01 0.13848E+02 -0.62486E+01 | ||
564 | + 1. 0.82385E+01 -0.17424E+02 -0.62420E+01 | ||
565 | + 1. -0.15377E+02 0.31793E-01 -0.62373E+01 | ||
566 | + 1. -0.13795E+01 0.63954E+01 -0.62331E+01 | ||
567 | + 1. -0.49546E+01 -0.74651E+01 -0.62201E+01 | ||
568 | + 1. 0.41088E+01 0.19142E+01 -0.62176E+01 | ||
569 | + 1. 0.10498E+02 0.10472E+02 -0.62116E+01 | ||
570 | + 1. -0.39773E+01 0.93196E+01 -0.62019E+01 | ||
571 | + 1. 0.85097E+01 0.75527E+01 -0.61986E+01 | ||
572 | + 1. -0.15422E+02 0.35609E+01 -0.61912E+01 | ||
573 | + 1. -0.11305E+02 0.79298E+01 -0.61828E+01 | ||
574 | + 1. -0.27892E+01 -0.15487E+02 -0.61764E+01 | ||
575 | + 1. -0.17172E+02 0.58495E+01 -0.61718E+01 | ||
576 | + 1. 0.74049E+01 0.15762E+02 -0.61655E+01 | ||
577 | + 1. -0.12735E+02 -0.30214E+01 -0.61583E+01 | ||
578 | + 1. 0.14726E+02 -0.27534E+01 -0.61496E+01 | ||
579 | + 1. 0.38786E+01 0.17460E+02 -0.61453E+01 | ||
580 | + 1. -0.19155E+02 -0.37236E+01 -0.61397E+01 | ||
581 | + 1. 0.15672E+02 -0.10812E+02 -0.61281E+01 | ||
582 | + 1. -0.54454E+01 0.13006E+02 -0.61216E+01 | ||
583 | + 1. 0.17946E+02 0.32140E+01 -0.61144E+01 | ||
584 | + 1. -0.67632E+01 0.95791E+01 -0.61070E+01 | ||
585 | + 1. -0.78040E+01 0.18937E+01 -0.61064E+01 | ||
586 | + 1. 0.17643E+02 -0.17725E+01 -0.60941E+01 | ||
587 | + 1. -0.46386E+01 0.15601E+02 -0.60889E+01 | ||
588 | + 1. 0.20587E+01 0.63730E+01 -0.60806E+01 | ||
589 | + 1. 0.19027E+02 0.61374E+01 -0.60758E+01 | ||
590 | + 1. 0.59621E+01 0.96394E+00 -0.60670E+01 | ||
591 | + 1. -0.15014E+02 0.67030E+01 -0.60637E+01 | ||
592 | + 1. -0.10257E+02 0.14062E+02 -0.60547E+01 | ||
593 | + 1. 0.25565E+00 -0.93911E+01 -0.60512E+01 | ||
594 | + 1. -0.10471E+02 -0.12725E+02 -0.60401E+01 | ||
595 | + 1. -0.19283E+02 0.13246E+01 -0.60398E+01 | ||
596 | + 1. -0.16124E+02 -0.40788E+01 -0.60322E+01 | ||
597 | + 1. -0.69963E+01 -0.18063E+02 -0.60202E+01 | ||
598 | + 1. 0.36744E+01 0.12687E+02 -0.60151E+01 | ||
599 | + 1. -0.11562E+02 -0.14901E+02 -0.60120E+01 | ||
600 | + 1. 0.22083E+00 -0.19060E+02 -0.60021E+01 | ||
601 | + 1. -0.58167E+01 -0.14585E+02 -0.59942E+01 | ||
602 | + 1. 0.56768E+00 0.10603E+02 -0.59919E+01 | ||
603 | + 1. 0.13739E+02 -0.12326E+02 -0.59823E+01 | ||
604 | + 1. -0.44784E+01 0.56451E+01 -0.59763E+01 | ||
605 | + 1. -0.12483E+02 0.56827E+01 -0.59715E+01 | ||
606 | + 1. -0.82096E+01 -0.11410E+01 -0.59651E+01 | ||
607 | + 1. -0.13013E+02 -0.92352E+00 -0.59595E+01 | ||
608 | + 1. 0.10437E+02 -0.11004E+02 -0.59492E+01 | ||
609 | + 1. 0.16426E+02 -0.77490E+01 -0.59448E+01 | ||
610 | + 1. 0.12622E+02 -0.59415E+01 -0.59364E+01 | ||
611 | + 1. 0.10300E+02 0.12898E+02 -0.59269E+01 | ||
612 | + 1. 0.11716E+01 0.16430E+01 -0.59229E+01 | ||
613 | + 1. 0.36793E+01 0.97609E+01 -0.59169E+01 | ||
614 | + 1. -0.40523E+00 -0.73008E+01 -0.59098E+01 | ||
615 | + 1. 0.15105E+02 0.11898E+02 -0.59042E+01 | ||
616 | + 1. 0.36338E+01 -0.18231E+02 -0.58949E+01 | ||
617 | + 1. 0.78608E+01 -0.48704E+00 -0.58931E+01 | ||
618 | + 1. -0.71894E+01 0.47856E+01 -0.58823E+01 | ||
619 | + 1. -0.79412E+01 -0.10947E+02 -0.58755E+01 | ||
620 | + 1. 0.21849E+01 0.19264E+02 -0.58673E+01 | ||
621 | + 1. -0.61866E+01 -0.18526E+01 -0.58660E+01 | ||
622 | + 1. 0.14265E+02 -0.70501E+00 -0.58561E+01 | ||
623 | + 1. -0.11138E+02 -0.88799E+01 -0.58520E+01 | ||
624 | + 1. 0.95298E+01 -0.65942E+01 -0.58442E+01 | ||
625 | + 1. -0.29697E+01 0.22334E+01 -0.58380E+01 | ||
626 | + 1. 0.82744E+01 0.10924E+02 -0.58327E+01 | ||
627 | + 1. 0.17422E+02 0.92300E+01 -0.58203E+01 | ||
628 | + 1. -0.90606E+01 0.11858E+02 -0.58198E+01 | ||
629 | + 1. 0.68436E+01 -0.42837E+01 -0.58085E+01 | ||
630 | + 1. -0.42639E+01 -0.54698E+01 -0.58036E+01 | ||
631 | + 1. -0.47590E+01 -0.94370E+01 -0.57951E+01 | ||
632 | + 1. -0.95918E+01 0.34564E+01 -0.57925E+01 | ||
633 | + 1. 0.58487E+01 0.29882E+01 -0.57828E+01 | ||
634 | + 1. 0.10643E+01 -0.13923E+02 -0.57749E+01 | ||
635 | + 1. -0.16241E+01 -0.17070E+02 -0.57719E+01 | ||
636 | + 1. 0.12131E+02 -0.15286E+02 -0.57646E+01 | ||
637 | + 1. 0.28174E+01 0.15169E+02 -0.57585E+01 | ||
638 | + 1. 0.41963E+01 -0.15344E+02 -0.57496E+01 | ||
639 | + 1. 0.12979E+02 -0.95761E+01 -0.57410E+01 | ||
640 | + 1. -0.86509E+01 -0.66022E+01 -0.57374E+01 | ||
641 | + 1. 0.44929E+01 0.53488E+01 -0.57289E+01 | ||
642 | + 1. -0.53671E+01 0.75920E+01 -0.57219E+01 | ||
643 | + 1. -0.11209E+02 0.46631E+00 -0.57176E+01 | ||
644 | + 1. -0.13547E+02 0.87958E+01 -0.57110E+01 | ||
645 | + 1. 0.70392E+01 -0.84097E+01 -0.57048E+01 | ||
646 | + 1. 0.18938E+02 -0.33802E+01 -0.56941E+01 | ||
647 | + 1. 0.39737E+01 -0.34184E+01 -0.56890E+01 | ||
648 | + 1. -0.73925E+01 0.18468E+02 -0.56852E+01 | ||
649 | + 1. -0.97657E+00 -0.26064E+01 -0.56745E+01 | ||
650 | + 1. 0.15832E+02 0.31904E+01 -0.56686E+01 | ||
651 | + 1. -0.28821E+01 -0.12783E+02 -0.56624E+01 | ||
652 | + 1. -0.83847E+01 -0.15827E+02 -0.56548E+01 | ||
653 | + 1. 0.49759E+01 0.19156E+02 -0.56474E+01 | ||
654 | + 1. -0.13331E+02 -0.58427E+01 -0.56450E+01 | ||
655 | + 1. 0.13891E+02 0.60039E+01 -0.56378E+01 | ||
656 | + 1. 0.18614E+01 0.35075E+01 -0.56321E+01 | ||
657 | + 1. -0.17130E+02 -0.59926E+01 -0.56216E+01 | ||
658 | + 1. 0.26111E+01 -0.12532E+02 -0.56191E+01 | ||
659 | + 1. 0.19301E+01 0.17042E+02 -0.56133E+01 | ||
660 | + 1. 0.12729E+02 0.11494E+02 -0.56039E+01 | ||
661 | + 1. 0.22133E+01 -0.57505E+01 -0.55965E+01 | ||
662 | + 1. 0.12803E+02 0.40393E+01 -0.55908E+01 | ||
663 | + 1. -0.20939E+01 0.19434E+02 -0.55816E+01 | ||
664 | + 1. 0.12133E+02 -0.16821E+01 -0.55739E+01 | ||
665 | + 1. 0.16553E+02 -0.33754E+01 -0.55701E+01 | ||
666 | + 1. 0.74079E+01 0.18016E+02 -0.55602E+01 | ||
667 | + 1. -0.13082E+02 -0.97763E+01 -0.55600E+01 | ||
668 | + 1. -0.28807E+01 0.12627E+02 -0.55525E+01 | ||
669 | + 1. 0.18966E+02 -0.61007E+01 -0.55450E+01 | ||
670 | + 1. -0.16573E+02 0.79650E+01 -0.55343E+01 | ||
671 | + 1. -0.66423E+01 0.15105E+02 -0.55322E+01 | ||
672 | + 1. -0.14652E+02 -0.12937E+02 -0.55232E+01 | ||
673 | + 1. 0.22350E+01 -0.15968E+02 -0.55150E+01 | ||
674 | + 1. 0.96245E+01 -0.28180E+01 -0.55120E+01 | ||
675 | + 1. -0.44268E+01 0.36432E+01 -0.55054E+01 | ||
676 | + 1. 0.11099E+02 0.15163E+02 -0.54935E+01 | ||
677 | + 1. 0.45051E+00 0.74981E+01 -0.54925E+01 | ||
678 | + 1. -0.49357E+01 -0.33721E+01 -0.54860E+01 | ||
679 | + 1. -0.43874E+01 -0.16920E+02 -0.54766E+01 | ||
680 | + 1. 0.76787E+01 0.53271E+01 -0.54723E+01 | ||
681 | + 1. -0.11799E+02 0.10384E+02 -0.54645E+01 | ||
682 | + 1. -0.17248E+02 0.11471E+00 -0.54559E+01 | ||
683 | + 1. -0.98509E+01 -0.10385E+02 -0.54491E+01 | ||
684 | + 1. 0.92675E+01 0.22207E+01 -0.54462E+01 | ||
685 | + 1. 0.51253E+01 -0.90290E+01 -0.54355E+01 | ||
686 | + 1. 0.88507E+01 0.14430E+02 -0.54269E+01 | ||
687 | + 1. -0.14645E+02 -0.20426E+01 -0.54266E+01 | ||
688 | + 1. -0.46030E+01 -0.30754E+00 -0.54151E+01 | ||
689 | + 1. 0.31829E+01 0.17736E+00 -0.54069E+01 | ||
690 | + 1. -0.17305E+02 -0.25475E+01 -0.54013E+01 | ||
691 | + 1. -0.16384E+02 -0.78712E+01 -0.53992E+01 | ||
692 | + 1. 0.55747E+01 -0.13803E+02 -0.53887E+01 | ||
693 | + 1. 0.11081E+02 -0.86790E+01 -0.53826E+01 | ||
694 | + 1. 0.12445E+02 0.94806E+01 -0.53789E+01 | ||
695 | + 1. -0.16876E+02 0.10469E+02 -0.53689E+01 | ||
696 | + 1. -0.46682E+01 0.11068E+02 -0.53662E+01 | ||
697 | + 1. -0.14053E+02 0.12331E+02 -0.53568E+01 | ||
698 | + 1. 0.19709E+02 0.20681E+01 -0.53493E+01 | ||
699 | + 1. -0.19183E+01 0.98248E+01 -0.53440E+01 | ||
700 | + 1. -0.99713E+01 -0.46270E+01 -0.53335E+01 | ||
701 | + 1. 0.17022E+02 0.64437E+00 -0.53271E+01 | ||
702 | + 1. 0.97779E+01 -0.78267E+00 -0.53217E+01 | ||
703 | + 1. 0.22839E+01 -0.91238E+01 -0.53179E+01 | ||
704 | + 1. 0.22237E+01 -0.19283E+01 -0.53085E+01 | ||
705 | + 1. 0.13263E+02 0.20520E+01 -0.53059E+01 | ||
706 | + 1. 0.11644E+02 0.71196E+01 -0.52940E+01 | ||
707 | + 1. -0.13680E+01 0.15745E+02 -0.52905E+01 | ||
708 | + 1. 0.19031E+01 0.90416E+01 -0.52849E+01 | ||
709 | + 1. 0.85945E+01 -0.15564E+02 -0.52746E+01 | ||
710 | + 1. -0.12426E+02 0.30698E+01 -0.52724E+01 | ||
711 | + 1. -0.13038E+01 -0.10588E+02 -0.52626E+01 | ||
712 | + 1. 0.59173E+01 0.10167E+02 -0.52564E+01 | ||
713 | + 1. 0.56502E+01 -0.63349E+01 -0.52486E+01 | ||
714 | + 1. 0.35968E+00 0.12953E+02 -0.52461E+01 | ||
715 | + 1. -0.32575E+01 0.72957E+01 -0.52359E+01 | ||
716 | + 1. 0.19862E+02 -0.71126E+00 -0.52328E+01 | ||
717 | + 1. -0.18950E+02 0.56332E+01 -0.52258E+01 | ||
718 | + 1. -0.66342E+01 -0.12707E+02 -0.52183E+01 | ||
719 | + 1. -0.17836E+02 0.33705E+01 -0.52072E+01 | ||
720 | + 1. -0.23619E+01 -0.57377E+01 -0.52035E+01 | ||
721 | + 1. -0.90060E+01 0.88952E+01 -0.51970E+01 | ||
722 | + 1. 0.73475E+01 0.13126E+02 -0.51899E+01 | ||
723 | + 1. -0.46968E+01 -0.11970E+02 -0.51842E+01 | ||
724 | + 1. -0.96728E+01 0.56553E+01 -0.51734E+01 | ||
725 | + 1. 0.98129E+01 0.57489E+01 -0.51730E+01 | ||
726 | + 1. -0.11405E+02 -0.62656E+01 -0.51611E+01 | ||
727 | + 1. 0.13340E+02 0.14235E+02 -0.51578E+01 | ||
728 | + 1. -0.74789E+01 0.66741E+01 -0.51521E+01 | ||
729 | + 1. -0.45476E+01 0.17569E+02 -0.51464E+01 | ||
730 | + 1. 0.69929E+01 -0.10781E+02 -0.51348E+01 | ||
731 | + 1. 0.89730E+01 -0.13494E+02 -0.51296E+01 | ||
732 | + 1. -0.52037E+00 -0.49601E+01 -0.51221E+01 | ||
733 | + 1. 0.55862E+01 0.16123E+02 -0.51184E+01 | ||
734 | + 1. -0.19617E+02 -0.17961E+01 -0.51112E+01 | ||
735 | + 1. -0.25711E+01 -0.20476E-01 -0.51035E+01 | ||
736 | + 1. 0.70237E+01 -0.18549E+02 -0.50957E+01 | ||
737 | + 1. -0.11212E+02 -0.17326E+01 -0.50878E+01 | ||
738 | + 1. -0.14378E+02 -0.79279E+01 -0.50866E+01 | ||
739 | + 1. -0.12643E+01 -0.14085E+02 -0.50762E+01 | ||
740 | + 1. 0.63266E+01 -0.22817E+01 -0.50715E+01 | ||
741 | + 1. -0.24958E+01 -0.77871E+01 -0.50658E+01 | ||
742 | + 1. -0.60178E+01 0.20140E+01 -0.50536E+01 | ||
743 | + 1. -0.16582E+02 -0.11034E+02 -0.50496E+01 | ||
744 | + 1. 0.13626E+02 -0.74356E+01 -0.50404E+01 | ||
745 | + 1. -0.13036E+02 0.14104E+02 -0.50398E+01 | ||
746 | + 1. -0.78905E+01 -0.40344E+01 -0.50314E+01 | ||
747 | + 1. -0.85747E+01 -0.13534E+02 -0.50255E+01 | ||
748 | + 1. -0.65552E+01 -0.71409E+01 -0.50172E+01 | ||
749 | + 1. -0.63062E+01 -0.16361E+02 -0.50118E+01 | ||
750 | + 1. 0.63594E-01 0.18761E+02 -0.50024E+01 | ||
751 | + 1. 0.10709E+02 0.39684E+01 -0.49946E+01 | ||
752 | + 1. -0.66056E+01 0.11563E+02 -0.49911E+01 | ||
753 | + 1. -0.15410E+02 0.18246E+01 -0.49835E+01 | ||
754 | + 1. 0.69017E+01 0.83338E+01 -0.49797E+01 | ||
755 | + 1. 0.10921E+02 -0.52378E+01 -0.49693E+01 | ||
756 | + 1. 0.19298E+02 0.42136E+01 -0.49628E+01 | ||
757 | + 1. 0.98186E+01 0.87658E+01 -0.49564E+01 | ||
758 | + 1. -0.11380E+02 0.15488E+02 -0.49490E+01 | ||
759 | + 1. -0.75949E-02 0.37522E+01 -0.49429E+01 | ||
760 | + 1. -0.91193E+01 0.17477E+02 -0.49348E+01 | ||
761 | + 1. -0.10963E+02 0.12450E+02 -0.49311E+01 | ||
762 | + 1. 0.16399E+00 -0.12050E+02 -0.49240E+01 | ||
763 | + 1. -0.31333E+01 -0.18600E+02 -0.49168E+01 | ||
764 | + 1. 0.13903E+02 -0.42715E+01 -0.49105E+01 | ||
765 | + 1. -0.15189E+02 -0.56562E+01 -0.49028E+01 | ||
766 | + 1. -0.14035E+02 0.49815E+01 -0.48984E+01 | ||
767 | + 1. -0.12672E+02 -0.13647E+02 -0.48880E+01 | ||
768 | + 1. 0.14429E+02 0.89155E+01 -0.48831E+01 | ||
769 | + 1. 0.89330E+01 0.16575E+02 -0.48736E+01 | ||
770 | + 1. -0.22612E+01 0.52070E+01 -0.48678E+01 | ||
771 | + 1. 0.46794E+01 -0.11706E+02 -0.48623E+01 | ||
772 | + 1. -0.27308E+01 -0.37865E+01 -0.48592E+01 | ||
773 | + 1. -0.11037E+02 -0.16589E+02 -0.48472E+01 | ||
774 | + 1. -0.39440E+01 -0.14508E+02 -0.48408E+01 | ||
775 | + 1. -0.83491E+01 0.14278E+02 -0.48339E+01 | ||
776 | + 1. 0.46086E+01 0.82600E+01 -0.48275E+01 | ||
777 | + 1. 0.16463E+02 0.10696E+02 -0.48266E+01 | ||
778 | + 1. 0.11314E+02 0.13284E+01 -0.48151E+01 | ||
779 | + 1. 0.17249E+02 -0.51869E+01 -0.48099E+01 | ||
780 | + 1. 0.17277E+02 0.69474E+01 -0.48057E+01 | ||
781 | + 1. 0.13649E+02 -0.14139E+02 -0.47957E+01 | ||
782 | + 1. 0.15241E+02 -0.91565E+01 -0.47902E+01 | ||
783 | + 1. 0.21782E+01 0.11970E+02 -0.47848E+01 | ||
784 | + 1. -0.86981E+01 -0.88637E+01 -0.47759E+01 | ||
785 | + 1. -0.58277E+01 -0.19136E+02 -0.47718E+01 | ||
786 | + 1. -0.11448E+02 -0.11528E+02 -0.47608E+01 | ||
787 | + 1. 0.41424E+01 0.33168E+01 -0.47547E+01 | ||
788 | + 1. -0.94341E+01 0.14404E+01 -0.47468E+01 | ||
789 | + 1. -0.34380E+01 0.14632E+02 -0.47450E+01 | ||
790 | + 1. -0.87340E+01 -0.17643E+02 -0.47349E+01 | ||
791 | + 1. 0.66373E+01 -0.16068E+02 -0.47301E+01 | ||
792 | + 1. 0.16031E+02 -0.14122E+01 -0.47245E+01 | ||
793 | + 1. -0.17798E+02 -0.91162E+01 -0.47175E+01 | ||
794 | + 1. 0.18213E+02 -0.78721E+01 -0.47113E+01 | ||
795 | + 1. 0.10480E+02 -0.16172E+02 -0.47044E+01 | ||
796 | + 1. -0.16028E+02 0.50782E+01 -0.46962E+01 | ||
797 | + 1. 0.87943E+01 -0.47851E+01 -0.46883E+01 | ||
798 | + 1. 0.68399E+00 0.15682E+02 -0.46841E+01 | ||
799 | + 1. 0.20181E+01 -0.17929E+02 -0.46746E+01 | ||
800 | + 1. 0.10013E+00 -0.57815E+00 -0.46668E+01 | ||
801 | + 1. 0.12475E+02 -0.11207E+02 -0.46662E+01 | ||
802 | + 1. 0.48117E+01 -0.17169E+02 -0.46562E+01 | ||
803 | + 1. -0.18932E+02 -0.52410E+01 -0.46474E+01 | ||
804 | + 1. -0.70604E+00 0.14558E+01 -0.46441E+01 | ||
805 | + 1. 0.93320E+01 -0.93490E+01 -0.46338E+01 | ||
806 | + 1. 0.15596E+02 -0.12206E+02 -0.46319E+01 | ||
807 | + 1. -0.14294E+02 -0.38713E+01 -0.46245E+01 | ||
808 | + 1. -0.12312E+02 -0.42534E+01 -0.46142E+01 | ||
809 | + 1. -0.79700E-01 -0.17630E+02 -0.46069E+01 | ||
810 | + 1. 0.77267E+01 -0.65005E+01 -0.46040E+01 | ||
811 | + 1. 0.53713E+01 0.13139E+02 -0.45996E+01 | ||
812 | + 1. -0.62159E+01 -0.10396E+02 -0.45933E+01 | ||
813 | + 1. -0.40455E+01 0.19436E+02 -0.45809E+01 | ||
814 | + 1. -0.15080E+02 0.94342E+01 -0.45736E+01 | ||
815 | + 1. 0.17192E+02 0.44294E+01 -0.45671E+01 | ||
816 | + 1. -0.22085E+00 0.58118E+01 -0.45611E+01 | ||
817 | + 1. -0.76520E+01 0.50942E+00 -0.45580E+01 | ||
818 | + 1. -0.14405E+01 0.78421E+01 -0.45501E+01 | ||
819 | + 1. 0.11090E+02 -0.14055E+02 -0.45424E+01 | ||
820 | + 1. 0.15141E+02 0.56478E+00 -0.45338E+01 | ||
821 | + 1. -0.26092E+01 0.17374E+02 -0.45325E+01 | ||
822 | + 1. 0.15478E+02 -0.65814E+01 -0.45234E+01 | ||
823 | + 1. -0.11241E+02 0.45699E+01 -0.45187E+01 | ||
824 | + 1. 0.74896E+01 0.21925E+01 -0.45120E+01 | ||
825 | + 1. 0.31983E+01 -0.72983E+01 -0.45005E+01 | ||
826 | + 1. 0.71024E+01 -0.12714E+02 -0.44962E+01 | ||
827 | + 1. 0.10845E+01 -0.77069E+01 -0.44924E+01 | ||
828 | + 1. -0.13568E+02 0.55452E+00 -0.44864E+01 | ||
829 | + 1. -0.74554E+01 0.32801E+01 -0.44746E+01 | ||
830 | + 1. -0.19593E+02 0.26354E+01 -0.44717E+01 | ||
831 | + 1. 0.15190E+02 0.70968E+01 -0.44604E+01 | ||
832 | + 1. -0.52990E+01 0.93030E+01 -0.44586E+01 | ||
833 | + 1. 0.60864E+01 0.46542E+01 -0.44508E+01 | ||
834 | + 1. -0.12343E+01 0.11845E+02 -0.44463E+01 | ||
835 | + 1. 0.41515E+01 0.11347E+02 -0.44370E+01 | ||
836 | + 1. 0.64474E+01 -0.14215E+00 -0.44269E+01 | ||
837 | + 1. -0.14542E+02 -0.10567E+02 -0.44215E+01 | ||
838 | + 1. -0.63226E+01 0.16940E+02 -0.44174E+01 | ||
839 | + 1. 0.33976E+00 -0.15556E+02 -0.44077E+01 | ||
840 | + 1. 0.96921E+01 0.11633E+02 -0.44044E+01 | ||
841 | + 1. -0.36982E+01 -0.18672E+01 -0.43976E+01 | ||
842 | + 1. 0.52368E+01 -0.19294E+02 -0.43877E+01 | ||
843 | + 1. -0.30436E+01 -0.99989E+01 -0.43807E+01 | ||
844 | + 1. -0.12169E+02 0.74054E+01 -0.43739E+01 | ||
845 | + 1. 0.11763E+02 0.12819E+02 -0.43698E+01 | ||
846 | + 1. 0.17069E+02 -0.10078E+02 -0.43654E+01 | ||
847 | + 1. 0.13031E+02 0.26343E+00 -0.43557E+01 | ||
848 | + 1. -0.12444E+02 -0.80920E+01 -0.43528E+01 | ||
849 | + 1. 0.31692E+01 0.65014E+01 -0.43414E+01 | ||
850 | + 1. 0.14561E+02 0.45955E+01 -0.43360E+01 | ||
851 | + 1. 0.13614E+02 -0.22518E+01 -0.43275E+01 | ||
852 | + 1. 0.17537E+01 -0.40252E+01 -0.43238E+01 | ||
853 | + 1. -0.19096E+02 0.37266E-01 -0.43164E+01 | ||
854 | + 1. 0.34590E+01 0.19334E+02 -0.43097E+01 | ||
855 | + 1. -0.43255E+01 -0.70660E+01 -0.43030E+01 | ||
856 | + 1. 0.87280E+01 -0.17782E+02 -0.42939E+01 | ||
857 | + 1. 0.43238E+01 -0.12428E+01 -0.42900E+01 | ||
858 | + 1. -0.18181E+02 0.77948E+01 -0.42840E+01 | ||
859 | + 1. 0.29336E+01 -0.19682E+02 -0.42750E+01 | ||
860 | + 1. -0.60866E+01 0.54833E+01 -0.42720E+01 | ||
861 | + 1. 0.14992E+02 0.13099E+02 -0.42665E+01 | ||
862 | + 1. -0.53993E+01 0.14132E+02 -0.42588E+01 | ||
863 | + 1. -0.16055E+02 -0.11942E+01 -0.42506E+01 | ||
864 | + 1. 0.11813E+02 -0.33790E+01 -0.42455E+01 | ||
865 | + 1. -0.10663E+02 -0.14022E+02 -0.42382E+01 | ||
866 | + 1. 0.71527E+01 0.11368E+02 -0.42293E+01 | ||
867 | + 1. 0.49987E+01 -0.45388E+01 -0.42235E+01 | ||
868 | + 1. -0.10906E+02 0.89954E+01 -0.42141E+01 | ||
869 | + 1. -0.74830E+01 -0.20477E+01 -0.42114E+01 | ||
870 | + 1. 0.83398E+01 -0.17965E+01 -0.42033E+01 | ||
871 | + 1. 0.51798E+01 0.14290E+01 -0.41985E+01 | ||
872 | + 1. -0.14172E+02 0.70150E+01 -0.41895E+01 | ||
873 | + 1. 0.94701E+00 -0.10272E+02 -0.41844E+01 | ||
874 | + 1. 0.14233E+02 0.10843E+02 -0.41791E+01 | ||
875 | + 1. 0.11604E+02 -0.70132E+01 -0.41692E+01 | ||
876 | + 1. 0.33059E+01 0.13654E+02 -0.41656E+01 | ||
877 | + 1. -0.53013E+01 -0.49467E+01 -0.41544E+01 | ||
878 | + 1. -0.95952E+01 -0.30384E+01 -0.41512E+01 | ||
879 | + 1. 0.28982E+01 0.18329E+01 -0.41433E+01 | ||
880 | + 1. -0.16760E+02 -0.42849E+01 -0.41393E+01 | ||
881 | + 1. -0.22190E+01 -0.15850E+02 -0.41306E+01 | ||
882 | + 1. 0.18867E+02 -0.21335E+01 -0.41246E+01 | ||
883 | + 1. -0.75361E+01 0.99208E+01 -0.41153E+01 | ||
884 | + 1. 0.74515E+01 0.15411E+02 -0.41070E+01 | ||
885 | + 1. 0.34842E+01 0.16710E+02 -0.41053E+01 | ||
886 | + 1. 0.18664E+02 0.57620E+00 -0.40964E+01 | ||
887 | + 1. -0.15681E+02 0.11827E+02 -0.40889E+01 | ||
888 | + 1. 0.12375E+02 0.55239E+01 -0.40847E+01 | ||
889 | + 1. 0.16868E+02 0.22926E+01 -0.40781E+01 | ||
890 | + 1. 0.84972E+01 0.39044E+01 -0.40726E+01 | ||
891 | + 1. 0.24216E+01 -0.14558E+02 -0.40602E+01 | ||
892 | + 1. 0.84209E+01 0.73713E+01 -0.40538E+01 | ||
893 | + 1. -0.10399E+02 -0.77045E+01 -0.40495E+01 | ||
894 | + 1. -0.99952E+01 -0.36575E+00 -0.40467E+01 | ||
895 | + 1. -0.82207E+00 -0.86832E+01 -0.40356E+01 | ||
896 | + 1. 0.48108E+00 0.98288E+01 -0.40314E+01 | ||
897 | + 1. 0.94101E+01 0.74559E+00 -0.40249E+01 | ||
898 | + 1. -0.17744E+02 -0.71446E+01 -0.40154E+01 | ||
899 | + 1. 0.58890E+01 0.68495E+01 -0.40074E+01 | ||
900 | + 1. -0.90150E+01 -0.11731E+02 -0.40013E+01 | ||
901 | + 1. -0.13335E+02 0.10970E+02 -0.39977E+01 | ||
902 | + 1. -0.65330E+00 0.14291E+02 -0.39885E+01 | ||
903 | + 1. -0.17502E+02 0.14889E+01 -0.39813E+01 | ||
904 | + 1. 0.99833E+01 -0.11141E+02 -0.39766E+01 | ||
905 | + 1. 0.34290E+01 -0.10173E+02 -0.39681E+01 | ||
906 | + 1. -0.39563E+01 0.21156E+01 -0.39633E+01 | ||
907 | + 1. -0.32450E+01 0.92329E+01 -0.39583E+01 | ||
908 | + 1. 0.57608E+00 -0.19415E+02 -0.39481E+01 | ||
909 | + 1. -0.20412E+01 0.30476E+01 -0.39465E+01 | ||
910 | + 1. -0.11421E+02 0.17911E+01 -0.39363E+01 | ||
911 | + 1. -0.13126E+02 -0.21070E+01 -0.39290E+01 | ||
912 | + 1. 0.23280E+01 0.45372E+01 -0.39258E+01 | ||
913 | + 1. 0.11289E+02 0.10369E+02 -0.39162E+01 | ||
914 | + 1. 0.57610E+01 0.17998E+02 -0.39109E+01 | ||
915 | + 1. -0.98954E+01 0.11081E+02 -0.39052E+01 | ||
916 | + 1. -0.16484E+01 -0.14443E+01 -0.38954E+01 | ||
917 | + 1. 0.16499E+02 0.88526E+01 -0.38909E+01 | ||
918 | + 1. -0.88559E+01 -0.56457E+01 -0.38837E+01 | ||
919 | + 1. -0.67953E+01 -0.14538E+02 -0.38757E+01 | ||
920 | + 1. 0.19096E+02 -0.46457E+01 -0.38693E+01 | ||
921 | + 1. -0.92812E+01 -0.15715E+02 -0.38657E+01 | ||
922 | + 1. 0.11043E+02 0.16651E+02 -0.38551E+01 | ||
923 | + 1. 0.11142E+02 -0.59623E+00 -0.38474E+01 | ||
924 | + 1. 0.44182E+01 -0.14625E+02 -0.38432E+01 | ||
925 | + 1. -0.61856E+01 0.75666E+01 -0.38350E+01 | ||
926 | + 1. -0.10242E+02 0.70635E+01 -0.38281E+01 | ||
927 | + 1. -0.14615E+01 -0.19298E+02 -0.38208E+01 | ||
928 | + 1. -0.15505E+01 -0.12552E+02 -0.38154E+01 | ||
929 | + 1. 0.13468E+02 -0.93385E+01 -0.38078E+01 | ||
930 | + 1. 0.84115E+01 0.97452E+01 -0.38038E+01 | ||
931 | + 1. -0.52123E+00 0.17071E+02 -0.37984E+01 | ||
932 | + 1. -0.59110E+01 -0.38195E+00 -0.37907E+01 | ||
933 | + 1. -0.37433E+01 0.12194E+02 -0.37806E+01 | ||
934 | + 1. -0.65603E+01 0.18847E+02 -0.37753E+01 | ||
935 | + 1. 0.70663E+01 -0.36290E+01 -0.37713E+01 | ||
936 | + 1. 0.95161E+01 -0.69187E+01 -0.37610E+01 | ||
937 | + 1. 0.64689E+01 -0.85565E+01 -0.37576E+01 | ||
938 | + 1. -0.94902E+01 0.37801E+01 -0.37524E+01 | ||
939 | + 1. -0.42967E+01 0.63193E+01 -0.37422E+01 | ||
940 | + 1. -0.11577E+01 -0.66819E+01 -0.37390E+01 | ||
941 | + 1. 0.15766E+02 -0.42643E+01 -0.37277E+01 | ||
942 | + 1. -0.15497E+02 -0.12516E+02 -0.37232E+01 | ||
943 | + 1. 0.21511E+01 -0.55584E+00 -0.37154E+01 | ||
944 | + 1. -0.80380E+01 0.15992E+02 -0.37085E+01 | ||
945 | + 1. -0.80205E+01 0.12255E+02 -0.37058E+01 | ||
946 | + 1. -0.10140E+02 0.14286E+02 -0.36955E+01 | ||
947 | + 1. -0.14505E+02 0.34547E+01 -0.36890E+01 | ||
948 | + 1. 0.64576E+00 -0.24856E+01 -0.36836E+01 | ||
949 | + 1. 0.18968E+02 0.62621E+01 -0.36763E+01 | ||
950 | + 1. 0.13074E+01 0.79303E+01 -0.36704E+01 | ||
951 | + 1. 0.19758E+01 -0.12067E+02 -0.36617E+01 | ||
952 | + 1. -0.13610E+02 -0.58874E+01 -0.36559E+01 | ||
953 | + 1. -0.46671E+01 -0.89898E+01 -0.36506E+01 | ||
954 | + 1. 0.13695E+02 -0.59621E+01 -0.36404E+01 | ||
955 | + 1. -0.37552E+01 0.42223E+01 -0.36393E+01 | ||
956 | + 1. 0.11525E+02 -0.97795E+01 -0.36283E+01 | ||
957 | + 1. 0.12456E+02 0.33256E+01 -0.36242E+01 | ||
958 | + 1. 0.88354E+01 0.13313E+02 -0.36188E+01 | ||
959 | + 1. -0.68455E+01 -0.17773E+02 -0.36080E+01 | ||
960 | + 1. -0.11182E+02 -0.97814E+01 -0.36041E+01 | ||
961 | + 1. -0.15880E+02 -0.91244E+01 -0.35973E+01 | ||
962 | + 1. -0.19660E+02 -0.35127E+01 -0.35870E+01 | ||
963 | + 1. -0.46675E+01 -0.16318E+02 -0.35826E+01 | ||
964 | + 1. -0.19960E+01 0.19402E+02 -0.35785E+01 | ||
965 | + 1. 0.14697E+01 0.19546E+02 -0.35683E+01 | ||
966 | + 1. -0.11983E+01 -0.34308E+01 -0.35635E+01 | ||
967 | + 1. 0.13091E+02 0.82373E+01 -0.35599E+01 | ||
968 | + 1. 0.36792E+01 -0.30823E+01 -0.35477E+01 | ||
969 | + 1. -0.79454E+01 0.50552E+01 -0.35465E+01 | ||
970 | + 1. 0.51410E+01 0.14877E+02 -0.35377E+01 | ||
971 | + 1. 0.20160E+00 -0.13674E+02 -0.35306E+01 | ||
972 | + 1. 0.10599E+02 0.14477E+02 -0.35265E+01 | ||
973 | + 1. -0.43911E+01 0.16045E+02 -0.35179E+01 | ||
974 | + 1. 0.10632E+02 0.76106E+01 -0.35100E+01 | ||
975 | + 1. -0.17227E+02 0.94156E+01 -0.35029E+01 | ||
976 | + 1. 0.99826E+01 -0.29572E+01 -0.34988E+01 | ||
977 | + 1. -0.43220E+01 -0.19485E+02 -0.34906E+01 | ||
978 | + 1. 0.29093E+01 -0.16536E+02 -0.34840E+01 | ||
979 | + 1. -0.17284E+02 0.61054E+01 -0.34739E+01 | ||
980 | + 1. -0.44296E+01 -0.12982E+02 -0.34687E+01 | ||
981 | + 1. 0.79137E+01 -0.14486E+02 -0.34632E+01 | ||
982 | + 1. -0.34050E+01 -0.50643E+01 -0.34580E+01 | ||
983 | + 1. -0.14267E+02 0.13538E+02 -0.34467E+01 | ||
984 | + 1. 0.59913E+01 -0.11178E+02 -0.34450E+01 | ||
985 | + 1. 0.16667E+02 -0.79286E+01 -0.34387E+01 | ||
986 | + 1. 0.79686E+01 -0.10288E+02 -0.34284E+01 | ||
987 | + 1. -0.13299E+02 -0.11990E+02 -0.34253E+01 | ||
988 | + 1. 0.17510E+01 -0.60728E+01 -0.34164E+01 | ||
989 | + 1. -0.77993E+01 -0.74496E+01 -0.34100E+01 | ||
990 | + 1. 0.31437E+01 0.98427E+01 -0.34024E+01 | ||
991 | + 1. 0.18720E+02 0.26276E+01 -0.33947E+01 | ||
992 | + 1. -0.18200E+02 -0.18696E+01 -0.33905E+01 | ||
993 | + 1. -0.12050E+02 -0.15597E+02 -0.33840E+01 | ||
994 | + 1. 0.12585E+02 0.15078E+02 -0.33741E+01 | ||
995 | + 1. -0.51330E+01 -0.29210E+01 -0.33684E+01 | ||
996 | + 1. 0.56940E+01 0.94583E+01 -0.33619E+01 | ||
997 | + 1. -0.15679E+02 -0.68585E+01 -0.33566E+01 | ||
998 | + 1. 0.12670E+02 -0.15390E+02 -0.33497E+01 | ||
999 | + 1. -0.13949E+02 -0.14291E+02 -0.33422E+01 | ||
1000 | + 1. 0.12827E+02 -0.12876E+02 -0.33345E+01 | ||
1001 | + 1. -0.35110E+01 -0.13187E+00 -0.33321E+01 | ||
1002 | + 1. -0.19381E+02 0.49295E+01 -0.33247E+01 | ||
1003 | + 1. 0.78998E+00 0.89018E+00 -0.33140E+01 | ||
1004 | + 1. 0.13880E+01 0.13247E+02 -0.33074E+01 | ||
1005 | + 1. 0.15134E+02 -0.10646E+02 -0.33040E+01 | ||
1006 | + 1. 0.79390E+01 0.17675E+02 -0.32996E+01 | ||
1007 | + 1. -0.57989E+01 0.36343E+01 -0.32895E+01 | ||
1008 | + 1. -0.12809E+02 0.54764E+01 -0.32867E+01 | ||
1009 | + 1. 0.16105E+02 0.56154E+01 -0.32743E+01 | ||
1010 | + 1. -0.15316E+02 0.68704E+00 -0.32672E+01 | ||
1011 | + 1. -0.77401E+01 -0.97776E+01 -0.32620E+01 | ||
1012 | + 1. 0.14491E+02 0.24547E+01 -0.32568E+01 | ||
1013 | + 1. -0.10699E+02 -0.47546E+01 -0.32475E+01 | ||
1014 | + 1. 0.10216E+02 0.30081E+01 -0.32462E+01 | ||
1015 | + 1. -0.17266E+02 0.33716E+01 -0.32346E+01 | ||
1016 | + 1. -0.10464E+02 0.16629E+02 -0.32279E+01 | ||
1017 | + 1. -0.12446E+02 0.15246E+02 -0.32261E+01 | ||
1018 | + 1. -0.23357E+01 0.15471E+02 -0.32138E+01 | ||
1019 | + 1. 0.49710E+01 -0.70887E+01 -0.32096E+01 | ||
1020 | + 1. 0.78593E+01 0.55953E+01 -0.32050E+01 | ||
1021 | + 1. -0.72167E+01 -0.12441E+02 -0.31991E+01 | ||
1022 | + 1. -0.87439E+01 0.83880E+01 -0.31913E+01 | ||
1023 | + 1. 0.17270E+02 -0.96117E+00 -0.31833E+01 | ||
1024 | + 1. 0.21149E+01 -0.88238E+01 -0.31789E+01 | ||
1025 | + 1. 0.11809E+02 -0.51169E+01 -0.31671E+01 | ||
1026 | + 1. -0.69537E+00 -0.10795E+02 -0.31636E+01 | ||
1027 | + 1. 0.43054E+01 0.50272E+01 -0.31584E+01 | ||
1028 | + 1. -0.72963E+01 -0.43500E+01 -0.31472E+01 | ||
1029 | + 1. 0.65859E+01 -0.56826E+01 -0.31425E+01 | ||
1030 | + 1. 0.61905E+01 -0.17667E+02 -0.31355E+01 | ||
1031 | + 1. 0.18414E+02 -0.63875E+01 -0.31329E+01 | ||
1032 | + 1. -0.15278E+01 0.10093E+02 -0.31258E+01 | ||
1033 | + 1. -0.11735E+02 0.13089E+02 -0.31151E+01 | ||
1034 | + 1. 0.10139E+02 0.55961E+01 -0.31079E+01 | ||
1035 | + 1. 0.14632E+02 -0.78397E+01 -0.31016E+01 | ||
1036 | + 1. -0.84328E+01 0.21817E+01 -0.30952E+01 | ||
1037 | + 1. 0.15765E+02 0.11574E+02 -0.30914E+01 | ||
1038 | + 1. -0.21895E+01 0.63076E+01 -0.30802E+01 | ||
1039 | + 1. 0.49252E+01 -0.12846E+02 -0.30748E+01 | ||
1040 | + 1. 0.14599E+02 -0.70901E+00 -0.30687E+01 | ||
1041 | + 1. 0.67695E+01 0.13689E+02 -0.30630E+01 | ||
1042 | + 1. -0.39110E+01 0.18064E+02 -0.30580E+01 | ||
1043 | + 1. -0.30481E+01 -0.17457E+02 -0.30530E+01 | ||
1044 | + 1. 0.10063E+01 0.31022E+01 -0.30429E+01 | ||
1045 | + 1. -0.57368E+01 0.11842E+02 -0.30394E+01 | ||
1046 | + 1. 0.19214E+01 0.16002E+02 -0.30300E+01 | ||
1047 | + 1. -0.13624E+02 -0.90506E+01 -0.30212E+01 | ||
1048 | + 1. -0.74870E+00 0.46526E+01 -0.30151E+01 | ||
1049 | + 1. -0.15484E+02 0.82407E+01 -0.30076E+01 | ||
1050 | + 1. 0.56643E+01 0.31563E+01 -0.30064E+01 | ||
1051 | + 1. -0.87885E+01 -0.13704E+02 -0.29979E+01 | ||
1052 | + 1. -0.19411E+01 0.13108E+02 -0.29920E+01 | ||
1053 | + 1. 0.88106E+01 -0.12504E+02 -0.29812E+01 | ||
1054 | + 1. -0.11852E+02 -0.59169E+00 -0.29744E+01 | ||
1055 | + 1. -0.73640E+00 -0.16566E+02 -0.29676E+01 | ||
1056 | + 1. -0.15109E+02 -0.24086E+01 -0.29620E+01 | ||
1057 | + 1. 0.98771E+01 -0.14412E+02 -0.29594E+01 | ||
1058 | + 1. -0.16204E+01 0.55894E+00 -0.29498E+01 | ||
1059 | + 1. 0.63759E+01 -0.18000E+01 -0.29431E+01 | ||
1060 | + 1. -0.29435E+01 -0.81139E+01 -0.29347E+01 | ||
1061 | + 1. 0.92495E+01 -0.16375E+02 -0.29288E+01 | ||
1062 | + 1. -0.84459E+01 0.17832E+02 -0.29217E+01 | ||
1063 | + 1. -0.12667E+02 0.88319E+01 -0.29169E+01 | ||
1064 | + 1. 0.78334E+01 -0.16264E-01 -0.29104E+01 | ||
1065 | + 1. -0.15270E+02 -0.49101E+01 -0.29001E+01 | ||
1066 | + 1. -0.65993E+01 0.14075E+01 -0.28941E+01 | ||
1067 | + 1. 0.34794E+01 -0.51637E+01 -0.28892E+01 | ||
1068 | + 1. 0.13312E+02 0.12326E+02 -0.28827E+01 | ||
1069 | + 1. -0.15095E+02 0.57411E+01 -0.28747E+01 | ||
1070 | + 1. 0.90781E+01 0.15679E+02 -0.28671E+01 | ||
1071 | + 1. 0.17462E+02 -0.34217E+01 -0.28634E+01 | ||
1072 | + 1. -0.12685E+02 0.32992E+01 -0.28598E+01 | ||
1073 | + 1. -0.11932E+02 -0.67508E+01 -0.28467E+01 | ||
1074 | + 1. -0.70356E+01 0.13943E+02 -0.28454E+01 | ||
1075 | + 1. 0.19844E+02 -0.88318E+00 -0.28355E+01 | ||
1076 | + 1. -0.19508E+02 0.14317E+01 -0.28297E+01 | ||
1077 | + 1. 0.38494E+01 -0.18254E+02 -0.28219E+01 | ||
1078 | + 1. 0.11915E+02 0.10294E+01 -0.28168E+01 | ||
1079 | + 1. 0.30706E+01 0.12078E+02 -0.28088E+01 | ||
1080 | + 1. 0.17431E+02 0.72970E+01 -0.28001E+01 | ||
1081 | + 1. -0.11556E+02 -0.29976E+01 -0.27988E+01 | ||
1082 | + 1. 0.94681E+00 0.57447E+01 -0.27918E+01 | ||
1083 | + 1. 0.13307E-01 0.11405E+02 -0.27806E+01 | ||
1084 | + 1. -0.11056E+02 -0.12538E+02 -0.27738E+01 | ||
1085 | + 1. -0.30871E+01 -0.14472E+02 -0.27671E+01 | ||
1086 | + 1. 0.88855E+01 -0.85558E+01 -0.27644E+01 | ||
1087 | + 1. 0.52174E+01 0.11574E+02 -0.27596E+01 | ||
1088 | + 1. 0.96953E+01 -0.50361E+01 -0.27522E+01 | ||
1089 | + 1. -0.95256E+01 -0.17493E+02 -0.27403E+01 | ||
1090 | + 1. 0.45793E+01 0.10395E+00 -0.27338E+01 | ||
1091 | + 1. 0.16286E+02 -0.60551E+01 -0.27284E+01 | ||
1092 | + 1. 0.36478E+01 0.79969E+01 -0.27203E+01 | ||
1093 | + 1. -0.14754E+02 0.10171E+02 -0.27198E+01 | ||
1094 | + 1. 0.14986E+02 -0.26703E+01 -0.27078E+01 | ||
1095 | + 1. 0.16697E+01 -0.18183E+02 -0.27036E+01 | ||
1096 | + 1. -0.18138E+02 -0.45569E+01 -0.26936E+01 | ||
1097 | + 1. 0.13946E+02 0.63373E+01 -0.26893E+01 | ||
1098 | + 1. 0.14874E+02 -0.12794E+02 -0.26823E+01 | ||
1099 | + 1. -0.27518E+01 -0.11404E+02 -0.26770E+01 | ||
1100 | + 1. 0.55334E+01 -0.15829E+02 -0.26733E+01 | ||
1101 | + 1. -0.13420E+02 -0.37520E+01 -0.26617E+01 | ||
1102 | + 1. -0.30371E+01 -0.26905E+01 -0.26563E+01 | ||
1103 | + 1. -0.75369E+01 -0.77412E+00 -0.26503E+01 | ||
1104 | + 1. 0.49376E+01 0.19357E+02 -0.26455E+01 | ||
1105 | + 1. -0.52354E+01 -0.62482E+01 -0.26335E+01 | ||
1106 | + 1. 0.17738E+02 0.45518E+01 -0.26268E+01 | ||
1107 | + 1. 0.33634E+00 -0.49005E+01 -0.26247E+01 | ||
1108 | + 1. 0.71018E+01 0.80336E+01 -0.26195E+01 | ||
1109 | + 1. 0.27739E+01 0.17939E+02 -0.26070E+01 | ||
1110 | + 1. -0.49234E+01 0.10068E+02 -0.26022E+01 | ||
1111 | + 1. -0.58480E+01 -0.10978E+02 -0.25954E+01 | ||
1112 | + 1. 0.36792E+01 0.28555E+01 -0.25921E+01 | ||
1113 | + 1. -0.98656E+00 0.81160E+01 -0.25824E+01 | ||
1114 | + 1. 0.12789E+02 0.10211E+02 -0.25752E+01 | ||
1115 | + 1. -0.46411E+01 0.80537E+01 -0.25674E+01 | ||
1116 | + 1. 0.11006E+02 0.12235E+02 -0.25646E+01 | ||
1117 | + 1. -0.17716E+02 -0.87762E+01 -0.25539E+01 | ||
1118 | + 1. -0.16957E+02 -0.47682E+00 -0.25533E+01 | ||
1119 | + 1. -0.16700E+02 -0.10931E+02 -0.25448E+01 | ||
1120 | + 1. -0.37352E+01 0.14111E+02 -0.25353E+01 | ||
1121 | + 1. 0.14706E+02 0.91405E+01 -0.25281E+01 | ||
1122 | + 1. 0.76832E+01 0.25152E+01 -0.25234E+01 | ||
1123 | + 1. 0.12124E+02 -0.23723E+01 -0.25177E+01 | ||
1124 | + 1. 0.10140E+02 0.94523E+01 -0.25129E+01 | ||
1125 | + 1. 0.48272E+01 -0.94249E+01 -0.25051E+01 | ||
1126 | + 1. -0.10843E+02 0.49651E+01 -0.24968E+01 | ||
1127 | + 1. -0.13161E+02 0.10011E+01 -0.24882E+01 | ||
1128 | + 1. 0.11580E+02 -0.11502E+02 -0.24859E+01 | ||
1129 | + 1. -0.12797E-01 -0.77459E+00 -0.24746E+01 | ||
1130 | + 1. -0.30020E+00 0.19204E+02 -0.24691E+01 | ||
1131 | + 1. -0.96068E+01 -0.88590E+01 -0.24621E+01 | ||
1132 | + 1. 0.16130E+02 0.13294E+01 -0.24574E+01 | ||
1133 | + 1. -0.10231E+02 0.96620E+01 -0.24481E+01 | ||
1134 | + 1. 0.96559E+01 -0.12504E+01 -0.24455E+01 | ||
1135 | + 1. 0.60636E+00 -0.73980E+01 -0.24388E+01 | ||
1136 | + 1. 0.11687E+02 -0.81225E+01 -0.24304E+01 | ||
1137 | + 1. -0.99788E+01 0.96227E+00 -0.24229E+01 | ||
1138 | + 1. -0.97102E+01 0.12777E+02 -0.24165E+01 | ||
1139 | + 1. -0.19967E+02 -0.10744E+01 -0.24093E+01 | ||
1140 | + 1. 0.49092E+01 0.16533E+02 -0.24049E+01 | ||
1141 | + 1. -0.78179E+01 -0.15735E+02 -0.23950E+01 | ||
1142 | + 1. 0.80264E+01 0.11679E+02 -0.23928E+01 | ||
1143 | + 1. -0.78711E+01 0.67325E+01 -0.23848E+01 | ||
1144 | + 1. 0.31366E+01 -0.13720E+02 -0.23735E+01 | ||
1145 | + 1. 0.54792E+01 -0.38359E+01 -0.23714E+01 | ||
1146 | + 1. -0.59172E+01 0.61952E+01 -0.23660E+01 | ||
1147 | + 1. -0.57233E+01 0.17302E+02 -0.23563E+01 | ||
1148 | + 1. 0.14603E+00 0.15149E+02 -0.23497E+01 | ||
1149 | + 1. 0.25845E+01 0.88440E+00 -0.23405E+01 | ||
1150 | + 1. 0.17362E+02 -0.95715E+01 -0.23397E+01 | ||
1151 | + 1. 0.11534E+01 -0.16223E+02 -0.23296E+01 | ||
1152 | + 1. -0.84089E+01 -0.25905E+01 -0.23263E+01 | ||
1153 | + 1. 0.19541E+02 -0.32501E+01 -0.23188E+01 | ||
1154 | + 1. -0.11802E+02 0.11108E+02 -0.23116E+01 | ||
1155 | + 1. -0.27006E+01 -0.19745E+02 -0.23011E+01 | ||
1156 | + 1. -0.98518E+01 -0.64725E+01 -0.22952E+01 | ||
1157 | + 1. 0.81614E+01 -0.66429E+01 -0.22914E+01 | ||
1158 | + 1. -0.71254E+01 0.92173E+01 -0.22824E+01 | ||
1159 | + 1. 0.21287E+01 -0.34574E+01 -0.22792E+01 | ||
1160 | + 1. 0.11896E+02 0.63557E+01 -0.22681E+01 | ||
1161 | + 1. -0.97526E+01 -0.10871E+02 -0.22611E+01 | ||
1162 | + 1. -0.11700E+02 0.68331E+01 -0.22570E+01 | ||
1163 | + 1. 0.30662E+01 0.14458E+02 -0.22505E+01 | ||
1164 | + 1. 0.14171E+02 -0.45685E+01 -0.22430E+01 | ||
1165 | + 1. -0.18821E+02 0.66664E+01 -0.22398E+01 | ||
1166 | + 1. -0.57863E+01 -0.15355E+02 -0.22318E+01 | ||
1167 | + 1. 0.14780E+02 0.42095E+01 -0.22222E+01 | ||
1168 | + 1. 0.35268E+01 -0.11662E+02 -0.22156E+01 | ||
1169 | + 1. -0.90335E+01 0.15043E+02 -0.22118E+01 | ||
1170 | + 1. -0.10680E+02 0.29071E+01 -0.22026E+01 | ||
1171 | + 1. -0.16442E+01 0.17573E+02 -0.21949E+01 | ||
1172 | + 1. -0.12463E+02 -0.10635E+02 -0.21911E+01 | ||
1173 | + 1. 0.17123E+02 0.10066E+02 -0.21818E+01 | ||
1174 | + 1. -0.16514E+01 -0.54798E+01 -0.21796E+01 | ||
1175 | + 1. -0.30526E+01 0.11100E+02 -0.21728E+01 | ||
1176 | + 1. -0.18562E+02 -0.69968E+01 -0.21608E+01 | ||
1177 | + 1. -0.12060E+01 -0.14141E+02 -0.21562E+01 | ||
1178 | + 1. -0.29388E+01 0.29829E+01 -0.21524E+01 | ||
1179 | + 1. -0.84594E+01 0.11046E+02 -0.21410E+01 | ||
1180 | + 1. -0.89089E+00 0.23152E+01 -0.21379E+01 | ||
1181 | + 1. 0.31645E+00 -0.93736E+01 -0.21318E+01 | ||
1182 | + 1. 0.32641E+01 -0.73992E+01 -0.21265E+01 | ||
1183 | + 1. 0.11351E+02 0.42815E+01 -0.21142E+01 | ||
1184 | + 1. -0.44070E+01 0.12476E+01 -0.21077E+01 | ||
1185 | + 1. 0.68816E+01 0.15566E+02 -0.21014E+01 | ||
1186 | + 1. -0.13837E+02 -0.72561E+01 -0.20966E+01 | ||
1187 | + 1. 0.99827E+01 0.96543E+00 -0.20915E+01 | ||
1188 | + 1. 0.60253E+01 0.52506E+01 -0.20814E+01 | ||
1189 | + 1. -0.57319E+01 -0.18867E+02 -0.20744E+01 | ||
1190 | + 1. -0.13774E+02 0.11831E+02 -0.20712E+01 | ||
1191 | + 1. 0.19376E+02 0.10053E+01 -0.20656E+01 | ||
1192 | + 1. 0.64990E+01 -0.13958E+02 -0.20556E+01 | ||
1193 | + 1. 0.13347E+02 -0.10291E+02 -0.20493E+01 | ||
1194 | + 1. -0.53116E+01 -0.13152E+01 -0.20404E+01 | ||
1195 | + 1. -0.31852E+00 -0.18973E+02 -0.20338E+01 | ||
1196 | + 1. -0.63674E+01 -0.85854E+01 -0.20287E+01 | ||
1197 | + 1. -0.14709E+02 -0.11624E+02 -0.20212E+01 | ||
1198 | + 1. -0.15401E+02 0.26950E+01 -0.20181E+01 | ||
1199 | + 1. 0.13769E+02 0.79632E+00 -0.20089E+01 | ||
1200 | + 1. 0.12702E+01 0.94158E+01 -0.20035E+01 | ||
1201 | + 1. 0.88371E+01 0.69889E+01 -0.19978E+01 | ||
1202 | + 1. 0.96308E+01 -0.10546E+02 -0.19924E+01 | ||
1203 | + 1. 0.52091E+00 -0.12373E+02 -0.19863E+01 | ||
1204 | + 1. -0.10426E+02 -0.14339E+02 -0.19773E+01 | ||
1205 | + 1. -0.19600E+02 0.34461E+01 -0.19675E+01 | ||
1206 | + 1. -0.16625E+02 0.48110E+01 -0.19642E+01 | ||
1207 | + 1. 0.70920E+00 0.17273E+02 -0.19552E+01 | ||
1208 | + 1. 0.31287E+01 -0.11133E+01 -0.19494E+01 | ||
1209 | + 1. -0.16854E+02 0.10642E+02 -0.19452E+01 | ||
1210 | + 1. 0.64720E+01 0.18168E+02 -0.19400E+01 | ||
1211 | + 1. 0.11074E+02 0.15795E+02 -0.19318E+01 | ||
1212 | + 1. 0.11805E+02 0.84020E+01 -0.19210E+01 | ||
1213 | + 1. -0.17318E+02 0.17475E+01 -0.19174E+01 | ||
1214 | + 1. 0.11506E+02 -0.16261E+02 -0.19123E+01 | ||
1215 | + 1. -0.13567E+02 -0.16535E+01 -0.19030E+01 | ||
1216 | + 1. -0.85160E+01 0.40444E+01 -0.18943E+01 | ||
1217 | + 1. 0.12025E+02 -0.14096E+02 -0.18881E+01 | ||
1218 | + 1. -0.12829E+02 -0.13187E+02 -0.18866E+01 | ||
1219 | + 1. -0.17152E+02 -0.29506E+01 -0.18756E+01 | ||
1220 | + 1. -0.39411E+01 0.53099E+01 -0.18674E+01 | ||
1221 | + 1. 0.28579E+01 0.63375E+01 -0.18608E+01 | ||
1222 | + 1. 0.14865E+02 0.13204E+02 -0.18595E+01 | ||
1223 | + 1. 0.10136E+02 -0.70004E+01 -0.18494E+01 | ||
1224 | + 1. -0.11652E+02 -0.84992E+01 -0.18447E+01 | ||
1225 | + 1. 0.79544E+01 -0.45258E+01 -0.18334E+01 | ||
1226 | + 1. 0.95655E+01 0.13945E+02 -0.18315E+01 | ||
1227 | + 1. 0.84807E+01 -0.17910E+02 -0.18226E+01 | ||
1228 | + 1. -0.16833E+01 -0.91925E+01 -0.18167E+01 | ||
1229 | + 1. 0.70810E+01 -0.83661E+01 -0.18103E+01 | ||
1230 | + 1. -0.56690E+01 -0.13146E+02 -0.18048E+01 | ||
1231 | + 1. -0.51936E+01 -0.42906E+01 -0.17981E+01 | ||
1232 | + 1. 0.12810E+02 0.25966E+01 -0.17905E+01 | ||
1233 | + 1. 0.22759E+01 0.41709E+01 -0.17827E+01 | ||
1234 | + 1. 0.12371E+01 -0.14247E+02 -0.17777E+01 | ||
1235 | + 1. 0.68936E+01 0.99620E+01 -0.17729E+01 | ||
1236 | + 1. 0.96696E+01 0.17472E+02 -0.17666E+01 | ||
1237 | + 1. 0.68955E+01 -0.10598E+02 -0.17542E+01 | ||
1238 | + 1. 0.75292E+01 -0.16026E+02 -0.17500E+01 | ||
1239 | + 1. 0.19742E+02 0.31243E+01 -0.17461E+01 | ||
1240 | + 1. -0.26289E+01 0.90267E+01 -0.17382E+01 | ||
1241 | + 1. -0.64141E+01 0.15505E+02 -0.17327E+01 | ||
1242 | + 1. 0.11969E+02 0.13967E+02 -0.17264E+01 | ||
1243 | + 1. -0.37429E+01 -0.97176E+01 -0.17158E+01 | ||
1244 | + 1. -0.79247E+01 -0.61267E+01 -0.17067E+01 | ||
1245 | + 1. -0.10007E+02 -0.11162E+01 -0.17040E+01 | ||
1246 | + 1. 0.16569E+02 0.32101E+01 -0.16965E+01 | ||
1247 | + 1. 0.12967E+02 -0.66305E+01 -0.16922E+01 | ||
1248 | + 1. -0.25932E+01 0.19812E+02 -0.16806E+01 | ||
1249 | + 1. 0.79823E+01 -0.23769E+01 -0.16799E+01 | ||
1250 | + 1. 0.15105E+02 -0.92270E+01 -0.16733E+01 | ||
1251 | + 1. -0.45385E+00 -0.30404E+01 -0.16657E+01 | ||
1252 | + 1. -0.13870E+02 0.72486E+01 -0.16581E+01 | ||
1253 | + 1. -0.11114E+02 -0.16615E+02 -0.16532E+01 | ||
1254 | + 1. -0.13049E+02 0.13986E+02 -0.16432E+01 | ||
1255 | + 1. 0.16187E+02 -0.11059E+02 -0.16366E+01 | ||
1256 | + 1. 0.26743E+01 -0.19635E+02 -0.16290E+01 | ||
1257 | + 1. -0.17019E+02 0.73401E+01 -0.16261E+01 | ||
1258 | + 1. -0.38585E+01 0.16386E+02 -0.16142E+01 | ||
1259 | + 1. 0.87263E+01 0.40035E+01 -0.16081E+01 | ||
1260 | + 1. 0.53954E+01 0.13790E+02 -0.16013E+01 | ||
1261 | + 1. 0.18572E+02 0.61562E+01 -0.15971E+01 | ||
1262 | + 1. -0.16758E+02 -0.57908E+01 -0.15926E+01 | ||
1263 | + 1. -0.15663E+02 -0.93332E+01 -0.15833E+01 | ||
1264 | + 1. 0.43272E+01 0.95065E+01 -0.15773E+01 | ||
1265 | + 1. -0.97762E+01 -0.39957E+01 -0.15673E+01 | ||
1266 | + 1. -0.76198E+01 -0.17659E+02 -0.15647E+01 | ||
1267 | + 1. 0.33637E+01 -0.16214E+02 -0.15581E+01 | ||
1268 | + 1. -0.42316E+01 -0.16747E+02 -0.15497E+01 | ||
1269 | + 1. 0.15650E+02 0.76445E+01 -0.15423E+01 | ||
1270 | + 1. 0.15421E+01 0.19430E+02 -0.15366E+01 | ||
1271 | + 1. -0.79251E+01 -0.11348E+02 -0.15325E+01 | ||
1272 | + 1. 0.52464E+01 -0.18935E+02 -0.15252E+01 | ||
1273 | + 1. 0.23204E+01 -0.10140E+02 -0.15137E+01 | ||
1274 | + 1. 0.64660E+01 0.12889E+01 -0.15114E+01 | ||
1275 | + 1. 0.10288E+02 -0.33649E+01 -0.15050E+01 | ||
1276 | + 1. -0.19183E+02 -0.32493E+01 -0.14945E+01 | ||
1277 | + 1. -0.54347E+01 0.13626E+02 -0.14873E+01 | ||
1278 | + 1. 0.17892E+02 -0.49917E+01 -0.14846E+01 | ||
1279 | + 1. -0.97241E+01 0.63921E+01 -0.14742E+01 | ||
1280 | + 1. -0.13859E+02 0.42874E+01 -0.14674E+01 | ||
1281 | + 1. -0.11058E+02 0.14094E+02 -0.14640E+01 | ||
1282 | + 1. 0.16803E+02 -0.76363E+01 -0.14588E+01 | ||
1283 | + 1. 0.17630E+02 0.15080E+00 -0.14485E+01 | ||
1284 | + 1. 0.47746E+01 -0.59322E+01 -0.14430E+01 | ||
1285 | + 1. -0.56984E+01 0.26492E+01 -0.14335E+01 | ||
1286 | + 1. -0.21811E+01 -0.71414E+00 -0.14320E+01 | ||
1287 | + 1. -0.46269E+00 0.13394E+02 -0.14243E+01 | ||
1288 | + 1. -0.12745E+02 -0.15331E+02 -0.14149E+01 | ||
1289 | + 1. -0.12086E+02 -0.50587E+01 -0.14099E+01 | ||
1290 | + 1. 0.21218E+01 -0.56893E+01 -0.14039E+01 | ||
1291 | + 1. 0.18099E+02 -0.19202E+01 -0.13968E+01 | ||
1292 | + 1. -0.33627E+01 -0.64127E+01 -0.13889E+01 | ||
1293 | + 1. -0.11704E+02 0.16137E+02 -0.13833E+01 | ||
1294 | + 1. -0.14856E+02 0.14788E-01 -0.13774E+01 | ||
1295 | + 1. 0.11331E+02 -0.56047E+00 -0.13671E+01 | ||
1296 | + 1. 0.98624E+01 0.11103E+02 -0.13638E+01 | ||
1297 | + 1. 0.10843E+01 0.72153E+01 -0.13592E+01 | ||
1298 | + 1. -0.20093E+01 -0.17873E+02 -0.13500E+01 | ||
1299 | + 1. 0.16362E+01 0.12780E+02 -0.13461E+01 | ||
1300 | + 1. -0.15270E+02 -0.35704E+01 -0.13356E+01 | ||
1301 | + 1. -0.41672E+01 -0.11841E+02 -0.13269E+01 | ||
1302 | + 1. -0.21776E+01 -0.15755E+02 -0.13204E+01 | ||
1303 | + 1. -0.65615E+01 0.11084E+02 -0.13168E+01 | ||
1304 | + 1. -0.47169E+01 0.19264E+02 -0.13085E+01 | ||
1305 | + 1. 0.93956E+00 0.16197E+01 -0.13023E+01 | ||
1306 | + 1. 0.49735E+01 0.67723E+01 -0.12993E+01 | ||
1307 | + 1. -0.16535E+01 0.15715E+02 -0.12868E+01 | ||
1308 | + 1. 0.48559E+01 -0.22043E+01 -0.12816E+01 | ||
1309 | + 1. -0.11598E+01 0.62842E+01 -0.12761E+01 | ||
1310 | + 1. 0.14163E+02 -0.14086E+02 -0.12709E+01 | ||
1311 | + 1. 0.16153E+02 0.54784E+01 -0.12626E+01 | ||
1312 | + 1. -0.12049E+01 -0.11323E+02 -0.12562E+01 | ||
1313 | + 1. 0.16299E+02 -0.37665E+01 -0.12521E+01 | ||
1314 | + 1. 0.12168E+02 -0.41319E+01 -0.12439E+01 | ||
1315 | + 1. -0.11367E+01 0.10845E+02 -0.12395E+01 | ||
1316 | + 1. 0.13550E+02 -0.10425E+01 -0.12274E+01 | ||
1317 | + 1. -0.18566E+02 -0.13430E+00 -0.12240E+01 | ||
1318 | + 1. -0.81618E+01 0.10534E+01 -0.12147E+01 | ||
1319 | + 1. 0.84728E+01 -0.13960E+02 -0.12096E+01 | ||
1320 | + 1. -0.95176E+01 -0.12563E+02 -0.12061E+01 | ||
1321 | + 1. -0.11583E+01 -0.72036E+01 -0.11957E+01 | ||
1322 | + 1. 0.14923E+02 -0.62968E+01 -0.11876E+01 | ||
1323 | + 1. 0.15409E+02 -0.45714E-01 -0.11824E+01 | ||
1324 | + 1. -0.14339E+02 -0.54240E+01 -0.11754E+01 | ||
1325 | + 1. -0.66718E+01 -0.27065E+01 -0.11707E+01 | ||
1326 | + 1. -0.11711E+02 0.14926E+01 -0.11617E+01 | ||
1327 | + 1. -0.68879E+01 0.18768E+02 -0.11571E+01 | ||
1328 | + 1. -0.78874E+01 -0.13730E+02 -0.11481E+01 | ||
1329 | + 1. 0.28341E+00 0.42193E+01 -0.11426E+01 | ||
1330 | + 1. -0.13414E+02 0.96085E+01 -0.11345E+01 | ||
1331 | + 1. 0.10439E+02 -0.12679E+02 -0.11330E+01 | ||
1332 | + 1. 0.14323E+02 0.11290E+02 -0.11231E+01 | ||
1333 | + 1. -0.86610E+01 0.16950E+02 -0.11199E+01 | ||
1334 | + 1. -0.30408E+01 0.69641E+01 -0.11111E+01 | ||
1335 | + 1. -0.15611E+02 0.90018E+01 -0.11063E+01 | ||
1336 | + 1. 0.75562E+01 0.13896E+02 -0.10955E+01 | ||
1337 | + 1. 0.41446E+01 0.13378E+01 -0.10908E+01 | ||
1338 | + 1. -0.86038E+01 0.82292E+01 -0.10856E+01 | ||
1339 | + 1. 0.11375E+02 -0.10065E+02 -0.10787E+01 | ||
1340 | + 1. 0.13671E+02 0.77269E+01 -0.10726E+01 | ||
1341 | + 1. -0.62550E+01 0.16613E+00 -0.10643E+01 | ||
1342 | + 1. 0.29527E+01 0.16340E+02 -0.10551E+01 | ||
1343 | + 1. 0.13282E+02 -0.12038E+02 -0.10523E+01 | ||
1344 | + 1. -0.15634E+02 0.11963E+02 -0.10436E+01 | ||
1345 | + 1. 0.84268E+01 0.88612E+01 -0.10366E+01 | ||
1346 | + 1. 0.66697E+01 -0.76473E+00 -0.10313E+01 | ||
1347 | + 1. 0.13051E+02 -0.85369E+01 -0.10264E+01 | ||
1348 | + 1. -0.82151E+01 0.13222E+02 -0.10159E+01 | ||
1349 | + 1. -0.24579E+01 0.13478E+02 -0.10083E+01 | ||
1350 | + 1. 0.10139E+02 0.54854E+01 -0.10062E+01 | ||
1351 | + 1. -0.10820E+02 0.84131E+01 -0.99655E+00 | ||
1352 | + 1. 0.37696E+01 0.19595E+02 -0.98742E+00 | ||
1353 | + 1. 0.33643E+01 0.11176E+02 -0.98219E+00 | ||
1354 | + 1. 0.45778E+01 -0.14061E+02 -0.97710E+00 | ||
1355 | + 1. 0.42068E+01 0.41049E+01 -0.96992E+00 | ||
1356 | + 1. -0.24250E+01 -0.36394E+01 -0.96204E+00 | ||
1357 | + 1. -0.19189E+02 -0.53520E+01 -0.95752E+00 | ||
1358 | + 1. -0.41403E+01 -0.25622E+01 -0.95108E+00 | ||
1359 | + 1. -0.83570E+01 -0.80208E+01 -0.94279E+00 | ||
1360 | + 1. -0.13596E+02 0.22226E+01 -0.93392E+00 | ||
1361 | + 1. 0.55176E+01 -0.16975E+02 -0.93197E+00 | ||
1362 | + 1. -0.13737E+02 -0.94448E+01 -0.92252E+00 | ||
1363 | + 1. 0.98267E+01 -0.15623E+02 -0.91429E+00 | ||
1364 | + 1. 0.64507E+01 0.12067E+02 -0.91002E+00 | ||
1365 | + 1. 0.83904E+01 0.13274E+01 -0.90447E+00 | ||
1366 | + 1. -0.59027E+01 0.76663E+01 -0.89713E+00 | ||
1367 | + 1. 0.84773E+01 -0.11921E+02 -0.88689E+00 | ||
1368 | + 1. 0.14109E+02 -0.30673E+01 -0.88273E+00 | ||
1369 | + 1. 0.50128E+01 -0.81358E+01 -0.87672E+00 | ||
1370 | + 1. 0.13107E+02 0.51292E+01 -0.87199E+00 | ||
1371 | + 1. -0.40023E+01 -0.14374E+02 -0.86044E+00 | ||
1372 | + 1. 0.12632E+01 -0.11434E+01 -0.85353E+00 | ||
1373 | + 1. -0.15468E+02 0.63206E+01 -0.85088E+00 | ||
1374 | + 1. 0.60641E+01 -0.12368E+02 -0.84664E+00 | ||
1375 | + 1. 0.77003E+01 0.16939E+02 -0.83994E+00 | ||
1376 | + 1. 0.64362E+01 0.33544E+01 -0.83265E+00 | ||
1377 | + 1. -0.31456E+00 -0.16663E+02 -0.82594E+00 | ||
1378 | + 1. 0.11836E+02 0.11674E+02 -0.81415E+00 | ||
1379 | + 1. -0.27845E+01 0.10935E+01 -0.80757E+00 | ||
1380 | + 1. 0.34565E+01 -0.40830E+01 -0.80624E+00 | ||
1381 | + 1. -0.18711E+02 0.48534E+01 -0.79693E+00 | ||
1382 | + 1. -0.63282E+01 0.47967E+01 -0.78797E+00 | ||
1383 | + 1. -0.14546E+02 -0.13629E+02 -0.78543E+00 | ||
1384 | + 1. 0.26467E+01 0.84305E+01 -0.77744E+00 | ||
1385 | + 1. -0.10424E+02 -0.97034E+01 -0.77125E+00 | ||
1386 | + 1. -0.11819E+02 -0.22091E+01 -0.76263E+00 | ||
1387 | + 1. -0.93974E+01 -0.15552E+02 -0.75761E+00 | ||
1388 | + 1. 0.89241E+01 -0.81866E+01 -0.75318E+00 | ||
1389 | + 1. -0.11848E+02 0.53271E+01 -0.74388E+00 | ||
1390 | + 1. 0.17464E+02 0.84898E+01 -0.73690E+00 | ||
1391 | + 1. -0.56967E+01 -0.72015E+01 -0.72934E+00 | ||
1392 | + 1. -0.15869E+02 -0.16874E+01 -0.72483E+00 | ||
1393 | + 1. 0.41523E+01 -0.10263E+02 -0.71914E+00 | ||
1394 | + 1. 0.21018E+01 -0.12667E+02 -0.70693E+00 | ||
1395 | + 1. -0.99451E+01 0.11244E+02 -0.70197E+00 | ||
1396 | + 1. -0.11403E+02 -0.11469E+02 -0.69944E+00 | ||
1397 | + 1. -0.55147E+01 -0.10061E+02 -0.68674E+00 | ||
1398 | + 1. -0.49959E+00 0.87712E+01 -0.68084E+00 | ||
1399 | + 1. -0.17772E+02 0.89625E+01 -0.67793E+00 | ||
1400 | + 1. 0.14707E+02 0.21098E+01 -0.66825E+00 | ||
1401 | + 1. 0.96653E+01 -0.53916E+01 -0.66188E+00 | ||
1402 | + 1. 0.10934E+02 0.23993E+01 -0.65943E+00 | ||
1403 | + 1. 0.71875E+01 0.63998E+01 -0.65224E+00 | ||
1404 | + 1. -0.68596E+01 -0.47983E+01 -0.64465E+00 | ||
1405 | + 1. -0.40821E+00 -0.48718E+01 -0.63668E+00 | ||
1406 | + 1. 0.93179E+01 0.15728E+02 -0.62706E+00 | ||
1407 | + 1. -0.41618E+01 0.10437E+02 -0.62334E+00 | ||
1408 | + 1. -0.16884E+02 -0.77650E+01 -0.61493E+00 | ||
1409 | + 1. 0.13821E+01 0.14694E+02 -0.60875E+00 | ||
1410 | + 1. 0.22953E+01 -0.17769E+02 -0.60564E+00 | ||
1411 | + 1. 0.19924E+02 -0.68720E+00 -0.59637E+00 | ||
1412 | + 1. 0.54482E+01 0.15558E+02 -0.59106E+00 | ||
1413 | + 1. -0.38492E+01 -0.19055E+02 -0.58393E+00 | ||
1414 | + 1. 0.17236E+01 -0.80640E+01 -0.57762E+00 | ||
1415 | + 1. -0.18906E+02 0.19775E+01 -0.57165E+00 | ||
1416 | + 1. 0.91243E+01 -0.55956E+00 -0.56029E+00 | ||
1417 | + 1. 0.65017E+01 0.83231E+01 -0.55455E+00 | ||
1418 | + 1. 0.64712E+01 -0.51713E+01 -0.55116E+00 | ||
1419 | + 1. -0.69816E+01 -0.15772E+02 -0.54068E+00 | ||
1420 | + 1. -0.23406E+01 -0.13005E+02 -0.53902E+00 | ||
1421 | + 1. -0.10981E+02 -0.67026E+01 -0.52923E+00 | ||
1422 | + 1. -0.24876E+01 0.46774E+01 -0.52269E+00 | ||
1423 | + 1. -0.92122E+00 0.19541E+02 -0.51594E+00 | ||
1424 | + 1. 0.10172E+02 0.74345E+01 -0.51126E+00 | ||
1425 | + 1. 0.18636E+02 -0.70323E+01 -0.50284E+00 | ||
1426 | + 1. -0.30790E+01 0.18058E+02 -0.49919E+00 | ||
1427 | + 1. -0.15989E+02 -0.11512E+02 -0.48671E+00 | ||
1428 | + 1. 0.10549E+01 0.10875E+02 -0.48443E+00 | ||
1429 | + 1. -0.16188E+01 -0.19864E+02 -0.47625E+00 | ||
1430 | + 1. 0.11118E+02 0.98138E+01 -0.46843E+00 | ||
1431 | + 1. -0.12952E+02 -0.37376E+00 -0.46620E+00 | ||
1432 | + 1. 0.69531E+01 -0.18449E+02 -0.45521E+00 | ||
1433 | + 1. -0.17265E+02 -0.98187E+01 -0.44970E+00 | ||
1434 | + 1. -0.41877E+01 -0.46531E+00 -0.44117E+00 | ||
1435 | + 1. -0.12208E+02 0.12205E+02 -0.43914E+00 | ||
1436 | + 1. -0.95536E+01 -0.17536E+02 -0.42876E+00 | ||
1437 | + 1. -0.96184E+01 0.27661E+01 -0.42355E+00 | ||
1438 | + 1. -0.40804E+01 0.32477E+01 -0.41590E+00 | ||
1439 | + 1. 0.19123E+02 -0.38051E+01 -0.40843E+00 | ||
1440 | + 1. -0.82307E+01 -0.12733E+01 -0.40559E+00 | ||
1441 | + 1. -0.16944E+02 0.34875E+01 -0.39543E+00 | ||
1442 | + 1. -0.74559E+01 0.28851E+01 -0.39258E+00 | ||
1443 | + 1. -0.19947E+02 -0.13942E+01 -0.38307E+00 | ||
1444 | + 1. 0.15718E+02 0.96288E+01 -0.37679E+00 | ||
1445 | + 1. 0.18309E+02 0.27444E+01 -0.37078E+00 | ||
1446 | + 1. -0.14797E+02 -0.77365E+01 -0.36068E+00 | ||
1447 | + 1. 0.12426E+02 0.15459E+02 -0.35622E+00 | ||
1448 | + 1. -0.56955E+01 0.17340E+02 -0.35237E+00 | ||
1449 | + 1. 0.16237E+02 0.11567E+02 -0.34018E+00 | ||
1450 | + 1. 0.37607E+00 -0.19833E+02 -0.33349E+00 | ||
1451 | + 1. -0.77789E+01 0.63598E+01 -0.32705E+00 | ||
1452 | + 1. 0.14337E+01 -0.37201E+01 -0.32518E+00 | ||
1453 | + 1. 0.10217E+02 0.12781E+02 -0.31660E+00 | ||
1454 | + 1. -0.16956E+02 -0.41970E+01 -0.31187E+00 | ||
1455 | + 1. 0.18164E+01 0.54453E+01 -0.30476E+00 | ||
1456 | + 1. 0.19587E+01 -0.15552E+02 -0.29737E+00 | ||
1457 | + 1. 0.80261E+00 -0.10614E+02 -0.29068E+00 | ||
1458 | + 1. -0.16574E+02 0.81301E+00 -0.28259E+00 | ||
1459 | + 1. 0.35473E+01 0.14216E+02 -0.27542E+00 | ||
1460 | + 1. -0.41506E+00 -0.14667E+02 -0.27217E+00 | ||
1461 | + 1. -0.30350E+01 -0.84992E+01 -0.26332E+00 | ||
1462 | + 1. 0.65598E+01 -0.31484E+01 -0.25465E+00 | ||
1463 | + 1. -0.83455E+01 -0.34022E+01 -0.24824E+00 | ||
1464 | + 1. 0.81343E+01 0.10994E+02 -0.24433E+00 | ||
1465 | + 1. 0.14308E+02 -0.10496E+02 -0.23746E+00 | ||
1466 | + 1. -0.84384E+00 -0.17046E+01 -0.22911E+00 | ||
1467 | + 1. -0.11426E+02 -0.13918E+02 -0.22655E+00 | ||
1468 | + 1. 0.17229E+02 -0.99238E+01 -0.21648E+00 | ||
1469 | + 1. 0.48868E+01 0.17789E+02 -0.21168E+00 | ||
1470 | + 1. -0.99811E+01 0.41277E+00 -0.20349E+00 | ||
1471 | + 1. -0.83421E-01 0.16573E+02 -0.19493E+00 | ||
1472 | + 1. 0.19926E+02 0.15267E+01 -0.18691E+00 | ||
1473 | + 1. -0.14090E+02 0.13048E+02 -0.18632E+00 | ||
1474 | + 1. -0.82683E+01 0.10086E+02 -0.17994E+00 | ||
1475 | + 1. -0.13232E+02 -0.12089E+02 -0.17027E+00 | ||
1476 | + 1. 0.67067E+01 -0.14667E+02 -0.16349E+00 | ||
1477 | + 1. -0.56522E+01 -0.17465E+02 -0.15818E+00 | ||
1478 | + 1. -0.37376E+01 0.14767E+02 -0.14780E+00 | ||
1479 | + 1. -0.18404E+02 0.69140E+01 -0.14586E+00 | ||
1480 | + 1. 0.13808E+02 0.13032E+02 -0.13808E+00 | ||
1481 | + 1. 0.12920E+02 0.77095E+00 -0.13332E+00 | ||
1482 | + 1. 0.11166E+02 -0.79063E+01 -0.12188E+00 | ||
1483 | + 1. 0.11712E+02 -0.22519E+01 -0.11345E+00 | ||
1484 | + 1. -0.99683E+01 0.15389E+02 -0.11155E+00 | ||
1485 | + 1. 0.29411E+01 -0.31446E+00 -0.10330E+00 | ||
1486 | + 1. -0.17833E+02 -0.21032E+01 -0.96015E-01 | ||
1487 | + 1. -0.43016E+01 0.12636E+02 -0.92979E-01 | ||
1488 | + 1. -0.93134E+01 -0.54113E+01 -0.83324E-01 | ||
1489 | + 1. 0.16910E+01 0.32271E+01 -0.78401E-01 | ||
1490 | + 1. -0.68112E+00 0.12961E+01 -0.67867E-01 | ||
1491 | + 1. 0.12726E+02 -0.15139E+02 -0.64059E-01 | ||
1492 | + 1. -0.41427E+01 -0.48671E+01 -0.57850E-01 | ||
1493 | + 1. 0.75879E+01 -0.67789E+01 -0.51261E-01 | ||
1494 | + 1. 0.56460E+01 0.10182E+02 -0.43949E-01 | ||
1495 | + 1. 0.14026E+01 0.17923E+02 -0.39997E-01 | ||
1496 | + 1. 0.40139E+01 -0.19535E+02 -0.30328E-01 | ||
1497 | + 1. -0.12492E+02 0.74426E+01 -0.25239E-01 | ||
1498 | + 1. -0.99543E+01 0.48661E+01 -0.13476E-01 | ||
1499 | + 1. -0.78053E+00 -0.89605E+01 -0.10096E-01 | ||
1500 | + 1. 0.14702E+02 0.63516E+01 -0.53276E-02 | ||
1501 | + 1. 0.14684E+02 0.40336E+01 0.47004E-02 | ||
1502 | + 1. -0.64731E+01 0.14469E+02 0.95324E-02 | ||
1503 | + 1. -0.26692E+01 -0.10803E+02 0.14102E-01 | ||
1504 | + 1. 0.16602E+02 -0.60727E+01 0.26419E-01 | ||
1505 | + 1. 0.41675E+01 -0.12357E+02 0.28076E-01 | ||
1506 | + 1. 0.16387E+02 -0.16681E+01 0.36083E-01 | ||
1507 | + 1. 0.56278E+01 0.51874E+01 0.42367E-01 | ||
1508 | + 1. -0.66936E+01 -0.12553E+02 0.49625E-01 | ||
1509 | + 1. 0.18893E+02 0.49731E+01 0.56476E-01 | ||
1510 | + 1. 0.70405E+01 -0.96728E+01 0.62090E-01 | ||
1511 | + 1. -0.12676E+02 -0.76622E+01 0.73267E-01 | ||
1512 | + 1. 0.84926E+01 -0.17141E+02 0.77894E-01 | ||
1513 | + 1. -0.11639E+02 0.32626E+01 0.81661E-01 | ||
1514 | + 1. 0.17446E+02 0.63670E+01 0.87488E-01 | ||
1515 | + 1. 0.96043E+01 -0.10586E+02 0.98967E-01 | ||
1516 | + 1. 0.15326E+02 -0.12850E+02 0.10291E+00 | ||
1517 | + 1. 0.84668E+01 -0.38188E+01 0.10984E+00 | ||
1518 | + 1. -0.11203E+02 -0.39994E+01 0.11343E+00 | ||
1519 | + 1. 0.11963E+02 -0.13209E+02 0.12504E+00 | ||
1520 | + 1. -0.20386E+01 -0.57926E+01 0.13234E+00 | ||
1521 | + 1. 0.13374E+02 -0.56184E+01 0.13704E+00 | ||
1522 | + 1. -0.16889E+02 0.10610E+02 0.14223E+00 | ||
1523 | + 1. -0.13670E+02 0.56278E+01 0.14756E+00 | ||
1524 | + 1. 0.15705E+02 -0.86737E+01 0.15694E+00 | ||
1525 | + 1. -0.13724E+02 -0.39707E+01 0.16039E+00 | ||
1526 | + 1. 0.52382E+01 -0.39454E-01 0.17121E+00 | ||
1527 | + 1. 0.45448E+01 0.84802E+01 0.17757E+00 | ||
1528 | + 1. 0.16772E+02 0.10398E+01 0.18059E+00 | ||
1529 | + 1. 0.46765E+01 0.12161E+02 0.19258E+00 | ||
1530 | + 1. -0.12540E+02 0.14651E+02 0.19906E+00 | ||
1531 | + 1. -0.47360E+01 0.59210E+01 0.20148E+00 | ||
1532 | + 1. -0.11889E+01 0.12338E+02 0.20903E+00 | ||
1533 | + 1. -0.14397E+02 0.10859E+02 0.21533E+00 | ||
1534 | + 1. 0.11186E+02 0.41827E+01 0.22469E+00 | ||
1535 | + 1. 0.82061E+01 0.31823E+01 0.23281E+00 | ||
1536 | + 1. 0.13308E+02 0.10083E+02 0.23735E+00 | ||
1537 | + 1. -0.83480E+01 -0.97235E+01 0.24258E+00 | ||
1538 | + 1. -0.20571E+01 0.27983E+01 0.25096E+00 | ||
1539 | + 1. 0.11968E+02 0.79430E+01 0.25709E+00 | ||
1540 | + 1. -0.10474E+01 0.14338E+02 0.26271E+00 | ||
1541 | + 1. -0.23850E+01 0.90014E+01 0.27076E+00 | ||
1542 | + 1. -0.11748E+02 0.10275E+02 0.27330E+00 | ||
1543 | + 1. -0.53517E+01 0.13677E+01 0.28483E+00 | ||
1544 | + 1. 0.32592E+01 -0.69261E+01 0.28781E+00 | ||
1545 | + 1. -0.16411E+02 0.78020E+01 0.29849E+00 | ||
1546 | + 1. 0.11412E+01 -0.62580E+01 0.30330E+00 | ||
1547 | + 1. -0.15875E+02 -0.60014E+01 0.30698E+00 | ||
1548 | + 1. 0.10602E+02 0.58315E+00 0.31364E+00 | ||
1549 | + 1. -0.34922E+01 -0.16027E+02 0.32257E+00 | ||
1550 | + 1. -0.11390E+02 -0.16224E+02 0.33084E+00 | ||
1551 | + 1. 0.39195E+01 -0.16738E+02 0.33552E+00 | ||
1552 | + 1. -0.10326E+02 0.12999E+02 0.34264E+00 | ||
1553 | + 1. 0.73779E+01 0.15300E+02 0.35101E+00 | ||
1554 | + 1. -0.55932E+01 -0.14645E+02 0.35578E+00 | ||
1555 | + 1. -0.14737E+02 0.33560E+01 0.36240E+00 | ||
1556 | + 1. -0.60505E+01 -0.15094E+01 0.36755E+00 | ||
1557 | + 1. 0.36236E+01 0.66112E+01 0.37732E+00 | ||
1558 | + 1. 0.16798E+00 -0.12608E+02 0.38247E+00 | ||
1559 | + 1. 0.72871E+01 0.18490E+02 0.38790E+00 | ||
1560 | + 1. 0.16714E+02 0.43102E+01 0.39731E+00 | ||
1561 | + 1. 0.37126E+01 -0.23776E+01 0.40403E+00 | ||
1562 | + 1. -0.61330E+01 0.94868E+01 0.41019E+00 | ||
1563 | + 1. -0.76002E+01 -0.18203E+02 0.41765E+00 | ||
1564 | + 1. -0.63071E+01 0.12468E+02 0.42348E+00 | ||
1565 | + 1. -0.18381E+02 -0.68252E+01 0.43028E+00 | ||
1566 | + 1. 0.10681E+02 0.16787E+02 0.43453E+00 | ||
1567 | + 1. -0.19613E+02 -0.36885E+01 0.44030E+00 | ||
1568 | + 1. -0.32458E+00 0.55653E+01 0.44869E+00 | ||
1569 | + 1. 0.99011E+01 -0.13864E+02 0.45427E+00 | ||
1570 | + 1. 0.15091E+02 -0.44620E+01 0.46212E+00 | ||
1571 | + 1. -0.19899E+02 0.46211E+00 0.46907E+00 | ||
1572 | + 1. -0.10583E+01 -0.17987E+02 0.47645E+00 | ||
1573 | + 1. -0.99373E+01 -0.20810E+01 0.48502E+00 | ||
1574 | + 1. 0.42519E+01 0.26895E+01 0.49092E+00 | ||
1575 | + 1. -0.12426E+02 -0.56166E+01 0.49592E+00 | ||
1576 | + 1. 0.96419E+01 -0.22406E+01 0.50543E+00 | ||
1577 | + 1. 0.11276E+02 -0.49564E+01 0.51254E+00 | ||
1578 | + 1. -0.43035E+01 0.82712E+01 0.51951E+00 | ||
1579 | + 1. 0.87562E+01 0.57190E+01 0.52255E+00 | ||
1580 | + 1. -0.98103E+01 -0.80439E+01 0.52973E+00 | ||
1581 | + 1. 0.93003E+00 0.78673E+01 0.53374E+00 | ||
1582 | + 1. 0.17197E+02 -0.40408E+01 0.54489E+00 | ||
1583 | + 1. -0.76030E+01 -0.63109E+01 0.54785E+00 | ||
1584 | + 1. -0.19658E+01 0.16518E+02 0.55657E+00 | ||
1585 | + 1. -0.77571E+01 0.15939E+02 0.56500E+00 | ||
1586 | + 1. -0.47939E+01 -0.12097E+02 0.57170E+00 | ||
1587 | + 1. -0.96747E+01 0.69260E+01 0.57331E+00 | ||
1588 | + 1. 0.25352E+01 -0.99273E+01 0.58339E+00 | ||
1589 | + 1. -0.77733E+01 0.18056E+02 0.58819E+00 | ||
1590 | + 1. 0.10591E+02 -0.16850E+02 0.59576E+00 | ||
1591 | + 1. 0.69011E+01 0.13546E+01 0.60206E+00 | ||
1592 | + 1. -0.49182E+01 -0.85008E+01 0.61193E+00 | ||
1593 | + 1. 0.85278E+01 0.13440E+02 0.61435E+00 | ||
1594 | + 1. 0.18312E+02 -0.14200E+01 0.62641E+00 | ||
1595 | + 1. -0.14728E+02 0.64829E+00 0.63167E+00 | ||
1596 | + 1. 0.20568E+01 0.19765E+02 0.63357E+00 | ||
1597 | + 1. -0.14391E+02 -0.14058E+01 0.64521E+00 | ||
1598 | + 1. -0.93148E+01 -0.13763E+02 0.65280E+00 | ||
1599 | + 1. -0.57821E+01 0.19136E+02 0.65763E+00 | ||
1600 | + 1. 0.82697E+01 0.76702E+01 0.66629E+00 | ||
1601 | + 1. 0.10761E+01 0.39150E+00 0.67038E+00 | ||
1602 | + 1. 0.47870E+01 -0.47635E+01 0.67600E+00 | ||
1603 | + 1. 0.17081E+01 0.13021E+02 0.68262E+00 | ||
1604 | + 1. 0.12251E+02 -0.96847E+01 0.68914E+00 | ||
1605 | + 1. -0.19579E+02 0.34247E+01 0.69628E+00 | ||
1606 | + 1. -0.15279E+02 -0.96918E+01 0.70511E+00 | ||
1607 | + 1. -0.17988E+01 0.70343E+01 0.71293E+00 | ||
1608 | + 1. -0.76158E+01 0.90402E+00 0.71591E+00 | ||
1609 | + 1. -0.13343E+02 -0.14286E+02 0.72559E+00 | ||
1610 | + 1. -0.77009E+01 0.45528E+01 0.73123E+00 | ||
1611 | + 1. -0.11897E+02 -0.96075E+01 0.73896E+00 | ||
1612 | + 1. 0.13877E+02 -0.79018E+01 0.74452E+00 | ||
1613 | + 1. -0.17147E+02 0.51800E+01 0.74926E+00 | ||
1614 | + 1. 0.76375E+01 -0.92609E+00 0.75732E+00 | ||
1615 | + 1. 0.13576E+02 -0.13376E+01 0.76306E+00 | ||
1616 | + 1. -0.27824E+01 -0.23441E+01 0.76765E+00 | ||
1617 | + 1. 0.71138E+01 -0.11667E+02 0.77511E+00 | ||
1618 | + 1. 0.19086E+02 -0.54367E+01 0.78346E+00 | ||
1619 | + 1. -0.52939E+00 0.10322E+02 0.79140E+00 | ||
1620 | + 1. 0.21300E+01 -0.19440E+02 0.79403E+00 | ||
1621 | + 1. 0.30733E+01 0.10226E+02 0.80210E+00 | ||
1622 | + 1. -0.54885E+01 -0.35066E+01 0.81181E+00 | ||
1623 | + 1. 0.94158E+01 0.93509E+01 0.81756E+00 | ||
1624 | + 1. -0.39287E+01 0.16802E+02 0.82515E+00 | ||
1625 | + 1. -0.24279E+01 -0.11650E+00 0.82947E+00 | ||
1626 | + 1. -0.84699E+01 0.12344E+02 0.83856E+00 | ||
1627 | + 1. 0.36541E+01 0.15887E+02 0.84347E+00 | ||
1628 | + 1. -0.24727E+01 0.19486E+02 0.84804E+00 | ||
1629 | + 1. -0.99432E+01 -0.11857E+02 0.85713E+00 | ||
1630 | + 1. 0.29110E+01 -0.13692E+02 0.86305E+00 | ||
1631 | + 1. -0.85051E+01 -0.16421E+02 0.87231E+00 | ||
1632 | + 1. 0.12330E+02 0.24014E+01 0.87905E+00 | ||
1633 | + 1. -0.78797E+00 -0.34643E+01 0.88183E+00 | ||
1634 | + 1. -0.15572E+02 -0.31422E+01 0.89276E+00 | ||
1635 | + 1. -0.14138E+02 0.88907E+01 0.89556E+00 | ||
1636 | + 1. 0.12109E+02 0.59059E+01 0.90206E+00 | ||
1637 | + 1. 0.17329E+02 0.97619E+01 0.91131E+00 | ||
1638 | + 1. -0.23017E+01 -0.14390E+02 0.91385E+00 | ||
1639 | + 1. -0.98075E+01 0.93410E+01 0.92630E+00 | ||
1640 | + 1. 0.56942E+01 -0.70238E+01 0.93288E+00 | ||
1641 | + 1. 0.43256E+01 -0.86887E+01 0.93642E+00 | ||
1642 | + 1. -0.11443E+02 -0.64201E+00 0.94258E+00 | ||
1643 | + 1. -0.56014E+01 0.34083E+01 0.94874E+00 | ||
1644 | + 1. 0.15753E+02 0.78257E+01 0.95518E+00 | ||
1645 | + 1. -0.11281E+02 0.16499E+02 0.96655E+00 | ||
1646 | + 1. -0.54511E+01 -0.19167E+02 0.96988E+00 | ||
1647 | + 1. 0.14935E+02 0.58566E+00 0.97460E+00 | ||
1648 | + 1. 0.11784E+02 0.13020E+02 0.98134E+00 | ||
1649 | + 1. 0.65673E+01 0.13147E+02 0.98825E+00 | ||
1650 | + 1. 0.56804E+01 -0.17762E+02 0.99900E+00 | ||
1651 | + 1. -0.17999E+02 0.13659E+00 0.10065E+01 | ||
1652 | + 1. -0.78856E+01 0.81557E+01 0.10088E+01 | ||
1653 | + 1. 0.95583E+01 -0.65313E+01 0.10147E+01 | ||
1654 | + 1. -0.25175E+01 0.11051E+02 0.10211E+01 | ||
1655 | + 1. 0.15930E+02 -0.11032E+02 0.10324E+01 | ||
1656 | + 1. -0.17718E+02 0.22984E+01 0.10383E+01 | ||
1657 | + 1. 0.46983E+00 -0.16496E+02 0.10409E+01 | ||
1658 | + 1. 0.50458E+01 -0.14813E+02 0.10469E+01 | ||
1659 | + 1. -0.64371E+01 -0.10822E+02 0.10540E+01 | ||
1660 | + 1. -0.54238E+01 -0.63352E+01 0.10631E+01 | ||
1661 | + 1. 0.69438E+00 -0.15534E+01 0.10710E+01 | ||
1662 | + 1. -0.14929E+02 -0.12558E+02 0.10792E+01 | ||
1663 | + 1. -0.12029E+02 0.15196E+01 0.10853E+01 | ||
1664 | + 1. 0.34185E+01 0.47143E+01 0.10900E+01 | ||
1665 | + 1. 0.14771E+02 0.11376E+02 0.10988E+01 | ||
1666 | + 1. 0.62356E+01 0.16805E+02 0.11009E+01 | ||
1667 | + 1. -0.15569E+02 0.12364E+02 0.11113E+01 | ||
1668 | + 1. 0.87100E+01 0.17163E+02 0.11165E+01 | ||
1669 | + 1. 0.24450E+01 -0.46926E+01 0.11262E+01 | ||
1670 | + 1. -0.31581E+00 0.18132E+02 0.11310E+01 | ||
1671 | + 1. 0.88008E+01 -0.89787E+01 0.11397E+01 | ||
1672 | + 1. 0.79135E+01 -0.13611E+02 0.11428E+01 | ||
1673 | + 1. 0.60332E+01 0.33627E+01 0.11525E+01 | ||
1674 | + 1. -0.38089E+01 -0.17881E+02 0.11595E+01 | ||
1675 | + 1. 0.49042E+01 -0.10614E+02 0.11624E+01 | ||
1676 | + 1. 0.12918E+02 -0.36282E+01 0.11676E+01 | ||
1677 | + 1. 0.26228E+01 0.16562E+01 0.11736E+01 | ||
1678 | + 1. 0.37839E+01 0.18748E+02 0.11836E+01 | ||
1679 | + 1. -0.16309E+02 -0.11938E+01 0.11882E+01 | ||
1680 | + 1. -0.49425E+01 0.10941E+02 0.11960E+01 | ||
1681 | + 1. 0.19805E+02 -0.26366E+01 0.12049E+01 | ||
1682 | + 1. -0.34991E+01 -0.68905E+01 0.12090E+01 | ||
1683 | + 1. 0.16159E+01 0.15915E+02 0.12181E+01 | ||
1684 | + 1. 0.71639E+01 -0.16149E+02 0.12221E+01 | ||
1685 | + 1. 0.13461E+02 0.14559E+02 0.12326E+01 | ||
1686 | + 1. 0.49150E+01 0.14292E+02 0.12358E+01 | ||
1687 | + 1. 0.17331E+02 -0.77288E+01 0.12429E+01 | ||
1688 | + 1. -0.11464E+02 0.56796E+01 0.12525E+01 | ||
1689 | + 1. 0.72258E+01 0.96775E+01 0.12554E+01 | ||
1690 | + 1. -0.57305E+01 0.15956E+02 0.12654E+01 | ||
1691 | + 1. 0.13142E+02 -0.11891E+02 0.12732E+01 | ||
1692 | + 1. 0.19154E+02 0.36278E+00 0.12783E+01 | ||
1693 | + 1. 0.99251E+01 0.22224E+01 0.12850E+01 | ||
1694 | + 1. -0.73325E+01 -0.83213E+01 0.12920E+01 | ||
1695 | + 1. 0.10015E+02 0.14660E+02 0.12959E+01 | ||
1696 | + 1. 0.13947E+02 -0.14338E+02 0.13037E+01 | ||
1697 | + 1. -0.93093E+01 0.16981E+02 0.13082E+01 | ||
1698 | + 1. 0.18377E+02 0.76569E+01 0.13149E+01 | ||
1699 | + 1. -0.10035E+01 -0.11205E+02 0.13263E+01 | ||
1700 | + 1. -0.37092E+01 0.22726E+01 0.13315E+01 | ||
1701 | + 1. 0.27230E+01 0.82708E+01 0.13399E+01 | ||
1702 | + 1. 0.64214E+01 0.71747E+01 0.13445E+01 | ||
1703 | + 1. -0.99934E+01 0.17796E+01 0.13495E+01 | ||
1704 | + 1. -0.14186E+02 -0.62746E+01 0.13574E+01 | ||
1705 | + 1. 0.20980E+01 -0.11830E+02 0.13626E+01 | ||
1706 | + 1. 0.10811E+02 0.11201E+02 0.13695E+01 | ||
1707 | + 1. -0.30741E+01 0.56367E+01 0.13734E+01 | ||
1708 | + 1. -0.12159E+02 -0.27735E+01 0.13858E+01 | ||
1709 | + 1. -0.28163E+01 0.13779E+02 0.13903E+01 | ||
1710 | + 1. 0.12134E+02 -0.69284E+01 0.13964E+01 | ||
1711 | + 1. 0.14227E+01 -0.82672E+01 0.14002E+01 | ||
1712 | + 1. 0.43870E+00 0.25745E+01 0.14111E+01 | ||
1713 | + 1. -0.15291E+02 0.62942E+01 0.14175E+01 | ||
1714 | + 1. 0.15135E+02 -0.24375E+01 0.14210E+01 | ||
1715 | + 1. 0.55007E+01 -0.22459E+01 0.14268E+01 | ||
1716 | + 1. 0.68673E+01 -0.53113E+01 0.14375E+01 | ||
1717 | + 1. 0.19285E+02 0.30074E+01 0.14430E+01 | ||
1718 | + 1. -0.16757E+02 -0.83185E+01 0.14527E+01 | ||
1719 | + 1. 0.91503E+01 -0.15505E+02 0.14546E+01 | ||
1720 | + 1. 0.15815E+02 0.24880E+01 0.14623E+01 | ||
1721 | + 1. -0.19501E+01 -0.82840E+01 0.14682E+01 | ||
1722 | + 1. -0.19047E+02 -0.18416E+01 0.14775E+01 | ||
1723 | + 1. -0.12054E+02 -0.12059E+02 0.14848E+01 | ||
1724 | + 1. 0.57592E+01 -0.12983E+02 0.14907E+01 | ||
1725 | + 1. -0.12987E+02 0.37027E+01 0.14936E+01 | ||
1726 | + 1. -0.11983E+02 0.86789E+01 0.15031E+01 | ||
1727 | + 1. -0.17574E+02 -0.51030E+01 0.15132E+01 | ||
1728 | + 1. -0.12726E+02 0.11681E+02 0.15169E+01 | ||
1729 | + 1. -0.41805E+01 -0.13748E+02 0.15211E+01 | ||
1730 | + 1. -0.90869E+01 0.14625E+02 0.15267E+01 | ||
1731 | + 1. -0.16551E+02 -0.11091E+02 0.15350E+01 | ||
1732 | + 1. -0.88997E+01 -0.46846E+00 0.15461E+01 | ||
1733 | + 1. -0.14852E+01 -0.16223E+02 0.15490E+01 | ||
1734 | + 1. 0.13469E+02 0.76462E+01 0.15574E+01 | ||
1735 | + 1. -0.55261E+01 -0.16406E+02 0.15645E+01 | ||
1736 | + 1. 0.99083E+01 -0.12043E+02 0.15680E+01 | ||
1737 | + 1. -0.67586E+01 0.62549E+01 0.15752E+01 | ||
1738 | + 1. -0.91701E+01 -0.36830E+01 0.15860E+01 | ||
1739 | + 1. 0.11841E+02 -0.60123E+00 0.15932E+01 | ||
1740 | + 1. -0.37880E+01 -0.10046E+02 0.15939E+01 | ||
1741 | + 1. -0.45807E+01 -0.14216E+00 0.16047E+01 | ||
1742 | + 1. 0.81308E+00 -0.14388E+02 0.16110E+01 | ||
1743 | + 1. -0.73735E+01 0.10761E+02 0.16192E+01 | ||
1744 | + 1. -0.10763E+02 -0.65571E+01 0.16228E+01 | ||
1745 | + 1. -0.19102E+02 0.56933E+01 0.16281E+01 | ||
1746 | + 1. 0.23160E+01 -0.16003E+02 0.16351E+01 | ||
1747 | + 1. -0.29761E+01 -0.48063E+01 0.16414E+01 | ||
1748 | + 1. -0.17747E+02 0.84244E+01 0.16521E+01 | ||
1749 | + 1. 0.14044E+02 0.51623E+01 0.16543E+01 | ||
1750 | + 1. -0.67271E+00 -0.65840E+01 0.16619E+01 | ||
1751 | + 1. -0.27556E+01 -0.19720E+02 0.16690E+01 | ||
1752 | + 1. 0.35141E+00 -0.18987E+02 0.16755E+01 | ||
1753 | + 1. -0.71019E+01 -0.13749E+02 0.16811E+01 | ||
1754 | + 1. -0.15064E+01 0.43280E+01 0.16894E+01 | ||
1755 | + 1. 0.11589E+02 -0.15148E+02 0.16980E+01 | ||
1756 | + 1. -0.10419E+02 0.11366E+02 0.17046E+01 | ||
1757 | + 1. 0.20803E+01 0.60973E+01 0.17093E+01 | ||
1758 | + 1. 0.10244E+02 0.74750E+01 0.17177E+01 | ||
1759 | + 1. 0.16191E+02 0.58225E+01 0.17257E+01 | ||
1760 | + 1. 0.14648E+02 -0.60433E+01 0.17288E+01 | ||
1761 | + 1. 0.12063E+02 0.94930E+01 0.17335E+01 | ||
1762 | + 1. -0.28373E+01 -0.12206E+02 0.17427E+01 | ||
1763 | + 1. -0.13534E+02 -0.10731E+02 0.17483E+01 | ||
1764 | + 1. -0.13701E+02 0.13663E+02 0.17559E+01 | ||
1765 | + 1. -0.50876E-01 0.13354E+02 0.17606E+01 | ||
1766 | + 1. -0.11385E+02 0.13918E+02 0.17710E+01 | ||
1767 | + 1. 0.95938E+01 0.42007E+01 0.17792E+01 | ||
1768 | + 1. 0.95956E+01 -0.46837E+01 0.17847E+01 | ||
1769 | + 1. 0.96835E+01 -0.41425E+00 0.17924E+01 | ||
1770 | + 1. 0.10601E+01 0.11475E+02 0.17957E+01 | ||
1771 | + 1. 0.82088E+01 0.11641E+02 0.18014E+01 | ||
1772 | + 1. 0.38578E+01 -0.26728E+00 0.18131E+01 | ||
1773 | + 1. 0.39566E+01 -0.18422E+02 0.18182E+01 | ||
1774 | + 1. -0.15971E+02 0.99680E+01 0.18233E+01 | ||
1775 | + 1. 0.17262E+02 -0.38195E-01 0.18283E+01 | ||
1776 | + 1. 0.10516E+02 -0.81615E+01 0.18398E+01 | ||
1777 | + 1. -0.99651E+01 0.37746E+01 0.18419E+01 | ||
1778 | + 1. -0.76116E+01 -0.20816E+01 0.18474E+01 | ||
1779 | + 1. -0.68471E+00 0.24914E+00 0.18563E+01 | ||
1780 | + 1. 0.58651E+01 0.11111E+02 0.18630E+01 | ||
1781 | + 1. -0.70755E+01 -0.45879E+01 0.18726E+01 | ||
1782 | + 1. -0.78266E+01 0.26593E+01 0.18754E+01 | ||
1783 | + 1. -0.58486E+01 0.13975E+02 0.18841E+01 | ||
1784 | + 1. 0.14762E+02 -0.94847E+01 0.18887E+01 | ||
1785 | + 1. 0.14626E+02 0.93362E+01 0.18980E+01 | ||
1786 | + 1. -0.10240E+02 -0.96876E+01 0.19055E+01 | ||
1787 | + 1. 0.73287E+01 0.51589E+01 0.19082E+01 | ||
1788 | + 1. -0.81457E+01 -0.11662E+02 0.19134E+01 | ||
1789 | + 1. -0.10723E+02 -0.14903E+02 0.19228E+01 | ||
1790 | + 1. -0.13279E+02 -0.82716E+01 0.19286E+01 | ||
1791 | + 1. -0.15518E+02 0.20516E+01 0.19386E+01 | ||
1792 | + 1. 0.45182E+00 0.19877E+02 0.19447E+01 | ||
1793 | + 1. 0.18141E+02 0.49964E+01 0.19506E+01 | ||
1794 | + 1. 0.41057E+01 -0.61912E+01 0.19597E+01 | ||
1795 | + 1. -0.64284E+00 0.81459E+01 0.19604E+01 | ||
1796 | + 1. 0.74624E+01 -0.73081E+01 0.19713E+01 | ||
1797 | + 1. 0.36834E+01 0.12119E+02 0.19753E+01 | ||
1798 | + 1. 0.84213E+01 -0.17775E+02 0.19826E+01 | ||
1799 | + 1. -0.17303E+02 -0.31720E+01 0.19870E+01 | ||
1800 | + 1. 0.61340E+00 -0.44335E+01 0.19989E+01 | ||
1801 | + 1. -0.13379E+02 0.64149E+01 0.20002E+01 | ||
1802 | + 1. 0.21608E+01 -0.28130E+01 0.20091E+01 | ||
1803 | + 1. 0.16741E+01 0.40584E+01 0.20198E+01 | ||
1804 | + 1. 0.76130E+01 -0.30041E+01 0.20206E+01 | ||
1805 | + 1. 0.45363E+01 0.94099E+01 0.20279E+01 | ||
1806 | + 1. 0.79086E+01 0.23602E+01 0.20396E+01 | ||
1807 | + 1. -0.10022E+02 -0.17278E+02 0.20415E+01 | ||
1808 | + 1. -0.15615E+02 0.41148E+01 0.20477E+01 | ||
1809 | + 1. 0.62576E+01 0.74038E-01 0.20568E+01 | ||
1810 | + 1. 0.17768E+02 -0.28617E+01 0.20656E+01 | ||
1811 | + 1. -0.19792E+02 0.16767E+01 0.20699E+01 | ||
1812 | + 1. -0.40597E+01 0.18756E+02 0.20743E+01 | ||
1813 | + 1. 0.11713E+02 0.16013E+02 0.20841E+01 | ||
1814 | + 1. 0.62725E+01 -0.91195E+01 0.20898E+01 | ||
1815 | + 1. 0.13013E+02 0.11660E+02 0.20935E+01 | ||
1816 | + 1. -0.87368E+00 -0.13196E+02 0.21036E+01 | ||
1817 | + 1. 0.31165E+01 0.14186E+02 0.21126E+01 | ||
1818 | + 1. 0.16579E+02 -0.51297E+01 0.21141E+01 | ||
1819 | + 1. -0.64979E+01 0.17788E+02 0.21213E+01 | ||
1820 | + 1. -0.34746E+01 0.91649E+01 0.21315E+01 | ||
1821 | + 1. -0.13866E+02 -0.36620E+01 0.21335E+01 | ||
1822 | + 1. -0.40996E+00 0.15515E+02 0.21412E+01 | ||
1823 | + 1. 0.24411E+01 0.17578E+02 0.21515E+01 | ||
1824 | + 1. -0.61170E+01 0.80648E+01 0.21547E+01 | ||
1825 | + 1. 0.14862E+02 0.13281E+02 0.21621E+01 | ||
1826 | + 1. 0.11065E+02 -0.10428E+02 0.21696E+01 | ||
1827 | + 1. -0.43434E+01 -0.22662E+01 0.21748E+01 | ||
1828 | + 1. -0.10932E+01 -0.17424E+01 0.21839E+01 | ||
1829 | + 1. -0.15141E+01 0.22118E+01 0.21916E+01 | ||
1830 | + 1. 0.98961E-01 -0.95634E+01 0.21949E+01 | ||
1831 | + 1. 0.17051E+02 -0.94867E+01 0.22034E+01 | ||
1832 | + 1. 0.48711E+01 0.60535E+01 0.22128E+01 | ||
1833 | + 1. -0.89493E+01 0.59041E+01 0.22186E+01 | ||
1834 | + 1. 0.14896E+02 -0.12457E+02 0.22259E+01 | ||
1835 | + 1. 0.13426E+02 0.13655E+01 0.22310E+01 | ||
1836 | + 1. -0.11064E+02 -0.43774E+01 0.22391E+01 | ||
1837 | + 1. 0.12188E+02 0.40600E+01 0.22444E+01 | ||
1838 | + 1. 0.11533E+02 -0.25535E+01 0.22476E+01 | ||
1839 | + 1. -0.68599E+01 -0.14743E+00 0.22539E+01 | ||
1840 | + 1. 0.54741E+01 0.18747E+02 0.22623E+01 | ||
1841 | + 1. -0.19883E+01 0.17970E+02 0.22731E+01 | ||
1842 | + 1. -0.13040E+02 0.23678E+00 0.22758E+01 | ||
1843 | + 1. -0.40738E+01 0.15378E+02 0.22845E+01 | ||
1844 | + 1. -0.86138E+01 -0.60501E+01 0.22878E+01 | ||
1845 | + 1. 0.78804E+01 0.15689E+02 0.22977E+01 | ||
1846 | + 1. 0.14115E+00 0.61610E+01 0.23007E+01 | ||
1847 | + 1. 0.16260E+02 0.10739E+02 0.23092E+01 | ||
1848 | + 1. 0.48490E+01 0.18184E+01 0.23151E+01 | ||
1849 | + 1. -0.65921E+01 -0.18126E+02 0.23213E+01 | ||
1850 | + 1. -0.41149E+01 0.12483E+02 0.23288E+01 | ||
1851 | + 1. -0.16083E+02 -0.65537E+01 0.23397E+01 | ||
1852 | + 1. 0.77332E+01 -0.10577E+02 0.23431E+01 | ||
1853 | + 1. -0.44999E+01 0.45343E+01 0.23499E+01 | ||
1854 | + 1. 0.12844E+01 -0.64655E+01 0.23588E+01 | ||
1855 | + 1. -0.12675E+01 0.11873E+02 0.23655E+01 | ||
1856 | + 1. -0.18389E+01 -0.18041E+02 0.23714E+01 | ||
1857 | + 1. 0.10845E+01 0.92539E+01 0.23748E+01 | ||
1858 | + 1. 0.74691E+01 0.18367E+02 0.23857E+01 | ||
1859 | + 1. 0.39308E+01 -0.11917E+02 0.23913E+01 | ||
1860 | + 1. -0.15241E+02 0.80387E+01 0.23955E+01 | ||
1861 | + 1. 0.50544E+01 -0.16291E+02 0.24003E+01 | ||
1862 | + 1. -0.43407E+01 0.70176E+01 0.24107E+01 | ||
1863 | + 1. -0.10434E+02 -0.18153E+01 0.24145E+01 | ||
1864 | + 1. 0.11349E+02 0.12561E+01 0.24214E+01 | ||
1865 | + 1. -0.10064E+02 0.78412E+01 0.24296E+01 | ||
1866 | + 1. -0.18592E+02 -0.66910E+01 0.24375E+01 | ||
1867 | + 1. -0.55864E+01 -0.78730E+01 0.24416E+01 | ||
1868 | + 1. -0.57615E+01 0.20131E+01 0.24482E+01 | ||
1869 | + 1. -0.17875E+02 0.38405E+01 0.24580E+01 | ||
1870 | + 1. 0.84474E+01 0.86212E+01 0.24600E+01 | ||
1871 | + 1. 0.11186E+02 -0.13335E+02 0.24685E+01 | ||
1872 | + 1. -0.55701E+01 -0.12473E+02 0.24786E+01 | ||
1873 | + 1. 0.13016E+02 -0.86189E+01 0.24805E+01 | ||
1874 | + 1. 0.19542E+01 0.18663E+00 0.24903E+01 | ||
1875 | + 1. -0.48594E+01 -0.47839E+01 0.24950E+01 | ||
1876 | + 1. 0.31858E+01 -0.81132E+01 0.25048E+01 | ||
1877 | + 1. 0.14481E+02 -0.84746E+00 0.25132E+01 | ||
1878 | + 1. 0.65496E+01 -0.18776E+02 0.25169E+01 | ||
1879 | + 1. 0.18950E+02 -0.12457E+01 0.25218E+01 | ||
1880 | + 1. -0.13383E+02 0.10000E+02 0.25303E+01 | ||
1881 | + 1. 0.95009E+01 0.13040E+02 0.25362E+01 | ||
1882 | + 1. -0.37418E+01 -0.16274E+02 0.25429E+01 | ||
1883 | + 1. -0.72772E+01 0.15518E+02 0.25482E+01 | ||
1884 | + 1. 0.53940E+01 -0.41554E+01 0.25545E+01 | ||
1885 | + 1. 0.17853E+02 0.19790E+01 0.25620E+01 | ||
1886 | + 1. -0.12593E+02 0.15500E+02 0.25690E+01 | ||
1887 | + 1. 0.11761E+02 -0.52701E+01 0.25755E+01 | ||
1888 | + 1. -0.13327E+02 -0.13437E+02 0.25835E+01 | ||
1889 | + 1. -0.19452E+02 -0.43408E+01 0.25932E+01 | ||
1890 | + 1. -0.65222E+01 0.41486E+01 0.25954E+01 | ||
1891 | + 1. -0.12752E+02 -0.55963E+01 0.26010E+01 | ||
1892 | + 1. 0.48868E+01 0.16080E+02 0.26092E+01 | ||
1893 | + 1. 0.36768E+01 -0.14520E+02 0.26191E+01 | ||
1894 | + 1. 0.91161E+01 0.60675E+01 0.26247E+01 | ||
1895 | + 1. -0.94499E+01 -0.13474E+02 0.26279E+01 | ||
1896 | + 1. -0.11019E+02 0.43284E+00 0.26394E+01 | ||
1897 | + 1. -0.76934E+01 0.13078E+02 0.26423E+01 | ||
1898 | + 1. -0.14997E+02 -0.20535E+01 0.26506E+01 | ||
1899 | + 1. 0.19127E+02 -0.46016E+01 0.26534E+01 | ||
1900 | + 1. 0.48259E+01 0.39753E+01 0.26601E+01 | ||
1901 | + 1. -0.55020E+01 -0.99609E+01 0.26691E+01 | ||
1902 | + 1. -0.17068E+02 0.58466E+01 0.26753E+01 | ||
1903 | + 1. 0.15359E+02 0.40272E+01 0.26854E+01 | ||
1904 | + 1. 0.16768E+02 0.75197E+01 0.26925E+01 | ||
1905 | + 1. -0.15449E+02 -0.92488E+01 0.26976E+01 | ||
1906 | + 1. 0.12123E+02 0.14075E+02 0.27036E+01 | ||
1907 | + 1. -0.78629E+01 -0.15718E+02 0.27088E+01 | ||
1908 | + 1. -0.91617E+01 0.99868E+01 0.27164E+01 | ||
1909 | + 1. -0.22572E+01 0.69578E+01 0.27244E+01 | ||
1910 | + 1. -0.15600E+02 -0.11104E+00 0.27297E+01 | ||
1911 | + 1. 0.20344E+01 -0.10319E+02 0.27347E+01 | ||
1912 | + 1. 0.20796E+01 -0.18884E+02 0.27410E+01 | ||
1913 | + 1. -0.17455E+02 0.12836E+01 0.27478E+01 | ||
1914 | + 1. -0.21358E+01 -0.98918E+01 0.27536E+01 | ||
1915 | + 1. 0.77904E+01 -0.10075E+01 0.27642E+01 | ||
1916 | + 1. -0.12964E+01 -0.45846E+01 0.27708E+01 | ||
1917 | + 1. 0.42583E+00 0.17228E+02 0.27766E+01 | ||
1918 | + 1. 0.14968E+02 -0.39824E+01 0.27842E+01 | ||
1919 | + 1. 0.15987E+02 -0.74988E+01 0.27900E+01 | ||
1920 | + 1. 0.18544E+02 -0.70933E+01 0.27985E+01 | ||
1921 | + 1. -0.79387E+01 -0.97576E+01 0.28051E+01 | ||
1922 | + 1. -0.53591E+01 -0.14809E+02 0.28105E+01 | ||
1923 | + 1. 0.62050E+01 0.14081E+02 0.28188E+01 | ||
1924 | + 1. -0.46828E+01 -0.19225E+02 0.28258E+01 | ||
1925 | + 1. -0.28433E+01 0.57114E+00 0.28305E+01 | ||
1926 | + 1. -0.88330E+00 0.99367E+01 0.28342E+01 | ||
1927 | + 1. -0.10612E+02 0.15422E+02 0.28439E+01 | ||
1928 | + 1. 0.20058E+01 -0.13316E+02 0.28467E+01 | ||
1929 | + 1. 0.11445E+02 0.59065E+01 0.28546E+01 | ||
1930 | + 1. -0.10640E+02 -0.11592E+02 0.28608E+01 | ||
1931 | + 1. 0.71881E+01 -0.14586E+02 0.28694E+01 | ||
1932 | + 1. -0.18809E+02 -0.33211E+00 0.28767E+01 | ||
1933 | + 1. -0.15019E+02 0.11504E+02 0.28857E+01 | ||
1934 | + 1. 0.97087E+01 0.10453E+02 0.28926E+01 | ||
1935 | + 1. 0.82465E+01 -0.12651E+02 0.28951E+01 | ||
1936 | + 1. -0.15697E+02 -0.46430E+01 0.29006E+01 | ||
1937 | + 1. 0.99166E+01 -0.16735E+02 0.29094E+01 | ||
1938 | + 1. 0.14821E+02 0.70569E+01 0.29161E+01 | ||
1939 | + 1. -0.21396E+01 0.19875E+02 0.29260E+01 | ||
1940 | + 1. 0.62990E+01 0.90152E+01 0.29321E+01 | ||
1941 | + 1. 0.52390E+00 -0.17279E+02 0.29369E+01 | ||
1942 | + 1. 0.28061E+00 -0.11455E+02 0.29439E+01 | ||
1943 | + 1. 0.13198E+02 -0.10737E+02 0.29480E+01 | ||
1944 | + 1. -0.18494E+01 -0.14729E+02 0.29568E+01 | ||
1945 | + 1. -0.60073E+01 0.11908E+02 0.29665E+01 | ||
1946 | + 1. 0.15733E+02 0.97219E+00 0.29675E+01 | ||
1947 | + 1. -0.15228E+02 -0.11621E+02 0.29779E+01 | ||
1948 | + 1. -0.11354E+02 0.24404E+01 0.29850E+01 | ||
1949 | + 1. 0.81726E+01 -0.56397E+01 0.29873E+01 | ||
1950 | + 1. 0.95693E+01 -0.20185E+01 0.29938E+01 | ||
1951 | + 1. -0.19876E+01 0.14623E+02 0.30034E+01 | ||
1952 | + 1. 0.27537E+01 0.19773E+02 0.30078E+01 | ||
1953 | + 1. -0.11882E+02 0.45864E+01 0.30166E+01 | ||
1954 | + 1. 0.28131E+01 0.10155E+02 0.30265E+01 | ||
1955 | + 1. -0.12530E+02 -0.15239E+02 0.30332E+01 | ||
1956 | + 1. 0.10098E+02 -0.65581E+01 0.30386E+01 | ||
1957 | + 1. -0.90779E+01 0.11031E+01 0.30418E+01 | ||
1958 | + 1. -0.32689E+01 -0.79323E+01 0.30490E+01 | ||
1959 | + 1. 0.33186E+01 0.70269E+01 0.30573E+01 | ||
1960 | + 1. -0.11569E+02 -0.80732E+01 0.30621E+01 | ||
1961 | + 1. 0.60583E+01 -0.63004E+01 0.30710E+01 | ||
1962 | + 1. -0.62785E+01 -0.29723E+01 0.30755E+01 | ||
1963 | + 1. 0.21201E+01 0.23203E+01 0.30840E+01 | ||
1964 | + 1. 0.26479E+01 -0.50621E+01 0.30920E+01 | ||
1965 | + 1. 0.13124E+02 -0.13727E+02 0.30960E+01 | ||
1966 | + 1. -0.80884E+01 0.78197E+01 0.31011E+01 | ||
1967 | + 1. 0.13312E+01 0.14733E+02 0.31070E+01 | ||
1968 | + 1. -0.13106E+02 0.80749E+01 0.31149E+01 | ||
1969 | + 1. 0.43977E+01 -0.10069E+02 0.31219E+01 | ||
1970 | + 1. 0.13356E+02 -0.24245E+01 0.31330E+01 | ||
1971 | + 1. 0.19854E+02 0.11587E+01 0.31337E+01 | ||
1972 | + 1. 0.15841E+02 -0.10885E+02 0.31444E+01 | ||
1973 | + 1. -0.83532E+01 0.17922E+02 0.31475E+01 | ||
1974 | + 1. 0.13449E+02 -0.67740E+01 0.31564E+01 | ||
1975 | + 1. 0.10144E+02 0.16785E+02 0.31627E+01 | ||
1976 | + 1. 0.93468E+01 0.13062E+01 0.31723E+01 | ||
1977 | + 1. 0.86329E+01 -0.86652E+01 0.31765E+01 | ||
1978 | + 1. -0.85711E+01 -0.78868E+01 0.31820E+01 | ||
1979 | + 1. 0.50200E+00 -0.10723E+01 0.31893E+01 | ||
1980 | + 1. -0.13357E+02 0.25404E+01 0.31999E+01 | ||
1981 | + 1. -0.12382E+02 -0.14741E+01 0.32064E+01 | ||
1982 | + 1. -0.51129E+01 0.97384E+01 0.32096E+01 | ||
1983 | + 1. -0.96108E+01 0.12566E+02 0.32196E+01 | ||
1984 | + 1. 0.21073E+01 0.12568E+02 0.32235E+01 | ||
1985 | + 1. -0.26028E+01 -0.26405E+01 0.32274E+01 | ||
1986 | + 1. -0.22651E+00 0.43610E+01 0.32362E+01 | ||
1987 | + 1. 0.93359E+01 -0.14602E+02 0.32405E+01 | ||
1988 | + 1. 0.50355E+01 -0.12255E+01 0.32488E+01 | ||
1989 | + 1. -0.17168E+02 -0.10163E+02 0.32544E+01 | ||
1990 | + 1. 0.16435E+02 -0.12161E+01 0.32649E+01 | ||
1991 | + 1. 0.11286E+02 0.11891E+02 0.32689E+01 | ||
1992 | + 1. -0.86888E+00 -0.19865E+02 0.32787E+01 | ||
1993 | + 1. -0.11804E+02 0.12386E+02 0.32816E+01 | ||
1994 | + 1. -0.84513E+01 -0.18010E+02 0.32871E+01 | ||
1995 | + 1. 0.18722E+02 0.67674E+01 0.32952E+01 | ||
1996 | + 1. -0.66976E+01 -0.61500E+01 0.33031E+01 | ||
1997 | + 1. -0.44618E+01 0.17063E+02 0.33103E+01 | ||
1998 | + 1. -0.14171E+02 -0.68801E+01 0.33195E+01 | ||
1999 | + 1. 0.94226E+01 0.14919E+02 0.33221E+01 | ||
2000 | + 1. -0.11480E+02 0.99443E+01 0.33306E+01 | ||
2001 | + 1. -0.34928E+01 0.24126E+01 0.33398E+01 | ||
2002 | + 1. 0.19069E+00 -0.15341E+02 0.33433E+01 | ||
2003 | + 1. 0.11446E+02 0.84671E+01 0.33469E+01 | ||
2004 | + 1. 0.68542E+01 0.67636E+01 0.33572E+01 | ||
2005 | + 1. -0.71807E-01 -0.77101E+01 0.33610E+01 | ||
2006 | + 1. 0.10614E+02 0.30148E+01 0.33719E+01 | ||
2007 | + 1. -0.32618E+01 -0.58775E+01 0.33775E+01 | ||
2008 | + 1. -0.38065E+01 -0.10974E+02 0.33828E+01 | ||
2009 | + 1. -0.85089E+01 -0.30943E+01 0.33873E+01 | ||
2010 | + 1. 0.54609E+01 -0.13576E+02 0.33964E+01 | ||
2011 | + 1. -0.18621E+02 0.69901E+01 0.34041E+01 | ||
2012 | + 1. 0.35582E+01 -0.17216E+02 0.34110E+01 | ||
2013 | + 1. -0.12092E+02 -0.10155E+02 0.34137E+01 | ||
2014 | + 1. 0.79815E+01 0.39831E+01 0.34257E+01 | ||
2015 | + 1. 0.72104E+01 0.10749E+02 0.34307E+01 | ||
2016 | + 1. 0.64899E+01 -0.11772E+02 0.34354E+01 | ||
2017 | + 1. -0.16964E+02 -0.80348E+01 0.34422E+01 | ||
2018 | + 1. 0.35876E+01 -0.28444E+01 0.34523E+01 | ||
2019 | + 1. 0.49800E-01 0.13609E+01 0.34560E+01 | ||
2020 | + 1. -0.16802E+02 0.89484E+01 0.34616E+01 | ||
2021 | + 1. 0.14706E+02 0.11669E+02 0.34699E+01 | ||
2022 | + 1. 0.19592E+02 0.38912E+01 0.34780E+01 | ||
2023 | + 1. -0.19786E+02 -0.19731E+01 0.34826E+01 | ||
2024 | + 1. -0.14756E+02 0.55716E+01 0.34882E+01 | ||
2025 | + 1. -0.87913E+01 -0.90671E+00 0.34998E+01 | ||
2026 | + 1. -0.97784E+01 -0.15831E+02 0.35060E+01 | ||
2027 | + 1. -0.88465E+01 0.37619E+01 0.35103E+01 | ||
2028 | + 1. 0.46353E+01 0.11183E+02 0.35133E+01 | ||
2029 | + 1. 0.71258E+01 -0.16597E+02 0.35233E+01 | ||
2030 | + 1. -0.27136E+01 0.44191E+01 0.35292E+01 | ||
2031 | + 1. -0.17576E+02 -0.52954E+01 0.35363E+01 | ||
2032 | + 1. 0.15992E+02 0.91820E+01 0.35415E+01 | ||
2033 | + 1. -0.34370E+01 -0.12944E+02 0.35511E+01 | ||
2034 | + 1. 0.96474E+01 -0.10917E+02 0.35570E+01 | ||
2035 | + 1. 0.11201E+02 -0.97363E+00 0.35660E+01 | ||
2036 | + 1. 0.69128E+01 0.14835E+01 0.35693E+01 | ||
2037 | + 1. 0.13648E+02 0.85810E+01 0.35760E+01 | ||
2038 | + 1. -0.58314E+01 -0.16597E+02 0.35814E+01 | ||
2039 | + 1. -0.10112E+02 -0.64320E+01 0.35901E+01 | ||
2040 | + 1. -0.77932E+01 -0.12691E+02 0.35969E+01 | ||
2041 | + 1. -0.16346E+02 0.29773E+01 0.36009E+01 | ||
2042 | + 1. 0.90604E+01 -0.38896E+01 0.36118E+01 | ||
2043 | + 1. -0.66577E+01 0.62703E+01 0.36147E+01 | ||
2044 | + 1. -0.76907E+01 0.11004E+02 0.36226E+01 | ||
2045 | + 1. -0.17286E+02 -0.17338E+01 0.36286E+01 | ||
2046 | + 1. 0.39318E+00 -0.31110E+01 0.36366E+01 | ||
2047 | + 1. -0.10899E+02 0.64246E+01 0.36430E+01 | ||
2048 | + 1. 0.11207E+02 -0.88555E+01 0.36473E+01 | ||
2049 | + 1. -0.45085E+01 -0.72715E+00 0.36568E+01 | ||
2050 | + 1. -0.24816E+01 0.16574E+02 0.36655E+01 | ||
2051 | + 1. -0.19425E+02 0.43655E+01 0.36673E+01 | ||
2052 | + 1. 0.17137E+02 0.49085E+01 0.36794E+01 | ||
2053 | + 1. 0.51243E+01 -0.81151E+01 0.36838E+01 | ||
2054 | + 1. 0.35361E+01 0.99607E+00 0.36893E+01 | ||
2055 | + 1. -0.28429E+01 -0.19261E+02 0.36967E+01 | ||
2056 | + 1. 0.13311E+02 0.48852E+01 0.37004E+01 | ||
2057 | + 1. 0.28749E+01 0.16338E+02 0.37083E+01 | ||
2058 | + 1. 0.11289E+01 0.76456E+01 0.37133E+01 | ||
2059 | + 1. -0.14789E+02 0.13330E+02 0.37260E+01 | ||
2060 | + 1. -0.21336E+00 0.18968E+02 0.37332E+01 | ||
2061 | + 1. 0.21164E+01 -0.15845E+02 0.37391E+01 | ||
2062 | + 1. 0.77844E+01 0.12876E+02 0.37401E+01 | ||
2063 | + 1. 0.29854E+01 0.46678E+01 0.37475E+01 | ||
2064 | + 1. -0.42133E+01 0.13897E+02 0.37535E+01 | ||
2065 | + 1. -0.25057E+01 0.10963E+02 0.37640E+01 | ||
2066 | + 1. -0.11639E+02 -0.13550E+02 0.37716E+01 | ||
2067 | + 1. 0.11321E+02 -0.14896E+02 0.37758E+01 | ||
2068 | + 1. 0.43943E+01 -0.19064E+02 0.37844E+01 | ||
2069 | + 1. -0.18831E+02 0.23718E+01 0.37930E+01 | ||
2070 | + 1. 0.39867E+00 0.11520E+02 0.37984E+01 | ||
2071 | + 1. 0.17230E+02 -0.38277E+01 0.38012E+01 | ||
2072 | + 1. 0.13071E+02 0.26012E+01 0.38121E+01 | ||
2073 | + 1. -0.49318E+01 0.19286E+02 0.38165E+01 | ||
2074 | + 1. -0.12225E+02 -0.38140E+01 0.38202E+01 | ||
2075 | + 1. -0.74097E+01 0.20249E+01 0.38309E+01 | ||
2076 | + 1. 0.12945E+02 0.10559E+02 0.38360E+01 | ||
2077 | + 1. 0.57397E+01 0.17474E+02 0.38440E+01 | ||
2078 | + 1. 0.19439E+02 -0.29056E+01 0.38501E+01 | ||
2079 | + 1. 0.50140E+01 0.77706E+01 0.38569E+01 | ||
2080 | + 1. -0.53567E+00 0.13349E+02 0.38603E+01 | ||
2081 | + 1. -0.14884E+01 -0.51965E+00 0.38706E+01 | ||
2082 | + 1. -0.12122E+01 -0.16833E+02 0.38779E+01 | ||
2083 | + 1. -0.22901E+01 0.89006E+01 0.38850E+01 | ||
2084 | + 1. -0.15360E+01 -0.12153E+02 0.38901E+01 | ||
2085 | + 1. 0.64707E+01 -0.28752E+01 0.38953E+01 | ||
2086 | + 1. 0.17847E+02 0.44621E+00 0.39056E+01 | ||
2087 | + 1. 0.12970E+02 0.70104E-01 0.39107E+01 | ||
2088 | + 1. 0.39819E+01 0.14640E+02 0.39180E+01 | ||
2089 | + 1. 0.11434E+02 -0.11780E+02 0.39214E+01 | ||
2090 | + 1. 0.97207E+01 0.75886E+01 0.39272E+01 | ||
2091 | + 1. 0.38055E+01 0.18332E+02 0.39342E+01 | ||
2092 | + 1. 0.82844E+01 0.17022E+02 0.39402E+01 | ||
2093 | + 1. -0.90483E+01 0.14625E+02 0.39509E+01 | ||
2094 | + 1. 0.14306E+00 -0.53330E+01 0.39557E+01 | ||
2095 | + 1. 0.13892E+02 0.14149E+02 0.39629E+01 | ||
2096 | + 1. -0.13895E+02 -0.90039E+01 0.39714E+01 | ||
2097 | + 1. -0.68171E+01 -0.85069E+01 0.39746E+01 | ||
2098 | + 1. 0.17920E+02 0.86509E+01 0.39853E+01 | ||
2099 | + 1. -0.14798E+02 0.93057E+01 0.39876E+01 | ||
2100 | + 1. -0.14922E+02 0.14292E+01 0.39963E+01 | ||
2101 | + 1. 0.17451E+02 -0.85469E+01 0.40037E+01 | ||
2102 | + 1. 0.16124E+02 -0.56488E+01 0.40085E+01 | ||
2103 | + 1. 0.15449E+02 -0.90764E+01 0.40199E+01 | ||
2104 | + 1. 0.17509E+01 0.18151E+02 0.40225E+01 | ||
2105 | + 1. 0.65252E+01 -0.98550E+01 0.40295E+01 | ||
2106 | + 1. -0.12910E+02 -0.11987E+02 0.40389E+01 | ||
2107 | + 1. 0.13256E+02 -0.48521E+01 0.40430E+01 | ||
2108 | + 1. 0.10083E+02 0.49620E+01 0.40505E+01 | ||
2109 | + 1. -0.10077E+02 -0.95996E+01 0.40573E+01 | ||
2110 | + 1. -0.63243E+01 0.16847E+02 0.40620E+01 | ||
2111 | + 1. 0.27630E+01 -0.10674E+01 0.40700E+01 | ||
2112 | + 1. -0.10253E+02 -0.43920E+01 0.40768E+01 | ||
2113 | + 1. -0.64823E+01 0.85027E+01 0.40826E+01 | ||
2114 | + 1. 0.18891E+01 -0.87425E+01 0.40868E+01 | ||
2115 | + 1. 0.91982E-01 -0.13421E+02 0.40993E+01 | ||
2116 | + 1. 0.12141E+02 0.15643E+02 0.41014E+01 | ||
2117 | + 1. 0.35756E+01 -0.68182E+01 0.41077E+01 | ||
2118 | + 1. 0.14123E+02 -0.12321E+02 0.41136E+01 | ||
2119 | + 1. 0.30508E+01 -0.11417E+02 0.41216E+01 | ||
2120 | + 1. -0.68604E+01 -0.14532E+02 0.41317E+01 | ||
2121 | + 1. -0.66218E+00 0.65206E+01 0.41365E+01 | ||
2122 | + 1. 0.53397E+01 0.26881E+01 0.41455E+01 | ||
2123 | + 1. -0.37458E+01 -0.14993E+02 0.41527E+01 | ||
2124 | + 1. -0.35909E+01 0.63568E+01 0.41542E+01 | ||
2125 | + 1. -0.12421E+02 0.14238E+02 0.41621E+01 | ||
2126 | + 1. -0.39437E+01 -0.41340E+01 0.41676E+01 | ||
2127 | + 1. 0.16553E+02 0.25238E+01 0.41749E+01 | ||
2128 | + 1. 0.57465E+01 0.51689E+01 0.41831E+01 | ||
2129 | + 1. -0.64921E+01 0.13565E+02 0.41925E+01 | ||
2130 | + 1. -0.13438E+02 0.11619E+02 0.41970E+01 | ||
2131 | + 1. -0.16437E+02 0.10933E+02 0.42061E+01 | ||
2132 | + 1. 0.49349E+01 -0.15397E+02 0.42078E+01 | ||
2133 | + 1. 0.44649E+01 -0.49314E+01 0.42169E+01 | ||
2134 | + 1. 0.10827E+02 -0.31402E+01 0.42237E+01 | ||
2135 | + 1. -0.14712E+02 -0.13533E+02 0.42316E+01 | ||
2136 | + 1. -0.14639E+01 0.24646E+01 0.42375E+01 | ||
2137 | + 1. -0.14106E+02 -0.29044E+01 0.42406E+01 | ||
2138 | + 1. -0.65360E+01 -0.19806E+00 0.42530E+01 | ||
2139 | + 1. -0.13388E+02 0.15814E+00 0.42552E+01 | ||
2140 | + 1. -0.87562E+01 0.60112E+01 0.42649E+01 | ||
2141 | + 1. -0.18512E+00 0.15765E+02 0.42685E+01 | ||
2142 | + 1. -0.56736E+01 0.29157E+01 0.42751E+01 | ||
2143 | + 1. 0.74879E+01 -0.18476E+02 0.42820E+01 | ||
2144 | + 1. 0.15250E+02 0.52699E+01 0.42897E+01 | ||
2145 | + 1. -0.64193E+00 -0.97361E+01 0.42992E+01 | ||
2146 | + 1. 0.18199E+02 -0.56508E+01 0.43031E+01 | ||
2147 | + 1. 0.19905E+02 -0.48703E+00 0.43092E+01 | ||
2148 | + 1. -0.67716E+01 -0.10864E+02 0.43162E+01 | ||
2149 | + 1. -0.16308E+02 0.72106E+01 0.43214E+01 | ||
2150 | + 1. 0.69592E+01 0.15306E+02 0.43295E+01 | ||
2151 | + 1. -0.65060E+01 -0.18355E+02 0.43354E+01 | ||
2152 | + 1. -0.18351E+02 -0.34904E+01 0.43428E+01 | ||
2153 | + 1. -0.10078E+02 0.17219E+02 0.43469E+01 | ||
2154 | + 1. -0.12254E+02 -0.66496E+01 0.43548E+01 | ||
2155 | + 1. -0.49346E+01 -0.65079E+01 0.43636E+01 | ||
2156 | + 1. -0.39012E+01 -0.17601E+02 0.43679E+01 | ||
2157 | + 1. 0.10867E+02 0.13574E+02 0.43748E+01 | ||
2158 | + 1. -0.25167E+01 0.18501E+02 0.43810E+01 | ||
2159 | + 1. -0.96711E+01 0.80350E+01 0.43869E+01 | ||
2160 | + 1. -0.73540E+01 -0.44324E+01 0.43951E+01 | ||
2161 | + 1. -0.52522E+01 0.48770E+01 0.44020E+01 | ||
2162 | + 1. -0.89145E+01 -0.11231E+02 0.44082E+01 | ||
2163 | + 1. 0.91814E+01 -0.35350E+00 0.44190E+01 | ||
2164 | + 1. 0.13369E+02 -0.91272E+01 0.44251E+01 | ||
2165 | + 1. 0.75807E+01 -0.71277E+01 0.44283E+01 | ||
2166 | + 1. 0.40658E+00 -0.18733E+02 0.44380E+01 | ||
2167 | + 1. -0.42280E+01 -0.90147E+01 0.44430E+01 | ||
2168 | + 1. 0.14577E+01 0.58016E+01 0.44503E+01 | ||
2169 | + 1. 0.11900E+02 -0.63470E+01 0.44551E+01 | ||
2170 | + 1. -0.13422E+02 0.42842E+01 0.44636E+01 | ||
2171 | + 1. -0.17859E+01 -0.69751E+01 0.44682E+01 | ||
2172 | + 1. -0.10554E+02 -0.22500E+01 0.44746E+01 | ||
2173 | + 1. 0.31863E+01 0.85749E+01 0.44834E+01 | ||
2174 | + 1. 0.66583E+01 -0.50259E+01 0.44925E+01 | ||
2175 | + 1. 0.95818E+01 -0.12996E+02 0.44957E+01 | ||
2176 | + 1. -0.16562E+02 0.48676E+01 0.45052E+01 | ||
2177 | + 1. 0.76852E+01 0.88567E+01 0.45070E+01 | ||
2178 | + 1. -0.45574E+01 0.11863E+02 0.45134E+01 | ||
2179 | + 1. -0.14301E+02 -0.49983E+01 0.45225E+01 | ||
2180 | + 1. 0.31650E+01 -0.13543E+02 0.45318E+01 | ||
2181 | + 1. -0.18718E+02 -0.67564E+01 0.45344E+01 | ||
2182 | + 1. 0.68686E+01 -0.70480E+00 0.45447E+01 | ||
2183 | + 1. -0.98466E+01 0.10418E+02 0.45521E+01 | ||
2184 | + 1. 0.55583E+01 0.12957E+02 0.45557E+01 | ||
2185 | + 1. 0.14519E+02 -0.13550E+01 0.45602E+01 | ||
2186 | + 1. -0.12926E+02 0.66142E+01 0.45703E+01 | ||
2187 | + 1. 0.14571E+02 0.12812E+01 0.45750E+01 | ||
2188 | + 1. 0.21375E+01 -0.37426E+01 0.45820E+01 | ||
2189 | + 1. -0.11254E+02 -0.56813E-01 0.45894E+01 | ||
2190 | + 1. 0.12101E+02 0.69907E+01 0.45941E+01 | ||
2191 | + 1. -0.92368E+01 -0.14136E+02 0.46043E+01 | ||
2192 | + 1. 0.88470E+01 -0.16242E+02 0.46121E+01 | ||
2193 | + 1. -0.98487E+01 0.22918E+01 0.46173E+01 | ||
2194 | + 1. -0.15491E+02 -0.10458E+02 0.46208E+01 | ||
2195 | + 1. -0.68918E+01 0.18726E+02 0.46321E+01 | ||
2196 | + 1. -0.16194E+02 -0.66075E+01 0.46339E+01 | ||
2197 | + 1. -0.10508E+02 0.42645E+01 0.46437E+01 | ||
2198 | + 1. 0.16731E+02 0.71084E+01 0.46533E+01 | ||
2199 | + 1. -0.17902E+02 0.43332E+00 0.46584E+01 | ||
2200 | + 1. -0.15270E+02 -0.91046E+00 0.46629E+01 | ||
2201 | + 1. 0.90963E+01 0.27549E+01 0.46700E+01 | ||
2202 | + 1. 0.11216E+02 0.14641E+01 0.46751E+01 | ||
2203 | + 1. -0.52401E+01 -0.12732E+02 0.46864E+01 | ||
2204 | + 1. 0.14047E+01 0.95485E+01 0.46928E+01 | ||
2205 | + 1. 0.23446E+01 -0.18180E+02 0.46983E+01 | ||
2206 | + 1. 0.51573E+01 0.96497E+01 0.47058E+01 | ||
2207 | + 1. 0.18974E+02 0.24043E+01 0.47075E+01 | ||
2208 | + 1. 0.88290E+01 0.10655E+02 0.47166E+01 | ||
2209 | + 1. 0.10050E+02 -0.52644E+01 0.47226E+01 | ||
2210 | + 1. -0.19664E+01 -0.44296E+01 0.47291E+01 | ||
2211 | + 1. 0.72784E+01 -0.13275E+02 0.47336E+01 | ||
2212 | + 1. 0.80307E+01 0.56025E+01 0.47412E+01 | ||
2213 | + 1. 0.13358E+02 -0.14864E+02 0.47521E+01 | ||
2214 | + 1. 0.54604E+01 -0.17296E+02 0.47534E+01 | ||
2215 | + 1. -0.80569E+01 -0.16588E+02 0.47644E+01 | ||
2216 | + 1. -0.80696E+01 -0.64154E+01 0.47671E+01 | ||
2217 | + 1. -0.16028E+02 -0.30428E+01 0.47796E+01 | ||
2218 | + 1. -0.34767E+01 0.68691E+00 0.47819E+01 | ||
2219 | + 1. -0.75791E+01 -0.19847E+01 0.47901E+01 | ||
2220 | + 1. 0.18473E+01 0.82793E+00 0.47943E+01 | ||
2221 | + 1. 0.96860E+00 0.27866E+01 0.48024E+01 | ||
2222 | + 1. 0.30673E+01 0.11547E+02 0.48128E+01 | ||
2223 | + 1. -0.26630E+01 0.13105E+02 0.48181E+01 | ||
2224 | + 1. 0.13327E+02 0.12265E+02 0.48265E+01 | ||
2225 | + 1. 0.14971E+02 -0.34545E+01 0.48274E+01 | ||
2226 | + 1. 0.49546E+01 0.13882E+00 0.48390E+01 | ||
2227 | + 1. 0.10765E+02 0.10051E+02 0.48442E+01 | ||
2228 | + 1. -0.47496E+01 0.78372E+01 0.48468E+01 | ||
2229 | + 1. -0.10797E+02 0.13289E+02 0.48591E+01 | ||
2230 | + 1. 0.84003E+01 -0.98775E+01 0.48611E+01 | ||
2231 | + 1. 0.14329E+02 -0.74192E+01 0.48722E+01 | ||
2232 | + 1. 0.18741E+02 0.54297E+01 0.48789E+01 | ||
2233 | + 1. -0.54971E+01 -0.24861E+01 0.48808E+01 | ||
2234 | + 1. -0.11607E+02 0.84282E+01 0.48879E+01 | ||
2235 | + 1. 0.69249E+01 0.18751E+02 0.48980E+01 | ||
2236 | + 1. 0.11653E+01 0.13139E+02 0.49033E+01 | ||
2237 | + 1. -0.53689E+01 0.15161E+02 0.49111E+01 | ||
2238 | + 1. 0.13892E+01 -0.65668E+01 0.49185E+01 | ||
2239 | + 1. -0.86002E+00 0.10424E+02 0.49222E+01 | ||
2240 | + 1. -0.11816E+02 -0.16127E+02 0.49305E+01 | ||
2241 | + 1. -0.61556E+01 0.10640E+02 0.49334E+01 | ||
2242 | + 1. -0.11975E+02 0.26214E+01 0.49462E+01 | ||
2243 | + 1. 0.17033E+02 0.10378E+02 0.49522E+01 | ||
2244 | + 1. 0.10331E+02 0.15859E+02 0.49590E+01 | ||
2245 | + 1. -0.87979E+01 0.50541E+00 0.49662E+01 | ||
2246 | + 1. 0.16000E+02 -0.11724E+02 0.49696E+01 | ||
2247 | + 1. 0.14860E+02 0.33535E+01 0.49781E+01 | ||
2248 | + 1. -0.86587E+01 0.12919E+02 0.49816E+01 | ||
2249 | + 1. -0.10678E+02 0.15398E+02 0.49925E+01 | ||
2250 | + 1. 0.12040E+01 -0.11413E+02 0.49958E+01 | ||
2251 | + 1. 0.17532E+02 -0.14838E+01 0.50037E+01 | ||
2252 | + 1. -0.35752E+01 -0.18943E+01 0.50131E+01 | ||
2253 | + 1. -0.74140E+01 0.37066E+01 0.50136E+01 | ||
2254 | + 1. 0.12768E+02 -0.28607E+01 0.50233E+01 | ||
2255 | + 1. 0.11830E+02 0.46584E+01 0.50319E+01 | ||
2256 | + 1. -0.16495E+01 -0.14505E+02 0.50397E+01 | ||
2257 | + 1. 0.14553E+02 0.71379E+01 0.50425E+01 | ||
2258 | + 1. -0.14204E+01 0.45689E+01 0.50492E+01 | ||
2259 | + 1. 0.48907E+01 -0.11295E+02 0.50592E+01 | ||
2260 | + 1. -0.17917E+02 0.84880E+01 0.50648E+01 | ||
2261 | + 1. -0.25493E+01 -0.10470E+02 0.50699E+01 | ||
2262 | + 1. -0.39871E+01 0.98479E+01 0.50745E+01 | ||
2263 | + 1. -0.11258E+02 -0.82623E+01 0.50853E+01 | ||
2264 | + 1. -0.17050E+02 -0.92153E+01 0.50923E+01 | ||
2265 | + 1. -0.10877E+02 -0.11231E+02 0.50965E+01 | ||
2266 | + 1. -0.33734E+01 0.15289E+02 0.51018E+01 | ||
2267 | + 1. 0.37991E+01 -0.92525E+01 0.51071E+01 | ||
2268 | + 1. -0.18984E+02 0.60159E+01 0.51183E+01 | ||
2269 | + 1. 0.19252E+01 0.19869E+02 0.51245E+01 | ||
2270 | + 1. 0.71303E+01 0.28287E+01 0.51268E+01 | ||
2271 | + 1. 0.37260E+01 0.63706E+01 0.51356E+01 | ||
2272 | + 1. 0.44518E+01 -0.21820E+01 0.51420E+01 | ||
2273 | + 1. 0.68429E+01 -0.15282E+02 0.51533E+01 | ||
2274 | + 1. -0.89798E+00 -0.26070E+01 0.51598E+01 | ||
2275 | + 1. -0.74596E+01 0.15566E+02 0.51630E+01 | ||
2276 | + 1. 0.20005E+01 0.15211E+02 0.51711E+01 | ||
2277 | + 1. -0.16813E+01 -0.18442E+02 0.51784E+01 | ||
2278 | + 1. -0.61505E+00 0.17496E+02 0.51830E+01 | ||
2279 | + 1. 0.16297E+02 0.26930E+00 0.51922E+01 | ||
2280 | + 1. -0.49109E+01 0.17780E+02 0.51997E+01 | ||
2281 | + 1. 0.52761E+01 -0.65452E+01 0.52019E+01 | ||
2282 | + 1. 0.12435E+02 0.88986E+01 0.52079E+01 | ||
2283 | + 1. -0.43647E+01 -0.19379E+02 0.52197E+01 | ||
2284 | + 1. 0.29259E+00 -0.16582E+02 0.52244E+01 | ||
2285 | + 1. 0.90902E+00 -0.90663E+00 0.52324E+01 | ||
2286 | + 1. -0.82495E+01 -0.91099E+01 0.52355E+01 | ||
2287 | + 1. 0.94675E+01 -0.78973E+01 0.52454E+01 | ||
2288 | + 1. -0.19145E+02 -0.12594E+01 0.52493E+01 | ||
2289 | + 1. 0.42712E+01 0.41979E+01 0.52540E+01 | ||
2290 | + 1. 0.10942E+02 -0.10162E+02 0.52630E+01 | ||
2291 | + 1. -0.31606E+01 0.28700E+01 0.52727E+01 | ||
2292 | + 1. 0.11834E+02 -0.13534E+02 0.52735E+01 | ||
2293 | + 1. 0.11229E+02 -0.16320E+02 0.52847E+01 | ||
2294 | + 1. 0.89253E+01 0.13573E+02 0.52929E+01 | ||
2295 | + 1. -0.15269E+02 0.31127E+01 0.52950E+01 | ||
2296 | + 1. -0.13336E+02 -0.14521E+02 0.53038E+01 | ||
2297 | + 1. 0.15028E+02 0.10147E+02 0.53077E+01 | ||
2298 | + 1. 0.50252E+01 0.16319E+02 0.53180E+01 | ||
2299 | + 1. 0.80075E+01 -0.35334E+01 0.53223E+01 | ||
2300 | + 1. 0.63451E+01 0.74362E+01 0.53290E+01 | ||
2301 | + 1. 0.33442E+01 -0.16246E+02 0.53357E+01 | ||
2302 | + 1. -0.69828E+00 0.93557E+00 0.53435E+01 | ||
2303 | + 1. 0.16801E+02 -0.70368E+01 0.53487E+01 | ||
2304 | + 1. -0.11767E+02 0.11028E+02 0.53564E+01 | ||
2305 | + 1. -0.12502E+02 -0.21116E+01 0.53617E+01 | ||
2306 | + 1. -0.14203E+02 -0.75803E+01 0.53713E+01 | ||
2307 | + 1. -0.73656E+01 0.71645E+01 0.53785E+01 | ||
2308 | + 1. -0.18225E+02 0.39502E+01 0.53822E+01 | ||
2309 | + 1. 0.14529E+01 -0.14514E+02 0.53922E+01 | ||
2310 | + 1. -0.17822E+00 0.85486E+01 0.54000E+01 | ||
2311 | + 1. -0.23054E+01 0.73483E+01 0.54036E+01 | ||
2312 | + 1. -0.13088E+02 -0.10236E+02 0.54123E+01 | ||
2313 | + 1. 0.53070E+01 -0.13412E+02 0.54142E+01 | ||
2314 | + 1. -0.78381E+01 0.92708E+01 0.54239E+01 | ||
2315 | + 1. 0.13485E+02 -0.10851E+02 0.54324E+01 | ||
2316 | + 1. -0.13953E+02 0.81907E+01 0.54345E+01 | ||
2317 | + 1. 0.34828E+01 0.20872E+01 0.54445E+01 | ||
2318 | + 1. -0.19869E+02 0.93699E+00 0.54526E+01 | ||
2319 | + 1. -0.37943E+00 -0.81158E+01 0.54595E+01 | ||
2320 | + 1. 0.70156E+01 -0.11315E+02 0.54612E+01 | ||
2321 | + 1. 0.18554E+02 -0.38739E+01 0.54715E+01 | ||
2322 | + 1. 0.28557E+01 0.17294E+02 0.54766E+01 | ||
2323 | + 1. -0.14378E+02 -0.11926E+02 0.54827E+01 | ||
2324 | + 1. -0.54102E+01 -0.15537E+02 0.54882E+01 | ||
2325 | + 1. 0.65431E+01 0.10949E+02 0.54956E+01 | ||
2326 | + 1. 0.77465E+01 0.82053E+00 0.55030E+01 | ||
2327 | + 1. -0.10807E+02 -0.58672E+01 0.55075E+01 | ||
2328 | + 1. -0.15465E+02 0.12589E+02 0.55186E+01 | ||
2329 | + 1. -0.19215E+02 -0.50573E+01 0.55243E+01 | ||
2330 | + 1. -0.98988E+01 -0.17259E+02 0.55317E+01 | ||
2331 | + 1. 0.11910E+02 -0.81447E+01 0.55383E+01 | ||
2332 | + 1. 0.58105E+01 -0.85733E+01 0.55410E+01 | ||
2333 | + 1. -0.14537E+01 0.14699E+02 0.55494E+01 | ||
2334 | + 1. -0.50934E+01 -0.10785E+02 0.55534E+01 | ||
2335 | + 1. 0.10933E+02 -0.13541E+01 0.55625E+01 | ||
2336 | + 1. 0.17247E+02 -0.10080E+02 0.55703E+01 | ||
2337 | + 1. -0.14886E+02 0.58015E+01 0.55752E+01 | ||
2338 | + 1. 0.15608E+02 0.12062E+02 0.55845E+01 | ||
2339 | + 1. 0.17248E+02 0.38851E+01 0.55899E+01 | ||
2340 | + 1. -0.89985E+01 -0.40145E+01 0.55935E+01 | ||
2341 | + 1. -0.23464E+01 -0.16603E+02 0.56041E+01 | ||
2342 | + 1. -0.13709E+02 0.13657E+02 0.56106E+01 | ||
2343 | + 1. -0.75945E+01 -0.12197E+02 0.56161E+01 | ||
2344 | + 1. 0.10114E+02 0.11997E+02 0.56249E+01 | ||
2345 | + 1. 0.14770E+02 -0.53870E+01 0.56271E+01 | ||
2346 | + 1. -0.62799E+01 -0.74153E+01 0.56356E+01 | ||
2347 | + 1. 0.10346E+02 0.62643E+01 0.56416E+01 | ||
2348 | + 1. 0.10053E+02 -0.14651E+02 0.56491E+01 | ||
2349 | + 1. -0.72674E-01 0.19615E+02 0.56595E+01 | ||
2350 | + 1. 0.58054E+01 -0.19117E+02 0.56665E+01 | ||
2351 | + 1. -0.29872E+01 -0.12750E+02 0.56720E+01 | ||
2352 | + 1. -0.10652E+02 0.68428E+01 0.56768E+01 | ||
2353 | + 1. -0.34609E+01 -0.74682E+01 0.56833E+01 | ||
2354 | + 1. 0.13686E+02 0.54051E+01 0.56912E+01 | ||
2355 | + 1. 0.28874E+01 -0.53099E+01 0.56961E+01 | ||
2356 | + 1. -0.13722E+02 0.18418E+01 0.57020E+01 | ||
2357 | + 1. 0.20799E+01 0.74191E+01 0.57102E+01 | ||
2358 | + 1. -0.14140E+02 0.10263E+02 0.57170E+01 | ||
2359 | + 1. -0.16352E+02 -0.49332E+01 0.57239E+01 | ||
2360 | + 1. -0.67925E+00 0.12491E+02 0.57311E+01 | ||
2361 | + 1. 0.49922E+01 0.18400E+02 0.57366E+01 | ||
2362 | + 1. 0.41495E+01 0.13763E+02 0.57412E+01 | ||
2363 | + 1. -0.66399E+01 0.16505E+01 0.57494E+01 | ||
2364 | + 1. 0.95077E+00 0.11287E+02 0.57534E+01 | ||
2365 | + 1. 0.94892E+01 0.83576E+01 0.57605E+01 | ||
2366 | + 1. 0.35929E+00 -0.45137E+01 0.57698E+01 | ||
2367 | + 1. -0.51492E+00 -0.12140E+02 0.57769E+01 | ||
2368 | + 1. -0.10826E+02 -0.13210E+02 0.57834E+01 | ||
2369 | + 1. -0.36451E+01 0.19456E+02 0.57897E+01 | ||
2370 | + 1. 0.13021E+02 0.21941E+01 0.57978E+01 | ||
2371 | + 1. -0.16885E+02 0.20252E+01 0.58043E+01 | ||
2372 | + 1. 0.22176E+01 0.43149E+01 0.58085E+01 | ||
2373 | + 1. 0.73774E+01 0.16963E+02 0.58164E+01 | ||
2374 | + 1. -0.52985E+01 -0.50907E+01 0.58221E+01 | ||
2375 | + 1. 0.19708E+02 0.82542E+00 0.58291E+01 | ||
2376 | + 1. 0.80989E+01 -0.55110E+01 0.58375E+01 | ||
2377 | + 1. 0.11608E+02 -0.46412E+01 0.58441E+01 | ||
2378 | + 1. -0.11729E+02 -0.40399E+01 0.58486E+01 | ||
2379 | + 1. -0.34844E+01 0.52421E+01 0.58549E+01 | ||
2380 | + 1. -0.19387E+01 -0.91815E+00 0.58660E+01 | ||
2381 | + 1. -0.17082E+02 -0.12215E+01 0.58694E+01 | ||
2382 | + 1. 0.54765E+01 -0.39663E+01 0.58793E+01 | ||
2383 | + 1. -0.52316E+01 -0.61956E+00 0.58842E+01 | ||
2384 | + 1. 0.26718E+01 -0.19817E+02 0.58890E+01 | ||
2385 | + 1. 0.12427E+02 0.14007E+02 0.58938E+01 | ||
2386 | + 1. 0.98056E+00 -0.95433E+01 0.59015E+01 | ||
2387 | + 1. -0.45411E+01 0.13489E+02 0.59077E+01 | ||
2388 | + 1. -0.86104E+01 0.17911E+02 0.59154E+01 | ||
2389 | + 1. 0.19739E+02 -0.22903E+01 0.59232E+01 | ||
2390 | + 1. 0.70754E+01 0.13004E+02 0.59320E+01 | ||
2391 | + 1. 0.16647E+02 -0.30510E+01 0.59336E+01 | ||
2392 | + 1. -0.55670E+01 0.63560E+01 0.59444E+01 | ||
2393 | + 1. 0.12793E+02 -0.62270E+00 0.59472E+01 | ||
2394 | + 1. 0.80994E+01 -0.14094E+01 0.59574E+01 | ||
2395 | + 1. 0.26377E+01 -0.17491E+01 0.59644E+01 | ||
2396 | + 1. 0.75263E+01 -0.17294E+02 0.59713E+01 | ||
2397 | + 1. 0.10164E+02 0.39043E+01 0.59789E+01 | ||
2398 | + 1. 0.14740E+02 -0.13348E+02 0.59832E+01 | ||
2399 | + 1. 0.17553E+02 0.86217E+01 0.59900E+01 | ||
2400 | + 1. 0.14992E+02 -0.95256E+01 0.59985E+01 | ||
2401 | + 1. 0.33897E+01 0.98651E+01 0.60043E+01 | ||
2402 | + 1. -0.97236E+01 -0.93512E+00 0.60077E+01 | ||
2403 | + 1. -0.15937E+02 0.87263E+01 0.60158E+01 | ||
2404 | + 1. -0.31300E+01 -0.54562E+01 0.60257E+01 | ||
2405 | + 1. -0.73176E+01 -0.15108E+02 0.60280E+01 | ||
2406 | + 1. -0.17283E+02 0.65833E+01 0.60390E+01 | ||
2407 | + 1. -0.12281E+02 0.52046E+01 0.60432E+01 | ||
2408 | + 1. -0.68129E+01 0.12169E+02 0.60468E+01 | ||
2409 | + 1. 0.30643E+00 0.49330E+01 0.60560E+01 | ||
2410 | + 1. 0.12061E+02 0.11212E+02 0.60621E+01 | ||
2411 | + 1. 0.18658E+02 -0.64733E+01 0.60679E+01 | ||
2412 | + 1. 0.96805E+01 0.12204E+01 0.60751E+01 | ||
2413 | + 1. 0.27104E+01 -0.76285E+01 0.60816E+01 | ||
2414 | + 1. 0.44125E+01 0.81280E+01 0.60928E+01 | ||
2415 | + 1. -0.96010E+01 -0.74183E+01 0.60999E+01 | ||
2416 | + 1. -0.10176E+02 -0.15175E+02 0.61017E+01 | ||
2417 | + 1. -0.31831E+01 0.17265E+02 0.61099E+01 | ||
2418 | + 1. -0.15655E+02 0.41544E+00 0.61194E+01 | ||
2419 | + 1. -0.10846E+02 0.11911E+01 0.61250E+01 | ||
2420 | + 1. 0.89562E+01 -0.11885E+02 0.61313E+01 | ||
2421 | + 1. 0.95682E+01 0.17398E+02 0.61368E+01 | ||
2422 | + 1. 0.65529E+01 0.54176E+01 0.61452E+01 | ||
2423 | + 1. -0.90539E+01 0.44267E+01 0.61483E+01 | ||
2424 | + 1. -0.29879E+01 0.11210E+02 0.61551E+01 | ||
2425 | + 1. -0.50176E+01 0.36248E+01 0.61640E+01 | ||
2426 | + 1. -0.98132E+01 0.11606E+02 0.61669E+01 | ||
2427 | + 1. -0.99200E+01 0.89945E+01 0.61795E+01 | ||
2428 | + 1. -0.14608E+02 -0.27542E+01 0.61863E+01 | ||
2429 | + 1. 0.28338E+01 -0.11288E+02 0.61915E+01 | ||
2430 | + 1. -0.69468E+01 -0.33772E+01 0.61988E+01 | ||
2431 | + 1. -0.76308E+01 -0.17957E+02 0.62050E+01 | ||
2432 | + 1. -0.17288E+02 -0.75009E+01 0.62111E+01 | ||
2433 | + 1. 0.53419E+01 0.22028E+01 0.62179E+01 | ||
2434 | + 1. -0.54891E+01 -0.17570E+02 0.62234E+01 | ||
2435 | + 1. -0.59478E+01 0.90567E+01 0.62328E+01 | ||
2436 | + 1. 0.98855E+00 0.16657E+02 0.62373E+01 | ||
2437 | + 1. 0.13034E+02 -0.63975E+01 0.62452E+01 | ||
2438 | + 1. -0.41204E+01 -0.34640E+01 0.62487E+01 | ||
2439 | + 1. -0.86186E-01 -0.19787E+02 0.62547E+01 | ||
2440 | + 1. 0.16884E+02 0.57703E+01 0.62632E+01 | ||
2441 | + 1. 0.95768E+01 -0.17323E+02 0.62683E+01 | ||
2442 | + 1. 0.60696E+01 0.14756E+02 0.62742E+01 | ||
2443 | + 1. -0.13567E+02 -0.18238E+00 0.62860E+01 | ||
2444 | + 1. -0.12928E+02 -0.60536E+01 0.62928E+01 | ||
2445 | + 1. 0.60360E+01 -0.17241E+01 0.62936E+01 | ||
2446 | + 1. -0.97082E+00 -0.98923E+01 0.63036E+01 | ||
2447 | + 1. 0.18684E+02 0.69763E+01 0.63129E+01 | ||
2448 | + 1. 0.98192E+01 -0.35963E+01 0.63189E+01 | ||
2449 | + 1. -0.91287E+01 0.15709E+02 0.63257E+01 | ||
2450 | + 1. 0.14490E+02 0.13766E+02 0.63302E+01 | ||
2451 | + 1. -0.18870E+02 -0.32561E+01 0.63344E+01 | ||
2452 | + 1. -0.88930E+01 -0.10720E+02 0.63440E+01 | ||
2453 | + 1. 0.75502E+01 -0.78256E+01 0.63482E+01 | ||
2454 | + 1. 0.82264E+01 0.42991E+01 0.63561E+01 | ||
2455 | + 1. -0.16431E+02 -0.11120E+02 0.63654E+01 | ||
2456 | + 1. -0.16354E+02 0.10737E+02 0.63681E+01 | ||
2457 | + 1. -0.62453E+01 0.16714E+02 0.63771E+01 | ||
2458 | + 1. 0.39570E+01 -0.18361E+02 0.63812E+01 | ||
2459 | + 1. 0.11993E+02 0.15896E+02 0.63910E+01 | ||
2460 | + 1. -0.72940E+01 -0.13621E+00 0.63982E+01 | ||
2461 | + 1. -0.11087E+01 -0.61001E+01 0.64028E+01 | ||
2462 | + 1. 0.50592E+01 -0.15678E+02 0.64084E+01 | ||
2463 | + 1. 0.15210E+02 0.19635E+01 0.64177E+01 | ||
2464 | + 1. 0.18813E+01 -0.17181E+02 0.64217E+01 | ||
2465 | + 1. 0.17502E+02 0.20754E+01 0.64304E+01 | ||
2466 | + 1. 0.42949E+00 0.14381E+02 0.64397E+01 | ||
2467 | + 1. 0.78398E+01 0.97331E+01 0.64452E+01 | ||
2468 | + 1. 0.32212E+01 0.24793E+00 0.64475E+01 | ||
2469 | + 1. 0.15541E+02 0.84640E+01 0.64537E+01 | ||
2470 | + 1. -0.56291E+01 -0.13634E+02 0.64664E+01 | ||
2471 | + 1. -0.71802E+01 -0.54305E+01 0.64729E+01 | ||
2472 | + 1. 0.19266E+02 0.38814E+01 0.64772E+01 | ||
2473 | + 1. -0.85429E+01 0.19716E+01 0.64828E+01 | ||
2474 | + 1. -0.68898E+01 -0.10009E+02 0.64894E+01 | ||
2475 | + 1. 0.14749E+02 -0.20862E+01 0.64947E+01 | ||
2476 | + 1. -0.13285E+01 0.30371E+01 0.65017E+01 | ||
2477 | + 1. 0.12738E+02 0.70961E+01 0.65126E+01 | ||
2478 | + 1. -0.88189E+01 -0.13541E+02 0.65154E+01 | ||
2479 | + 1. -0.11470E+02 0.14207E+02 0.65204E+01 | ||
2480 | + 1. -0.49297E+01 -0.88500E+01 0.65330E+01 | ||
2481 | + 1. 0.32860E+01 -0.13420E+02 0.65354E+01 | ||
2482 | + 1. -0.32942E+01 -0.14579E+02 0.65422E+01 | ||
2483 | + 1. 0.16618E+02 -0.50928E+01 0.65474E+01 | ||
2484 | + 1. -0.12205E+02 -0.11726E+02 0.65551E+01 | ||
2485 | + 1. 0.33118E+00 0.69044E+01 0.65624E+01 | ||
2486 | + 1. 0.13975E+01 0.16948E+01 0.65727E+01 | ||
2487 | + 1. -0.19741E+02 0.31229E+01 0.65740E+01 | ||
2488 | + 1. 0.10713E+02 -0.63275E+01 0.65815E+01 | ||
2489 | + 1. 0.84060E+01 0.15339E+02 0.65874E+01 | ||
2490 | + 1. -0.27949E+01 -0.19377E+02 0.65996E+01 | ||
2491 | + 1. -0.13543E+02 0.37036E+01 0.66016E+01 | ||
2492 | + 1. 0.13563E+02 -0.39381E+01 0.66118E+01 | ||
2493 | + 1. 0.33081E+01 0.19461E+02 0.66178E+01 | ||
2494 | + 1. -0.55872E+01 0.19031E+02 0.66243E+01 | ||
2495 | + 1. -0.12900E+02 -0.84732E+01 0.66310E+01 | ||
2496 | + 1. -0.48478E+00 -0.14202E+02 0.66382E+01 | ||
2497 | + 1. -0.15485E+01 -0.38916E+01 0.66419E+01 | ||
2498 | + 1. -0.14568E+02 -0.48542E+01 0.66531E+01 | ||
2499 | + 1. -0.14639E+02 -0.98736E+01 0.66578E+01 | ||
2500 | + 1. 0.10989E+02 -0.11783E+02 0.66636E+01 | ||
2501 | + 1. -0.16874E+01 0.92729E+01 0.66669E+01 | ||
2502 | + 1. 0.18427E+02 -0.84109E+00 0.66747E+01 | ||
2503 | + 1. 0.70659E+01 -0.13697E+02 0.66825E+01 | ||
2504 | + 1. 0.26221E+01 0.12418E+02 0.66876E+01 | ||
2505 | + 1. -0.12856E+02 0.12065E+02 0.66985E+01 | ||
2506 | + 1. -0.39582E+01 0.76726E+01 0.67050E+01 | ||
2507 | + 1. -0.40202E+01 0.80039E+00 0.67077E+01 | ||
2508 | + 1. -0.66713E+01 0.14089E+02 0.67166E+01 | ||
2509 | + 1. 0.10233E+02 0.14509E+02 0.67237E+01 | ||
2510 | + 1. 0.12051E+02 -0.15203E+02 0.67283E+01 | ||
2511 | + 1. -0.18043E+02 0.35617E+00 0.67363E+01 | ||
2512 | + 1. 0.97553E+01 0.10267E+02 0.67425E+01 | ||
2513 | + 1. 0.11833E+01 0.92794E+01 0.67484E+01 | ||
2514 | + 1. -0.10718E+02 -0.99656E+01 0.67567E+01 | ||
2515 | + 1. -0.67088E+01 0.48222E+01 0.67639E+01 | ||
2516 | + 1. -0.12204E+02 0.90323E+01 0.67708E+01 | ||
2517 | + 1. 0.30695E+00 -0.22944E+01 0.67761E+01 | ||
2518 | + 1. 0.23547E+01 -0.37154E+01 0.67856E+01 | ||
2519 | + 1. -0.10548E+02 -0.26072E+01 0.67909E+01 | ||
2520 | + 1. -0.26611E+01 -0.89302E+01 0.67979E+01 | ||
2521 | + 1. -0.16683E+02 -0.30111E+01 0.68061E+01 | ||
2522 | + 1. -0.16712E+02 0.43761E+01 0.68087E+01 | ||
2523 | + 1. 0.79945E+01 0.66878E+01 0.68174E+01 | ||
2524 | + 1. -0.17133E+01 0.56240E+01 0.68205E+01 | ||
2525 | + 1. 0.62042E+01 0.43980E+00 0.68321E+01 | ||
2526 | + 1. 0.86951E+01 -0.95428E+01 0.68390E+01 | ||
2527 | + 1. -0.10981E+02 0.38704E+01 0.68434E+01 | ||
2528 | + 1. 0.11318E+02 0.86565E+01 0.68496E+01 | ||
2529 | + 1. 0.12757E+02 0.40062E+01 0.68571E+01 | ||
2530 | + 1. 0.45639E+01 -0.99242E+01 0.68657E+01 | ||
2531 | + 1. 0.13368E+02 -0.85871E+01 0.68709E+01 | ||
2532 | + 1. 0.45900E+01 0.11669E+02 0.68734E+01 | ||
2533 | + 1. -0.51052E+01 0.11325E+02 0.68801E+01 | ||
2534 | + 1. -0.16710E+01 0.18507E+02 0.68927E+01 | ||
2535 | + 1. -0.90358E+01 0.65495E+01 0.68951E+01 | ||
2536 | + 1. -0.14551E+02 -0.13673E+02 0.69025E+01 | ||
2537 | + 1. -0.83945E+00 -0.17045E+02 0.69118E+01 | ||
2538 | + 1. -0.92430E+01 0.13737E+02 0.69162E+01 | ||
2539 | + 1. 0.16895E+02 -0.84024E+01 0.69258E+01 | ||
2540 | + 1. -0.46274E+01 0.15323E+02 0.69295E+01 | ||
2541 | + 1. 0.57089E+01 0.97497E+01 0.69394E+01 | ||
2542 | + 1. -0.81475E+01 0.10711E+02 0.69460E+01 | ||
2543 | + 1. 0.84756E+01 -0.15294E+02 0.69512E+01 | ||
2544 | + 1. 0.31491E+01 0.15123E+02 0.69540E+01 | ||
2545 | + 1. 0.17001E+02 0.10374E+02 0.69641E+01 | ||
2546 | + 1. 0.11945E+02 -0.23592E+01 0.69713E+01 | ||
2547 | + 1. -0.12055E+02 -0.14351E+02 0.69738E+01 | ||
2548 | + 1. 0.13035E+02 0.96915E+01 0.69830E+01 | ||
2549 | + 1. -0.26370E+01 0.13939E+02 0.69910E+01 | ||
2550 | + 1. 0.16306E+02 -0.11321E+02 0.69974E+01 | ||
2551 | + 1. -0.13167E+02 0.71784E+01 0.70033E+01 | ||
2552 | + 1. -0.17932E+02 -0.57730E+01 0.70083E+01 | ||
2553 | + 1. 0.14363E+02 0.11429E+02 0.70179E+01 | ||
2554 | + 1. 0.41817E+01 0.55249E+01 0.70204E+01 | ||
2555 | + 1. 0.77441E+01 0.23850E+01 0.70333E+01 | ||
2556 | + 1. 0.47923E+01 -0.55932E+01 0.70374E+01 | ||
2557 | + 1. 0.55163E+01 -0.11802E+02 0.70414E+01 | ||
2558 | + 1. 0.76688E+00 -0.11186E+02 0.70492E+01 | ||
2559 | + 1. -0.11581E+02 0.16276E+02 0.70568E+01 | ||
2560 | + 1. 0.11159E+02 0.22868E+01 0.70619E+01 | ||
2561 | + 1. 0.15107E+02 0.63048E+01 0.70693E+01 | ||
2562 | + 1. 0.14887E+02 0.41725E+01 0.70737E+01 | ||
2563 | + 1. 0.89822E+00 -0.72387E+01 0.70812E+01 | ||
2564 | + 1. 0.10988E+02 0.86812E-01 0.70867E+01 | ||
2565 | + 1. 0.25365E+01 -0.15317E+02 0.70986E+01 | ||
2566 | + 1. -0.17690E+02 0.86544E+01 0.71001E+01 | ||
2567 | + 1. -0.15232E+02 -0.79207E+01 0.71079E+01 | ||
2568 | + 1. -0.17693E+02 -0.93090E+01 0.71175E+01 | ||
2569 | + 1. 0.38158E+01 0.32294E+01 0.71223E+01 | ||
2570 | + 1. -0.11534E+01 0.16433E+02 0.71313E+01 | ||
2571 | + 1. 0.12756E+02 -0.13140E+02 0.71371E+01 | ||
2572 | + 1. 0.87512E+01 0.12212E+02 0.71403E+01 | ||
2573 | + 1. 0.42040E+01 0.16874E+02 0.71485E+01 | ||
2574 | + 1. 0.95943E+00 0.18551E+02 0.71565E+01 | ||
2575 | + 1. -0.20309E+01 -0.11451E+02 0.71651E+01 | ||
2576 | + 1. 0.48739E+01 -0.78389E+01 0.71688E+01 | ||
2577 | + 1. 0.81245E+00 -0.35497E+00 0.71748E+01 | ||
2578 | + 1. 0.75238E+01 0.18445E+02 0.71802E+01 | ||
2579 | + 1. 0.15076E+02 -0.69331E+01 0.71918E+01 | ||
2580 | + 1. -0.38225E+01 -0.16874E+02 0.71970E+01 | ||
2581 | + 1. -0.46779E+01 -0.11912E+02 0.72066E+01 | ||
2582 | + 1. -0.11407E+02 -0.72490E+01 0.72133E+01 | ||
2583 | + 1. -0.18800E+02 0.55395E+01 0.72193E+01 | ||
2584 | + 1. 0.12594E+02 -0.10625E+02 0.72236E+01 | ||
2585 | + 1. -0.17055E+01 0.11583E+01 0.72315E+01 | ||
2586 | + 1. -0.15385E+02 0.23821E+01 0.72375E+01 | ||
2587 | + 1. -0.33479E+01 -0.17415E+01 0.72427E+01 | ||
2588 | + 1. -0.79805E+01 -0.80710E+01 0.72484E+01 | ||
2589 | + 1. 0.18813E+02 -0.47591E+01 0.72550E+01 | ||
2590 | + 1. 0.16180E+02 0.30569E+00 0.72646E+01 | ||
2591 | + 1. -0.81728E+01 -0.18574E+01 0.72715E+01 | ||
2592 | + 1. 0.70765E+01 -0.33099E+01 0.72740E+01 | ||
2593 | + 1. -0.12276E+02 0.22880E+01 0.72811E+01 | ||
2594 | + 1. -0.15823E+02 0.71531E+01 0.72882E+01 | ||
2595 | + 1. -0.14361E+02 0.88030E+01 0.72961E+01 | ||
2596 | + 1. -0.19510E+02 -0.10001E+01 0.73007E+01 | ||
2597 | + 1. -0.11960E+02 -0.79937E+00 0.73094E+01 | ||
2598 | + 1. 0.40469E+01 -0.23706E+01 0.73193E+01 | ||
2599 | + 1. 0.68709E+01 -0.18697E+02 0.73256E+01 | ||
2600 | + 1. -0.43816E+01 -0.67739E+01 0.73330E+01 | ||
2601 | + 1. -0.69516E+01 0.72598E+01 0.73378E+01 | ||
2602 | + 1. -0.90325E+01 -0.52342E+01 0.73459E+01 | ||
2603 | + 1. -0.86551E+01 -0.16459E+02 0.73492E+01 | ||
2604 | + 1. 0.21491E+01 0.61509E+01 0.73577E+01 | ||
2605 | + 1. 0.10693E+02 -0.95488E+01 0.73609E+01 | ||
2606 | + 1. 0.96162E+01 0.53497E+01 0.73688E+01 | ||
2607 | + 1. 0.11250E+02 0.12820E+02 0.73789E+01 | ||
2608 | + 1. -0.70063E+01 0.29311E+01 0.73855E+01 | ||
2609 | + 1. -0.35496E+01 0.28672E+01 0.73871E+01 | ||
2610 | + 1. -0.13067E+01 0.11119E+02 0.73944E+01 | ||
2611 | + 1. 0.64482E+01 -0.91572E+01 0.74042E+01 | ||
2612 | + 1. 0.14029E+02 -0.37702E-01 0.74109E+01 | ||
2613 | + 1. -0.57988E+01 -0.15949E+02 0.74165E+01 | ||
2614 | + 1. -0.15464E+02 -0.11044E+01 0.74226E+01 | ||
2615 | + 1. 0.56714E+01 0.72955E+01 0.74317E+01 | ||
2616 | + 1. 0.56699E+01 0.39247E+01 0.74386E+01 | ||
2617 | + 1. 0.12854E+01 -0.18837E+02 0.74404E+01 | ||
2618 | + 1. -0.15243E+02 0.12104E+02 0.74493E+01 | ||
2619 | + 1. 0.82874E+01 0.33892E-01 0.74598E+01 | ||
2620 | + 1. 0.99152E+01 -0.13407E+02 0.74628E+01 | ||
2621 | + 1. -0.12968E+02 -0.38780E+01 0.74704E+01 | ||
2622 | + 1. -0.61641E+01 -0.16383E+01 0.74793E+01 | ||
2623 | + 1. 0.67100E+01 -0.59931E+01 0.74805E+01 | ||
2624 | + 1. 0.17888E+02 -0.26294E+01 0.74915E+01 | ||
2625 | + 1. 0.94228E+01 -0.20019E+01 0.74990E+01 | ||
2626 | + 1. -0.17815E+02 0.28075E+01 0.75030E+01 | ||
2627 | + 1. 0.24544E+00 0.12650E+02 0.75090E+01 | ||
2628 | + 1. -0.39483E+01 0.96767E+01 0.75178E+01 | ||
2629 | + 1. -0.94372E+01 0.45710E+00 0.75239E+01 | ||
2630 | + 1. -0.47182E+01 0.51443E+01 0.75282E+01 | ||
2631 | + 1. -0.13960E+02 -0.11868E+02 0.75399E+01 | ||
2632 | + 1. 0.26155E+01 -0.90998E+01 0.75425E+01 | ||
2633 | + 1. -0.96969E+01 0.17460E+02 0.75498E+01 | ||
2634 | + 1. -0.11073E+02 0.10888E+02 0.75557E+01 | ||
2635 | + 1. -0.11115E+02 0.60850E+01 0.75618E+01 | ||
2636 | + 1. -0.47703E+01 -0.19390E+02 0.75687E+01 | ||
2637 | + 1. -0.74355E+01 -0.11726E+02 0.75791E+01 | ||
2638 | + 1. -0.13581E+02 0.14264E+02 0.75822E+01 | ||
2639 | + 1. 0.19700E+02 0.19639E+01 0.75887E+01 | ||
2640 | + 1. 0.28221E+01 -0.59546E+01 0.75943E+01 | ||
2641 | + 1. 0.99889E+00 0.34162E+01 0.76043E+01 | ||
2642 | + 1. -0.10893E+02 -0.45146E+01 0.76104E+01 | ||
2643 | + 1. 0.58236E+01 0.13120E+02 0.76150E+01 | ||
2644 | + 1. 0.63295E+01 0.16554E+02 0.76204E+01 | ||
2645 | + 1. -0.75066E+01 0.15714E+02 0.76310E+01 | ||
2646 | + 1. 0.69413E+01 0.11429E+02 0.76354E+01 | ||
2647 | + 1. 0.52941E+01 -0.17282E+02 0.76435E+01 | ||
2648 | + 1. 0.16667E+02 0.34571E+01 0.76487E+01 | ||
2649 | + 1. 0.90239E+01 -0.64450E+01 0.76555E+01 | ||
2650 | + 1. 0.30890E+01 0.85297E+01 0.76623E+01 | ||
2651 | + 1. -0.85577E+01 0.86930E+01 0.76690E+01 | ||
2652 | + 1. -0.14463E+02 0.54314E+01 0.76771E+01 | ||
2653 | + 1. -0.10261E+02 -0.11951E+02 0.76838E+01 | ||
2654 | + 1. 0.77422E+01 -0.11396E+02 0.76890E+01 | ||
2655 | + 1. -0.11111E+02 -0.16502E+02 0.76986E+01 | ||
2656 | + 1. 0.14637E+02 -0.12296E+02 0.77063E+01 | ||
2657 | + 1. -0.58127E+01 0.81714E+00 0.77086E+01 | ||
2658 | + 1. -0.89649E+00 -0.81883E+01 0.77197E+01 | ||
2659 | + 1. -0.72194E+01 0.18388E+02 0.77207E+01 | ||
2660 | + 1. -0.42137E+01 0.17932E+02 0.77326E+01 | ||
2661 | + 1. 0.16360E+01 -0.13036E+02 0.77389E+01 | ||
2662 | + 1. 0.13241E+02 0.13077E+02 0.77462E+01 | ||
2663 | + 1. 0.13646E+02 0.20778E+01 0.77482E+01 | ||
2664 | + 1. 0.10843E+02 -0.16640E+02 0.77549E+01 | ||
2665 | + 1. 0.50255E+01 0.19305E+02 0.77618E+01 | ||
2666 | + 1. 0.97016E+01 0.78647E+01 0.77668E+01 | ||
2667 | + 1. 0.16925E+02 0.77694E+01 0.77772E+01 | ||
2668 | + 1. 0.50181E+01 -0.14076E+02 0.77826E+01 | ||
2669 | + 1. -0.49430E+01 -0.46813E+01 0.77907E+01 | ||
2670 | + 1. -0.10013E+02 0.23716E+01 0.77947E+01 | ||
2671 | + 1. -0.19722E+02 0.94273E+00 0.78032E+01 | ||
2672 | + 1. 0.15549E+02 -0.34575E+01 0.78113E+01 | ||
2673 | + 1. -0.10919E+01 -0.18932E+02 0.78184E+01 | ||
2674 | + 1. -0.53313E+01 0.13092E+02 0.78219E+01 | ||
2675 | + 1. 0.12325E+02 -0.53408E+01 0.78276E+01 | ||
2676 | + 1. -0.19813E+01 -0.15391E+02 0.78386E+01 | ||
2677 | + 1. -0.72713E+01 -0.14200E+02 0.78466E+01 | ||
2678 | + 1. 0.27967E+00 -0.50122E+01 0.78472E+01 | ||
2679 | + 1. -0.16098E+02 -0.54483E+01 0.78579E+01 | ||
2680 | + 1. 0.65117E+01 -0.15425E+02 0.78629E+01 | ||
2681 | + 1. 0.31041E+01 0.10754E+02 0.78678E+01 | ||
2682 | + 1. -0.19712E+01 0.73681E+01 0.78782E+01 | ||
2683 | + 1. 0.14182E+02 0.79178E+01 0.78820E+01 | ||
2684 | + 1. 0.83854E+01 -0.17177E+02 0.78867E+01 | ||
2685 | + 1. 0.17824E+02 -0.66685E+01 0.78976E+01 | ||
2686 | + 1. 0.10477E+02 0.16507E+02 0.79010E+01 | ||
2687 | + 1. 0.44169E+01 0.12638E+01 0.79126E+01 | ||
2688 | + 1. 0.18395E+02 0.53923E+01 0.79135E+01 | ||
2689 | + 1. 0.74991E+01 0.83651E+01 0.79219E+01 | ||
2690 | + 1. 0.23484E+01 0.17101E+02 0.79313E+01 | ||
2691 | + 1. 0.11236E+02 0.64206E+01 0.79384E+01 | ||
2692 | + 1. -0.24053E+01 -0.64508E+01 0.79463E+01 | ||
2693 | + 1. -0.12358E+02 -0.10076E+02 0.79495E+01 | ||
2694 | + 1. -0.14995E+01 -0.71630E+00 0.79541E+01 | ||
2695 | + 1. -0.13596E+02 -0.70152E+01 0.79654E+01 | ||
2696 | + 1. -0.64606E+01 0.99676E+01 0.79693E+01 | ||
2697 | + 1. 0.14695E+02 -0.96965E+01 0.79779E+01 | ||
2698 | + 1. -0.16496E+02 0.75219E+00 0.79860E+01 | ||
2699 | + 1. -0.65284E+01 -0.68852E+01 0.79876E+01 | ||
2700 | + 1. 0.10410E+02 -0.46407E+01 0.79941E+01 | ||
2701 | + 1. -0.72814E+01 0.12512E+02 0.80054E+01 | ||
2702 | + 1. -0.17589E+02 -0.13138E+01 0.80086E+01 | ||
2703 | + 1. 0.12995E+02 0.15101E+02 0.80161E+01 | ||
2704 | + 1. -0.78250E+01 -0.37582E+01 0.80234E+01 | ||
2705 | + 1. 0.11609E+02 0.10654E+02 0.80281E+01 | ||
2706 | + 1. -0.14397E+02 0.52135E+00 0.80346E+01 | ||
2707 | + 1. 0.73495E+01 0.50017E+01 0.80450E+01 | ||
2708 | + 1. 0.11935E+02 -0.77315E+01 0.80476E+01 | ||
2709 | + 1. 0.64606E+00 0.15905E+02 0.80586E+01 | ||
2710 | + 1. 0.19972E+02 -0.98587E+00 0.80611E+01 | ||
2711 | + 1. 0.76810E+01 0.14145E+02 0.80725E+01 | ||
2712 | + 1. -0.61621E+01 -0.17992E+02 0.80751E+01 | ||
2713 | + 1. 0.53792E+01 -0.10381E+01 0.80842E+01 | ||
2714 | + 1. -0.10397E+02 0.80103E+01 0.80884E+01 | ||
2715 | + 1. -0.18499E+02 -0.74231E+01 0.80989E+01 | ||
2716 | + 1. 0.81529E+00 -0.16815E+02 0.81044E+01 | ||
2717 | + 1. -0.99988E+01 0.15227E+02 0.81126E+01 | ||
2718 | + 1. 0.32984E+01 -0.17368E+02 0.81166E+01 | ||
2719 | + 1. -0.84944E+00 -0.12854E+02 0.81261E+01 | ||
2720 | + 1. -0.39974E+01 -0.10092E+02 0.81323E+01 | ||
2721 | + 1. 0.19358E+01 0.13810E+02 0.81379E+01 | ||
2722 | + 1. -0.21086E+01 0.40758E+01 0.81443E+01 | ||
2723 | + 1. 0.13154E+02 0.58252E+01 0.81469E+01 | ||
2724 | + 1. -0.94102E+01 0.11887E+02 0.81570E+01 | ||
2725 | + 1. 0.96480E+01 0.33189E+01 0.81602E+01 | ||
2726 | + 1. -0.18275E+02 -0.41171E+01 0.81729E+01 | ||
2727 | + 1. -0.95474E+01 0.49442E+01 0.81780E+01 | ||
2728 | + 1. 0.61031E+00 -0.95210E+01 0.81815E+01 | ||
2729 | + 1. -0.34285E+01 0.11572E+02 0.81898E+01 | ||
2730 | + 1. -0.97191E+00 0.14546E+02 0.81997E+01 | ||
2731 | + 1. -0.37294E+00 0.19820E+02 0.82023E+01 | ||
2732 | + 1. 0.34833E+01 -0.11745E+02 0.82092E+01 | ||
2733 | + 1. -0.45290E+01 -0.14186E+02 0.82153E+01 | ||
2734 | + 1. 0.52975E+01 -0.38454E+01 0.82203E+01 | ||
2735 | + 1. -0.95534E+01 -0.14773E+02 0.82296E+01 | ||
2736 | + 1. 0.17899E+02 0.11525E+01 0.82346E+01 | ||
2737 | + 1. -0.26012E+01 0.19731E+02 0.82425E+01 | ||
2738 | + 1. 0.38728E+00 0.80855E+01 0.82494E+01 | ||
2739 | + 1. 0.17184E+02 -0.10014E+02 0.82546E+01 | ||
2740 | + 1. 0.82981E+01 -0.46079E+01 0.82604E+01 | ||
2741 | + 1. 0.23625E+01 0.11011E+01 0.82701E+01 | ||
2742 | + 1. -0.14604E+02 -0.29336E+01 0.82773E+01 | ||
2743 | + 1. -0.41030E+00 0.51258E+01 0.82848E+01 | ||
2744 | + 1. -0.14050E+02 0.10545E+02 0.82913E+01 | ||
2745 | + 1. 0.17086E+01 -0.22770E+01 0.82933E+01 | ||
2746 | + 1. -0.27342E+01 -0.43150E+01 0.83014E+01 | ||
2747 | + 1. -0.96932E+01 -0.71513E+01 0.83101E+01 | ||
2748 | + 1. -0.15703E+02 -0.94466E+01 0.83185E+01 | ||
2749 | + 1. -0.93572E+01 -0.97315E+01 0.83240E+01 | ||
2750 | + 1. -0.17724E+02 0.69333E+01 0.83293E+01 | ||
2751 | + 1. 0.13636E+02 -0.19408E+01 0.83352E+01 | ||
2752 | + 1. -0.16234E+02 -0.11445E+02 0.83451E+01 | ||
2753 | + 1. 0.15144E+02 0.96230E+01 0.83527E+01 | ||
2754 | + 1. 0.47106E+01 -0.19237E+02 0.83562E+01 | ||
2755 | + 1. 0.17267E+00 0.10123E+02 0.83659E+01 | ||
2756 | + 1. 0.84727E+01 0.10148E+02 0.83683E+01 | ||
2757 | + 1. -0.57877E+01 0.16701E+02 0.83775E+01 | ||
2758 | + 1. 0.80359E+01 -0.13249E+02 0.83841E+01 | ||
2759 | + 1. -0.19314E+02 0.38632E+01 0.83898E+01 | ||
2760 | + 1. 0.10003E+02 0.12584E+01 0.83966E+01 | ||
2761 | + 1. -0.23919E+01 0.17405E+02 0.84051E+01 | ||
2762 | + 1. -0.16141E+02 0.92843E+01 0.84133E+01 | ||
2763 | + 1. 0.84388E+01 0.16649E+02 0.84198E+01 | ||
2764 | + 1. -0.51868E+01 0.77779E+01 0.84231E+01 | ||
2765 | + 1. 0.47060E+01 0.14805E+02 0.84308E+01 | ||
2766 | + 1. 0.14665E+02 -0.52184E+01 0.84387E+01 | ||
2767 | + 1. -0.62448E+01 -0.10072E+02 0.84424E+01 | ||
2768 | + 1. 0.20743E+01 0.19872E+02 0.84526E+01 | ||
2769 | + 1. -0.82712E+01 -0.18114E+02 0.84590E+01 | ||
2770 | + 1. 0.13349E+02 -0.14555E+02 0.84626E+01 | ||
2771 | + 1. -0.10140E+02 -0.12598E+01 0.84668E+01 | ||
2772 | + 1. 0.62761E+01 0.21009E+01 0.84756E+01 | ||
2773 | + 1. 0.15760E+02 0.12146E+02 0.84854E+01 | ||
2774 | + 1. 0.11553E+02 0.41830E+01 0.84903E+01 | ||
2775 | + 1. -0.47538E+00 -0.31657E+01 0.84997E+01 | ||
2776 | + 1. -0.81935E+01 0.16816E+01 0.85046E+01 | ||
2777 | + 1. -0.33805E+01 0.15099E+02 0.85121E+01 | ||
2778 | + 1. 0.17354E+02 -0.75941E+00 0.85133E+01 | ||
2779 | + 1. -0.11381E+02 0.13511E+02 0.85266E+01 | ||
2780 | + 1. 0.10211E+02 -0.11225E+02 0.85311E+01 | ||
2781 | + 1. -0.73898E+01 -0.35999E+00 0.85349E+01 | ||
2782 | + 1. 0.75027E+01 -0.75789E+01 0.85418E+01 | ||
2783 | + 1. 0.16778E+00 0.98004E+00 0.85508E+01 | ||
2784 | + 1. 0.97667E+01 -0.15151E+02 0.85557E+01 | ||
2785 | + 1. -0.31224E+01 0.58692E+01 0.85628E+01 | ||
2786 | + 1. -0.21445E+01 0.96754E+01 0.85721E+01 | ||
2787 | + 1. -0.12330E+02 0.45739E+01 0.85786E+01 | ||
2788 | + 1. 0.19444E+02 0.36888E+01 0.85802E+01 | ||
2789 | + 1. 0.15830E+02 0.18503E+01 0.85877E+01 | ||
2790 | + 1. 0.16893E+02 -0.49179E+01 0.85950E+01 | ||
2791 | + 1. 0.19571E+02 -0.31481E+01 0.86030E+01 | ||
2792 | + 1. -0.15734E+02 0.39372E+01 0.86114E+01 | ||
2793 | + 1. 0.12401E+02 0.41399E+00 0.86138E+01 | ||
2794 | + 1. 0.30419E+01 0.44771E+01 0.86224E+01 | ||
2795 | + 1. 0.81062E+00 -0.14704E+02 0.86273E+01 | ||
2796 | + 1. -0.75435E+01 0.55941E+01 0.86344E+01 | ||
2797 | + 1. -0.19782E+02 -0.26265E+01 0.86426E+01 | ||
2798 | + 1. -0.13759E+02 0.29716E+01 0.86487E+01 | ||
2799 | + 1. -0.50252E+01 0.34303E+01 0.86582E+01 | ||
2800 | + 1. -0.35703E+01 0.11452E+01 0.86617E+01 | ||
2801 | + 1. 0.39464E+01 0.12849E+02 0.86673E+01 | ||
2802 | + 1. 0.31059E+01 -0.37371E+01 0.86778E+01 | ||
2803 | + 1. 0.99114E+01 -0.82490E+01 0.86816E+01 | ||
2804 | + 1. -0.13057E+02 -0.14977E+02 0.86928E+01 | ||
2805 | + 1. -0.25777E+01 -0.13684E+02 0.86993E+01 | ||
2806 | + 1. -0.13596E+02 0.12562E+02 0.87009E+01 | ||
2807 | + 1. 0.10184E+02 0.14296E+02 0.87131E+01 | ||
2808 | + 1. 0.12352E+02 0.89158E+01 0.87179E+01 | ||
2809 | + 1. 0.36173E+01 0.64589E+01 0.87260E+01 | ||
2810 | + 1. -0.11448E+01 -0.10313E+02 0.87280E+01 | ||
2811 | + 1. 0.16088E+02 -0.80428E+01 0.87385E+01 | ||
2812 | + 1. 0.24707E+01 -0.19838E+02 0.87461E+01 | ||
2813 | + 1. -0.12802E+02 0.84040E+01 0.87523E+01 | ||
2814 | + 1. -0.12162E+02 0.69224E+00 0.87589E+01 | ||
2815 | + 1. -0.11803E+02 -0.13289E+02 0.87665E+01 | ||
2816 | + 1. -0.21053E+01 -0.17359E+02 0.87674E+01 | ||
2817 | + 1. -0.45376E+01 -0.24767E+01 0.87775E+01 | ||
2818 | + 1. 0.47420E+01 0.90735E+01 0.87851E+01 | ||
2819 | + 1. -0.14037E+02 -0.51713E+01 0.87916E+01 | ||
2820 | + 1. -0.28598E+01 -0.19346E+02 0.87958E+01 | ||
2821 | + 1. 0.16654E+02 0.59181E+01 0.88051E+01 | ||
2822 | + 1. 0.30707E+01 -0.82041E+00 0.88119E+01 | ||
2823 | + 1. 0.72751E+01 -0.16224E+01 0.88193E+01 | ||
2824 | + 1. -0.16196E+02 -0.72166E+01 0.88206E+01 | ||
2825 | + 1. -0.28778E+01 -0.84625E+01 0.88309E+01 | ||
2826 | + 1. 0.11382E+02 -0.13329E+02 0.88357E+01 | ||
2827 | + 1. 0.49754E+01 -0.90011E+01 0.88413E+01 | ||
2828 | + 1. 0.11767E+02 -0.32951E+01 0.88503E+01 | ||
2829 | + 1. -0.10996E+02 -0.86311E+01 0.88588E+01 | ||
2830 | + 1. -0.14473E+02 0.72257E+01 0.88653E+01 | ||
2831 | + 1. -0.12323E+02 -0.22710E+01 0.88702E+01 | ||
2832 | + 1. -0.60282E+01 -0.12597E+02 0.88757E+01 | ||
2833 | + 1. -0.42699E+00 0.17886E+02 0.88800E+01 | ||
2834 | + 1. -0.85115E+01 0.14052E+02 0.88921E+01 | ||
2835 | + 1. 0.84072E+01 -0.98582E+01 0.88992E+01 | ||
2836 | + 1. 0.13651E+02 0.11438E+02 0.89042E+01 | ||
2837 | + 1. 0.61196E+01 -0.10724E+02 0.89109E+01 | ||
2838 | + 1. 0.43680E+01 -0.69144E+01 0.89154E+01 | ||
2839 | + 1. -0.11975E+02 -0.61034E+01 0.89216E+01 | ||
2840 | + 1. 0.10887E+02 -0.11614E+01 0.89305E+01 | ||
2841 | + 1. 0.29241E+01 -0.14326E+02 0.89376E+01 | ||
2842 | + 1. 0.98643E+01 0.11923E+02 0.89454E+01 | ||
2843 | + 1. -0.17467E+02 0.49272E+01 0.89494E+01 | ||
2844 | + 1. 0.39043E+01 0.18131E+02 0.89553E+01 | ||
2845 | + 1. 0.14010E+02 -0.72096E+01 0.89664E+01 | ||
2846 | + 1. 0.60271E+01 -0.12810E+02 0.89689E+01 | ||
2847 | + 1. 0.16875E+01 -0.11259E+02 0.89743E+01 | ||
2848 | + 1. -0.16450E+02 -0.37883E+01 0.89860E+01 | ||
2849 | + 1. 0.16118E+01 -0.70353E+01 0.89871E+01 | ||
2850 | + 1. 0.86836E+01 0.62250E+01 0.89971E+01 | ||
2851 | + 1. 0.56099E+01 0.60596E+01 0.90048E+01 | ||
2852 | + 1. -0.86625E+01 0.10197E+02 0.90120E+01 | ||
2853 | + 1. -0.14479E+02 -0.13319E+02 0.90152E+01 | ||
2854 | + 1. 0.10313E+02 0.94707E+01 0.90260E+01 | ||
2855 | + 1. -0.77003E+01 -0.56401E+01 0.90332E+01 | ||
2856 | + 1. -0.51788E+01 -0.82968E+01 0.90356E+01 | ||
2857 | + 1. -0.27837E+01 -0.11649E+02 0.90407E+01 | ||
2858 | + 1. -0.25380E+01 -0.24280E+01 0.90468E+01 | ||
2859 | + 1. 0.12476E+02 -0.97108E+01 0.90573E+01 | ||
2860 | + 1. 0.16096E+01 0.11760E+02 0.90617E+01 | ||
2861 | + 1. 0.12991E+02 -0.11880E+02 0.90703E+01 | ||
2862 | + 1. -0.61023E+01 0.14588E+02 0.90773E+01 | ||
2863 | + 1. -0.57913E+00 -0.67364E+01 0.90838E+01 | ||
2864 | + 1. 0.69533E+01 0.18205E+02 0.90890E+01 | ||
2865 | + 1. -0.12056E+02 0.15586E+02 0.90997E+01 | ||
2866 | + 1. 0.53428E+01 0.11300E+02 0.91001E+01 | ||
2867 | + 1. -0.42019E+01 -0.17671E+02 0.91101E+01 | ||
2868 | + 1. 0.14602E+02 0.47885E+01 0.91182E+01 | ||
2869 | + 1. -0.99896E+01 -0.33509E+01 0.91208E+01 | ||
2870 | + 1. 0.46596E+01 -0.15946E+02 0.91290E+01 | ||
2871 | + 1. -0.16801E+01 0.12338E+02 0.91370E+01 | ||
2872 | + 1. 0.15076E+02 -0.17921E+00 0.91460E+01 | ||
2873 | + 1. -0.18182E+01 0.20350E+01 0.91522E+01 | ||
2874 | + 1. 0.19178E+02 -0.56516E+01 0.91599E+01 | ||
2875 | + 1. -0.77034E+01 0.76088E+01 0.91664E+01 | ||
2876 | + 1. -0.11162E+02 0.95951E+01 0.91730E+01 | ||
2877 | + 1. -0.82598E+01 0.17206E+02 0.91786E+01 | ||
2878 | + 1. 0.65992E+01 -0.17164E+02 0.91824E+01 | ||
2879 | + 1. -0.54070E+01 -0.51633E+00 0.91920E+01 | ||
2880 | + 1. -0.97580E+01 -0.16997E+02 0.91979E+01 | ||
2881 | + 1. 0.16813E+01 0.67816E+01 0.92007E+01 | ||
2882 | + 1. -0.53158E+01 0.19251E+02 0.92072E+01 | ||
2883 | + 1. -0.14004E+02 -0.10448E+02 0.92175E+01 | ||
2884 | + 1. -0.17527E+02 -0.93361E+01 0.92257E+01 | ||
2885 | + 1. -0.11481E+02 0.26819E+01 0.92299E+01 | ||
2886 | + 1. 0.19026E+01 0.94157E+01 0.92371E+01 | ||
2887 | + 1. 0.27865E+01 0.15512E+02 0.92429E+01 | ||
2888 | + 1. 0.15872E+02 -0.11941E+02 0.92493E+01 | ||
2889 | + 1. 0.40484E+01 0.28446E+01 0.92572E+01 | ||
2890 | + 1. -0.18697E+02 0.18786E+01 0.92633E+01 | ||
2891 | + 1. -0.73498E+01 -0.16409E+02 0.92720E+01 | ||
2892 | + 1. 0.78136E+01 0.10291E+01 0.92758E+01 | ||
2893 | + 1. 0.12350E+02 0.24167E+01 0.92832E+01 | ||
2894 | + 1. 0.90779E+01 -0.29582E+01 0.92894E+01 | ||
2895 | + 1. 0.79133E+01 -0.15537E+02 0.92993E+01 | ||
2896 | + 1. 0.90078E+01 -0.58004E+00 0.93023E+01 | ||
2897 | + 1. -0.79884E+01 0.35124E+01 0.93116E+01 | ||
2898 | + 1. -0.80398E+01 -0.85047E+01 0.93163E+01 | ||
2899 | + 1. 0.18292E+02 0.76823E+01 0.93239E+01 | ||
2900 | + 1. -0.43707E+01 -0.63726E+01 0.93327E+01 | ||
2901 | + 1. 0.11872E+02 -0.15663E+02 0.93384E+01 | ||
2902 | + 1. -0.16323E+02 0.11107E+02 0.93407E+01 | ||
2903 | + 1. 0.11966E+02 0.12903E+02 0.93483E+01 | ||
2904 | + 1. 0.32996E+00 -0.10246E+01 0.93583E+01 | ||
2905 | + 1. -0.19681E+02 -0.44055E+00 0.93623E+01 | ||
2906 | + 1. -0.15362E+02 0.19477E+01 0.93680E+01 | ||
2907 | + 1. -0.15043E+02 -0.12882E+01 0.93763E+01 | ||
2908 | + 1. 0.16760E+02 -0.27779E+01 0.93860E+01 | ||
2909 | + 1. 0.44343E+01 -0.23746E+01 0.93920E+01 | ||
2910 | + 1. -0.38794E+01 0.13234E+02 0.93996E+01 | ||
2911 | + 1. 0.33120E+00 0.13320E+02 0.94060E+01 | ||
2912 | + 1. -0.89777E+01 -0.13086E+02 0.94102E+01 | ||
2913 | + 1. 0.17787E+02 0.28096E+01 0.94135E+01 | ||
2914 | + 1. -0.57988E+01 0.11397E+02 0.94229E+01 | ||
2915 | + 1. 0.75511E+01 0.12193E+02 0.94293E+01 | ||
2916 | + 1. -0.17963E+02 0.87564E+01 0.94367E+01 | ||
2917 | + 1. 0.71310E+00 -0.18415E+02 0.94400E+01 | ||
2918 | + 1. -0.37113E+01 0.86771E+01 0.94491E+01 | ||
2919 | + 1. 0.18127E+01 0.26752E+01 0.94596E+01 | ||
2920 | + 1. -0.18865E+02 -0.57931E+01 0.94653E+01 | ||
2921 | + 1. 0.63747E+01 0.15286E+02 0.94698E+01 | ||
2922 | + 1. 0.14183E+02 0.13942E+02 0.94775E+01 | ||
2923 | + 1. 0.10319E+02 -0.63735E+01 0.94848E+01 | ||
2924 | + 1. 0.17231E+02 0.95350E+01 0.94923E+01 | ||
2925 | + 1. -0.51427E+01 0.52625E+01 0.94981E+01 | ||
2926 | + 1. 0.14923E+02 0.68598E+01 0.95041E+01 | ||
2927 | + 1. 0.68297E+01 0.37414E+01 0.95105E+01 | ||
2928 | + 1. -0.10715E+02 -0.10785E+02 0.95188E+01 | ||
2929 | + 1. -0.10223E+02 0.16701E+02 0.95263E+01 | ||
2930 | + 1. 0.21583E+01 -0.92355E+01 0.95276E+01 | ||
2931 | + 1. -0.64442E+01 -0.36629E+01 0.95350E+01 | ||
2932 | + 1. -0.58087E+01 0.17985E+01 0.95426E+01 | ||
2933 | + 1. -0.34571E+01 -0.15754E+02 0.95519E+01 | ||
2934 | + 1. 0.65394E+01 -0.59382E+01 0.95545E+01 | ||
2935 | + 1. 0.23387E+01 -0.16322E+02 0.95642E+01 | ||
2936 | + 1. -0.99534E+01 0.65662E+01 0.95709E+01 | ||
2937 | + 1. 0.19757E+02 0.36934E+00 0.95735E+01 | ||
2938 | + 1. 0.94945E+01 -0.16938E+02 0.95816E+01 | ||
2939 | + 1. -0.77168E+01 -0.10824E+02 0.95904E+01 | ||
2940 | + 1. -0.10695E+01 0.65673E+01 0.95964E+01 | ||
2941 | + 1. 0.11601E+02 0.15641E+02 0.96009E+01 | ||
2942 | + 1. -0.94415E+00 -0.15089E+02 0.96095E+01 | ||
2943 | + 1. 0.15326E+01 -0.48095E+01 0.96140E+01 | ||
2944 | + 1. 0.98785E+01 0.17372E+02 0.96259E+01 | ||
2945 | + 1. -0.10054E+02 0.76689E+00 0.96315E+01 | ||
2946 | + 1. 0.68498E+01 -0.36130E+01 0.96375E+01 | ||
2947 | + 1. -0.11528E+02 0.11575E+02 0.96453E+01 | ||
2948 | + 1. 0.15972E+01 0.18040E+02 0.96511E+01 | ||
2949 | + 1. 0.10551E+02 0.73303E+01 0.96585E+01 | ||
2950 | + 1. 0.14278E+02 -0.33016E+01 0.96627E+01 | ||
2951 | + 1. -0.12282E+00 0.33089E+01 0.96702E+01 | ||
2952 | + 1. -0.96634E+01 -0.55717E+01 0.96750E+01 | ||
2953 | + 1. 0.70241E+01 0.95811E+01 0.96836E+01 | ||
2954 | + 1. 0.50711E+01 0.59407E+00 0.96930E+01 | ||
2955 | + 1. -0.58938E+01 -0.14641E+02 0.96963E+01 | ||
2956 | + 1. -0.13228E+02 -0.79932E+01 0.97007E+01 | ||
2957 | + 1. -0.16326E+02 0.64602E+01 0.97121E+01 | ||
2958 | + 1. -0.11326E+02 -0.15860E+02 0.97191E+01 | ||
2959 | + 1. -0.13775E+02 0.14410E+02 0.97248E+01 | ||
2960 | + 1. -0.12094E+02 -0.42679E+01 0.97269E+01 | ||
2961 | + 1. -0.23223E+01 0.84320E-02 0.97381E+01 | ||
2962 | + 1. 0.41375E+00 -0.12887E+02 0.97446E+01 | ||
2963 | + 1. -0.14077E+01 0.16111E+02 0.97513E+01 | ||
2964 | + 1. -0.41466E+01 0.16942E+02 0.97548E+01 | ||
2965 | + 1. 0.12822E+02 -0.50795E+01 0.97659E+01 | ||
2966 | + 1. -0.97512E+00 -0.19447E+02 0.97689E+01 | ||
2967 | + 1. -0.12576E+02 0.65046E+01 0.97788E+01 | ||
2968 | + 1. -0.14408E+02 0.90919E+01 0.97804E+01 | ||
2969 | + 1. -0.85749E+01 -0.19920E+01 0.97920E+01 | ||
2970 | + 1. -0.14501E+02 0.53353E+01 0.97952E+01 | ||
2971 | + 1. 0.10518E+02 0.52865E+01 0.98027E+01 | ||
2972 | + 1. 0.86208E+01 0.81712E+01 0.98129E+01 | ||
2973 | + 1. -0.34374E+01 0.40442E+01 0.98198E+01 | ||
2974 | + 1. 0.19050E+02 0.53330E+01 0.98242E+01 | ||
2975 | + 1. 0.46557E+01 -0.50319E+01 0.98298E+01 | ||
2976 | + 1. 0.18167E+02 -0.75301E+01 0.98390E+01 | ||
2977 | + 1. -0.15235E+01 -0.47868E+01 0.98443E+01 | ||
2978 | + 1. -0.83172E+01 0.12299E+02 0.98484E+01 | ||
2979 | + 1. 0.14366E+02 -0.10592E+02 0.98551E+01 | ||
2980 | + 1. 0.36922E+01 -0.18330E+02 0.98641E+01 | ||
2981 | + 1. -0.60953E+01 0.91315E+01 0.98733E+01 | ||
2982 | + 1. -0.17199E+02 -0.21445E+01 0.98795E+01 | ||
2983 | + 1. 0.84098E+01 -0.11618E+02 0.98826E+01 | ||
2984 | + 1. -0.57023E+01 -0.19010E+02 0.98888E+01 | ||
2985 | + 1. 0.85363E+01 0.15040E+02 0.98954E+01 | ||
2986 | + 1. -0.16991E+02 0.27072E+00 0.99043E+01 | ||
2987 | + 1. 0.14573E+02 -0.13492E+02 0.99107E+01 | ||
2988 | + 1. 0.13045E+02 0.74086E+01 0.99198E+01 | ||
2989 | + 1. 0.19066E+02 -0.15403E+01 0.99205E+01 | ||
2990 | + 1. 0.13229E+01 0.48428E+01 0.99269E+01 | ||
2991 | + 1. -0.28709E+00 -0.89428E+01 0.99370E+01 | ||
2992 | + 1. -0.18864E+02 0.65966E+01 0.99441E+01 | ||
2993 | + 1. -0.43471E+01 -0.13196E+02 0.99473E+01 | ||
2994 | + 1. -0.12647E+02 -0.11787E+02 0.99568E+01 | ||
2995 | + 1. -0.47721E+01 -0.10785E+02 0.99631E+01 | ||
2996 | + 1. 0.14267E+02 0.28735E+01 0.99670E+01 | ||
2997 | + 1. 0.40853E+01 -0.10600E+02 0.99797E+01 | ||
2998 | + 1. -0.71554E+00 0.86857E+01 0.99816E+01 | ||
2999 | + 1. 0.10411E+02 0.24616E+01 0.99929E+01 | ||
3000 | + 1. -0.10791E+02 0.44438E+01 0.99945E+01 |
1 | +++ a/etaGold.txt | ||
1 | +lambda n k | ||
2 | +1.937 0.92 13.78 | ||
3 | +1.610 0.56 11.21 | ||
4 | +1.393 0.43 9.519 | ||
5 | +1.216 0.35 8.145 | ||
6 | +1.088 0.27 7.150 | ||
7 | +0.9840 0.22 6.350 | ||
8 | +0.8920 0.17 5.663 | ||
9 | +0.8211 0.16 5.083 | ||
10 | +0.7560 0.14 4.542 | ||
11 | +0.7045 0.13 4.103 | ||
12 | +0.6595 0.14 3.697 | ||
13 | +0.6168 0.21 3.272 | ||
14 | +0.5821 0.29 2.863 | ||
15 | +0.5486 0.43 2.455 | ||
16 | +0.5209 0.62 2.081 | ||
17 | +0.4959 1.04 1.833 | ||
18 | +0.4714 1.31 1.849 | ||
19 | +0.4509 1.38 1.914 | ||
20 | +0.4305 1.45 1.948 | ||
21 | +0.4133 1.46 1.958 | ||
22 | +0.3974 1.47 1.952 | ||
23 | +0.3815 1.46 1.933 | ||
24 | +0.3679 1.48 1.895 | ||
25 | +0.3542 1.50 1.866 | ||
26 | +0.3425 1.48 1.871 | ||
27 | +0.3315 1.48 1.883 | ||
28 | +0.3204 1.54 1.898 | ||
29 | +0.3107 1.53 1.893 | ||
30 | +0.3009 1.53 1.889 | ||
31 | +0.2924 1.49 1.878 | ||
32 | +0.2844 1.47 1.869 | ||
33 | +0.2761 1.43 1.847 | ||
34 | +0.2689 1.38 1.803 | ||
35 | +0.2616 1.35 1.749 | ||
36 | +0.2551 1.33 1.688 | ||
37 | +0.2490 1.33 1.631 | ||
38 | +0.2426 1.32 1.577 | ||
39 | +0.2371 1.32 1.536 | ||
40 | +0.2313 1.30 1.497 | ||
41 | +0.2262 1.31 1.460 | ||
42 | +0.2214 1.30 1.427 | ||
43 | +0.2164 1.30 1.387 | ||
44 | +0.2119 1.30 1.350 | ||
45 | +0.2073 1.30 1.304 | ||
46 | +0.2033 1.33 1.277 | ||
47 | +0.1993 1.33 1.251 | ||
48 | +0.1953 1.34 1.226 | ||
49 | +0.1916 1.32 1.203 | ||
50 | +0.1879 1.28 1.188 |
1 | +++ a/etaSilver.txt | ||
1 | +lambda n k | ||
2 | +1.937 0.24 14.08 | ||
3 | +1.610 0.15 11.85 | ||
4 | +1.393 0.13 10.10 | ||
5 | +1.216 0.09 8.828 | ||
6 | +1.088 0.04 7.795 | ||
7 | +0.9840 0.04 6.992 | ||
8 | +0.8920 0.04 6.312 | ||
9 | +0.8211 0.04 5.727 | ||
10 | +0.7560 0.03 5.242 | ||
11 | +0.7045 0.04 4.838 | ||
12 | +0.6595 0.05 4.483 | ||
13 | +0.6168 0.06 4.152 | ||
14 | +0.5821 0.05 3.858 | ||
15 | +0.5486 0.06 3.586 | ||
16 | +0.5209 0.05 3.324 | ||
17 | +0.4959 0.05 3.093 | ||
18 | +0.4714 0.05 2.869 | ||
19 | +0.4509 0.04 2.657 | ||
20 | +0.4305 0.04 2.462 | ||
21 | +0.4133 0.05 2.275 | ||
22 | +0.3974 0.05 2.070 | ||
23 | +0.3815 0.05 1.864 | ||
24 | +0.3679 0.07 1.657 | ||
25 | +0.3542 0.10 1.419 | ||
26 | +0.3425 0.14 1.142 | ||
27 | +0.3315 0.17 0.829 | ||
28 | +0.3204 0.81 0.392 | ||
29 | +0.3107 1.13 0.616 | ||
30 | +0.3009 1.34 0.964 | ||
31 | +0.2924 1.39 1.161 | ||
32 | +0.2844 1.41 1.264 | ||
33 | +0.2761 1.41 1.331 | ||
34 | +0.2689 1.38 1.372 | ||
35 | +0.2616 1.35 1.387 | ||
36 | +0.2551 1.33 1.393 | ||
37 | +0.2490 1.31 1.389 | ||
38 | +0.2426 1.30 1.378 | ||
39 | +0.2371 1.28 1.367 | ||
40 | +0.2313 1.28 1.357 | ||
41 | +0.2262 1.26 1.344 | ||
42 | +0.2214 1.25 1.342 | ||
43 | +0.2164 1.22 1.336 | ||
44 | +0.2119 1.20 1.325 | ||
45 | +0.2073 1.18 1.312 | ||
46 | +0.2033 1.15 1.296 | ||
47 | +0.1993 1.14 1.277 | ||
48 | +0.1953 1.12 1.255 | ||
49 | +0.1916 1.10 1.232 | ||
50 | +0.1879 1.07 1.212 | ||
0 | \ No newline at end of file | 51 | \ No newline at end of file |
1 | +++ a/mpidefs-parallel.f90 | ||
1 | +! | ||
2 | +! MPI alias definitions for parallel machines. | ||
3 | +! | ||
4 | +! | ||
5 | +! last revised: 15 January 2011 | ||
6 | +! | ||
7 | + module mpidefs | ||
8 | + use mpi | ||
9 | + implicit none | ||
10 | + integer :: ms_mpi_comm_world,ms_mpi_sum,ms_mpi_max,ms_mpi_min | ||
11 | + | ||
12 | + contains | ||
13 | + | ||
14 | + subroutine ms_mpi(mpi_command,mpi_recv_buf_i,mpi_recv_buf_r,mpi_recv_buf_c,mpi_recv_buf_dp, & | ||
15 | + mpi_recv_buf_dc,mpi_send_buf_i,mpi_send_buf_r,mpi_send_buf_c, & | ||
16 | + mpi_send_buf_dp,mpi_send_buf_dc,mpi_number,mpi_comm,mpi_group,mpi_rank,mpi_size,& | ||
17 | + mpi_new_comm,mpi_new_group,mpi_new_group_list,mpi_operation) | ||
18 | + integer, optional :: mpi_number,mpi_recv_buf_i(*),mpi_send_buf_i(*),mpi_comm,mpi_group,mpi_rank, & | ||
19 | + mpi_size,mpi_new_comm,mpi_new_group,mpi_new_group_list(*),mpi_operation | ||
20 | + integer :: stat(MPI_STATUS_SIZE) | ||
21 | + real(4), optional :: mpi_recv_buf_r(*),mpi_send_buf_r(*) | ||
22 | + real(8), optional :: mpi_recv_buf_dp(*),mpi_send_buf_dp(*) | ||
23 | + complex(4), optional :: mpi_recv_buf_c(*),mpi_send_buf_c(*) | ||
24 | + complex(8), optional :: mpi_recv_buf_dc(*),mpi_send_buf_dc(*) | ||
25 | + character(*) :: mpi_command | ||
26 | + integer :: type,ierr,comm,size,rank,group,newcomm | ||
27 | + | ||
28 | + if(mpi_command.eq.'init') then | ||
29 | + call mpi_init(ierr) | ||
30 | + ms_mpi_comm_world=mpi_comm_world | ||
31 | + ms_mpi_sum=mpi_sum | ||
32 | + ms_mpi_max=mpi_max | ||
33 | + ms_mpi_min=mpi_min | ||
34 | + return | ||
35 | + endif | ||
36 | + if(mpi_command.eq.'finalize') then | ||
37 | + call mpi_finalize(ierr) | ||
38 | + return | ||
39 | + endif | ||
40 | + if(present(mpi_comm)) then | ||
41 | + comm=mpi_comm | ||
42 | + else | ||
43 | + comm=mpi_comm_world | ||
44 | + endif | ||
45 | + if(mpi_command.eq.'size') then | ||
46 | + call mpi_comm_size(comm,size,ierr) | ||
47 | + mpi_size=size | ||
48 | + return | ||
49 | + endif | ||
50 | + if(mpi_command.eq.'rank') then | ||
51 | + call mpi_comm_rank(comm,rank,ierr) | ||
52 | + mpi_rank=rank | ||
53 | + return | ||
54 | + endif | ||
55 | + if(mpi_command.eq.'group') then | ||
56 | + call mpi_comm_group(comm,group,ierr) | ||
57 | + mpi_group=group | ||
58 | + return | ||
59 | + endif | ||
60 | + if(mpi_command.eq.'incl') then | ||
61 | + call mpi_group_incl(mpi_group,mpi_size,mpi_new_group_list,group,ierr) | ||
62 | + mpi_new_group=group | ||
63 | + return | ||
64 | + endif | ||
65 | + if(mpi_command.eq.'create') then | ||
66 | + call mpi_comm_create(comm,mpi_group,newcomm,ierr) | ||
67 | + mpi_new_comm=newcomm | ||
68 | + return | ||
69 | + endif | ||
70 | + if(mpi_command.eq.'barrier') then | ||
71 | + call mpi_barrier (comm,ierr) | ||
72 | + return | ||
73 | + endif | ||
74 | + | ||
75 | + if(present(mpi_recv_buf_i).or.present(mpi_send_buf_i)) then | ||
76 | + type=mpi_integer | ||
77 | + if(mpi_command.eq.'bcast') then | ||
78 | + call MPI_BCAST (mpi_send_buf_i,mpi_number,type,mpi_rank,comm,ierr) | ||
79 | + return | ||
80 | + endif | ||
81 | + if(mpi_command.eq.'send') then | ||
82 | + call mpi_send(mpi_send_buf_i,mpi_number,type,mpi_rank,1,comm,ierr) | ||
83 | + return | ||
84 | + endif | ||
85 | + if(mpi_command.eq.'recv') then | ||
86 | + call mpi_recv(mpi_recv_buf_i,mpi_number,type,mpi_rank,1,comm,stat,ierr) | ||
87 | + return | ||
88 | + endif | ||
89 | + if(mpi_command.eq.'reduce') then | ||
90 | + if(present(mpi_send_buf_i)) then | ||
91 | + call mpi_reduce(mpi_send_buf_i,mpi_recv_buf_i,mpi_number,type,mpi_operation, & | ||
92 | + mpi_rank,comm,ierr) | ||
93 | + else | ||
94 | + call mpi_reduce(mpi_in_place,mpi_recv_buf_i,mpi_number,type,mpi_operation, & | ||
95 | + mpi_rank,comm,ierr) | ||
96 | + endif | ||
97 | + return | ||
98 | + endif | ||
99 | + if(mpi_command.eq.'allreduce') then | ||
100 | + if(present(mpi_send_buf_i)) then | ||
101 | + call mpi_allreduce(mpi_send_buf_i,mpi_recv_buf_i,mpi_number,type,mpi_operation, & | ||
102 | + comm,ierr) | ||
103 | + else | ||
104 | + call mpi_allreduce(mpi_in_place,mpi_recv_buf_i,mpi_number,type,mpi_operation, & | ||
105 | + comm,ierr) | ||
106 | + endif | ||
107 | + return | ||
108 | + endif | ||
109 | + endif | ||
110 | + | ||
111 | + if(present(mpi_recv_buf_r).or.present(mpi_send_buf_r)) then | ||
112 | + type=mpi_real | ||
113 | + if(mpi_command.eq.'bcast') then | ||
114 | + call MPI_BCAST (mpi_send_buf_r,mpi_number,type,mpi_rank,comm,ierr) | ||
115 | + return | ||
116 | + endif | ||
117 | + if(mpi_command.eq.'send') then | ||
118 | + call mpi_send(mpi_send_buf_r,mpi_number,type,mpi_rank,1,comm,ierr) | ||
119 | + return | ||
120 | + endif | ||
121 | + if(mpi_command.eq.'recv') then | ||
122 | + call mpi_recv(mpi_recv_buf_r,mpi_number,type,mpi_rank,1,comm,stat,ierr) | ||
123 | + return | ||
124 | + endif | ||
125 | + if(mpi_command.eq.'reduce') then | ||
126 | + if(present(mpi_send_buf_r)) then | ||
127 | + call mpi_reduce(mpi_send_buf_r,mpi_recv_buf_r,mpi_number,type,mpi_operation, & | ||
128 | + mpi_rank,comm,ierr) | ||
129 | + else | ||
130 | + call mpi_reduce(mpi_in_place,mpi_recv_buf_r,mpi_number,type,mpi_operation, & | ||
131 | + mpi_rank,comm,ierr) | ||
132 | + endif | ||
133 | + return | ||
134 | + endif | ||
135 | + if(mpi_command.eq.'allreduce') then | ||
136 | + if(present(mpi_send_buf_r)) then | ||
137 | + call mpi_allreduce(mpi_send_buf_r,mpi_recv_buf_r,mpi_number,type,mpi_operation, & | ||
138 | + comm,ierr) | ||
139 | + else | ||
140 | + call mpi_allreduce(mpi_in_place,mpi_recv_buf_r,mpi_number,type,mpi_operation, & | ||
141 | + comm,ierr) | ||
142 | + endif | ||
143 | + return | ||
144 | + endif | ||
145 | + endif | ||
146 | + | ||
147 | + if(present(mpi_recv_buf_c).or.present(mpi_send_buf_c)) then | ||
148 | + type=mpi_complex | ||
149 | + if(mpi_command.eq.'bcast') then | ||
150 | + call MPI_BCAST (mpi_send_buf_c,mpi_number,type,mpi_rank,comm,ierr) | ||
151 | + return | ||
152 | + endif | ||
153 | + if(mpi_command.eq.'send') then | ||
154 | + call mpi_send(mpi_send_buf_c,mpi_number,type,mpi_rank,1,comm,ierr) | ||
155 | + return | ||
156 | + endif | ||
157 | + if(mpi_command.eq.'recv') then | ||
158 | + call mpi_recv(mpi_recv_buf_c,mpi_number,type,mpi_rank,1,comm,stat,ierr) | ||
159 | + return | ||
160 | + endif | ||
161 | + if(mpi_command.eq.'reduce') then | ||
162 | + if(present(mpi_send_buf_c)) then | ||
163 | + call mpi_reduce(mpi_send_buf_c,mpi_recv_buf_c,mpi_number,type,mpi_operation, & | ||
164 | + mpi_rank,comm,ierr) | ||
165 | + else | ||
166 | + call mpi_reduce(mpi_in_place,mpi_recv_buf_c,mpi_number,type,mpi_operation, & | ||
167 | + mpi_rank,comm,ierr) | ||
168 | + endif | ||
169 | + return | ||
170 | + endif | ||
171 | + if(mpi_command.eq.'allreduce') then | ||
172 | + if(present(mpi_send_buf_c)) then | ||
173 | + call mpi_allreduce(mpi_send_buf_c,mpi_recv_buf_c,mpi_number,type,mpi_operation, & | ||
174 | + comm,ierr) | ||
175 | + else | ||
176 | + call mpi_allreduce(mpi_in_place,mpi_recv_buf_c,mpi_number,type,mpi_operation, & | ||
177 | + comm,ierr) | ||
178 | + endif | ||
179 | + return | ||
180 | + endif | ||
181 | + endif | ||
182 | + | ||
183 | + if(present(mpi_recv_buf_dp).or.present(mpi_send_buf_dp)) then | ||
184 | + type=mpi_double_precision | ||
185 | + if(mpi_command.eq.'bcast') then | ||
186 | + call MPI_BCAST (mpi_send_buf_dp,mpi_number,type,mpi_rank,comm,ierr) | ||
187 | + return | ||
188 | + endif | ||
189 | + if(mpi_command.eq.'send') then | ||
190 | + call mpi_send(mpi_send_buf_dp,mpi_number,type,mpi_rank,1,comm,ierr) | ||
191 | + return | ||
192 | + endif | ||
193 | + if(mpi_command.eq.'recv') then | ||
194 | + call mpi_recv(mpi_recv_buf_dp,mpi_number,type,mpi_rank,1,comm,stat,ierr) | ||
195 | + return | ||
196 | + endif | ||
197 | + if(mpi_command.eq.'reduce') then | ||
198 | + if(present(mpi_send_buf_dp)) then | ||
199 | + call mpi_reduce(mpi_send_buf_dp,mpi_recv_buf_dp,mpi_number,type,mpi_operation, & | ||
200 | + mpi_rank,comm,ierr) | ||
201 | + else | ||
202 | + call mpi_reduce(mpi_in_place,mpi_recv_buf_dp,mpi_number,type,mpi_operation, & | ||
203 | + mpi_rank,comm,ierr) | ||
204 | + endif | ||
205 | + return | ||
206 | + endif | ||
207 | + if(mpi_command.eq.'allreduce') then | ||
208 | + if(present(mpi_send_buf_dp)) then | ||
209 | + call mpi_allreduce(mpi_send_buf_dp,mpi_recv_buf_dp,mpi_number,type,mpi_operation, & | ||
210 | + comm,ierr) | ||
211 | + else | ||
212 | + call mpi_allreduce(mpi_in_place,mpi_recv_buf_dp,mpi_number,type,mpi_operation, & | ||
213 | + comm,ierr) | ||
214 | + endif | ||
215 | + return | ||
216 | + endif | ||
217 | + endif | ||
218 | + | ||
219 | + if(present(mpi_recv_buf_dc).or.present(mpi_send_buf_dc)) then | ||
220 | + type=mpi_double_complex | ||
221 | + if(mpi_command.eq.'bcast') then | ||
222 | + call MPI_BCAST (mpi_send_buf_dc,mpi_number,type,mpi_rank,comm,ierr) | ||
223 | + return | ||
224 | + endif | ||
225 | + if(mpi_command.eq.'send') then | ||
226 | + call mpi_send(mpi_send_buf_dc,mpi_number,type,mpi_rank,1,comm,ierr) | ||
227 | + return | ||
228 | + endif | ||
229 | + if(mpi_command.eq.'recv') then | ||
230 | + call mpi_recv(mpi_recv_buf_dc,mpi_number,type,mpi_rank,1,comm,stat,ierr) | ||
231 | + return | ||
232 | + endif | ||
233 | + if(mpi_command.eq.'reduce') then | ||
234 | + if(present(mpi_send_buf_dc)) then | ||
235 | + call mpi_reduce(mpi_send_buf_dc,mpi_recv_buf_dc,mpi_number,type,mpi_operation, & | ||
236 | + mpi_rank,comm,ierr) | ||
237 | + else | ||
238 | + call mpi_reduce(mpi_in_place,mpi_recv_buf_dc,mpi_number,type,mpi_operation, & | ||
239 | + mpi_rank,comm,ierr) | ||
240 | + endif | ||
241 | + return | ||
242 | + endif | ||
243 | + if(mpi_command.eq.'allreduce') then | ||
244 | + if(present(mpi_send_buf_dc)) then | ||
245 | + call mpi_allreduce(mpi_send_buf_dc,mpi_recv_buf_dc,mpi_number,type,mpi_operation, & | ||
246 | + comm,ierr) | ||
247 | + else | ||
248 | + call mpi_allreduce(mpi_in_place,mpi_recv_buf_dc,mpi_number,type,mpi_operation, & | ||
249 | + comm,ierr) | ||
250 | + endif | ||
251 | + return | ||
252 | + endif | ||
253 | + endif | ||
254 | + | ||
255 | + end subroutine ms_mpi | ||
256 | + end module mpidefs |
1 | +++ a/mpidefs-serial.f90 | ||
1 | +! | ||
2 | +! MPI alias definitions for serial machines. | ||
3 | +! | ||
4 | +! | ||
5 | +! last revised: 15 January 2011 | ||
6 | +! | ||
7 | + module mpidefs | ||
8 | + implicit none | ||
9 | + integer :: mpi_comm_world,ms_mpi_comm_world,ms_mpi_sum,ms_mpi_max,ms_mpi_min | ||
10 | + | ||
11 | + contains | ||
12 | + | ||
13 | + subroutine ms_mpi(mpi_command,mpi_recv_buf_i,mpi_recv_buf_r,mpi_recv_buf_c,mpi_recv_buf_dp, & | ||
14 | + mpi_recv_buf_dc,mpi_send_buf_i,mpi_send_buf_r,mpi_send_buf_c, & | ||
15 | + mpi_send_buf_dp,mpi_send_buf_dc,mpi_number,mpi_comm,mpi_group,mpi_rank,mpi_size, & | ||
16 | + mpi_new_comm,mpi_new_group,mpi_new_group_list,mpi_operation) | ||
17 | + integer, optional :: mpi_number,mpi_recv_buf_i(*),mpi_send_buf_i(*),mpi_comm,mpi_group,mpi_rank, & | ||
18 | + mpi_size,mpi_new_comm,mpi_new_group,mpi_new_group_list(*),mpi_operation | ||
19 | + integer :: stat(1) | ||
20 | + real(4), optional :: mpi_recv_buf_r(*),mpi_send_buf_r(*) | ||
21 | + real(8), optional :: mpi_recv_buf_dp(*),mpi_send_buf_dp(*) | ||
22 | + complex(4), optional :: mpi_recv_buf_c(*),mpi_send_buf_c(*) | ||
23 | + complex(8), optional :: mpi_recv_buf_dc(*),mpi_send_buf_dc(*) | ||
24 | + character(*) :: mpi_command | ||
25 | + integer :: type,ierr,comm,size,rank,group,newcomm | ||
26 | + | ||
27 | + if(mpi_command.eq.'init') then | ||
28 | + mpi_comm_world=1 | ||
29 | + return | ||
30 | + endif | ||
31 | + if(mpi_command.eq.'finalize') then | ||
32 | + return | ||
33 | + endif | ||
34 | + if(present(mpi_comm)) then | ||
35 | + comm=mpi_comm | ||
36 | + else | ||
37 | + comm=mpi_comm_world | ||
38 | + endif | ||
39 | + if(mpi_command.eq.'size') then | ||
40 | + mpi_size=1 | ||
41 | + return | ||
42 | + endif | ||
43 | + if(mpi_command.eq.'rank') then | ||
44 | + mpi_rank=0 | ||
45 | + return | ||
46 | + endif | ||
47 | + if(mpi_command.eq.'group') then | ||
48 | + return | ||
49 | + endif | ||
50 | + if(mpi_command.eq.'incl') then | ||
51 | + mpi_new_group=0 | ||
52 | + return | ||
53 | + endif | ||
54 | + if(mpi_command.eq.'create') then | ||
55 | + mpi_new_comm=1 | ||
56 | + return | ||
57 | + endif | ||
58 | + if(mpi_command.eq.'barrier') then | ||
59 | + return | ||
60 | + endif | ||
61 | + | ||
62 | + if(present(mpi_recv_buf_i).or.present(mpi_send_buf_i)) then | ||
63 | + if(mpi_command.eq.'bcast'.or.mpi_command.eq.'send'.or.mpi_command.eq.'recv') then | ||
64 | + return | ||
65 | + endif | ||
66 | + if(mpi_command.eq.'reduce'.or.mpi_command.eq.'allreduce') then | ||
67 | + if(present(mpi_send_buf_i)) then | ||
68 | + mpi_recv_buf_i(1:mpi_number)=mpi_send_buf_i(1:mpi_number) | ||
69 | + endif | ||
70 | + endif | ||
71 | + return | ||
72 | + endif | ||
73 | + | ||
74 | + if(present(mpi_recv_buf_r).or.present(mpi_send_buf_r)) then | ||
75 | + if(mpi_command.eq.'bcast'.or.mpi_command.eq.'send'.or.mpi_command.eq.'recv') then | ||
76 | + return | ||
77 | + endif | ||
78 | + if(mpi_command.eq.'reduce'.or.mpi_command.eq.'allreduce') then | ||
79 | + if(present(mpi_send_buf_r)) then | ||
80 | + mpi_recv_buf_r(1:mpi_number)=mpi_send_buf_r(1:mpi_number) | ||
81 | + endif | ||
82 | + endif | ||
83 | + return | ||
84 | + endif | ||
85 | + | ||
86 | + if(present(mpi_recv_buf_c).or.present(mpi_send_buf_c)) then | ||
87 | + if(mpi_command.eq.'bcast'.or.mpi_command.eq.'send'.or.mpi_command.eq.'recv') then | ||
88 | + return | ||
89 | + endif | ||
90 | + if(mpi_command.eq.'reduce'.or.mpi_command.eq.'allreduce') then | ||
91 | + if(present(mpi_send_buf_c)) then | ||
92 | + mpi_recv_buf_c(1:mpi_number)=mpi_send_buf_c(1:mpi_number) | ||
93 | + endif | ||
94 | + endif | ||
95 | + return | ||
96 | + endif | ||
97 | + | ||
98 | + if(present(mpi_recv_buf_dp).or.present(mpi_send_buf_dp)) then | ||
99 | + if(mpi_command.eq.'bcast'.or.mpi_command.eq.'send'.or.mpi_command.eq.'recv') then | ||
100 | + return | ||
101 | + endif | ||
102 | + if(mpi_command.eq.'reduce'.or.mpi_command.eq.'allreduce') then | ||
103 | + if(present(mpi_send_buf_dp)) then | ||
104 | + mpi_recv_buf_dp(1:mpi_number)=mpi_send_buf_dp(1:mpi_number) | ||
105 | + endif | ||
106 | + endif | ||
107 | + return | ||
108 | + endif | ||
109 | + | ||
110 | + if(present(mpi_recv_buf_dc).or.present(mpi_send_buf_dc)) then | ||
111 | + if(mpi_command.eq.'bcast'.or.mpi_command.eq.'send'.or.mpi_command.eq.'recv') then | ||
112 | + return | ||
113 | + endif | ||
114 | + if(mpi_command.eq.'reduce'.or.mpi_command.eq.'allreduce') then | ||
115 | + if(present(mpi_send_buf_dc)) then | ||
116 | + mpi_recv_buf_dc(1:mpi_number)=mpi_send_buf_dc(1:mpi_number) | ||
117 | + endif | ||
118 | + endif | ||
119 | + return | ||
120 | + endif | ||
121 | + | ||
122 | + end subroutine ms_mpi | ||
123 | + end module mpidefs |
1 | +++ a/msinput.inp | ||
1 | +number_spheres | ||
2 | +27 | ||
3 | +sphere_position_file | ||
4 | +cube27.pos | ||
5 | +output_file | ||
6 | +test.dat | ||
7 | +run_print_file | ||
8 | + | ||
9 | +length_scale_factor | ||
10 | +2 | ||
11 | +real_ref_index_scale_factor | ||
12 | +1.4 | ||
13 | +imag_ref_index_scale_factor | ||
14 | +.1 | ||
15 | +real_chiral_factor | ||
16 | +0.d0 | ||
17 | +imag_chiral_factor | ||
18 | +0.d0 | ||
19 | +mie_epsilon | ||
20 | +1.d-4 | ||
21 | +translation_epsilon | ||
22 | +1.d-6 | ||
23 | +solution_epsilon | ||
24 | +1.d-7 | ||
25 | +max_number_iterations | ||
26 | +5000 | ||
27 | +max_memory_per_processor | ||
28 | +1500 | ||
29 | +store_translation_matrix | ||
30 | +1 | ||
31 | +near_field_distance | ||
32 | +-1. | ||
33 | +iterations_per_correction | ||
34 | +20 | ||
35 | +min_scattering_angle_deg | ||
36 | +0.d0 | ||
37 | +max_scattering_angle_deg | ||
38 | +180.d0 | ||
39 | +number_scattering_angles | ||
40 | +181 | ||
41 | +normalize_scattering_matrix | ||
42 | +1 | ||
43 | +gaussian_beam_constant | ||
44 | +0.0d0 | ||
45 | +gaussian_beam_focal_point | ||
46 | +0.d0,0.d0,0.d0 | ||
47 | +fixed_or_random_orientation | ||
48 | +0 | ||
49 | +incident_azimuth_angle_deg | ||
50 | +0.d0 | ||
51 | +incident_polar_angle_deg | ||
52 | +0.d0 | ||
53 | +scattering_plane_angle_deg | ||
54 | +0.d0 | ||
55 | +calculate_scattering_coefficients | ||
56 | +1 | ||
57 | +scattering_coefficient_file | ||
58 | +amn_temp.dat | ||
59 | +track_iterations | ||
60 | +1 | ||
61 | +calculate_near_field | ||
62 | +1 | ||
63 | +near_field_plane_coord | ||
64 | +1 | ||
65 | +near_field_plane_position | ||
66 | +0.d0 | ||
67 | +near_field_plane_vertices | ||
68 | +-20.d0,-20.d0,20.d0,20.d0 | ||
69 | +spacial_step_size | ||
70 | +.2d0 | ||
71 | +polarization_angle_deg | ||
72 | +0.d0 | ||
73 | +near_field_output_file | ||
74 | +nf-temp.dat | ||
75 | +near_field_output_data | ||
76 | +2 | ||
77 | +plane_wave_epsilon | ||
78 | +0.01d0 | ||
79 | +calculate_t_matrix | ||
80 | +1 | ||
81 | +t_matrix_file | ||
82 | +tmatrix-temp.dat | ||
83 | +t_matrix_convergence_epsilon | ||
84 | +1.d-9 | ||
85 | +sphere_sizes_and_positions | ||
86 | +10. 0. 0. 0. | ||
87 | +5. 0. 0. 15. | ||
88 | +2. 0. 0. -12. | ||
89 | +8. 18. 0. 0. | ||
90 | +end_of_options |
1 | +++ a/mstm-generic-main-v2.2.f90 | ||
1 | +! | ||
2 | +! generic mstm calling program. | ||
3 | +! | ||
4 | +! this code is intended for user modification. It does not employ input files, command line arguments, etc. | ||
5 | +! | ||
6 | +! all parameters must be hardwired. read the code for the basic ideas. | ||
7 | +! | ||
8 | + program main | ||
9 | + use mpidefs | ||
10 | + use mpidata | ||
11 | + use intrinsics | ||
12 | + use spheredata | ||
13 | + use numconstants | ||
14 | + use specialfuncs | ||
15 | + use miecoefdata | ||
16 | + use translation | ||
17 | + use solver | ||
18 | + use scatprops | ||
19 | + use nearfield | ||
20 | + implicit none | ||
21 | + integer :: nsphere,neqns,nodrmax,nodrt,i,k,niter,istat,numtheta, & | ||
22 | + nblkt,nodrg,m,n,p,l,q,mn,kl,m1,n1,l1,k1,q1,w,klm,mnm,ikm, & | ||
23 | + fixedorrandom,numargs,calctmatrix,maxiter,nodrta(1),calcnf, & | ||
24 | + calcamn,ip1,ip2,ma,na,nsend,nfplane,nfoutunit,nfoutdata, & | ||
25 | + maxmbperproc,trackiterations,nonactive,normalizesm, & | ||
26 | + storetranmat,calcsm,niterstep,fftranpresent | ||
27 | + integer, allocatable :: nodr(:),ntran(:),sphereblk(:),sphereoff(:) | ||
28 | + real (8) :: alphadeg,betadeg,alpha,beta,epsmie,epstran,epssoln, & | ||
29 | + qexttot,qabstot,xv,scalefac,qscatot,asymparm, & | ||
30 | + rireal,riimag,phideg,theta1d,theta2d,thetad,costheta,phi, & | ||
31 | + sm(4,4),time1,time2,fc1,fc2,fc3,fc4,epstcon,qabslm,absrat, & | ||
32 | + cbeam,gbfocus(3),maxerr,nfplanepos,nfplanevert(2,2), & | ||
33 | + deltax,gammadeg,epspw,gamma,qexttotpar,qexttotper, & | ||
34 | + qabstotpar,qabstotper,qscatotpar,qscatotper,cphi,sphi,s11, & | ||
35 | + nfdistance | ||
36 | + real(8), allocatable :: xsp(:), rpos(:,:),qext(:,:),qabs(:,:), & | ||
37 | + qsca(:,:),smc(:,:,:),smt(:,:,:) | ||
38 | + complex(8) :: sa(4),chiralfactor | ||
39 | + complex(8), allocatable :: amnp(:,:),amnp0(:,:,:,:),ri(:,:), & | ||
40 | + gmn(:),amnp1(:,:,:),amnp2(:,:,:) | ||
41 | + character*30 :: inputfile,spherefile,parmfile,outfile,tmatrixfile,& | ||
42 | + amnfile,nfoutfile,runfile | ||
43 | + complex(8), allocatable :: pmnp0(:,:,:,:) | ||
44 | + integer :: ierr,rank,printinputdata,runprintunit,numprocs | ||
45 | +! | ||
46 | +! this main program was set up to perform a loop of T matrix calculations, | ||
47 | +! all involving scaled sphere positions from the file 'ran200fvp5.pos' | ||
48 | +! | ||
49 | +! | ||
50 | +! extra variable declarations go here | ||
51 | +! | ||
52 | + integer :: case,numcases | ||
53 | + real(8) :: xsp0,rpos0(3,200),rotang,volfrac,volfrac0,volfrac1,posscale | ||
54 | + complex(8) :: ri0 | ||
55 | +! | ||
56 | +! define the sphere properties and run parameters | ||
57 | +! | ||
58 | + nsphere=200 | ||
59 | + xsp0=3.d0 | ||
60 | + ri0=(1.31d0,0.0d0) | ||
61 | + chiralfactor=0.d0 | ||
62 | + volfrac0=0.1d0 | ||
63 | + volfrac1=0.5d0 | ||
64 | + | ||
65 | + allocate(xsp(nsphere),rpos(3,nsphere),nodr(nsphere),ntran(nsphere), & | ||
66 | + ri(2,nsphere),sphereblk(nsphere),sphereoff(nsphere+1)) | ||
67 | + spherefile='ran200fvp5.pos' | ||
68 | + open(1,file=spherefile) | ||
69 | + do i=1,nsphere | ||
70 | + read(1,*) xsp(i),rpos0(:,i) | ||
71 | + enddo | ||
72 | + close(1) | ||
73 | + | ||
74 | + outfile='test.dat' | ||
75 | + runfile=' ' | ||
76 | + xsp=xsp0 | ||
77 | + xv=xsp0*dble(nsphere)**.3333d0 | ||
78 | + ri=ri0 | ||
79 | + epsmie=1.d-4 | ||
80 | + epstran=1.d-6 | ||
81 | + epssoln=1.d-10 | ||
82 | + niter=2000 | ||
83 | + fixedorrandom=1 | ||
84 | + theta1d=0. | ||
85 | + theta2d=180. | ||
86 | + numtheta=181 | ||
87 | + maxmbperproc=1500. | ||
88 | + storetranmat=1 | ||
89 | + nfdistance=10000. | ||
90 | + normalizesm=0 | ||
91 | + calcamn=1 | ||
92 | + amnfile='amn-temp.dat' | ||
93 | + phideg=0.d0 | ||
94 | + alphadeg=0.d0 | ||
95 | + betadeg=0.d0 | ||
96 | + trackiterations=0 | ||
97 | + calcnf=0 | ||
98 | + cbeam=0.d0 | ||
99 | + nfplane=1 | ||
100 | + nfplanepos=0.d0 | ||
101 | + deltax=0.2d0 | ||
102 | + nfplanevert=reshape((/-40.d0,-40.d0,40.d0,40.d0/),(/2,2/)) | ||
103 | + gammadeg=0.d0 | ||
104 | + nfoutfile='nftest2b.dat' | ||
105 | + nfoutunit=2 | ||
106 | + nfoutdata=1 | ||
107 | + epspw=0.01d0 | ||
108 | + calctmatrix=1 | ||
109 | + tmatrixfile='tmatrix-temp.dat' | ||
110 | + epstcon=1.d-6 | ||
111 | +! | ||
112 | +! this erases the output file: the code runs a loop where | ||
113 | +! output values are appended to the file | ||
114 | +! | ||
115 | + open(1,file=outfile) | ||
116 | + close(1,status='delete') | ||
117 | + if(runfile.ne.' ') then | ||
118 | + runprintunit=4 | ||
119 | + open(runprintunit,file=runfile) | ||
120 | + else | ||
121 | + runprintunit=6 | ||
122 | + endif | ||
123 | + call setrunparameters(run_print_unit=runprintunit) | ||
124 | +! | ||
125 | +! initialize mpi | ||
126 | +! | ||
127 | + call ms_mpi(mpi_command='init') | ||
128 | +! | ||
129 | +! this is the main variable loop. In this example the volume fraction of the spheres | ||
130 | +! is changed with each case. | ||
131 | +! | ||
132 | + numcases=20 | ||
133 | + do case=1,numcases-1 | ||
134 | + volfrac=volfrac0+(volfrac1-volfrac0)*dble(case-1)/dble(numcases-1) | ||
135 | + posscale=(volfrac1/volfrac)**.33333d0 | ||
136 | + rpos=rpos0*posscale*xsp0 | ||
137 | + write(runprintunit,'('' case, fv:'',i5,f8.2)') case, volfrac | ||
138 | +! | ||
139 | +! the rest of the code is basically the same as the mstm | ||
140 | +! main program, without the getrunparameter calls. | ||
141 | +! | ||
142 | + if(numtheta.gt.0) then | ||
143 | + if(allocated(smt)) deallocate(smt) | ||
144 | + allocate(smt(4,4,numtheta)) | ||
145 | + endif | ||
146 | +! | ||
147 | +! determine if optical activity is present | ||
148 | +! | ||
149 | + nonactive=1 | ||
150 | + do i=1,nsphere | ||
151 | + if(cdabs(ri(1,i)-ri(2,i)).gt.1.d-10) then | ||
152 | + nonactive=0 | ||
153 | + exit | ||
154 | + endif | ||
155 | + enddo | ||
156 | +! | ||
157 | +! calculation of sphere mie coefficients, order limits | ||
158 | +! | ||
159 | + call miecoefcalc(nsphere,xsp,ri,epsmie) | ||
160 | + call getmiedata(sphere_order=nodr,max_order=nodrmax,number_equations=neqns, & | ||
161 | + sphere_block=sphereblk,sphere_block_offset=sphereoff) | ||
162 | +! | ||
163 | +! determine the size of the parallel run and set it up | ||
164 | +! | ||
165 | + call ms_mpi(mpi_command='size',mpi_size=numprocs) | ||
166 | + call ms_mpi(mpi_command='rank',mpi_rank=rank) | ||
167 | + call ms_mpi(mpi_command='barrier') | ||
168 | + call mpisetup(nsphere,nodr,rpos,fixedorrandom,maxmbperproc,storetranmat, & | ||
169 | + nfdistance,fftranpresent,runprintunit) | ||
170 | + call ms_mpi(mpi_command='barrier') | ||
171 | +! | ||
172 | +! this was an option for moving the GB focal point | ||
173 | +! | ||
174 | + gbfocus=(/0.d0,dble(case-1),0.d0/)*.5d0 | ||
175 | + gbfocus=0.d0 | ||
176 | +! | ||
177 | +! translation matrix calculation | ||
178 | +! | ||
179 | + call mpirottranmtrxsetup(nsphere,nodr,rpos,(1.d0,0.d0),storetranmat, & | ||
180 | + nfdistance,runprintunit) | ||
181 | + call ms_mpi(mpi_command='barrier') | ||
182 | +! | ||
183 | +! determine orders required to expand scattered fields about target origin | ||
184 | +! | ||
185 | + call tranorders(nsphere,nodr,rpos,epstran,ntran,nodrt) | ||
186 | +! | ||
187 | +! report the size of the run | ||
188 | +! | ||
189 | + if(rank.eq.0) then | ||
190 | + write(runprintunit,'('' maximum sphere order:'',i5)') nodrmax | ||
191 | + write(runprintunit,'('' estimated T matrix order:'',i5)') nodrt | ||
192 | + write(runprintunit,'('' number of equations:'',i9)') neqns | ||
193 | + call flush(runprintunit) | ||
194 | + endif | ||
195 | +! | ||
196 | +! the main calculations | ||
197 | +! | ||
198 | + if(fixedorrandom.eq.1) then | ||
199 | +! | ||
200 | +! random orientation option | ||
201 | +! | ||
202 | + if(allocated(qext)) deallocate(qext,qabs,qsca) | ||
203 | + allocate(qext(nsphere,1), qabs(nsphere,1), qsca(nsphere,1)) | ||
204 | + if(calctmatrix.ge.1) then | ||
205 | +! | ||
206 | +! this option calculates the T matrix either from the beginning or where left off | ||
207 | +! | ||
208 | + if(rank.eq.0) time1=mytime() | ||
209 | + call tmatrixsoln(neqns,nsphere,nodr,nodrt,xsp,rpos,epssoln,epstcon,niter,& | ||
210 | + calctmatrix,tmatrixfile,fftranpresent,niterstep,qext,qabs,qsca,istat) | ||
211 | + if(rank.eq.0) then | ||
212 | + time2=mytime()-time1 | ||
213 | + call timewrite(runprintunit,' execution time:',time2) | ||
214 | + endif | ||
215 | + call rottranmtrxclear() | ||
216 | + else | ||
217 | +! | ||
218 | +! and this has the T matrix already calculated and stored in the file. | ||
219 | +! | ||
220 | +! read the order of the T matrix and broadcast to the processors. | ||
221 | +! | ||
222 | + if(rank.eq.0) then | ||
223 | + open(3,file=tmatrixfile) | ||
224 | + read(3,*) nodrt | ||
225 | + close(3) | ||
226 | + write(runprintunit,'('' t matrix order:'',i5)') nodrt | ||
227 | + call flush(runprintunit) | ||
228 | + endif | ||
229 | + nodrta(1)=nodrt | ||
230 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_i=nodrta,mpi_number=1,mpi_rank=0) | ||
231 | + nodrt=nodrta(1) | ||
232 | + call ms_mpi(mpi_command='barrier') | ||
233 | + endif | ||
234 | +! | ||
235 | +! the T matrix is available; calculate the random orientation scattering matrix | ||
236 | +! | ||
237 | + nblkt=nodrt*(nodrt+2) | ||
238 | + nodrg=nodrt*2 | ||
239 | + if(allocated(smc)) deallocate(smc) | ||
240 | + allocate(smc(4,4,0:nodrg)) | ||
241 | + call ranorientscatmatrix(xv,nsphere,nodrt,nodrg,cbeam,tmatrixfile,smc,qext, & | ||
242 | + qabs,qsca) | ||
243 | + if(rank.eq.0) then | ||
244 | + qexttot=sum(qext(:,1)*xsp*xsp)/xv/xv | ||
245 | + qabstot=sum(qabs(:,1)*xsp*xsp)/xv/xv | ||
246 | + qscatot=qexttot-qabstot | ||
247 | + asymparm=dble(smc(1,1,1)/smc(1,1,0))/3.d0 | ||
248 | + call ranorienscatmatrixcalc(numtheta,theta1d,theta2d,1,smc,nodrg,smt) | ||
249 | + endif | ||
250 | + else | ||
251 | +! | ||
252 | +! fixed orientation option | ||
253 | +! | ||
254 | + alpha=alphadeg*pi/180.d0 | ||
255 | + beta=betadeg*pi/180.d0 | ||
256 | + phi=phideg*pi/180.d0 | ||
257 | + if(allocated(amnp)) deallocate(amnp) | ||
258 | + allocate(amnp(neqns,2)) | ||
259 | + if(allocated(qext)) deallocate(qext,qabs,qsca) | ||
260 | + allocate(qext(nsphere,3), qabs(nsphere,3), qsca(nsphere,3)) | ||
261 | + if(calcamn.eq.1) then | ||
262 | +! | ||
263 | +! this option calculates the scattering coefficients | ||
264 | +! | ||
265 | + if(rank.eq.0) time1=mytime() | ||
266 | + call fixedorsoln(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,epssoln,& | ||
267 | + epstran,niter,amnp,qext,qabs,qsca,maxerr,maxiter,trackiterations, & | ||
268 | + fftranpresent,niterstep,istat) | ||
269 | +! | ||
270 | +! write the scattering coefficients to the file | ||
271 | +! | ||
272 | + if(rank.eq.0) then | ||
273 | + time2=mytime()-time1 | ||
274 | + write(runprintunit,'('' max iterations, soln error:'',i6,e13.5)') & | ||
275 | + maxiter,maxerr | ||
276 | + call timewrite(runprintunit,' execution time:',time2) | ||
277 | + open(3,file=amnfile) | ||
278 | + do i=1,nsphere | ||
279 | + write(3,'(6e13.5)') qext(i,:),qabs(i,:),qsca(i,:) | ||
280 | + allocate(amnp1(0:nodr(i)+1,nodr(i),2),amnp2(0:nodr(i)+1,nodr(i),2)) | ||
281 | + ip1=sphereoff(i)+1 | ||
282 | + ip2=sphereoff(i)+sphereblk(i) | ||
283 | + amnp1=reshape(amnp(ip1:ip2,1),(/nodr(i)+2,nodr(i),2/)) | ||
284 | + amnp2=reshape(amnp(ip1:ip2,2),(/nodr(i)+2,nodr(i),2/)) | ||
285 | + do n=1,nodr(i) | ||
286 | + do m=-n,n | ||
287 | + if(m.le.-1) then | ||
288 | + ma=n+1 | ||
289 | + na=-m | ||
290 | + else | ||
291 | + ma=m | ||
292 | + na=n | ||
293 | + endif | ||
294 | + write(3,'(4e17.9)') amnp1(ma,na,1),amnp2(ma,na,1) | ||
295 | + write(3,'(4e17.9)') amnp1(ma,na,2),amnp2(ma,na,2) | ||
296 | + enddo | ||
297 | + enddo | ||
298 | + deallocate(amnp1,amnp2) | ||
299 | + enddo | ||
300 | + close(3) | ||
301 | + endif | ||
302 | + else | ||
303 | +! | ||
304 | +! this option reads the scattering coefficients from the file | ||
305 | +! | ||
306 | + if(rank.eq.0) then | ||
307 | + open(3,file=amnfile) | ||
308 | + do i=1,nsphere | ||
309 | + read(3,'(6e13.5)') qext(i,:),qabs(i,:),qsca(i,:) | ||
310 | + allocate(amnp1(0:nodr(i)+1,nodr(i),2),amnp2(0:nodr(i)+1,nodr(i),2)) | ||
311 | + do n=1,nodr(i) | ||
312 | + do m=-n,n | ||
313 | + if(m.le.-1) then | ||
314 | + ma=n+1 | ||
315 | + na=-m | ||
316 | + else | ||
317 | + ma=m | ||
318 | + na=n | ||
319 | + endif | ||
320 | + read(3,'(4e17.9)') amnp1(ma,na,1),amnp2(ma,na,1) | ||
321 | + read(3,'(4e17.9)') amnp1(ma,na,2),amnp2(ma,na,2) | ||
322 | + enddo | ||
323 | + enddo | ||
324 | + ip1=sphereoff(i)+1 | ||
325 | + ip2=sphereoff(i)+sphereblk(i) | ||
326 | + amnp(ip1:ip2,1)=reshape(amnp1(0:nodr(i)+1,1:nodr(i),1:2),(/sphereblk(i)/)) | ||
327 | + amnp(ip1:ip2,2)=reshape(amnp2(0:nodr(i)+1,1:nodr(i),1:2),(/sphereblk(i)/)) | ||
328 | + deallocate(amnp1,amnp2) | ||
329 | + enddo | ||
330 | + close(3) | ||
331 | + endif | ||
332 | +! | ||
333 | +! broadcast the scattering coefficients to the other processors | ||
334 | +! | ||
335 | + nsend=neqns*2 | ||
336 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=amnp,mpi_number=nsend,mpi_rank=0) | ||
337 | + endif | ||
338 | +! | ||
339 | +! calculate the efficiency factors | ||
340 | +! | ||
341 | + cphi=cos(phi) | ||
342 | + sphi=sin(phi) | ||
343 | + qexttotpar=sum((qext(:,1)*cphi*cphi+2.d0*qext(:,3)*cphi*sphi+qext(:,2)*sphi*sphi) & | ||
344 | + *xsp*xsp)/xv/xv | ||
345 | + qexttotper=sum((qext(:,1)*sphi*sphi-2.d0*qext(:,3)*cphi*sphi+qext(:,2)*cphi*cphi) & | ||
346 | + *xsp*xsp)/xv/xv | ||
347 | + qabstotpar=sum((qabs(:,1)*cphi*cphi+2.d0*qabs(:,3)*cphi*sphi+qabs(:,2)*sphi*sphi) & | ||
348 | + *xsp*xsp)/xv/xv | ||
349 | + qabstotper=sum((qabs(:,1)*sphi*sphi-2.d0*qabs(:,3)*cphi*sphi+qabs(:,2)*cphi*cphi) & | ||
350 | + *xsp*xsp)/xv/xv | ||
351 | + qscatotpar=qexttotpar-qabstotpar | ||
352 | + qscatotper=qexttotper-qabstotper | ||
353 | + qexttot=(qexttotpar+qexttotper)*.5d0 | ||
354 | + qabstot=(qabstotpar+qabstotper)*.5d0 | ||
355 | + qscatot=(qscatotpar+qscatotper)*.5d0 | ||
356 | + qext(:,1)=(qext(:,1)+qext(:,2))*.5d0 | ||
357 | + qabs(:,1)=(qabs(:,1)+qabs(:,2))*.5d0 | ||
358 | + qsca(:,1)=(qsca(:,1)+qsca(:,2))*.5d0 | ||
359 | + call rottranmtrxclear() | ||
360 | +! | ||
361 | +! calculate the target-based expansion and rotate to the incident field frame | ||
362 | +! | ||
363 | + allocate(amnp0(0:nodrt+1,nodrt,2,2),pmnp0(0:nodrt+1,nodrt,2,2)) | ||
364 | + do k=1,2 | ||
365 | + call amncommonorigin(neqns,nsphere,nodr,ntran,nodrt,rpos, & | ||
366 | + amnp(1:neqns,k),amnp0(0:,1:,1:,k)) | ||
367 | + call rotvec(alpha,beta,0.d0,nodrt,nodrt,amnp0(0:,1:,1:,k),1) | ||
368 | + enddo | ||
369 | +! | ||
370 | +! calculate the asymmetry parameter and the scattering matrix | ||
371 | +! | ||
372 | + allocate(gmn(0:2)) | ||
373 | + call s11expansion(amnp0,nodrt,0,1,gmn) | ||
374 | + asymparm=dble(gmn(1)/gmn(0))/3.d0 | ||
375 | + do i=1,numtheta | ||
376 | + thetad=theta1d+(theta2d-theta1d)*(i-1)/max(1.d0,dble(numtheta-1)) | ||
377 | + costheta=cos(thetad*pi/180.d0) | ||
378 | + call scatteringmatrix(amnp0,nodrt,xv,costheta,phi,sa,smt(:,:,i)) | ||
379 | + enddo | ||
380 | + deallocate(amnp0,pmnp0,gmn) | ||
381 | + endif | ||
382 | +! | ||
383 | +! output file operations | ||
384 | +! | ||
385 | + if(rank.eq.0) then | ||
386 | + open(1,file=outfile,position='append') | ||
387 | + if(nonactive.eq.0) then | ||
388 | + write(1,'('' sphere S.P., pos. (x,y,z), ref. index (L,R), Qext, Qsca, Qabs, Qabs/Qabs,LM'')') | ||
389 | + else | ||
390 | + write(1,'('' sphere S.P., pos. (x,y,z), ref. index, Qext, Qsca, Qabs, Qabs/Qabs,LM'')') | ||
391 | + endif | ||
392 | + do i=1,nsphere | ||
393 | + call getmiedata(which_sphere=i,sphere_qabs=qabslm) | ||
394 | + if(dimag(ri(1,i)).eq.0.d0.and.dimag(ri(2,i)).eq.0.d0) then | ||
395 | + absrat=1.d0 | ||
396 | + else | ||
397 | + absrat=qabs(i,1)/qabslm | ||
398 | + endif | ||
399 | + if(nonactive.eq.0) then | ||
400 | + write(1,'(i5,4f10.4,4f10.6,3e13.5,f8.4)') i, xsp(i),rpos(:,i)+gbfocus, ri(:,i), & | ||
401 | + qext(i,1),qsca(i,1),qabs(i,1),absrat | ||
402 | + else | ||
403 | + write(1,'(i5,4f10.4,2f10.6,3e13.5,f8.4)') i, xsp(i),rpos(:,i)+gbfocus, ri(1,i), & | ||
404 | + qext(i,1),qsca(i,1),qabs(i,1),absrat | ||
405 | + endif | ||
406 | + enddo | ||
407 | + if(fixedorrandom.eq.1) then | ||
408 | + write(1,'('' total ext, abs, scat efficiencies, w.r.t. xv, and asym. parm'')') | ||
409 | + write(1,'(6e13.5)') qexttot,qabstot,qscatot,asymparm | ||
410 | + else | ||
411 | + write(1,'('' unpolarized total ext, abs, scat efficiencies, w.r.t. xv, and asym. parm'')') | ||
412 | + write(1,'(6e13.5)') qexttot,qabstot,qscatot,asymparm | ||
413 | + write(1,'('' parallel total ext, abs, scat efficiencies'')') | ||
414 | + write(1,'(6e13.5)') qexttotpar,qabstotpar,qscatotpar | ||
415 | + write(1,'('' perpendicular total ext, abs, scat efficiencies'')') | ||
416 | + write(1,'(6e13.5)') qexttotper,qabstotper,qscatotper | ||
417 | + endif | ||
418 | + | ||
419 | + write(1,'('' scattering matrix elements'')') | ||
420 | + if(normalizesm.eq.0) then | ||
421 | + write(1,'('' theta s11 s22 s33'',& | ||
422 | + &'' s44'',& | ||
423 | + &'' s21 s32 s43 s31'',& | ||
424 | + &'' s42 s41'')') | ||
425 | + do i=1,numtheta | ||
426 | + thetad=theta1d+(theta2d-theta1d)*(i-1)/max(1.d0,dble(numtheta-1)) | ||
427 | + write(1,'(f8.2,10e12.4)') thetad,smt(1,1,i),smt(2,2,i),smt(3,3,i), & | ||
428 | + smt(4,4,i),smt(1,2,i),smt(2,3,i),smt(3,4,i),smt(1,3,i), & | ||
429 | + smt(2,4,i),smt(1,4,i) | ||
430 | + enddo | ||
431 | + else | ||
432 | + write(1,'('' theta s11 s22/s11 s33'',& | ||
433 | + &''/s11 s44'',& | ||
434 | + &''/s11 s21/s11 s32/s11 s43/s11 s31'',& | ||
435 | + &''/s11 s42/s11 s41/s11'')') | ||
436 | + do i=1,numtheta | ||
437 | + thetad=theta1d+(theta2d-theta1d)*(i-1)/max(1.d0,dble(numtheta-1)) | ||
438 | + s11=smt(1,1,i) | ||
439 | + write(1,'(f8.2,10e12.4)') thetad,smt(1,1,i),smt(2,2,i)/s11,smt(3,3,i)/s11, & | ||
440 | + smt(4,4,i)/s11,smt(1,2,i)/s11,smt(2,3,i)/s11,smt(3,4,i)/s11,smt(1,3,i)/s11, & | ||
441 | + smt(2,4,i)/s11,smt(1,4,i)/s11 | ||
442 | + enddo | ||
443 | + endif | ||
444 | + if(fixedorrandom.eq.1) then | ||
445 | + write(1,'('' scattering matrix expansion coefficients'')') | ||
446 | + write(1,'('' w a11 a22 a33 '',& | ||
447 | + &''a23 a32 a44 a12 '',& | ||
448 | + &''a34 a13 a24 a14'')') | ||
449 | + do w=0,nodrg | ||
450 | + write(1,'(i5,11e12.4)') w,smc(1,1,w),smc(2,2,w),& | ||
451 | + smc(3,3,w),smc(2,3,w),smc(3,2,w),smc(4,4,w),& | ||
452 | + smc(1,2,w),smc(3,4,w),smc(1,3,w),smc(2,4,w),& | ||
453 | + smc(1,4,w) | ||
454 | + enddo | ||
455 | + endif | ||
456 | + close(1) | ||
457 | + endif | ||
458 | +! | ||
459 | +! near field calculation options | ||
460 | +! | ||
461 | + if(fixedorrandom.eq.0.and.calcnf.eq.1) then | ||
462 | +! | ||
463 | +! this was a modification to the main: the near field file | ||
464 | +! is opened for appending | ||
465 | +! | ||
466 | + if(rank.eq.0) then | ||
467 | + open(nfoutunit,file=nfoutfile,position='append') | ||
468 | + endif | ||
469 | + gamma=gammadeg*pi/180.d0 | ||
470 | + call nearfieldgridcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
471 | + nfplane,nfplanepos,nfplanevert,gbfocus,deltax,gamma,nfoutunit,epspw, & | ||
472 | + nfoutdata,runprintunit) | ||
473 | + if(rank.eq.0) then | ||
474 | + close(nfoutunit) | ||
475 | + endif | ||
476 | + endif | ||
477 | +! | ||
478 | +! all done! | ||
479 | +! | ||
480 | +! | ||
481 | +! and this ends the main variable loop. | ||
482 | +! | ||
483 | + enddo | ||
484 | +! | ||
485 | +! time to go home | ||
486 | +! | ||
487 | + call ms_mpi(mpi_command='finalize') | ||
488 | + end |
1 | +++ a/mstm-gui.py | ||
1 | +#!/usr/bin/python | ||
2 | + | ||
3 | +from mstm_materials import * | ||
4 | +from mstm_parameters import * | ||
5 | +from mstm_simparser import * | ||
6 | +import time | ||
7 | +import sys | ||
8 | + | ||
9 | +#PyQt4 libraries | ||
10 | +from PyQt4 import QtGui | ||
11 | +from PyQt4 import QtCore | ||
12 | +from PyQt4 import uic | ||
13 | + | ||
14 | +class GuiWindow(QtGui.QMainWindow): | ||
15 | + | ||
16 | + params = ParameterClass('msinput.inp') | ||
17 | + | ||
18 | + def setParams(self): | ||
19 | + #update the Gui based on values in the parameters structure | ||
20 | + self.ui.spinStartLambda.setValue(self.params.minLambda) | ||
21 | + self.ui.spinEndLambda.setValue(self.params.maxLambda) | ||
22 | + self.ui.spinNumSamples.setValue(self.params.nSamples) | ||
23 | + self.ui.spinNumSpheres.setValue(int(self.params['number_spheres'])) | ||
24 | + #self.ui.spinAlpha.setValue(float(self.params['incident_azimuth_angle_deg'])) | ||
25 | + #self.ui.spinBeta.setValue(float(self.params['incident_polar_angle_deg'])) | ||
26 | + | ||
27 | + fi = QtCore.QFileInfo(self.params.matFilename) | ||
28 | + self.ui.txtMaterial.setText(fi.baseName()) | ||
29 | + | ||
30 | + #update global parameters for the dimer simulation | ||
31 | + self.ui.spinSpacing.setValue(d) | ||
32 | + | ||
33 | + def getParams(self): | ||
34 | + self.params.minLambda = self.ui.spinStartLambda.value() | ||
35 | + self.params.maxLambda = self.ui.spinEndLambda.value() | ||
36 | + self.params.nSamples = self.ui.spinNumSamples.value() | ||
37 | + self.params.nSpheres = self.ui.spinNumSpheres.value() | ||
38 | + self.params['incident_azimuth_angle_deg'] = self.ui.spinAlpha.value() | ||
39 | + self.params['incident_polar_angle_deg'] = self.ui.spinBeta.value() | ||
40 | + | ||
41 | + | ||
42 | + #global parameters for dimers | ||
43 | + d = self.ui.spinSpacing.value() | ||
44 | + | ||
45 | + return self.params | ||
46 | + | ||
47 | + def simulate(self): | ||
48 | + self.results = RunSimulation(self.params) | ||
49 | + | ||
50 | + def saveresults(self): | ||
51 | + fileName = QtGui.QFileDialog.getSaveFileName(w, 'Save Spectral Results', '', 'DAT data files (*.dat)') | ||
52 | + if fileName: | ||
53 | + self.results.saveFile(fileName) | ||
54 | + | ||
55 | + def loadmaterial(self): | ||
56 | + fileName = QtGui.QFileDialog.getOpenFileName(w, 'Load Material Refractive Index', '', 'TXT data files (*.txt)') | ||
57 | + if fileName: | ||
58 | + self.params.matFilename = fileName | ||
59 | + | ||
60 | + fi = QtCore.QFileInfo(fileName) | ||
61 | + self.ui.txtMaterial.setText(fi.baseName()) | ||
62 | + | ||
63 | + def __init__(self): | ||
64 | + QtGui.QWidget.__init__(self) | ||
65 | + | ||
66 | + #dimer-specific settings | ||
67 | + self.params['number_spheres'] = 2 | ||
68 | + self.params['sphere_position_file'] = '' | ||
69 | + | ||
70 | + #load the UI window | ||
71 | + self.ui = uic.loadUi('mstm_guiwindow.ui') | ||
72 | + #update the displayed parameters | ||
73 | + self.setParams() | ||
74 | + #display the UI | ||
75 | + self.ui.show() | ||
76 | + | ||
77 | + #simulation button | ||
78 | + self.connect(self.ui.btnSimulate, QtCore.SIGNAL("clicked()"), self.simulate) | ||
79 | + self.connect(self.ui.mnuSaveResults, QtCore.SIGNAL("triggered()"), self.saveresults) | ||
80 | + self.connect(self.ui.mnuLoadMaterial, QtCore.SIGNAL("triggered()"), self.loadmaterial) | ||
81 | + | ||
82 | +class ProgressBar(QtGui.QWidget): | ||
83 | + def __init__(self, parent=None, total=20): | ||
84 | + super(ProgressBar, self).__init__(parent) | ||
85 | + self.name_line = QtGui.QLineEdit() | ||
86 | + | ||
87 | + self.progressbar = QtGui.QProgressBar() | ||
88 | + self.progressbar.setMinimum(1) | ||
89 | + self.progressbar.setMaximum(total) | ||
90 | + | ||
91 | + main_layout = QtGui.QGridLayout() | ||
92 | + main_layout.addWidget(self.progressbar, 0, 0) | ||
93 | + | ||
94 | + self.setLayout(main_layout) | ||
95 | + self.setWindowTitle("Progress") | ||
96 | + | ||
97 | + def update_progressbar(self, val): | ||
98 | + self.progressbar.setValue(val) | ||
99 | + | ||
100 | + | ||
101 | +def RunSimulation(parameters): | ||
102 | + | ||
103 | + #load the material | ||
104 | + material = MaterialClass(parameters.matFilename) | ||
105 | + | ||
106 | + #add water if necessary | ||
107 | + if parameters.inWater: | ||
108 | + material.addSolution(1.33) | ||
109 | + | ||
110 | + #set the parameters based on the UI | ||
111 | + parameters = w.getParams() | ||
112 | + | ||
113 | + #range for simulation | ||
114 | + minLambda = parameters.minLambda | ||
115 | + maxLambda = parameters.maxLambda | ||
116 | + nSamples = parameters.nSamples | ||
117 | + | ||
118 | + #store the simulation results | ||
119 | + results = SimParserClass() | ||
120 | + | ||
121 | + #create a progress bar | ||
122 | + pbar = ProgressBar(total=nSamples) | ||
123 | + pbar.show() | ||
124 | + | ||
125 | + #for each wavelength in the material | ||
126 | + for i in range(nSamples): | ||
127 | + | ||
128 | + l = minLambda + i*(maxLambda - minLambda)/(nSamples - 1) | ||
129 | + | ||
130 | + | ||
131 | + | ||
132 | + #set the computed parameters | ||
133 | + m = material[l] | ||
134 | + n = m.n | ||
135 | + parameters['real_ref_index_scale_factor'] = n.real | ||
136 | + parameters['imag_ref_index_scale_factor'] = n.imag | ||
137 | + parameters['length_scale_factor'] = (2.0 * 3.14159)/l | ||
138 | + parameters['scattering_plane_angle_deg'] = gamma; | ||
139 | + | ||
140 | + | ||
141 | + parameters.clearSpheres() | ||
142 | + parameters.addSphere(a, -(d + 2*a)/2, 0, 0) | ||
143 | + parameters.addSphere(a, (d + 2*a)/2, 0, 0) | ||
144 | + | ||
145 | + #save the scripted input file | ||
146 | + parameters.saveFile('scriptParams.inp') | ||
147 | + | ||
148 | + #run the binary | ||
149 | + from subprocess import call | ||
150 | + devnull = open('/dev/null', 'w') | ||
151 | + call(["./ms-tmatrix", "scriptParams.inp"], stdout=devnull) | ||
152 | + | ||
153 | + results.parseSimFile(l, 'test.dat') | ||
154 | + | ||
155 | + #update the progress bar | ||
156 | + pbar.update_progressbar(i+1) | ||
157 | + | ||
158 | + | ||
159 | + #plot results of interest | ||
160 | + import matplotlib.pyplot as plt | ||
161 | + wl = results['lambda'] | ||
162 | + unpol = results['extinction_unpolarized'] | ||
163 | + para = results['extinction_parallel'] | ||
164 | + perp = results['extinction_perpendicular'] | ||
165 | + plt.plot(wl, unpol, 'r-', wl, para, 'g-', wl, perp, 'b-') | ||
166 | + plt.ylabel('Extinction') | ||
167 | + plt.xlabel('Wavelength (um)') | ||
168 | + plt.show() | ||
169 | + | ||
170 | + #return the results | ||
171 | + return results; | ||
172 | + | ||
173 | + | ||
174 | + | ||
175 | + | ||
176 | + | ||
177 | + | ||
178 | +#input template file name | ||
179 | +inpFilename = 'msinput.inp' | ||
180 | + | ||
181 | +#output spectral file name | ||
182 | +outFilename = 'spectralOut.txt' | ||
183 | + | ||
184 | +#sphere radii | ||
185 | +a = 0.025 | ||
186 | +#distance between spheres | ||
187 | +d = 0.002 | ||
188 | +#incident light directions | ||
189 | +alpha = 0 | ||
190 | +beta = 0 | ||
191 | +gamma = 0 | ||
192 | + | ||
193 | +#results stored for each spectral sample | ||
194 | +resultLabels = {'lambda', 'extinction_unpolarized', 'extinction_parallel', 'extinction_perpendicular'} | ||
195 | + | ||
196 | + | ||
197 | + | ||
198 | + | ||
199 | + | ||
200 | +outFile = open(outFilename, 'w') | ||
201 | + | ||
202 | +#number of characters in the progress bar | ||
203 | +pb_max = 50 | ||
204 | + | ||
205 | + | ||
206 | + | ||
207 | +#create a Qt window | ||
208 | +app = QtGui.QApplication(sys.argv) | ||
209 | +w = GuiWindow() | ||
210 | +sys.exit(app.exec_()) | ||
211 | + | ||
212 | + | ||
213 | + | ||
214 | + | ||
215 | + |
1 | +++ a/mstm-intrinsics.f90 | ||
1 | + module intrinsics | ||
2 | +! | ||
3 | +! compiler-dependent intrinsic functions. | ||
4 | +! | ||
5 | +! | ||
6 | +! last revised: 15 January 2011 | ||
7 | +! | ||
8 | + | ||
9 | + implicit none | ||
10 | + contains | ||
11 | +! | ||
12 | +! system clock | ||
13 | +! | ||
14 | + real function mytime() | ||
15 | + implicit none | ||
16 | + real :: etime | ||
17 | + real(4), parameter :: x=0. | ||
18 | + real :: t(2) | ||
19 | +! mytime=secnds(x) | ||
20 | + mytime=etime(t) | ||
21 | + end function mytime | ||
22 | + | ||
23 | +! flush is one of the best named functions in fortran, although it does not do what I think it should. This function flushes | ||
24 | +! the buffer to print unit i, so when the unit is flushed, all data written to the open file will appear in the file. | ||
25 | +! Not all compilers have this function. | ||
26 | + | ||
27 | + subroutine flush(i) | ||
28 | + implicit none | ||
29 | + integer :: i | ||
30 | + flush(i) | ||
31 | + end subroutine flush | ||
32 | +! | ||
33 | +! number of command-line arguments. | ||
34 | +! | ||
35 | + integer function mstm_nargs() | ||
36 | + implicit none | ||
37 | + integer nargs | ||
38 | +! mstm_nargs=nargs() | ||
39 | + mstm_nargs=iargc() | ||
40 | + end function mstm_nargs | ||
41 | +! | ||
42 | +! command line argument retrieval | ||
43 | +! | ||
44 | + subroutine mstm_getarg(char) | ||
45 | + implicit none | ||
46 | + integer :: istat | ||
47 | + character(*) :: char | ||
48 | +! call getarg(1,char,istat) | ||
49 | + call getarg(1,char) | ||
50 | + end subroutine mstm_getarg | ||
51 | + | ||
52 | + end module intrinsics |
1 | +++ a/mstm-main-v2.2.f90 | ||
1 | +! | ||
2 | +! mstm main program | ||
3 | +! | ||
4 | +! | ||
5 | +! original release: 15 January 2011 | ||
6 | +! 21 February 2011: modifications to fixed orientation efficiency factor | ||
7 | +! | ||
8 | + program main | ||
9 | + use mpidefs | ||
10 | + use mpidata | ||
11 | + use intrinsics | ||
12 | + use spheredata | ||
13 | + use numconstants | ||
14 | + use specialfuncs | ||
15 | + use miecoefdata | ||
16 | + use translation | ||
17 | + use solver | ||
18 | + use scatprops | ||
19 | + use nearfield | ||
20 | + implicit none | ||
21 | + integer :: nsphere,neqns,nodrmax,nodrt,i,k,niter,istat,numtheta, & | ||
22 | + nblkt,nodrg,m,n,p,l,q,mn,kl,m1,n1,l1,k1,q1,w,klm,mnm,ikm, & | ||
23 | + fixedorrandom,numargs,calctmatrix,maxiter,nodrta(1),calcnf, & | ||
24 | + calcamn,ip1,ip2,ma,na,nsend,nfplane,nfoutunit,nfoutdata, & | ||
25 | + maxmbperproc,trackiterations,nonactive,normalizesm,storetranmat, & | ||
26 | + fftranpresent,niterstep | ||
27 | + integer, allocatable :: nodr(:),ntran(:),sphereblk(:),sphereoff(:) | ||
28 | + real (8) :: alphadeg,betadeg,alpha,beta,epsmie,epstran,epssoln, & | ||
29 | + qexttot,qabstot,xv,scalefac,qscatot,asymparm, & | ||
30 | + rireal,riimag,phideg,theta1d,theta2d,thetad,costheta,phi, & | ||
31 | + sm(4,4),time1,time2,fc1,fc2,fc3,fc4,epstcon,qabslm,absrat, & | ||
32 | + cbeam,gbfocus(3),maxerr,nfplanepos,nfplanevert(2,2), & | ||
33 | + deltax,gammadeg,epspw,gamma,qexttotpar,qexttotper, & | ||
34 | + qabstotpar,qabstotper,qscatotpar,qscatotper,cphi,sphi,s11, & | ||
35 | + nfdistance | ||
36 | + real(8), allocatable :: xsp(:), rpos(:,:),qext(:,:),qabs(:,:), & | ||
37 | + qsca(:,:),smc(:,:,:),smt(:,:,:) | ||
38 | + complex(8) :: sa(4) | ||
39 | + complex(8), allocatable :: amnp(:,:),amnp0(:,:,:,:),ri(:,:), & | ||
40 | + gmn(:),amnp1(:,:,:),amnp2(:,:,:) | ||
41 | + character*30 :: inputfile,spherefile,parmfile,outfile,tmatrixfile,& | ||
42 | + amnfile,nfoutfile | ||
43 | + complex(8), allocatable :: pmnp0(:,:,:,:) | ||
44 | + integer :: ierr,rank,printinputdata,runprintunit,numprocs | ||
45 | +! | ||
46 | +! command line argument retrieval for input file | ||
47 | +! | ||
48 | + printinputdata=1 | ||
49 | + numargs=mstm_nargs() | ||
50 | + if(numargs.eq.0) then | ||
51 | + inputfile='msinput.inp' | ||
52 | + else | ||
53 | + call mstm_getarg(inputfile) | ||
54 | + endif | ||
55 | + call inputdata(inputfile,printinputdata) | ||
56 | +! | ||
57 | +! reading of run and sphere data, setting up of arrays | ||
58 | +! | ||
59 | + call getspheredata(number_spheres=nsphere) | ||
60 | + allocate(xsp(nsphere),rpos(3,nsphere),nodr(nsphere),ntran(nsphere), & | ||
61 | + ri(2,nsphere),sphereblk(nsphere),sphereoff(nsphere+1)) | ||
62 | + call getspheredata(sphere_size_parameters=xsp,sphere_positions=rpos, & | ||
63 | + sphere_refractive_indices=ri,volume_size_parameter=xv) | ||
64 | + call getrunparameters(mie_epsilon=epsmie,translation_epsilon=epstran, & | ||
65 | + solution_epsilon=epssoln,max_number_iterations=niter, & | ||
66 | + fixed_or_random_orientation=fixedorrandom,output_file=outfile, & | ||
67 | + min_scattering_angle_deg=theta1d,max_scattering_angle_deg=theta2d, & | ||
68 | + number_scattering_angles=numtheta,gaussian_beam_constant=cbeam, & | ||
69 | + gaussian_beam_focal_point=gbfocus,run_print_unit=runprintunit, & | ||
70 | + max_memory_per_processor=maxmbperproc, & | ||
71 | + normalize_scattering_matrix=normalizesm, & | ||
72 | + store_translation_matrix=storetranmat, & | ||
73 | + near_field_distance=nfdistance, & | ||
74 | + iterations_per_correction=niterstep) | ||
75 | + if(numtheta.gt.0) then | ||
76 | + allocate(smt(4,4,numtheta)) | ||
77 | + endif | ||
78 | +! | ||
79 | +! determine if optical activity is present | ||
80 | +! | ||
81 | + nonactive=1 | ||
82 | + do i=1,nsphere | ||
83 | + if(cdabs(ri(1,i)-ri(2,i)).gt.1.d-10) then | ||
84 | + nonactive=0 | ||
85 | + exit | ||
86 | + endif | ||
87 | + enddo | ||
88 | +! | ||
89 | +! calculation of sphere mie coefficients, order limits | ||
90 | +! | ||
91 | + call miecoefcalc(nsphere,xsp,ri,epsmie) | ||
92 | + call getmiedata(sphere_order=nodr,max_order=nodrmax,number_equations=neqns, & | ||
93 | + sphere_block=sphereblk,sphere_block_offset=sphereoff) | ||
94 | +! | ||
95 | +! determine the size of the parallel run and set it up | ||
96 | +! | ||
97 | + call ms_mpi(mpi_command='init') | ||
98 | + call ms_mpi(mpi_command='size',mpi_size=numprocs) | ||
99 | + call ms_mpi(mpi_command='rank',mpi_rank=rank) | ||
100 | + call ms_mpi(mpi_command='barrier') | ||
101 | + call mpisetup(nsphere,nodr,rpos,fixedorrandom,maxmbperproc,storetranmat, & | ||
102 | + nfdistance,fftranpresent,runprintunit) | ||
103 | + call ms_mpi(mpi_command='barrier') | ||
104 | + call mpirottranmtrxsetup(nsphere,nodr,rpos,(1.d0,0.d0),storetranmat,& | ||
105 | + nfdistance,runprintunit) | ||
106 | + call ms_mpi(mpi_command='barrier') | ||
107 | +! | ||
108 | +! determine orders required to expand scattered fields about target origin | ||
109 | +! | ||
110 | + call tranorders(nsphere,nodr,rpos,epstran,ntran,nodrt) | ||
111 | +! | ||
112 | +! report the size of the run | ||
113 | +! | ||
114 | + if(rank.eq.0) then | ||
115 | + write(runprintunit,'('' maximum sphere order:'',i5)') nodrmax | ||
116 | + write(runprintunit,'('' estimated T matrix order:'',i5)') nodrt | ||
117 | + write(runprintunit,'('' number of equations:'',i9)') neqns | ||
118 | + call flush(runprintunit) | ||
119 | + endif | ||
120 | +! | ||
121 | + if(fixedorrandom.eq.1) then | ||
122 | +! | ||
123 | +! random orientation option | ||
124 | +! | ||
125 | + call getrunparameters(calculate_t_matrix=calctmatrix,t_matrix_file=tmatrixfile, & | ||
126 | + t_matrix_convergence_epsilon=epstcon) | ||
127 | + allocate(qext(nsphere,1), qabs(nsphere,1), qsca(nsphere,1)) | ||
128 | + if(calctmatrix.ge.1) then | ||
129 | +! | ||
130 | +! this option calculates the T matrix either from the beginning or where left off | ||
131 | +! | ||
132 | + if(rank.eq.0) time1=mytime() | ||
133 | + call tmatrixsoln(neqns,nsphere,nodr,nodrt,xsp,rpos,epssoln,epstcon,niter,& | ||
134 | + calctmatrix,tmatrixfile,fftranpresent,niterstep,qext,qabs,qsca,istat) | ||
135 | + if(rank.eq.0) then | ||
136 | + time2=mytime()-time1 | ||
137 | + call timewrite(runprintunit,' execution time:',time2) | ||
138 | + endif | ||
139 | + call rottranmtrxclear() | ||
140 | + else | ||
141 | +! | ||
142 | +! and this has the T matrix already calculated and stored in the file. | ||
143 | +! | ||
144 | +! read the order of the T matrix and broadcast to the processors. | ||
145 | +! | ||
146 | + if(rank.eq.0) then | ||
147 | + open(3,file=tmatrixfile) | ||
148 | + read(3,*) nodrt | ||
149 | + close(3) | ||
150 | + write(runprintunit,'('' t matrix order:'',i5)') nodrt | ||
151 | + call flush(runprintunit) | ||
152 | + endif | ||
153 | + nodrta(1)=nodrt | ||
154 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_i=nodrta,mpi_number=1,mpi_rank=0) | ||
155 | + nodrt=nodrta(1) | ||
156 | + call ms_mpi(mpi_command='barrier') | ||
157 | + endif | ||
158 | +! | ||
159 | +! the T matrix is available; calculate the random orientation scattering matrix | ||
160 | +! | ||
161 | + nblkt=nodrt*(nodrt+2) | ||
162 | + nodrg=nodrt*2 | ||
163 | + allocate(smc(4,4,0:nodrg)) | ||
164 | + call ranorientscatmatrix(xv,nsphere,nodrt,nodrg,cbeam,tmatrixfile,smc,qext, & | ||
165 | + qabs,qsca) | ||
166 | + if(rank.eq.0) then | ||
167 | + qexttot=sum(qext(:,1)*xsp*xsp)/xv/xv | ||
168 | + qabstot=sum(qabs(:,1)*xsp*xsp)/xv/xv | ||
169 | + qscatot=qexttot-qabstot | ||
170 | + asymparm=dble(smc(1,1,1)/smc(1,1,0))/3.d0 | ||
171 | + call ranorienscatmatrixcalc(numtheta,theta1d,theta2d,1,smc,nodrg,smt) | ||
172 | + endif | ||
173 | + else | ||
174 | +! | ||
175 | +! fixed orientation option | ||
176 | +! | ||
177 | + call getrunparameters(calculate_scattering_coefficients=calcamn, & | ||
178 | + scattering_coefficient_file=amnfile, & | ||
179 | + scattering_plane_angle_deg=phideg, & | ||
180 | + incident_azimuth_angle_deg=alphadeg, & | ||
181 | + incident_polar_angle_deg=betadeg, & | ||
182 | + track_iterations=trackiterations) | ||
183 | + alpha=alphadeg*pi/180.d0 | ||
184 | + beta=betadeg*pi/180.d0 | ||
185 | + phi=phideg*pi/180.d0 | ||
186 | + allocate(amnp(neqns,2)) | ||
187 | + allocate(qext(nsphere,3), qabs(nsphere,3), qsca(nsphere,3)) | ||
188 | + if(calcamn.eq.1) then | ||
189 | +! | ||
190 | +! this option calculates the scattering coefficients | ||
191 | +! | ||
192 | + if(rank.eq.0) time1=mytime() | ||
193 | + call fixedorsoln(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,epssoln,& | ||
194 | + epstran,niter,amnp,qext,qabs,qsca,maxerr,maxiter,trackiterations, & | ||
195 | + fftranpresent,niterstep,istat) | ||
196 | +! | ||
197 | +! write the scattering coefficients to the file | ||
198 | +! | ||
199 | + if(rank.eq.0) then | ||
200 | + time2=mytime()-time1 | ||
201 | + write(runprintunit,'('' max iterations, soln error:'',i6,e13.5)') & | ||
202 | + maxiter,maxerr | ||
203 | + call timewrite(runprintunit,' execution time:',time2) | ||
204 | + open(3,file=amnfile) | ||
205 | + do i=1,nsphere | ||
206 | + write(3,'(6e13.5)') qext(i,:),qabs(i,:),qsca(i,:) | ||
207 | + allocate(amnp1(0:nodr(i)+1,nodr(i),2),amnp2(0:nodr(i)+1,nodr(i),2)) | ||
208 | + ip1=sphereoff(i)+1 | ||
209 | + ip2=sphereoff(i)+sphereblk(i) | ||
210 | + amnp1=reshape(amnp(ip1:ip2,1),(/nodr(i)+2,nodr(i),2/)) | ||
211 | + amnp2=reshape(amnp(ip1:ip2,2),(/nodr(i)+2,nodr(i),2/)) | ||
212 | + do n=1,nodr(i) | ||
213 | + do m=-n,n | ||
214 | + if(m.le.-1) then | ||
215 | + ma=n+1 | ||
216 | + na=-m | ||
217 | + else | ||
218 | + ma=m | ||
219 | + na=n | ||
220 | + endif | ||
221 | + write(3,'(4e17.9)') amnp1(ma,na,1),amnp2(ma,na,1) | ||
222 | + write(3,'(4e17.9)') amnp1(ma,na,2),amnp2(ma,na,2) | ||
223 | + enddo | ||
224 | + enddo | ||
225 | + deallocate(amnp1,amnp2) | ||
226 | + enddo | ||
227 | + close(3) | ||
228 | + endif | ||
229 | + else | ||
230 | +! | ||
231 | +! this option reads the scattering coefficients from the file | ||
232 | +! | ||
233 | + if(rank.eq.0) then | ||
234 | + open(3,file=amnfile) | ||
235 | + do i=1,nsphere | ||
236 | + read(3,'(6e13.5)') qext(i,:),qabs(i,:),qsca(i,:) | ||
237 | + allocate(amnp1(0:nodr(i)+1,nodr(i),2),amnp2(0:nodr(i)+1,nodr(i),2)) | ||
238 | + do n=1,nodr(i) | ||
239 | + do m=-n,n | ||
240 | + if(m.le.-1) then | ||
241 | + ma=n+1 | ||
242 | + na=-m | ||
243 | + else | ||
244 | + ma=m | ||
245 | + na=n | ||
246 | + endif | ||
247 | + read(3,'(4e17.9)') amnp1(ma,na,1),amnp2(ma,na,1) | ||
248 | + read(3,'(4e17.9)') amnp1(ma,na,2),amnp2(ma,na,2) | ||
249 | + enddo | ||
250 | + enddo | ||
251 | + ip1=sphereoff(i)+1 | ||
252 | + ip2=sphereoff(i)+sphereblk(i) | ||
253 | + amnp(ip1:ip2,1)=reshape(amnp1(0:nodr(i)+1,1:nodr(i),1:2),(/sphereblk(i)/)) | ||
254 | + amnp(ip1:ip2,2)=reshape(amnp2(0:nodr(i)+1,1:nodr(i),1:2),(/sphereblk(i)/)) | ||
255 | + deallocate(amnp1,amnp2) | ||
256 | + enddo | ||
257 | + close(3) | ||
258 | + endif | ||
259 | +! | ||
260 | +! broadcast the scattering coefficients to the other processors | ||
261 | +! | ||
262 | + nsend=neqns*2 | ||
263 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=amnp,mpi_number=nsend,mpi_rank=0) | ||
264 | + endif | ||
265 | +! | ||
266 | +! calculate the efficiency factors | ||
267 | +! | ||
268 | + | ||
269 | + cphi=cos(phi) | ||
270 | + sphi=sin(phi) | ||
271 | + qexttotpar=sum((qext(:,1)*cphi*cphi+2.d0*qext(:,3)*cphi*sphi+qext(:,2)*sphi*sphi) & | ||
272 | + *xsp*xsp)/xv/xv | ||
273 | + qexttotper=sum((qext(:,1)*sphi*sphi-2.d0*qext(:,3)*cphi*sphi+qext(:,2)*cphi*cphi) & | ||
274 | + *xsp*xsp)/xv/xv | ||
275 | + qabstotpar=sum((qabs(:,1)*cphi*cphi+2.d0*qabs(:,3)*cphi*sphi+qabs(:,2)*sphi*sphi) & | ||
276 | + *xsp*xsp)/xv/xv | ||
277 | + qabstotper=sum((qabs(:,1)*sphi*sphi-2.d0*qabs(:,3)*cphi*sphi+qabs(:,2)*cphi*cphi) & | ||
278 | + *xsp*xsp)/xv/xv | ||
279 | + qscatotpar=qexttotpar-qabstotpar | ||
280 | + qscatotper=qexttotper-qabstotper | ||
281 | + qexttot=(qexttotpar+qexttotper)*.5d0 | ||
282 | + qabstot=(qabstotpar+qabstotper)*.5d0 | ||
283 | + qscatot=(qscatotpar+qscatotper)*.5d0 | ||
284 | + qext(:,1)=(qext(:,1)+qext(:,2))*.5d0 | ||
285 | + qabs(:,1)=(qabs(:,1)+qabs(:,2))*.5d0 | ||
286 | + qsca(:,1)=(qsca(:,1)+qsca(:,2))*.5d0 | ||
287 | + call rottranmtrxclear() | ||
288 | +! | ||
289 | +! calculate the target-based expansion and rotate to the incident field frame | ||
290 | +! | ||
291 | + allocate(amnp0(0:nodrt+1,nodrt,2,2),pmnp0(0:nodrt+1,nodrt,2,2)) | ||
292 | + if(rank.eq.0) then | ||
293 | + do k=1,2 | ||
294 | + call amncommonorigin(neqns,nsphere,nodr,ntran,nodrt,rpos, & | ||
295 | + amnp(1:neqns,k),amnp0(0:,1:,1:,k)) | ||
296 | + call rotvec(alpha,beta,0.d0,nodrt,nodrt,amnp0(0:,1:,1:,k),1) | ||
297 | + enddo | ||
298 | + endif | ||
299 | + nsend=4*nodrt*(nodrt+2) | ||
300 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=amnp0,mpi_number=nsend,mpi_rank=0) | ||
301 | + | ||
302 | +! | ||
303 | +! calculate the asymmetry parameter and the scattering matrix | ||
304 | +! | ||
305 | + allocate(gmn(0:2)) | ||
306 | + call s11expansion(amnp0,nodrt,0,1,gmn) | ||
307 | + asymparm=dble(gmn(1)/gmn(0))/3.d0 | ||
308 | + do i=1,numtheta | ||
309 | + thetad=theta1d+(theta2d-theta1d)*(i-1)/max(1.d0,dble(numtheta-1)) | ||
310 | + costheta=cos(thetad*pi/180.d0) | ||
311 | + call scatteringmatrix(amnp0,nodrt,xv,costheta,phi,sa,smt(:,:,i)) | ||
312 | + enddo | ||
313 | + deallocate(amnp0,pmnp0,gmn) | ||
314 | + endif | ||
315 | +! | ||
316 | +! output file operations | ||
317 | +! | ||
318 | + if(rank.eq.0) then | ||
319 | + open(1,file=outfile,position='append') | ||
320 | + if(nonactive.eq.0) then | ||
321 | + write(1,'('' sphere S.P., pos. (x,y,z), ref. index (L,R), Qext, Qsca, Qabs, Qabs/Qabs,LM'')') | ||
322 | + else | ||
323 | + write(1,'('' sphere S.P., pos. (x,y,z), ref. index, Qext, Qsca, Qabs, Qabs/Qabs,LM'')') | ||
324 | + endif | ||
325 | + do i=1,nsphere | ||
326 | + call getmiedata(which_sphere=i,sphere_qabs=qabslm) | ||
327 | + if(dimag(ri(1,i)).eq.0.d0.and.dimag(ri(2,i)).eq.0.d0) then | ||
328 | + absrat=1.d0 | ||
329 | + else | ||
330 | + absrat=qabs(i,1)/qabslm | ||
331 | + endif | ||
332 | + if(nonactive.eq.0) then | ||
333 | + write(1,'(i5,4f10.4,4f10.6,3e13.5,f8.4)') i, xsp(i),rpos(:,i)+gbfocus, ri(:,i), & | ||
334 | + qext(i,1),qsca(i,1),qabs(i,1),absrat | ||
335 | + else | ||
336 | + write(1,'(i5,4f10.4,2f10.6,3e13.5,f8.4)') i, xsp(i),rpos(:,i)+gbfocus, ri(1,i), & | ||
337 | + qext(i,1),qsca(i,1),qabs(i,1),absrat | ||
338 | + endif | ||
339 | + enddo | ||
340 | + if(fixedorrandom.eq.1) then | ||
341 | + write(1,'('' total ext, abs, scat efficiencies, w.r.t. xv, and asym. parm'')') | ||
342 | + write(1,'(6e13.5)') qexttot,qabstot,qscatot,asymparm | ||
343 | + else | ||
344 | + write(1,'('' unpolarized total ext, abs, scat efficiencies, w.r.t. xv, and asym. parm'')') | ||
345 | + write(1,'(6e13.5)') qexttot,qabstot,qscatot,asymparm | ||
346 | + write(1,'('' parallel total ext, abs, scat efficiencies'')') | ||
347 | + write(1,'(6e13.5)') qexttotpar,qabstotpar,qscatotpar | ||
348 | + write(1,'('' perpendicular total ext, abs, scat efficiencies'')') | ||
349 | + write(1,'(6e13.5)') qexttotper,qabstotper,qscatotper | ||
350 | + endif | ||
351 | + | ||
352 | + write(1,'('' scattering matrix elements'')') | ||
353 | + if(normalizesm.eq.0) then | ||
354 | + write(1,'('' theta s11 s22 s33'',& | ||
355 | + &'' s44'',& | ||
356 | + &'' s21 s32 s43 s31'',& | ||
357 | + &'' s42 s41'')') | ||
358 | + do i=1,numtheta | ||
359 | + thetad=theta1d+(theta2d-theta1d)*(i-1)/max(1.d0,dble(numtheta-1)) | ||
360 | + write(1,'(f8.2,10e12.4)') thetad,smt(1,1,i),smt(2,2,i),smt(3,3,i), & | ||
361 | + smt(4,4,i),smt(1,2,i),smt(2,3,i),smt(3,4,i),smt(1,3,i), & | ||
362 | + smt(2,4,i),smt(1,4,i) | ||
363 | + enddo | ||
364 | + else | ||
365 | + write(1,'('' theta s11 s22/s11 s33'',& | ||
366 | + &''/s11 s44'',& | ||
367 | + &''/s11 s21/s11 s32/s11 s43/s11 s31'',& | ||
368 | + &''/s11 s42/s11 s41/s11'')') | ||
369 | + do i=1,numtheta | ||
370 | + thetad=theta1d+(theta2d-theta1d)*(i-1)/max(1.d0,dble(numtheta-1)) | ||
371 | + s11=smt(1,1,i) | ||
372 | + write(1,'(f8.2,10e12.4)') thetad,smt(1,1,i),smt(2,2,i)/s11,smt(3,3,i)/s11, & | ||
373 | + smt(4,4,i)/s11,smt(1,2,i)/s11,smt(2,3,i)/s11,smt(3,4,i)/s11,smt(1,3,i)/s11, & | ||
374 | + smt(2,4,i)/s11,smt(1,4,i)/s11 | ||
375 | + enddo | ||
376 | + endif | ||
377 | + if(fixedorrandom.eq.1) then | ||
378 | + write(1,'('' scattering matrix expansion coefficients'')') | ||
379 | + write(1,'('' w a11 a22 a33 '',& | ||
380 | + &''a23 a32 a44 a12 '',& | ||
381 | + &''a34 a13 a24 a14'')') | ||
382 | + do w=0,nodrg | ||
383 | + write(1,'(i5,11e12.4)') w,smc(1,1,w),smc(2,2,w),& | ||
384 | + smc(3,3,w),smc(2,3,w),smc(3,2,w),smc(4,4,w),& | ||
385 | + smc(1,2,w),smc(3,4,w),smc(1,3,w),smc(2,4,w),& | ||
386 | + smc(1,4,w) | ||
387 | + enddo | ||
388 | + endif | ||
389 | + endif | ||
390 | +! | ||
391 | +! near field calculation options | ||
392 | +! | ||
393 | + if(fixedorrandom.eq.0) call getrunparameters(calculate_near_field=calcnf) | ||
394 | + if(fixedorrandom.eq.0.and.calcnf.eq.1) then | ||
395 | + call getrunparameters(near_field_plane_coord=nfplane, & | ||
396 | + near_field_plane_position=nfplanepos,near_field_plane_vertices=nfplanevert, & | ||
397 | + spacial_step_size=deltax,polarization_angle_deg=gammadeg, & | ||
398 | + near_field_output_file=nfoutfile,near_field_output_data=nfoutdata, & | ||
399 | + plane_wave_epsilon=epspw) | ||
400 | + nfoutunit=2 | ||
401 | + if(rank.eq.0) then | ||
402 | + open(nfoutunit,file=nfoutfile) | ||
403 | + endif | ||
404 | + gamma=gammadeg*pi/180.d0 | ||
405 | + call nearfieldgridcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
406 | + nfplane,nfplanepos,nfplanevert,gbfocus,deltax,gamma,nfoutunit,epspw, & | ||
407 | + nfoutdata,runprintunit) | ||
408 | + if(rank.eq.0) then | ||
409 | + close(nfoutunit) | ||
410 | + endif | ||
411 | + endif | ||
412 | +! | ||
413 | +! all done! | ||
414 | +! | ||
415 | + if(rank.eq.0) close(1) | ||
416 | + call ms_mpi(mpi_command='finalize') | ||
417 | + end |
No preview for this file type
1 | +++ a/mstm-modules-v2.2.f90 | ||
1 | +! | ||
2 | +! numerical constants | ||
3 | +! | ||
4 | +! | ||
5 | +! last revised: 15 January 2011 | ||
6 | +! | ||
7 | + module numconstants | ||
8 | + implicit none | ||
9 | + integer :: print_intermediate_results | ||
10 | + integer, allocatable :: monen(:) | ||
11 | + integer, private :: nmax=0 | ||
12 | + real(8) :: pi | ||
13 | + real(8), allocatable :: bcof(:,:),fnr(:),vwh_coef(:,:,:,:) | ||
14 | + real(8), allocatable :: vcc_const(:,:,:),fnm1_const(:,:),fn_const(:,:),fnp1_const(:,:) | ||
15 | + data pi/3.141592653589793/ | ||
16 | + | ||
17 | + contains | ||
18 | + | ||
19 | + subroutine init(notd) | ||
20 | + implicit none | ||
21 | + integer :: notd,l,n,ierr,nbc,m,mm1,mp1,np1,nm1,nn1,mn | ||
22 | + real(8) :: fnorm1,fnorm2 | ||
23 | +! | ||
24 | +! bcof(n,l)=((n+l)!/(n!l!))^(1/2) | ||
25 | +! | ||
26 | + if(notd.le.nmax) return | ||
27 | + nmax=max(nmax,notd) | ||
28 | + nbc=6*notd+6 | ||
29 | + if(allocated(fnr)) deallocate(monen,fnr,bcof) | ||
30 | + allocate (monen(0:2*notd),bcof(0:nbc,0:nbc),fnr(0:2*nbc),stat=ierr) | ||
31 | +! write(*,'('' nmax, bcof status:'',2i5)') nmax,ierr | ||
32 | + do n=0,2*notd | ||
33 | + monen(n)=(-1)**n | ||
34 | + enddo | ||
35 | + fnr(0)=0.d0 | ||
36 | + do n=1,2*nbc | ||
37 | + fnr(n)=dsqrt(dble(n)) | ||
38 | + enddo | ||
39 | + bcof(0,0)=1.d0 | ||
40 | + do n=0,nbc-1 | ||
41 | + do l=n+1,nbc | ||
42 | + bcof(n,l)=fnr(n+l)*bcof(n,l-1)/fnr(l) | ||
43 | + bcof(l,n)=bcof(n,l) | ||
44 | + enddo | ||
45 | + bcof(n+1,n+1)=fnr(n+n+2)*fnr(n+n+1)*bcof(n,n)/fnr(n+1)/fnr(n+1) | ||
46 | + enddo | ||
47 | + if(allocated(vwh_coef)) deallocate(vwh_coef) | ||
48 | + allocate(vwh_coef(-notd:notd,1:notd,-1:1,-1:1)) | ||
49 | +! | ||
50 | +! constants used for calculation of svwf functions. | ||
51 | +! | ||
52 | + do n=1,notd | ||
53 | + nn1=n*(n+1) | ||
54 | + np1=n+1 | ||
55 | + nm1=n-1 | ||
56 | + fnorm1=-.5d0/fnr(n+n+1)/fnr(n)/fnr(n+1) | ||
57 | + fnorm2=-.5d0*fnr(n+n+1)/fnr(n)/fnr(n+1) | ||
58 | + m=-n | ||
59 | + mp1=m+1 | ||
60 | + mm1=m-1 | ||
61 | + vwh_coef(m,n, 1, 1)=-fnorm1*n*fnr(np1+m)*fnr(np1+mp1) | ||
62 | + vwh_coef(m,n, 1,-1)=fnorm1*np1*fnr(n-m)*fnr(nm1-m) | ||
63 | + vwh_coef(m,n,-1, 1)=fnorm1*n*fnr(np1-m)*fnr(np1-mm1) | ||
64 | + vwh_coef(m,n,-1,-1)=0.d0 | ||
65 | + vwh_coef(m,n, 0, 1)=fnorm1*n*fnr(np1+m)*fnr(np1-m) | ||
66 | + vwh_coef(m,n, 0,-1)=0.d0 | ||
67 | + vwh_coef(m,n, 1, 0)=-fnorm2*fnr(n-m)*fnr(np1+m) | ||
68 | + vwh_coef(m,n,-1, 0)=-0.d0 | ||
69 | + vwh_coef(m,n, 0, 0)=-fnorm2*m | ||
70 | + do m=-n+1,-1 | ||
71 | + mp1=m+1 | ||
72 | + mm1=m-1 | ||
73 | + vwh_coef(m,n, 1, 1)=-fnorm1*n*fnr(np1+m)*fnr(np1+mp1) | ||
74 | + vwh_coef(m,n, 1,-1)=fnorm1*np1*fnr(n-m)*fnr(nm1-m) | ||
75 | + vwh_coef(m,n,-1, 1)=fnorm1*n*fnr(np1-m)*fnr(np1-mm1) | ||
76 | + vwh_coef(m,n,-1,-1)=-fnorm1*np1*fnr(n+m)*fnr(nm1+m) | ||
77 | + vwh_coef(m,n, 0, 1)=fnorm1*n*fnr(np1+m)*fnr(np1-m) | ||
78 | + vwh_coef(m,n, 0,-1)=fnorm1*np1*fnr(n+m)*fnr(n-m) | ||
79 | + vwh_coef(m,n, 1, 0)=-fnorm2*fnr(n-m)*fnr(np1+m) | ||
80 | + vwh_coef(m,n,-1, 0)=-fnorm2*fnr(n+m)*fnr(np1-m) | ||
81 | + vwh_coef(m,n, 0, 0)=-fnorm2*m | ||
82 | + enddo | ||
83 | + do m=0,n-1 | ||
84 | + mp1=m+1 | ||
85 | + mm1=m-1 | ||
86 | + vwh_coef(m,n, 1, 1)=-fnorm1*n*fnr(np1+m)*fnr(np1+mp1) | ||
87 | + vwh_coef(m,n, 1,-1)=fnorm1*np1*fnr(n-m)*fnr(nm1-m) | ||
88 | + vwh_coef(m,n,-1, 1)=fnorm1*n*fnr(np1-m)*fnr(np1-mm1) | ||
89 | + vwh_coef(m,n,-1,-1)=-fnorm1*np1*fnr(n+m)*fnr(nm1+m) | ||
90 | + vwh_coef(m,n, 0, 1)=fnorm1*n*fnr(np1+m)*fnr(np1-m) | ||
91 | + vwh_coef(m,n, 0,-1)=fnorm1*np1*fnr(n+m)*fnr(n-m) | ||
92 | + vwh_coef(m,n, 1, 0)=-fnorm2*fnr(n-m)*fnr(np1+m) | ||
93 | + vwh_coef(m,n,-1, 0)=-fnorm2*fnr(n+m)*fnr(np1-m) | ||
94 | + vwh_coef(m,n, 0, 0)=-fnorm2*m | ||
95 | + enddo | ||
96 | + m=n | ||
97 | + mp1=m+1 | ||
98 | + mm1=m-1 | ||
99 | + vwh_coef(m,n, 1, 1)=-fnorm1*n*fnr(np1+m)*fnr(np1+mp1) | ||
100 | + vwh_coef(m,n, 1,-1)=0.d0 | ||
101 | + vwh_coef(m,n,-1, 1)=fnorm1*n*fnr(np1-m)*fnr(np1-mm1) | ||
102 | + vwh_coef(m,n,-1,-1)=-fnorm1*np1*fnr(n+m)*fnr(nm1+m) | ||
103 | + vwh_coef(m,n, 0, 1)=fnorm1*n*fnr(np1+m)*fnr(np1-m) | ||
104 | + vwh_coef(m,n, 0,-1)=0.d0 | ||
105 | + vwh_coef(m,n, 1, 0)=-0.d0 | ||
106 | + vwh_coef(m,n,-1, 0)=-fnorm2*fnr(n+m)*fnr(np1-m) | ||
107 | + vwh_coef(m,n, 0, 0)=-fnorm2*m | ||
108 | + enddo | ||
109 | + end subroutine init | ||
110 | + | ||
111 | + end module numconstants | ||
112 | +! | ||
113 | +! special function for the multiple sphere problem | ||
114 | +! | ||
115 | + module specialfuncs | ||
116 | + implicit none | ||
117 | + contains | ||
118 | + | ||
119 | + subroutine timewrite(iunit,char1,time) | ||
120 | + use intrinsics | ||
121 | + implicit none | ||
122 | + integer :: iunit | ||
123 | + real(8) :: time,time2 | ||
124 | + character(*) :: char1 | ||
125 | + if(time.gt.3600.d0) then | ||
126 | + time2=time/3600.d0 | ||
127 | + write(iunit,'(a,f9.3,'' hours'')') char1,time2 | ||
128 | + elseif(time.gt.60.d0) then | ||
129 | + time2=time/60.d0 | ||
130 | + write(iunit,'(a,f9.2,'' min'')') char1,time2 | ||
131 | + else | ||
132 | + write(iunit,'(a,f9.2,'' sec'')') char1,time | ||
133 | + endif | ||
134 | + call flush(iunit) | ||
135 | + end subroutine timewrite | ||
136 | +! | ||
137 | +! ricatti-bessel function psi(n), real argument | ||
138 | +! | ||
139 | + subroutine ricbessel(n,ds,eps,nmax,psi) | ||
140 | + implicit none | ||
141 | + integer :: n,nmax,ns,i | ||
142 | + real(8) :: ds,dns,sn,psi(0:n),psit,ds2,sum,eps,err | ||
143 | + if(int(ds).lt.n) then | ||
144 | + ns=nint(ds+4.*(ds**.3333d0)+17) | ||
145 | + ns=max(n+10,ns) | ||
146 | + dns=0.d0 | ||
147 | + do i=ns-1,n,-1 | ||
148 | + sn=dble(i+1)/ds | ||
149 | + dns=sn-1.d0/(dns+sn) | ||
150 | + enddo | ||
151 | + psi(n)=dns | ||
152 | + psi(n-1)=dble(n)/ds-1.d0/(dns+dble(n)/ds) | ||
153 | + do i=n-2,1,-1 | ||
154 | + sn=dble(i+1)/ds | ||
155 | + psi(i)=sn-1.d0/(psi(i+1)+sn) | ||
156 | + enddo | ||
157 | + psit=dsin(ds) | ||
158 | + psi(0)=psit | ||
159 | + ds2=ds*ds | ||
160 | + sum=psit*psit/ds2 | ||
161 | + do i=1,n | ||
162 | + psit=psit/(dble(i)/ds+psi(i)) | ||
163 | + sum=sum+dble(i+i+1)*psit*psit/ds2 | ||
164 | + err=dabs(1.d0-sum) | ||
165 | + psi(i)=psit | ||
166 | + if(err.lt.eps) then | ||
167 | + nmax=i | ||
168 | + return | ||
169 | + endif | ||
170 | + enddo | ||
171 | + nmax=n | ||
172 | + else | ||
173 | + psi(0)=dsin(ds) | ||
174 | + psi(1)=psi(0)/ds-dcos(ds) | ||
175 | + do i=1,n-1 | ||
176 | + sn=dble(i+i+1)/ds | ||
177 | + psi(i+1)=sn*psi(i)-psi(i-1) | ||
178 | + enddo | ||
179 | + nmax=n | ||
180 | + endif | ||
181 | + end subroutine ricbessel | ||
182 | +! | ||
183 | +! ricatti-hankel function xi(n), real argument | ||
184 | +! | ||
185 | +! | ||
186 | +! last revised: 15 January 2011 | ||
187 | +! | ||
188 | + subroutine richankel(n,ds,xi) | ||
189 | + implicit none | ||
190 | + integer :: n,i,ns | ||
191 | + real(8) :: ds,dns,sn,chi0,chi1,chi2,psi,psi0,psi1 | ||
192 | + complex(8) :: xi(0:n) | ||
193 | + if(int(ds).lt.n) then | ||
194 | + ns=nint(ds+4.*(ds**.3333)+17) | ||
195 | + ns=max(n+10,ns) | ||
196 | + dns=0.d0 | ||
197 | + do i=ns-1,n,-1 | ||
198 | + sn=dble(i+1)/ds | ||
199 | + dns=sn-1.d0/(dns+sn) | ||
200 | + enddo | ||
201 | + xi(n)=dns | ||
202 | + xi(n-1)=dble(n)/ds-1.d0/(dns+dble(n)/ds) | ||
203 | + do i=n-2,1,-1 | ||
204 | + sn=dble(i+1)/ds | ||
205 | + xi(i)=sn-1.d0/(xi(i+1)+sn) | ||
206 | + enddo | ||
207 | + chi0=-dcos(ds) | ||
208 | + psi=dsin(ds) | ||
209 | + chi1=chi0/ds-psi | ||
210 | + xi(0)=dcmplx(psi,chi0) | ||
211 | + do i=1,n | ||
212 | + chi2=dble(i+i+1)/ds*chi1-chi0 | ||
213 | + psi=psi/(dble(i)/ds+xi(i)) | ||
214 | + xi(i)=dcmplx(psi,chi1) | ||
215 | + chi0=chi1 | ||
216 | + chi1=chi2 | ||
217 | + enddo | ||
218 | + return | ||
219 | + else | ||
220 | + chi0=-dcos(ds) | ||
221 | + psi0=dsin(ds) | ||
222 | + chi1=chi0/ds-psi0 | ||
223 | + psi1=psi0/ds+chi0 | ||
224 | + xi(0)=dcmplx(psi0,chi0) | ||
225 | + xi(1)=dcmplx(psi1,chi1) | ||
226 | + do i=1,n-1 | ||
227 | + sn=dble(i+i+1)/ds | ||
228 | + xi(i+1)=sn*xi(i)-xi(i-1) | ||
229 | + enddo | ||
230 | + return | ||
231 | + endif | ||
232 | + end subroutine richankel | ||
233 | +! | ||
234 | +! ricatti-bessel function psi(n), complex argument | ||
235 | +! | ||
236 | +! | ||
237 | +! last revised: 15 January 2011 | ||
238 | +! | ||
239 | + subroutine cricbessel(n,ds,psi) | ||
240 | + implicit none | ||
241 | + integer :: n,i | ||
242 | + complex(8) :: ds,psi(0:n),chi(0:n) | ||
243 | + call cspherebessel(n,ds,psi,chi) | ||
244 | + do i=0,n | ||
245 | + psi(i)=psi(i)*ds | ||
246 | + enddo | ||
247 | + return | ||
248 | + end subroutine cricbessel | ||
249 | +! | ||
250 | +! ricatti-hankel function psi(n), complex argument | ||
251 | +! | ||
252 | +! | ||
253 | +! last revised: 15 January 2011 | ||
254 | +! 7 october 2011: forces upwards recurrence for real argument ds | ||
255 | +! | ||
256 | + subroutine crichankel(n,ds,xi) | ||
257 | + implicit none | ||
258 | + integer :: n,i,i1 | ||
259 | + complex(8) :: ds,psi(0:n),chi(0:n),xi(0:n),ci | ||
260 | + data ci/(0.d0,1.d0)/ | ||
261 | + xi(0)=-ci*cdexp(ci*ds) | ||
262 | + xi(1)=-cdexp(ci*ds)*(ci+ds)/ds | ||
263 | + if(dimag(ds).eq.0.d0) then | ||
264 | + do i=1,n-1 | ||
265 | + i1=i+1 | ||
266 | + xi(i1)=dble(i+i1)/ds*xi(i)-xi(i-1) | ||
267 | + enddo | ||
268 | + return | ||
269 | + endif | ||
270 | + if(cdabs(xi(0)).lt.1.d-10) then | ||
271 | + do i=1,n-1 | ||
272 | + i1=i+1 | ||
273 | + xi(i1)=dble(i+i1)/ds*xi(i)-xi(i-1) | ||
274 | + enddo | ||
275 | + return | ||
276 | + else | ||
277 | + call cspherebessel(n,ds,psi,chi) | ||
278 | + do i=1,n-1 | ||
279 | + i1=i+1 | ||
280 | + xi(i1)=(psi(i1)+ci*chi(i1))*ds | ||
281 | + enddo | ||
282 | + return | ||
283 | + endif | ||
284 | + end subroutine crichankel | ||
285 | +! | ||
286 | +! ========================================================== | ||
287 | +! Purpose: Compute spherical Bessel functions jn(z) & yn(z) | ||
288 | +! for a complex argument | ||
289 | +! Input : z --- Complex argument | ||
290 | +! n --- Order of jn(z) & yn(z) ( n = 0,1,2,... ) | ||
291 | +! Output: CSJ(n) --- jn(z) | ||
292 | +! CSY(n) --- yn(z) | ||
293 | +! NM --- Highest order computed | ||
294 | +! Routines called: | ||
295 | +! MSTA1 and MSTA2 for computing the starting | ||
296 | +! point for backward recurrence | ||
297 | +! ========================================================== | ||
298 | +! | ||
299 | +! obtained from, and copywrited by, Jian-Ming Jin | ||
300 | +! http://jin.ece.uiuc.edu/ | ||
301 | +! | ||
302 | +! | ||
303 | +! last revised: 15 January 2011 | ||
304 | +! | ||
305 | + subroutine cspherebessel(n,z,csj,csy) | ||
306 | + implicit none | ||
307 | + integer :: n,nm,k,m | ||
308 | + real(8) :: a0 | ||
309 | + complex(8) :: z,csj(0:n),csy(0:n),csa,csb,cs,cf0,cf1,cf | ||
310 | + a0=cdabs(z) | ||
311 | + nm=n | ||
312 | + if (a0.lt.1.0d-60) then | ||
313 | + csj=(0.d0,0.d0) | ||
314 | + csy=(-1.d300,0.d0) | ||
315 | + csy(0)=(1.d0,0.d0) | ||
316 | + return | ||
317 | + endif | ||
318 | + csj=(0.d0,0.d0) | ||
319 | + csj(0)=cdsin(z)/z | ||
320 | + csj(1)=(csj(0)-cdcos(z))/z | ||
321 | + if (n.ge.2) then | ||
322 | + csa=csj(0) | ||
323 | + csb=csj(1) | ||
324 | + m=msta1(a0,200) | ||
325 | + if (m.lt.n) then | ||
326 | + nm=m | ||
327 | + else | ||
328 | + m=msta2(a0,n,15) | ||
329 | + endif | ||
330 | + cf0=0.0d0 | ||
331 | + cf1=1.0d0-100 | ||
332 | + do k=m,0,-1 | ||
333 | + cf=(2.0d0*k+3.0d0)*cf1/z-cf0 | ||
334 | + if (k.le.nm) csj(k)=cf | ||
335 | + cf0=cf1 | ||
336 | + cf1=cf | ||
337 | + enddo | ||
338 | + if (cdabs(csa).gt.cdabs(csb)) cs=csa/cf | ||
339 | + if (cdabs(csa).le.cdabs(csb)) cs=csb/cf0 | ||
340 | + do k=0,min(nm,n) | ||
341 | + csj(k)=cs*csj(k) | ||
342 | + enddo | ||
343 | + endif | ||
344 | + csy=(1.d200,0.d0) | ||
345 | + csy(0)=-cdcos(z)/z | ||
346 | + csy(1)=(csy(0)-cdsin(z))/z | ||
347 | + do k=2,min(nm,n) | ||
348 | + if (cdabs(csj(k-1)).gt.cdabs(csj(k-2))) then | ||
349 | + csy(k)=(csj(k)*csy(k-1)-1.0d0/(z*z))/csj(k-1) | ||
350 | + else | ||
351 | + csy(k)=(csj(k)*csy(k-2)-(2.0d0*k-1.0d0)/z**3)/csj(k-2) | ||
352 | + endif | ||
353 | + enddo | ||
354 | + end subroutine cspherebessel | ||
355 | +! | ||
356 | +! =================================================== | ||
357 | +! Purpose: Determine the starting point for backward | ||
358 | +! recurrence such that the magnitude of | ||
359 | +! Jn(x) at that point is about 10^(-MP) | ||
360 | +! Input : x --- Argument of Jn(x) | ||
361 | +! MP --- Value of magnitude | ||
362 | +! Output: MSTA1 --- Starting point | ||
363 | +! =================================================== | ||
364 | +! | ||
365 | +! | ||
366 | +! last revised: 15 January 2011 | ||
367 | +! | ||
368 | + integer function msta1(x,mp) | ||
369 | + implicit none | ||
370 | + integer :: mp,n0,n1,it,nn | ||
371 | + real(8) :: x, a0,f1,f,f0 | ||
372 | + a0=dabs(x) | ||
373 | + n0=int(1.1*a0)+1 | ||
374 | + f0=envj(n0,a0)-mp | ||
375 | + n1=n0+5 | ||
376 | + f1=envj(n1,a0)-mp | ||
377 | + do it=1,20 | ||
378 | + nn=n1-(n1-n0)/(1.0d0-f0/f1) | ||
379 | + f=envj(nn,a0)-mp | ||
380 | + if(abs(nn-n1).lt.1) exit | ||
381 | + n0=n1 | ||
382 | + f0=f1 | ||
383 | + n1=nn | ||
384 | + f1=f | ||
385 | + enddo | ||
386 | + msta1=nn | ||
387 | + end function msta1 | ||
388 | +! | ||
389 | +! =================================================== | ||
390 | +! Purpose: Determine the starting point for backward | ||
391 | +! recurrence such that all Jn(x) has MP | ||
392 | +! significant digits | ||
393 | +! Input : x --- Argument of Jn(x) | ||
394 | +! n --- Order of Jn(x) | ||
395 | +! MP --- Significant digit | ||
396 | +! Output: MSTA2 --- Starting point | ||
397 | +! =================================================== | ||
398 | +! | ||
399 | +! | ||
400 | +! last revised: 15 January 2011 | ||
401 | +! | ||
402 | + integer function msta2(x,n,mp) | ||
403 | + implicit none | ||
404 | + integer :: n,mp,n0,n1,it,nn | ||
405 | + real(8) :: x,a0,hmp,ejn,obj,f0,f1,f | ||
406 | + a0=dabs(x) | ||
407 | + hmp=0.5d0*dble(mp) | ||
408 | + ejn=envj(n,a0) | ||
409 | + if (ejn.le.hmp) then | ||
410 | + obj=mp | ||
411 | + n0=int(1.1*a0) | ||
412 | + else | ||
413 | + obj=hmp+ejn | ||
414 | + n0=n | ||
415 | + endif | ||
416 | + f0=envj(n0,a0)-obj | ||
417 | + n1=n0+5 | ||
418 | + f1=envj(n1,a0)-obj | ||
419 | + do it=1,20 | ||
420 | + nn=n1-(n1-n0)/(1.0d0-f0/f1) | ||
421 | + f=envj(nn,a0)-obj | ||
422 | + if (abs(nn-n1).lt.1) exit | ||
423 | + n0=n1 | ||
424 | + f0=f1 | ||
425 | + n1=nn | ||
426 | + f1=f | ||
427 | + enddo | ||
428 | + msta2=nn+10 | ||
429 | + end function msta2 | ||
430 | + | ||
431 | + real(8) function envj(n,x) | ||
432 | + implicit none | ||
433 | + integer :: n | ||
434 | + real(8) :: x | ||
435 | + n=max(1,abs(n)) | ||
436 | + envj=0.5d0*dlog10(6.28d0*n)-n*dlog10(1.36d0*x/n) | ||
437 | + end function envj | ||
438 | +! | ||
439 | +! vector coupling coefficients vc(w) = C(m,n|k,l|m+k,w), w = |n-l|,... n+l | ||
440 | +! uses downwards and upwards recurrence | ||
441 | +! | ||
442 | +! | ||
443 | +! last revised: 15 January 2011 | ||
444 | +! | ||
445 | + subroutine vcfunc(m,n,k,l,vcn) | ||
446 | + use numconstants | ||
447 | + implicit none | ||
448 | + integer :: m,n,k,l,wmax,wmin,w,mk | ||
449 | + real(8) :: vcn(0:n+l),t1,t2,t3,vcmax,vctest,rat | ||
450 | + vcn=0.d0 | ||
451 | + wmax=n+l | ||
452 | + wmin=max(abs(n-l),abs(m+k)) | ||
453 | + vcn(wmax)=bcof(n+m,l+k)*bcof(n-m,l-k)/bcof(n+n,l+l) | ||
454 | + if(wmin.eq.wmax) return | ||
455 | + vcn(wmax-1)=vcn(wmax)*(l*m-k*n)*fnr(2*(l+n)-1)/fnr(l)/fnr(n)& | ||
456 | + & /fnr(n+l+m+k)/fnr(n+l-m-k) | ||
457 | + if(wmin.eq.wmax-1) return | ||
458 | + mk=m+k | ||
459 | + vcmax=abs(vcn(wmax))+abs(vcn(wmax-1)) | ||
460 | +! | ||
461 | +! a downwards recurrence is used initially | ||
462 | +! | ||
463 | + do w=wmax,wmin+2,-1 | ||
464 | + t1=2*w*fnr(w+w+1)*fnr(w+w-1)/(fnr(w+mk)*fnr(w-mk)& | ||
465 | + & *fnr(n-l+w)*fnr(l-n+w)*fnr(n+l-w+1)*fnr(n+l+w+1)) | ||
466 | + t2=dble((m-k)*w*(w-1)-mk*n*(n+1)+mk*l*(l+1))& | ||
467 | + & /dble(2*w*(w-1)) | ||
468 | + t3=fnr(w-mk-1)*fnr(w+mk-1)*fnr(l-n+w-1)*fnr(n-l+w-1)& | ||
469 | + & *fnr(n+l-w+2)*fnr(n+l+w)/(dble(2*(w-1))*fnr(2*w-3)& | ||
470 | + & *fnr(2*w-1)) | ||
471 | + vcn(w-2)=(t2*vcn(w-1)-vcn(w)/t1)/t3 | ||
472 | + if(mod(wmax-w,2).eq.1) then | ||
473 | + vctest=abs(vcn(w-2))+abs(vcn(w-1)) | ||
474 | + vcmax=max(vcmax,vctest) | ||
475 | + rat=vctest/vcmax | ||
476 | +! | ||
477 | +! if/when the coefficients start to decrease in magnitude, an upwards recurrence takes over | ||
478 | +! | ||
479 | + if(rat.lt.0.01d0) exit | ||
480 | + endif | ||
481 | + enddo | ||
482 | + if(w-2.gt.wmin) then | ||
483 | + wmax=w-3 | ||
484 | + call vcfuncuprec(m,n,k,l,wmax,vcn) | ||
485 | + endif | ||
486 | + end subroutine vcfunc | ||
487 | +! | ||
488 | +! upwards VC coefficient recurrence | ||
489 | +! | ||
490 | +! | ||
491 | +! last revised: 15 January 2011 | ||
492 | +! | ||
493 | + subroutine vcfuncuprec(m,n,k,l,wmax,vcn) | ||
494 | + use numconstants | ||
495 | + implicit none | ||
496 | + integer :: m,n,k,l,wmax,wmin,w,mk,nl,m1,n1,l1,k1,w1,w2 | ||
497 | + real(8) :: vcn(0:n+l),t1,t2,t3,vc1 | ||
498 | + mk=abs(m+k) | ||
499 | + nl=abs(n-l) | ||
500 | + if(nl.ge.mk) then | ||
501 | + w=nl | ||
502 | + if(n.ge.l) then | ||
503 | + m1=m | ||
504 | + n1=n | ||
505 | + l1=l | ||
506 | + k1=k | ||
507 | + else | ||
508 | + m1=k | ||
509 | + n1=l | ||
510 | + k1=m | ||
511 | + l1=n | ||
512 | + endif | ||
513 | + vc1=(-1)**(k1+l1)*bcof(l1+k1,w-m1-k1) & | ||
514 | + *bcof(l1-k1,w+m1+k1)/bcof(l1+l1,w+w+1) | ||
515 | + else | ||
516 | + w=mk | ||
517 | + if(m+k.ge.0) then | ||
518 | + vc1=(-1)**(n+m)*bcof(n-l+w,l-k)*bcof(l-n+w,n-m) & | ||
519 | + /bcof(w+w+1,n+l-w) | ||
520 | + else | ||
521 | + vc1=(-1)**(l+k)*bcof(n-l+w,l+k)*bcof(l-n+w,n+m) & | ||
522 | + /bcof(w+w+1,n+l-w) | ||
523 | + endif | ||
524 | + endif | ||
525 | + w1=w | ||
526 | + vcn(w)=vc1 | ||
527 | + w=w1+1 | ||
528 | + mk=m+k | ||
529 | + w2=min(wmax,n+l) | ||
530 | + if(w2.gt.w1) then | ||
531 | + t1=2*w*fnr(w+w+1)*fnr(w+w-1)/(fnr(w+mk)*fnr(w-mk) & | ||
532 | + *fnr(n-l+w)*fnr(l-n+w)*fnr(n+l-w+1)*fnr(n+l+w+1)) | ||
533 | + if(w1.eq.0) then | ||
534 | + t2=.5*dble(m-k) | ||
535 | + else | ||
536 | + t2=dble((m-k)*w*(w-1)-mk*n*(n+1)+mk*l*(l+1)) & | ||
537 | + /dble(2*w*(w-1)) | ||
538 | + endif | ||
539 | + vcn(w)=t1*t2*vcn(w1) | ||
540 | + endif | ||
541 | + do w=w1+2,w2 | ||
542 | + t1=2*w*fnr(w+w+1)*fnr(w+w-1)/(fnr(w+mk)*fnr(w-mk) & | ||
543 | + *fnr(n-l+w)*fnr(l-n+w)*fnr(n+l-w+1)*fnr(n+l+w+1)) | ||
544 | + t2=dble((m-k)*w*(w-1)-mk*n*(n+1)+mk*l*(l+1)) & | ||
545 | + /dble(2*w*(w-1)) | ||
546 | + t3=fnr(w-mk-1)*fnr(w+mk-1)*fnr(l-n+w-1)*fnr(n-l+w-1) & | ||
547 | + *fnr(n+l-w+2)*fnr(n+l+w)/(dble(2*(w-1))*fnr(2*w-3) & | ||
548 | + *fnr(2*w-1)) | ||
549 | + vcn(w)=t1*(t2*vcn(w-1)-t3*vcn(w-2)) | ||
550 | + enddo | ||
551 | + end subroutine vcfuncuprec | ||
552 | +! | ||
553 | +! Normalized associated legendre functions | ||
554 | +! | ||
555 | +! | ||
556 | +! last revised: 15 January 2011 | ||
557 | +! | ||
558 | + subroutine normalizedlegendre(cbe,mmax,nmax,dc) | ||
559 | + use numconstants | ||
560 | + implicit none | ||
561 | + integer :: nmax,mmax,m,n,np1,nm1,im | ||
562 | + real(8) :: dc(-mmax:mmax,0:nmax),cbe,sbe | ||
563 | + sbe=dsqrt((1.d0+cbe)*(1.d0-cbe)) | ||
564 | + dc=0.d0 | ||
565 | + do m=0,mmax | ||
566 | + dc(m,m)=(-1)**m*(0.5d0*sbe)**m*bcof(m,m) | ||
567 | + if(m.eq.nmax) exit | ||
568 | + dc(m,m+1)=fnr(m+m+1)*cbe*dc(m,m) | ||
569 | + do n=m+1,nmax-1 | ||
570 | + dc(m,n+1)=(-fnr(n-m)*fnr(n+m)*dc(m,n-1)+dble(n+n+1)*cbe*dc(m,n)) & | ||
571 | + /(fnr(n+1-m)*fnr(n+1+m)) | ||
572 | + enddo | ||
573 | + enddo | ||
574 | + do m=1,mmax | ||
575 | + im=(-1)**m | ||
576 | + do n=m,nmax | ||
577 | + dc(-m,n)=im*dc(m,n) | ||
578 | + enddo | ||
579 | + enddo | ||
580 | + end subroutine normalizedlegendre | ||
581 | +! | ||
582 | +! Generalized spherical functions | ||
583 | +! | ||
584 | +! dc(m,n*(n+1)+k)=(-1)^(m + k)((n - k)!(n + k)!/(n - m)!/(n + m)!)^(1/2) | ||
585 | +! ((1 + x)/2)^((m + k)/2)((1 - x)/2)^((k - m)/2)JacobiP[n - k, k - m, k + m, x] | ||
586 | +! | ||
587 | +! for |m| <= kmax, n=0,1,...nmax, |k| <= n | ||
588 | +! | ||
589 | +! | ||
590 | +! last revised: 15 January 2011 | ||
591 | +! | ||
592 | + subroutine rotcoef(cbe,kmax,nmax,dc) | ||
593 | + use numconstants | ||
594 | + implicit none | ||
595 | + integer :: kmax,nmax,k,m,in,n,knmax,nn1,kn,im,m1 | ||
596 | + real(8) :: cbe,sbe,dc(-kmax:kmax,0:nmax*(nmax+2)),cbe2,sbe2,dk0(-nmax-1:nmax+1),& | ||
597 | + dk01(-nmax-1:nmax+1),sben,dkt,fmn,dkm0,dkm1,dkn1 | ||
598 | + sbe=dsqrt((1.d0+cbe)*(1.d0-cbe)) | ||
599 | + cbe2=.5d0*(1.d0+cbe) | ||
600 | + sbe2=.5d0*(1.d0-cbe) | ||
601 | + in=1 | ||
602 | + dk0(0)=1.d0 | ||
603 | + sben=1.d0 | ||
604 | + dc(0,0)=1.d0 | ||
605 | + dk01(0)=0. | ||
606 | + do n=1,nmax | ||
607 | + knmax=min(n,kmax) | ||
608 | + nn1=n*(n+1) | ||
609 | + in=-in | ||
610 | + sben=sben*sbe/2.d0 | ||
611 | + dk0(n)=in*sben*bcof(n,n) | ||
612 | + dk0(-n)=in*dk0(n) | ||
613 | + dk01(n)=0. | ||
614 | + dk01(-n)=0. | ||
615 | + dc(0,nn1+n)=dk0(n) | ||
616 | + dc(0,nn1-n)=dk0(-n) | ||
617 | + do k=-n+1,n-1 | ||
618 | + kn=nn1+k | ||
619 | + dkt=dk01(k) | ||
620 | + dk01(k)=dk0(k) | ||
621 | + dk0(k)=(cbe*dble(n+n-1)*dk01(k)-fnr(n-k-1)*fnr(n+k-1)*dkt)& | ||
622 | + /(fnr(n+k)*fnr(n-k)) | ||
623 | + dc(0,kn)=dk0(k) | ||
624 | + enddo | ||
625 | + im=1 | ||
626 | + do m=1,knmax | ||
627 | + im=-im | ||
628 | + fmn=1.d0/fnr(n-m+1)/fnr(n+m) | ||
629 | + m1=m-1 | ||
630 | + dkm0=0. | ||
631 | + do k=-n,n | ||
632 | + kn=nn1+k | ||
633 | + dkm1=dkm0 | ||
634 | + dkm0=dc(m1,kn) | ||
635 | + if(k.eq.n) then | ||
636 | + dkn1=0. | ||
637 | + else | ||
638 | + dkn1=dc(m1,kn+1) | ||
639 | + endif | ||
640 | + dc(m,kn)=(fnr(n+k)*fnr(n-k+1)*cbe2*dkm1 & | ||
641 | + -fnr(n-k)*fnr(n+k+1)*sbe2*dkn1 & | ||
642 | + -dble(k)*sbe*dc(m1,kn))*fmn | ||
643 | + dc(-m,nn1-k)=dc(m,kn)*(-1)**(k)*im | ||
644 | + enddo | ||
645 | + enddo | ||
646 | + enddo | ||
647 | + end subroutine rotcoef | ||
648 | + | ||
649 | + subroutine rotcoefvecarg(narg,cbe,kmax,nmax,dc) | ||
650 | + use numconstants | ||
651 | + implicit none | ||
652 | + integer :: kmax,nmax,k,m,in,n,knmax,nn1,kn,im,m1,narg | ||
653 | + real(8) :: cbe(narg),sbe(narg),dc(-kmax:kmax,0:nmax*(nmax+2),narg), & | ||
654 | + cbe2(narg),sbe2(narg),dk0(-nmax-1:nmax+1,narg),& | ||
655 | + dk01(-nmax-1:nmax+1,narg),sben(narg),dkt(narg), & | ||
656 | + fmn,dkm0(narg),dkm1(narg),dkn1(narg) | ||
657 | + sbe=sqrt((1.d0+cbe)*(1.d0-cbe)) | ||
658 | + cbe2=.5d0*(1.d0+cbe) | ||
659 | + sbe2=.5d0*(1.d0-cbe) | ||
660 | + in=1 | ||
661 | + dk0(0,:)=1.d0 | ||
662 | + sben=1.d0 | ||
663 | + dc(0,0,:)=1.d0 | ||
664 | + dk01(0,:)=0. | ||
665 | + do n=1,nmax | ||
666 | + knmax=min(n,kmax) | ||
667 | + nn1=n*(n+1) | ||
668 | + in=-in | ||
669 | + sben=sben*sbe/2.d0 | ||
670 | + dk0(n,:)=in*sben(:)*bcof(n,n) | ||
671 | + dk0(-n,:)=in*dk0(n,:) | ||
672 | + dk01(n,:)=0. | ||
673 | + dk01(-n,:)=0. | ||
674 | + dc(0,nn1+n,:)=dk0(n,:) | ||
675 | + dc(0,nn1-n,:)=dk0(-n,:) | ||
676 | + do k=-n+1,n-1 | ||
677 | + kn=nn1+k | ||
678 | + dkt(:)=dk01(k,:) | ||
679 | + dk01(k,:)=dk0(k,:) | ||
680 | + dk0(k,:)=(cbe(:)*dble(n+n-1)*dk01(k,:)-fnr(n-k-1)*fnr(n+k-1)*dkt(:)) & | ||
681 | + /(fnr(n+k)*fnr(n-k)) | ||
682 | + dc(0,kn,:)=dk0(k,:) | ||
683 | + enddo | ||
684 | + im=1 | ||
685 | + do m=1,knmax | ||
686 | + im=-im | ||
687 | + fmn=1.d0/fnr(n-m+1)/fnr(n+m) | ||
688 | + m1=m-1 | ||
689 | + dkm0=0. | ||
690 | + do k=-n,n | ||
691 | + kn=nn1+k | ||
692 | + dkm1=dkm0 | ||
693 | + dkm0(:)=dc(m1,kn,:) | ||
694 | + if(k.eq.n) then | ||
695 | + dkn1=0. | ||
696 | + else | ||
697 | + dkn1(:)=dc(m1,kn+1,:) | ||
698 | + endif | ||
699 | + dc(m,kn,:)=(fnr(n+k)*fnr(n-k+1)*cbe2(:)*dkm1(:) & | ||
700 | + -fnr(n-k)*fnr(n+k+1)*sbe2(:)*dkn1(:) & | ||
701 | + -dble(k)*sbe(:)*dc(m1,kn,:))*fmn | ||
702 | + dc(-m,nn1-k,:)=dc(m,kn,:)*(-1)**(k)*im | ||
703 | + enddo | ||
704 | + enddo | ||
705 | + enddo | ||
706 | + end subroutine rotcoefvecarg | ||
707 | +! | ||
708 | +! tau are the vector spherical harmonic functions, normalized | ||
709 | +! | ||
710 | +! | ||
711 | +! last revised: 15 January 2011 | ||
712 | +! | ||
713 | + subroutine taufunc(cb,nmax,tau) | ||
714 | + use numconstants | ||
715 | + implicit none | ||
716 | + integer :: nmax,n,m,p,nn1,mn | ||
717 | + real(8) :: drot(-1:1,0:nmax*(nmax+2)),tau(0:nmax+1,nmax,2),cb,fnm | ||
718 | + call rotcoef(cb,1,nmax,drot) | ||
719 | + do n=1,nmax | ||
720 | + nn1=n*(n+1) | ||
721 | + fnm=sqrt(dble(n+n+1)/2.d0)/4.d0 | ||
722 | + do m=-n,-1 | ||
723 | + mn=nn1+m | ||
724 | + tau(n+1,-m,1)=-fnm*(-drot(-1,mn)+drot(1,mn)) | ||
725 | + tau(n+1,-m,2)=-fnm*(drot(-1,mn)+drot(1,mn)) | ||
726 | + enddo | ||
727 | + do m=0,n | ||
728 | + mn=nn1+m | ||
729 | + tau(m,n,1)=-fnm*(-drot(-1,mn)+drot(1,mn)) | ||
730 | + tau(m,n,2)=-fnm*(drot(-1,mn)+drot(1,mn)) | ||
731 | + enddo | ||
732 | + enddo | ||
733 | + end subroutine taufunc | ||
734 | +! | ||
735 | +! vector spherical harmonic function | ||
736 | +! november 2011 | ||
737 | +! | ||
738 | + | ||
739 | + subroutine pifunc(cb,ephi,nmax,ndim,pivec) | ||
740 | + use numconstants | ||
741 | + implicit none | ||
742 | + integer :: nmax,n,m,p,nn1,mn,ndim | ||
743 | + real(8) :: drot(-1:1,0:nmax*(nmax+2)),tau(2),cb,fnm | ||
744 | + complex(8) :: pivec(0:ndim+1,ndim,2),ephi,ephim(-nmax:nmax),cin | ||
745 | + call rotcoef(cb,1,nmax,drot) | ||
746 | + ephim(0)=1.d0 | ||
747 | + do m=1,nmax | ||
748 | + ephim(m)=ephi*ephim(m-1) | ||
749 | + ephim(-m)=dconjg(ephim(m)) | ||
750 | + enddo | ||
751 | + do n=1,nmax | ||
752 | + cin=(0.d0,-1.d0)**(n+1) | ||
753 | + nn1=n*(n+1) | ||
754 | + fnm=sqrt(dble(n+n+1)/2.d0)/4.d0 | ||
755 | + do m=-n,-1 | ||
756 | + mn=nn1+m | ||
757 | + tau(1)=-fnm*(-drot(-1,mn)+drot(1,mn)) | ||
758 | + tau(2)=-fnm*(drot(-1,mn)+drot(1,mn)) | ||
759 | + pivec(n+1,-m,1)=cin*tau(1)*ephim(m) | ||
760 | + pivec(n+1,-m,2)=cin*tau(2)*ephim(m) | ||
761 | + enddo | ||
762 | + do m=0,n | ||
763 | + mn=nn1+m | ||
764 | + tau(1)=-fnm*(-drot(-1,mn)+drot(1,mn)) | ||
765 | + tau(2)=-fnm*(drot(-1,mn)+drot(1,mn)) | ||
766 | + pivec(m,n,1)=cin*tau(1)*ephim(m) | ||
767 | + pivec(m,n,2)=cin*tau(2)*ephim(m) | ||
768 | + enddo | ||
769 | + enddo | ||
770 | + end subroutine pifunc | ||
771 | +! | ||
772 | +! regular vswf expansion coefficients for a plane wave. | ||
773 | +! alpha, beta: incident azimuth and polar angles. | ||
774 | +! | ||
775 | +! | ||
776 | +! last revised: 15 January 2011 | ||
777 | +! | ||
778 | + subroutine planewavecoef(alpha,beta,nodr,pmnp0) | ||
779 | + use numconstants | ||
780 | + implicit none | ||
781 | + integer :: nodr,m,n,p,k,ierr | ||
782 | + real(8) :: alpha,beta,cb,sb,ca,sa | ||
783 | + real(8), allocatable :: tau(:,:,:) | ||
784 | + complex(8) :: ealpha,ci,cin | ||
785 | + complex(8), allocatable :: ealpham(:) | ||
786 | + complex(8) :: pmnp0(0:nodr+1,nodr,2,2) | ||
787 | + data ci/(0.d0,1.d0)/ | ||
788 | + call init(nodr) | ||
789 | + allocate(ealpham(-nodr:nodr)) | ||
790 | + allocate(tau(0:nodr+1,nodr,2)) | ||
791 | + cb=cos(beta) | ||
792 | + sb=sqrt((1.d0-cb)*(1.d0+cb)) | ||
793 | + ca=cos(alpha) | ||
794 | + sa=sin(alpha) | ||
795 | + ealpha=dcmplx(ca,sa) | ||
796 | + call taufunc(cb,nodr,tau) | ||
797 | + call ephicoef(ealpha,nodr,ealpham) | ||
798 | + do n=1,nodr | ||
799 | + cin=4.d0*ci**(n+1) | ||
800 | + do p=1,2 | ||
801 | + do m=-n,-1 | ||
802 | + pmnp0(n+1,-m,p,1)=-cin*tau(n+1,-m,p)*ealpham(-m) | ||
803 | + pmnp0(n+1,-m,p,2)=ci*cin*tau(n+1,-m,3-p)*ealpham(-m) | ||
804 | + enddo | ||
805 | + do m=0,n | ||
806 | + pmnp0(m,n,p,1)=-cin*tau(m,n,p)*ealpham(-m) | ||
807 | + pmnp0(m,n,p,2)=ci*cin*tau(m,n,3-p)*ealpham(-m) | ||
808 | + enddo | ||
809 | + enddo | ||
810 | + enddo | ||
811 | + deallocate(ealpham,tau) | ||
812 | + end subroutine planewavecoef | ||
813 | +! | ||
814 | +! regular vswf expansion coefficients for a gaussian beam, localized approximation. | ||
815 | +! cbeam = 1/(k omega) | ||
816 | +! | ||
817 | +! | ||
818 | +! last revised: 15 January 2011 | ||
819 | +! | ||
820 | + subroutine gaussianbeamcoef(alpha,beta,cbeam,nodr,pmnp0) | ||
821 | + use numconstants | ||
822 | + implicit none | ||
823 | + integer :: nodr,m,n,p,k,ierr | ||
824 | + real(8) :: alpha,beta,cbeam,gbn | ||
825 | + complex(8) :: pmnp0(0:nodr+1,nodr,2,2) | ||
826 | + call planewavecoef(alpha,beta,nodr,pmnp0) | ||
827 | + do n=1,nodr | ||
828 | + gbn=dexp(-((dble(n)+.5d0)*cbeam)**2.) | ||
829 | + do p=1,2 | ||
830 | + do k=1,2 | ||
831 | + do m=-n,-1 | ||
832 | + pmnp0(n+1,-m,p,k)=pmnp0(n+1,-m,p,k)*gbn | ||
833 | + enddo | ||
834 | + do m=0,n | ||
835 | + pmnp0(m,n,p,k)=pmnp0(m,n,p,k)*gbn | ||
836 | + enddo | ||
837 | + enddo | ||
838 | + enddo | ||
839 | + enddo | ||
840 | + end subroutine gaussianbeamcoef | ||
841 | +! | ||
842 | +! plane wave expansion coefficients at sphere origins. uses a phase shift. | ||
843 | +! | ||
844 | +! | ||
845 | +! last revised: 15 January 2011 | ||
846 | +! | ||
847 | + subroutine sphereplanewavecoef(nsphere,neqns,nodr,nodrmax,alpha,beta,rpos,pmnp) | ||
848 | + implicit none | ||
849 | + integer :: m,n,p,nsphere,i,l,nodr(nsphere),nblk,nboff,nodrmax,neqns,k | ||
850 | + real(8) :: alpha,beta,cb,sb,ca,sa,rpos(3,nsphere) | ||
851 | + complex(8) :: ci,phasefac, pmnp(neqns,2) | ||
852 | + complex(8) :: pmnp0(0:nodrmax+1,nodrmax,2,2) | ||
853 | + data ci/(0.d0,1.d0)/ | ||
854 | + call planewavecoef(alpha,beta,nodrmax,pmnp0) | ||
855 | + cb=cos(beta) | ||
856 | + sb=sqrt((1.d0-cb)*(1.d0+cb)) | ||
857 | + ca=cos(alpha) | ||
858 | + sa=sin(alpha) | ||
859 | + l=0 | ||
860 | + do i=1,nsphere | ||
861 | + phasefac=cdexp(ci*((ca*rpos(1,i)+sa*rpos(2,i))*sb+rpos(3,i)*cb)) | ||
862 | + do p=1,2 | ||
863 | + do n=1,nodr(i) | ||
864 | + do m=0,nodr(i)+1 | ||
865 | + l=l+1 | ||
866 | + do k=1,2 | ||
867 | + pmnp(l,k)=phasefac*pmnp0(m,n,p,k) | ||
868 | + enddo | ||
869 | + enddo | ||
870 | + enddo | ||
871 | + enddo | ||
872 | + enddo | ||
873 | + end subroutine sphereplanewavecoef | ||
874 | +! | ||
875 | +! this computes the normalized translation coefficients for an | ||
876 | +! axial translation of positive distance r. For itype=1 or 3, the translation | ||
877 | +! uses the spherical Bessel or Hankel functions as a basis function, | ||
878 | +! respectively. They are related to the coefficients appearing in | ||
879 | +! M&M JOSA 96 by | ||
880 | +! | ||
881 | +! J^{ij}_{mnp mlq} = (E_{ml}/E_{mn})^(1/2) ac(s,n,l*(l+1)+m) | ||
882 | +! | ||
883 | +! where | ||
884 | +! | ||
885 | +! E_{mn} = n(n+1)(n+m)!/((2n+1)(n-m)!) | ||
886 | +! s=mod(p+q,2)+1 (i.e., s=1 for the A coefficient, =2 for the B | ||
887 | +! coefficient) | ||
888 | +! | ||
889 | +! The calculation procedure is based on the derivation | ||
890 | +! of the addition theorem for vector harmonics, appearing in | ||
891 | +! Fuller and Mackowski, proc. Light Scattering by Nonspherical | ||
892 | +! Particles, NASA/GISS Sept. 1998. | ||
893 | +! | ||
894 | +! revised: 10 october 2011: used F90 vector arithmetic and precalculation | ||
895 | +! of various constants. | ||
896 | +! | ||
897 | + subroutine axialtrancoef(itype,r,ri,nmax,lmax,ac) | ||
898 | + use numconstants | ||
899 | + implicit none | ||
900 | + integer :: itype,nmax,lmax,n,l,m,p,w,n21,ll1,nlmin,lblk,wmin,wmax,ml | ||
901 | + integer :: iadd,nlmax | ||
902 | + integer, save :: nlmax0 | ||
903 | + real(8) :: r | ||
904 | + complex(8) :: ri,ci,z,xi(0:nmax+lmax) | ||
905 | + complex(8) :: ac(nmax,lmax*(lmax+3)/2,2) | ||
906 | + data ci,nlmax0/(0.d0,1.d0),0/ | ||
907 | + nlmax=max(nmax,lmax) | ||
908 | + if(nlmax.gt.nlmax0) then | ||
909 | + nlmax0=nlmax | ||
910 | + call axialtrancoefinit(nlmax) | ||
911 | + endif | ||
912 | + if(r.eq.0.d0) then | ||
913 | + ac=(0.d0,0.d0) | ||
914 | + if(itype.ne.1) return | ||
915 | + do m=0,min(nmax,lmax) | ||
916 | + do n=max(1,m),min(nmax,lmax) | ||
917 | + iadd=atcadd(m,n,lmax) | ||
918 | + ac(n,iadd,l)=1. | ||
919 | + enddo | ||
920 | + enddo | ||
921 | + return | ||
922 | + endif | ||
923 | + z=r*ri | ||
924 | + if(itype.eq.1) then | ||
925 | + call cricbessel(nmax+lmax,z,xi) | ||
926 | + else | ||
927 | + call crichankel(nmax+lmax,z,xi) | ||
928 | + endif | ||
929 | + xi=xi/z | ||
930 | + do n=1,nmax | ||
931 | + do l=1,lmax | ||
932 | + wmin=abs(n-l) | ||
933 | + wmax=n+l | ||
934 | + do m=0,min(n,l) | ||
935 | + iadd=atcadd(m,l,lmax) | ||
936 | + ml=l*(l+1)/2+m | ||
937 | + ac(n,iadd,1)=sum(vcc_const(n,ml,wmin:wmax:2)*xi(wmin:wmax:2)) | ||
938 | + ac(n,iadd,2)=ci*sum(vcc_const(n,ml,wmin+1:wmax-1:2)*xi(wmin+1:wmax-1:2)) | ||
939 | + enddo | ||
940 | + enddo | ||
941 | + enddo | ||
942 | + end subroutine axialtrancoef | ||
943 | +! | ||
944 | +! axial translation coefficients calculated by the diamond recurrence formula | ||
945 | +! new: 10 october 2011 | ||
946 | +! | ||
947 | + subroutine axialtrancoefrecurrence(itype,r,ri,nmax,lmax,ac) | ||
948 | + use numconstants | ||
949 | + implicit none | ||
950 | + integer :: itype,nmax,lmax,n,l,m,p,q,w,n21,ll1,nlmin,lblk, & | ||
951 | + wmin,wmax,ml,m1,np1,nm1,iaddp1,iaddm1,lm1,lp1 | ||
952 | + integer :: iadd,nlmax,iadd0,iadd1 | ||
953 | + integer, save :: nlmax0 | ||
954 | + real(8) :: r,fnp1,fn,fnm1,flp1,fl,flm1 | ||
955 | + complex(8) :: ri,ci,z,xi(0:nmax+lmax) | ||
956 | + complex(8) :: ac(nmax,lmax*(lmax+3)/2,2) | ||
957 | + data ci,nlmax0/(0.d0,1.d0),0/ | ||
958 | + nlmax=max(nmax,lmax) | ||
959 | + nlmin=min(nmax,lmax) | ||
960 | + if(nlmax.gt.nlmax0) then | ||
961 | + nlmax0=nlmax | ||
962 | + call axialtrancoefinit(nlmax) | ||
963 | + endif | ||
964 | + | ||
965 | + if(r.eq.0.d0) then | ||
966 | + ac=(0.d0,0.d0) | ||
967 | + if(itype.ne.1) return | ||
968 | + do m=0,nlmin | ||
969 | + m1=max(1,m) | ||
970 | + do n=m1,nlmin | ||
971 | + iadd=atcadd(m,n,lmax) | ||
972 | + ac(n,iadd,l)=1. | ||
973 | + enddo | ||
974 | + enddo | ||
975 | + return | ||
976 | + endif | ||
977 | + z=r*ri | ||
978 | + if(itype.eq.1) then | ||
979 | + call cricbessel(nmax+lmax,z,xi) | ||
980 | + else | ||
981 | + call crichankel(nmax+lmax,z,xi) | ||
982 | + endif | ||
983 | + xi=xi/z | ||
984 | + | ||
985 | + lm1=lmax-1 | ||
986 | + do m=0,nlmin | ||
987 | + m1=max(1,abs(m)) | ||
988 | + lp1=m1+1 | ||
989 | + iadd0=atcadd(m,m1,lmax) | ||
990 | + iadd1=atcadd(m,lmax,lmax) | ||
991 | + iaddp1=iadd0+1 | ||
992 | + iaddm1=iadd1-1 | ||
993 | + | ||
994 | + iadd=iadd0-1 | ||
995 | + n=m1 | ||
996 | + do l=m1,lmax | ||
997 | + wmin=abs(n-l) | ||
998 | + wmax=n+l | ||
999 | + iadd=iadd+1 | ||
1000 | + ml=l*(l+1)/2+m | ||
1001 | + ac(n,iadd,1)=sum(vcc_const(n,ml,wmin:wmax:2)*xi(wmin:wmax:2)) | ||
1002 | + ac(n,iadd,2)=ci*sum(vcc_const(n,ml,wmin+1:wmax-1:2)*xi(wmin+1:wmax-1:2)) | ||
1003 | + enddo | ||
1004 | + l=lmax | ||
1005 | + iadd=iadd1 | ||
1006 | + ml=l*(l+1)/2+m | ||
1007 | + do n=m1+1,nmax | ||
1008 | + wmin=abs(n-l) | ||
1009 | + wmax=n+l | ||
1010 | + ac(n,iadd,1)=sum(vcc_const(n,ml,wmin:wmax:2)*xi(wmin:wmax:2)) | ||
1011 | + ac(n,iadd,2)=ci*sum(vcc_const(n,ml,wmin+1:wmax-1:2)*xi(wmin+1:wmax-1:2)) | ||
1012 | + enddo | ||
1013 | + if(m1.eq.nlmin) cycle | ||
1014 | + | ||
1015 | + do n=m1,nmax-1 | ||
1016 | + np1=n+1 | ||
1017 | + nm1=n-1 | ||
1018 | + do p=1,2 | ||
1019 | + q=3-p | ||
1020 | + ac(np1,iadd0:iaddm1,p)= & | ||
1021 | + - ac(n,iaddp1:iadd1,p)*fnp1_const(m,m1:lm1) & | ||
1022 | + + (fn_const(m,m1:lm1)-fn_const(m,n))*ci*ac(n,iadd0:iaddm1,q) | ||
1023 | + ac(np1,iaddp1:iaddm1,p)=ac(np1,iaddp1:iaddm1,p) & | ||
1024 | + + ac(n,iadd0:iadd1-2,p)*fnm1_const(m,lp1:lm1) | ||
1025 | + if(n.gt.m1) then | ||
1026 | + ac(np1,iadd0:iaddm1,p)=ac(np1,iadd0:iaddm1,p) & | ||
1027 | + + ac(nm1,iadd0:iaddm1,p)*fnm1_const(m,n) | ||
1028 | + endif | ||
1029 | + ac(np1,iadd0:iaddm1,p)=ac(np1,iadd0:iaddm1,p)/fnp1_const(m,n) | ||
1030 | + enddo | ||
1031 | + enddo | ||
1032 | + enddo | ||
1033 | + end subroutine axialtrancoefrecurrence | ||
1034 | +! | ||
1035 | +! constants for translation coefficient calculation | ||
1036 | +! | ||
1037 | + subroutine axialtrancoefinit(nmax) | ||
1038 | + use numconstants | ||
1039 | + implicit none | ||
1040 | + integer :: nmax,m,n,l,w,n21,ml,ll1,wmin,wmax,nlmin,lp1,lm1 | ||
1041 | + real(8) :: c1,c2,vc1(0:2*nmax),vc2(0:2*nmax),alnw | ||
1042 | + complex(8) :: ci,inlw | ||
1043 | + data ci/(0.d0,1.d0)/ | ||
1044 | + if(allocated(vcc_const)) deallocate(vcc_const,fnm1_const,fn_const,fnp1_const) | ||
1045 | + allocate(vcc_const(nmax,nmax*(nmax+1)/2+nmax,0:2*nmax),fnm1_const(0:nmax,nmax), & | ||
1046 | + fn_const(0:nmax,nmax),fnp1_const(0:nmax,nmax)) | ||
1047 | + do n=1,nmax | ||
1048 | + n21=n+n+1 | ||
1049 | + do l=1,nmax | ||
1050 | + c1=fnr(n21)*fnr(l+l+1) | ||
1051 | + ll1=l*(l+1)/2 | ||
1052 | + call vcfunc(-1,n,1,l,vc2) | ||
1053 | + wmin=abs(n-l) | ||
1054 | + wmax=n+l | ||
1055 | + nlmin=min(l,n) | ||
1056 | + do m=0,nlmin | ||
1057 | + ml=ll1+m | ||
1058 | + c2=-c1*(-1)**m | ||
1059 | + call vcfunc(-m,n,m,l,vc1) | ||
1060 | + do w=wmin,wmax | ||
1061 | + inlw=ci**(n-l+w) | ||
1062 | + vcc_const(n,ml,w)=c2*vc1(w)*vc2(w)*(dble(inlw)+dimag(inlw)) | ||
1063 | + enddo | ||
1064 | + enddo | ||
1065 | + enddo | ||
1066 | + enddo | ||
1067 | + fnm1_const=0. | ||
1068 | + fn_const=0. | ||
1069 | + fnp1_const=0. | ||
1070 | + do m=0,nmax | ||
1071 | + do l=max(1,m),nmax | ||
1072 | + lp1=l+1 | ||
1073 | + lm1=l-1 | ||
1074 | + fnm1_const(m,l)=fnr(lm1)*fnr(lp1)*fnr(l-m)*fnr(l+m)/fnr(lm1+l)/fnr(l+lp1)/dble(l) | ||
1075 | + fn_const(m,l)=dble(m)/dble(l)/dble(lp1) | ||
1076 | + fnp1_const(m,l)=fnr(l)*fnr(l+2)*fnr(lp1-m)*fnr(lp1+m)/fnr(l+lp1)/fnr(l+l+3)/dble(lp1) | ||
1077 | + enddo | ||
1078 | + enddo | ||
1079 | + end subroutine axialtrancoefinit | ||
1080 | +! | ||
1081 | +! test to determine convergence of regular vswf addition theorem for max. order lmax | ||
1082 | +! and translation distance r w/ refractive index ri. | ||
1083 | +! | ||
1084 | +! | ||
1085 | +! last revised: 15 January 2011 | ||
1086 | +! | ||
1087 | + subroutine tranordertest(r,ri,lmax,eps,nmax) | ||
1088 | + use numconstants | ||
1089 | + implicit none | ||
1090 | + integer :: itype,nmax,lmax,n,l,m,p,w,n21,ll1,nlmin,lblk,wmin,wmax | ||
1091 | + integer, parameter :: nlim=200 | ||
1092 | + integer :: iadd | ||
1093 | + real(8) :: r,alnw,sum,eps | ||
1094 | + real(8) :: vc1(0:nlim+lmax) | ||
1095 | + complex(8) :: ri,ci,z,a,b,c | ||
1096 | + complex(8) :: xi(0:nlim+lmax) | ||
1097 | + data ci/(0.d0,1.d0)/ | ||
1098 | + if(r.eq.0.d0) then | ||
1099 | + nmax=lmax | ||
1100 | + return | ||
1101 | + endif | ||
1102 | + z=r*ri | ||
1103 | + sum=0.d0 | ||
1104 | + do n=1,nlim | ||
1105 | + call init(n+lmax) | ||
1106 | + call cricbessel(n+lmax,z,xi) | ||
1107 | + do l=0,n+lmax | ||
1108 | + xi(l)=xi(l)/z*ci**l | ||
1109 | + enddo | ||
1110 | + n21=n+n+1 | ||
1111 | + l=lmax | ||
1112 | + c=fnr(n21)*fnr(l+l+1)*ci**(n-l) | ||
1113 | + call vcfunc(-1,n,1,l,vc1) | ||
1114 | + wmin=abs(n-l) | ||
1115 | + wmax=n+l | ||
1116 | + m=1 | ||
1117 | + a=0. | ||
1118 | + b=0. | ||
1119 | + do w=wmin,wmax | ||
1120 | + alnw=vc1(w)*vc1(w) | ||
1121 | + if(mod(n+l+w,2).eq.0) then | ||
1122 | + a=a+alnw*xi(w) | ||
1123 | + else | ||
1124 | + b=b+alnw*xi(w) | ||
1125 | + endif | ||
1126 | + enddo | ||
1127 | + a=c*a | ||
1128 | + b=c*b | ||
1129 | + sum=sum+a*conjg(a)+b*conjg(b) | ||
1130 | + if(abs(1.d0-sum).lt.eps) exit | ||
1131 | + enddo | ||
1132 | + nmax=min(n,nlim) | ||
1133 | + nmax=max(nmax,lmax) | ||
1134 | + end subroutine tranordertest | ||
1135 | +! | ||
1136 | +! address for axial translation coefficient | ||
1137 | +! | ||
1138 | +! | ||
1139 | +! last revised: 15 January 2011 | ||
1140 | +! | ||
1141 | + integer function atcadd(m,n,ntot) | ||
1142 | + implicit none | ||
1143 | + integer :: m,n,ntot | ||
1144 | + atcadd=n-ntot+(max(1,m)*(1+2*ntot-max(1,m)))/2+ntot*min(1,m) | ||
1145 | + end function atcadd | ||
1146 | +! | ||
1147 | +! gentrancoef: calculates the vwh translation coefficients for | ||
1148 | +! a general translation from one origin to another | ||
1149 | +! | ||
1150 | +! input: itype: integer, =1, regular, =3, outgoing type harmonics | ||
1151 | +! xptran: real, dim 3 vector: x,y,z components of translation, in units | ||
1152 | +! of 1/k | ||
1153 | +! ri: complex, refractive index of medium | ||
1154 | +! nrow0,nrow1,ncol0,ncol1: integer, starting and stopping row and column order | ||
1155 | +! iaddrow0,iaddcol0: address offset for row and column order (see below) | ||
1156 | +! output: ac(p,mn,kl): complex translation matrix. calculated for mode p=1,2 (A or B type), | ||
1157 | +! order n=nrow0,nrow1, degree m=-n,n | ||
1158 | +! order l=ncol0,ncol1, degree k=-n,n | ||
1159 | +! address is given by | ||
1160 | +! mn=m+n*(n+1)-(nrow0-1)*(nrow0+1)+iaddrow0 | ||
1161 | +! kl=k+l*(l+1)-(ncol0-1)*(ncol0+1)+iaddcol0 | ||
1162 | +! that is, if iaddrow0=0 the address is mn=1 for n=nrow0 and m=-n. | ||
1163 | +! | ||
1164 | +! | ||
1165 | +! last revised: 15 January 2011 | ||
1166 | +! | ||
1167 | + subroutine gentrancoef(itype,xptran,ri,nrow0,nrow1,ncol0,ncol1, & | ||
1168 | + iaddrow0,iaddcol0,ac) | ||
1169 | + use numconstants | ||
1170 | + implicit none | ||
1171 | + integer :: itype,nrow0,nrow1,ncol0,ncol1,iaddrow0,iaddcol0,kmax | ||
1172 | + integer :: ntot,nblkr0,nblkr1,nblkc0,nblkc1 | ||
1173 | + integer :: v,vw,w,wmax,wmin,n,l,m,k,p,nn1,ll1,mn,kl,m1m | ||
1174 | + real(8) :: vc1(0:nrow1+ncol1),vc2(0:nrow1+ncol1),& | ||
1175 | + xptran(3),r,ct,ct0 | ||
1176 | + real(8) :: drot(0:0,0:(nrow1+ncol1)*(nrow1+ncol1+2)) | ||
1177 | + complex(8) :: ri,ci,ephi,ac(2,nrow1*(nrow1+2)-(nrow0-1)*(nrow0+1)-iaddrow0,& | ||
1178 | + ncol1*(ncol1+2)-(ncol0-1)*(ncol0+1)-iaddcol0),& | ||
1179 | + z,c,a,b | ||
1180 | + complex(8) :: ephim(-(nrow1+ncol1):nrow1+ncol1),jnc(0:nrow1+ncol1) | ||
1181 | + data ci/(0.d0,1.d0)/ | ||
1182 | + call cartosphere(xptran,r,ct,ephi) | ||
1183 | + ntot=nrow1+ncol1 | ||
1184 | + nblkr0=(nrow0-1)*(nrow0+1) | ||
1185 | + nblkr1=nrow1*(nrow1+2) | ||
1186 | + nblkc0=(ncol0-1)*(ncol0+1) | ||
1187 | + nblkc1=ncol1*(ncol1+2) | ||
1188 | + if(r.eq.0.d0) then | ||
1189 | + do n=nblkr0+1,nblkr1 | ||
1190 | + mn=n-nblkr0+iaddrow0 | ||
1191 | + do l=nblkc0+1,nblkc1 | ||
1192 | + kl=l-nblkc0+iaddcol0 | ||
1193 | + do p=1,2 | ||
1194 | + ac(p,mn,kl)=0.d0 | ||
1195 | + enddo | ||
1196 | + enddo | ||
1197 | + if(n.gt.nblkc0.and.n.le.nblkc1.and.itype.eq.1) then | ||
1198 | + ac(1,mn,n-nblkc0+iaddcol0)=1.d0 | ||
1199 | + endif | ||
1200 | + enddo | ||
1201 | + return | ||
1202 | + endif | ||
1203 | + kmax=0 | ||
1204 | + ct0=ct | ||
1205 | + call rotcoef(ct0,kmax,ntot,drot) | ||
1206 | + call ephicoef(ephi,ntot,ephim) | ||
1207 | + z=ri*r | ||
1208 | + if(itype.eq.1) then | ||
1209 | + call cricbessel(ntot,z,jnc) | ||
1210 | + else | ||
1211 | + call crichankel(ntot,z,jnc) | ||
1212 | + endif | ||
1213 | + do n=0,ntot | ||
1214 | + c=ci**n | ||
1215 | + jnc(n)=c*jnc(n)/z | ||
1216 | + enddo | ||
1217 | + do l=ncol0,ncol1 | ||
1218 | + ll1=l*(l+1) | ||
1219 | + do n=nrow0,nrow1 | ||
1220 | + nn1=n*(n+1) | ||
1221 | + wmax=n+l | ||
1222 | + call vcfunc(-1,n,1,l,vc2) | ||
1223 | + c=-ci**(n-l)*fnr(n+n+1)*fnr(l+l+1) | ||
1224 | + do k=-l,l | ||
1225 | + kl=ll1+k-nblkc0+iaddcol0 | ||
1226 | + do m=-n,n | ||
1227 | + m1m=(-1)**m | ||
1228 | + mn=nn1+m-nblkr0+iaddrow0 | ||
1229 | + v=k-m | ||
1230 | + call vcfunc(-m,n,k,l,vc1) | ||
1231 | + a=0. | ||
1232 | + b=0. | ||
1233 | + wmin=max(abs(v),abs(n-l)) | ||
1234 | + do w=wmax,wmin,-1 | ||
1235 | + vw=w*(w+1)+v | ||
1236 | + if(mod(wmax-w,2).eq.0) then | ||
1237 | + a=a+vc1(w)*vc2(w)*jnc(w)*drot(0,vw) | ||
1238 | + else | ||
1239 | + b=b+vc1(w)*vc2(w)*jnc(w)*drot(0,vw) | ||
1240 | + endif | ||
1241 | + enddo | ||
1242 | + ac(1,mn,kl)=a*c*m1m*ephim(v) | ||
1243 | + ac(2,mn,kl)=b*c*m1m*ephim(v) | ||
1244 | + enddo | ||
1245 | + enddo | ||
1246 | + enddo | ||
1247 | + enddo | ||
1248 | + return | ||
1249 | + end subroutine gentrancoef | ||
1250 | +! | ||
1251 | +! cartosphere takes the cartesian point (x,y,z) = xp(1), xp(2), xp(3) | ||
1252 | +! and converts to polar form: r: radius, ct: cos(theta), ep = exp(i phi) | ||
1253 | +! | ||
1254 | +! | ||
1255 | +! last revised: 15 January 2011 | ||
1256 | +! | ||
1257 | + subroutine cartosphere(xp,r,ct,ep) | ||
1258 | + implicit none | ||
1259 | + real(8) :: xp(3),r,ct | ||
1260 | + complex(8) :: ep | ||
1261 | + r=xp(1)*xp(1)+xp(2)*xp(2)+xp(3)*xp(3) | ||
1262 | + if(r.eq.0.d0) then | ||
1263 | + ct=1.d0 | ||
1264 | + ep=(1.d0,0.d0) | ||
1265 | + return | ||
1266 | + endif | ||
1267 | + r=sqrt(r) | ||
1268 | + ct=xp(3)/r | ||
1269 | + if(xp(1).eq.0.d0.and.xp(2).eq.0.d0) then | ||
1270 | + ep=(1.d0,0.d0) | ||
1271 | + else | ||
1272 | + ep=dcmplx(xp(1),xp(2))/sqrt(xp(1)*xp(1)+xp(2)*xp(2)) | ||
1273 | + endif | ||
1274 | + return | ||
1275 | + end subroutine cartosphere | ||
1276 | +! | ||
1277 | +! ephicoef returns the complex array epm(m) = exp(i m phi) for | ||
1278 | +! m=-nodr,nodr. ep =exp(i phi), and epm is dimensioned epm(-nd:nd) | ||
1279 | +! | ||
1280 | +! | ||
1281 | +! last revised: 15 January 2011 | ||
1282 | +! | ||
1283 | + subroutine ephicoef(ep,nodr,epm) | ||
1284 | + implicit none | ||
1285 | + integer :: nodr,m | ||
1286 | + complex(8) :: ep,epm(-nodr:nodr) | ||
1287 | + epm(0)=(1.d0,0.d0) | ||
1288 | + do m=1,nodr | ||
1289 | + epm(m)=ep*epm(m-1) | ||
1290 | + epm(-m)=dconjg(epm(m)) | ||
1291 | + enddo | ||
1292 | + return | ||
1293 | + end subroutine ephicoef | ||
1294 | +! | ||
1295 | +! test to determine max order of vswf expansion of a plane wave at distance r | ||
1296 | +! | ||
1297 | +! | ||
1298 | +! last revised: 15 January 2011 | ||
1299 | +! | ||
1300 | + subroutine planewavetruncationorder(r,eps,nodr) | ||
1301 | + implicit none | ||
1302 | + integer :: nodr,n1,n | ||
1303 | + real(8) :: r,eps,err | ||
1304 | + real(8), allocatable :: jn(:) | ||
1305 | + complex(8) :: sum, ci,eir | ||
1306 | + data ci/(0.d0,1.d0)/ | ||
1307 | + n1=max(10,int(3.*r+1)) | ||
1308 | + allocate(jn(0:n1)) | ||
1309 | + call ricbessel(n1,r,-1.d0,n1,jn) | ||
1310 | + jn(0:n1)=jn(0:n1)/r | ||
1311 | + eir=cdexp(-ci*r) | ||
1312 | + sum=jn(0)*eir | ||
1313 | + do n=1,n1 | ||
1314 | + sum=sum+ci**n*dble(n+n+1)*jn(n)*eir | ||
1315 | + err=cdabs(1.d0-sum) | ||
1316 | + if(err.lt.eps) then | ||
1317 | + nodr=n | ||
1318 | + deallocate(jn) | ||
1319 | + return | ||
1320 | + endif | ||
1321 | + enddo | ||
1322 | + nodr=n1 | ||
1323 | + deallocate(jn) | ||
1324 | + end subroutine planewavetruncationorder | ||
1325 | +! | ||
1326 | +! calculates the cartesian components of the vswf at position rpos, in ref. index ri. | ||
1327 | +! | ||
1328 | +! | ||
1329 | +! original: 15 January 2011 | ||
1330 | +! revised: 23 February 2011: multiplied by root 2 | ||
1331 | +! | ||
1332 | + subroutine vwhcalc(rpos,ri,nodr,itype,vwh) | ||
1333 | + use numconstants | ||
1334 | + implicit none | ||
1335 | + integer :: nodr,itype,m,n,p,nodrp1,nodrm1,nn1,mn,np1,nm1,mp1,mm1,ndim, & | ||
1336 | + nblkp | ||
1337 | + integer, save :: nodrmax | ||
1338 | + real(8) :: rpos(3),r,ct,fnorm1,fnorm2 | ||
1339 | + real(8) pmn(0:0,0:(nodr+1)*(nodr+3)) | ||
1340 | + complex(8) :: ci,vwh(3,2,1:*),ri,ephi,a,b,a1,b1,z1,a2,b2,z2 | ||
1341 | + complex(8) :: a1vec(-nodr:nodr), & | ||
1342 | + b1vec(-nodr:nodr),z1vec(-nodr:nodr),a2vec(-nodr:nodr), & | ||
1343 | + b2vec(-nodr:nodr),z2vec(-nodr:nodr) | ||
1344 | + complex(8) :: umn(-nodr-2:nodr+2,0:nodr+1), hn(0:nodr+1), ephim(-nodr-1:nodr+1) | ||
1345 | + data ci,nodrmax/(0.d0,1.d0),0/ | ||
1346 | + if(nodr.gt.nodrmax) then | ||
1347 | + nodrmax=nodr | ||
1348 | + call init(nodr+2) | ||
1349 | + endif | ||
1350 | + call cartosphere(rpos,r,ct,ephi) | ||
1351 | + if(r.le.1.d-4) then | ||
1352 | + vwh(:,:,1:nodr*(nodr+1))=(0.d0,0.d0) | ||
1353 | + if(itype.eq.3) return | ||
1354 | + vwh(1,1,1)=.5d0*fnr(2)/fnr(3) | ||
1355 | + vwh(2,1,1)=-.5d0*ci*fnr(2)/fnr(3) | ||
1356 | + vwh(3,1,2)=1.d0*fnr(2)/fnr(6) | ||
1357 | + vwh(1,1,3)=-.5d0*fnr(2)/fnr(3) | ||
1358 | + vwh(2,1,3)=-.5d0*ci*fnr(2)/fnr(3) | ||
1359 | + return | ||
1360 | + endif | ||
1361 | + nodrp1=nodr+1 | ||
1362 | + nodrm1=nodr-1 | ||
1363 | + a=ri*r | ||
1364 | + if(itype.eq.1) then | ||
1365 | + call cricbessel(nodrp1,a,hn) | ||
1366 | + else | ||
1367 | + call crichankel(nodrp1,a,hn) | ||
1368 | + endif | ||
1369 | + hn(0:nodrp1)=hn(0:nodrp1)/a | ||
1370 | + call rotcoef(ct,0,nodrp1,pmn) | ||
1371 | + call ephicoef(ephi,nodrp1,ephim) | ||
1372 | + umn=0.d0 | ||
1373 | + umn(0,0)=hn(0)*fnr(2) | ||
1374 | + do n=1,nodrp1 | ||
1375 | + nn1=n*(n+1) | ||
1376 | + umn(-n:n,n)=fnr(2)*pmn(0,nn1-n:nn1+n)*ephim(-n:n)*hn(n) | ||
1377 | + umn(-n-1,n)=0.d0 | ||
1378 | + umn(n+1,n)=0.d0 | ||
1379 | + enddo | ||
1380 | + do n=1,nodr | ||
1381 | + nn1=n*(n+1) | ||
1382 | + np1=n+1 | ||
1383 | + nm1=n-1 | ||
1384 | + a1vec(-n:n)=vwh_coef(-n:n,n,1,1)*umn(-nm1:np1,np1) & | ||
1385 | + +vwh_coef(-n:n,n,1,-1)*umn(-nm1:np1,nm1) | ||
1386 | + b1vec(-n:n)=vwh_coef(-n:n,n,-1,1)*umn(-np1:nm1,np1) & | ||
1387 | + +vwh_coef(-n:n,n,-1,-1)*umn(-np1:nm1,nm1) | ||
1388 | + z1vec(-n:n)=vwh_coef(-n:n,n,0,1)*umn(-n:n,np1) & | ||
1389 | + +vwh_coef(-n:n,n,0,-1)*umn(-n:n,nm1) | ||
1390 | + a2vec(-n:n)=vwh_coef(-n:n,n,1,0)*umn(-nm1:np1,n) | ||
1391 | + b2vec(-n:n)=vwh_coef(-n:n,n,-1,0)*umn(-np1:nm1,n) | ||
1392 | + z2vec(-n:n)=vwh_coef(-n:n,n,0,0)*umn(-n:n,n) | ||
1393 | + vwh(1,1,nn1-n:nn1+n)=-0.5d0*(a1vec(-n:n)+b1vec(-n:n)) | ||
1394 | + vwh(2,1,nn1-n:nn1+n)=-0.5d0*ci*(-a1vec(-n:n)+b1vec(-n:n)) | ||
1395 | + vwh(3,1,nn1-n:nn1+n)=-z1vec(-n:n) | ||
1396 | + vwh(1,2,nn1-n:nn1+n)=-0.5d0*ci*(a2vec(-n:n)+b2vec(-n:n)) | ||
1397 | + vwh(2,2,nn1-n:nn1+n)=-0.5d0*(a2vec(-n:n)-b2vec(-n:n)) | ||
1398 | + vwh(3,2,nn1-n:nn1+n)=-ci*z2vec(-n:n) | ||
1399 | + enddo | ||
1400 | + end subroutine vwhcalc | ||
1401 | +! | ||
1402 | +! svwf calculation for an axial translation | ||
1403 | +! | ||
1404 | +! | ||
1405 | +! original: 15 January 2011 | ||
1406 | +! revised: 23 February 2011: multiplied by root 2 | ||
1407 | +! | ||
1408 | + subroutine vwhaxialcalc(rpos,ri,nodr,itype,vwh) | ||
1409 | + use numconstants | ||
1410 | + implicit none | ||
1411 | + integer :: nodr,itype,m,n,p,nodrp1,nodrm1,nn1,mn,np1,nm1,mp1,mm1,ndim, & | ||
1412 | + nblkp | ||
1413 | + integer, save :: nodrmax | ||
1414 | + real(8) :: rpos(3),r,ct | ||
1415 | + real(8) pmn(-2:2,0:nodr+1) | ||
1416 | + complex(8) :: ci,vwh(3,2,2,1:nodr),ri,ephi,a,b,a1,b1,z1,a2,b2,z2 | ||
1417 | + complex(8) :: umn(-2:2,0:nodr+1), hn(0:nodr+1), ephim(-2:2) | ||
1418 | + data ci,nodrmax/(0.d0,1.d0),0/ | ||
1419 | + if(nodr.gt.nodrmax) then | ||
1420 | + nodrmax=nodr | ||
1421 | + call init(nodr+2) | ||
1422 | + endif | ||
1423 | + call cartosphere(rpos,r,ct,ephi) | ||
1424 | + if(r.le.1.d-4) then | ||
1425 | + vwh(:,:,:,1:nodr)=(0.d0,0.d0) | ||
1426 | + if(itype.eq.3) return | ||
1427 | + vwh(1,1,1,1)=.5d0*fnr(2)/fnr(3) | ||
1428 | + vwh(2,1,1,1)=-.5d0*ci*fnr(2)/fnr(3) | ||
1429 | + vwh(1,1,2,1)=-.5d0*fnr(2)/fnr(3) | ||
1430 | + vwh(2,1,2,1)=-.5d0*ci*fnr(2)/fnr(3) | ||
1431 | + return | ||
1432 | + endif | ||
1433 | + nodrp1=nodr+1 | ||
1434 | + nodrm1=nodr-1 | ||
1435 | + a=ri*r | ||
1436 | + if(itype.eq.1) then | ||
1437 | + call cricbessel(nodrp1,a,hn) | ||
1438 | + else | ||
1439 | + call crichankel(nodrp1,a,hn) | ||
1440 | + endif | ||
1441 | + hn(0:nodrp1)=hn(0:nodrp1)/a | ||
1442 | + call normalizedlegendre(ct,2,nodrp1,pmn) | ||
1443 | + call ephicoef(ephi,2,ephim) | ||
1444 | + umn(-2:2,0:nodrp1)=0.d0 | ||
1445 | + umn(0,0)=hn(0)*fnr(2) | ||
1446 | + do n=1,nodrp1 | ||
1447 | + p=min(n,2) | ||
1448 | + do m=-p,p | ||
1449 | + umn(m,n)=fnr(2)*pmn(m,n)*ephim(m)*hn(n) | ||
1450 | + enddo | ||
1451 | + enddo | ||
1452 | + vwh(:,:,:,1:nodr)=0.d0 | ||
1453 | + do n=1,nodr | ||
1454 | + np1=n+1 | ||
1455 | + nm1=n-1 | ||
1456 | + m=-1 | ||
1457 | + mp1=m+1 | ||
1458 | + mm1=m-1 | ||
1459 | + a1=vwh_coef(m,n,1,1)*umn(mp1,np1) & | ||
1460 | + +vwh_coef(m,n,1,-1)*umn(mp1,nm1) | ||
1461 | + b1=vwh_coef(m,n,-1,1)*umn(mm1,np1) & | ||
1462 | + +vwh_coef(m,n,-1,-1)*umn(mm1,nm1) | ||
1463 | + z1=vwh_coef(m,n,0,1)*umn(m,np1) & | ||
1464 | + +vwh_coef(m,n,0,-1)*umn(m,nm1) | ||
1465 | + a2=vwh_coef(m,n,1,0)*umn(mp1,n) | ||
1466 | + b2=vwh_coef(m,n,-1,0)*umn(mm1,n) | ||
1467 | + z2=vwh_coef(m,n,0,0)*umn(m,n) | ||
1468 | + vwh(1,1,1,n)=-0.5d0*(a1+b1) | ||
1469 | + vwh(2,1,1,n)=-0.5d0*ci*(-a1+b1) | ||
1470 | + vwh(3,1,1,n)=-z1 | ||
1471 | + vwh(1,2,1,n)=-0.5d0*ci*(a2+b2) | ||
1472 | + vwh(2,2,1,n)=-0.5d0*(a2-b2) | ||
1473 | + vwh(3,2,1,n)=-ci*z2 | ||
1474 | + m=1 | ||
1475 | + mp1=m+1 | ||
1476 | + mm1=m-1 | ||
1477 | + a1=vwh_coef(m,n,1,1)*umn(mp1,np1) & | ||
1478 | + +vwh_coef(m,n,1,-1)*umn(mp1,nm1) | ||
1479 | + b1=vwh_coef(m,n,-1,1)*umn(mm1,np1) & | ||
1480 | + +vwh_coef(m,n,-1,-1)*umn(mm1,nm1) | ||
1481 | + z1=vwh_coef(m,n,0,1)*umn(m,np1) & | ||
1482 | + +vwh_coef(m,n,0,-1)*umn(m,nm1) | ||
1483 | + a2=vwh_coef(m,n,1,0)*umn(mp1,n) | ||
1484 | + b2=vwh_coef(m,n,-1,0)*umn(mm1,n) | ||
1485 | + z2=vwh_coef(m,n,0,0)*umn(m,n) | ||
1486 | + vwh(1,1,2,n)=-0.5d0*(a1+b1) | ||
1487 | + vwh(2,1,2,n)=-0.5d0*ci*(-a1+b1) | ||
1488 | + vwh(3,1,2,n)=-z1 | ||
1489 | + vwh(1,2,2,n)=-0.5d0*ci*(a2+b2) | ||
1490 | + vwh(2,2,2,n)=-0.5d0*(a2-b2) | ||
1491 | + vwh(3,2,2,n)=-ci*z2 | ||
1492 | + enddo | ||
1493 | + return | ||
1494 | + end subroutine vwhaxialcalc | ||
1495 | + | ||
1496 | + end module specialfuncs | ||
1497 | +! | ||
1498 | +! module mpidata | ||
1499 | +! | ||
1500 | +! | ||
1501 | +! last revised: 15 January 2011 | ||
1502 | +! | ||
1503 | + module mpidata | ||
1504 | + implicit none | ||
1505 | + integer :: group_comm,root_group_comm,base_rank,group_rank,root_group_rank, & | ||
1506 | + base_group,number_groups,proc_per_group,number_proc | ||
1507 | + integer, allocatable :: mpi_sphere_index(:), mpi_sphere_number(:) | ||
1508 | + | ||
1509 | + contains | ||
1510 | +! | ||
1511 | +! allocates the processors into groups | ||
1512 | +! | ||
1513 | +! last revised: 15 January 2011: original | ||
1514 | +! 20 April 2011: fixedorran=0 now looks for 2 groups. | ||
1515 | +! 10 october 2011: option for not storing matrices. If fixorran=0, 2 groups, else | ||
1516 | +! nproc groups | ||
1517 | +! november 2011: near and far field translation differentiation | ||
1518 | +! | ||
1519 | + subroutine mpisetup(nsphere,nodr,rpos,fixorran,maxmbperproc,istore, & | ||
1520 | + nfdistance,fftranpresent,iunit) | ||
1521 | + use mpidefs | ||
1522 | + use intrinsics | ||
1523 | + use specialfuncs | ||
1524 | + implicit none | ||
1525 | + integer :: nsphere,numprocs,ierr,i,iunit,nodr(nsphere),fixorran, & | ||
1526 | + nodrmax,nodrmin,temp_comm,newgroup,j,rank,maxmbperproc, & | ||
1527 | + istore,nfspheres,fftranpresent,ffspheres | ||
1528 | + integer, allocatable :: grouplist1(:),grouplist2(:) | ||
1529 | + real(8) :: memrow(nsphere),memtot,maxmemproc,memperproc | ||
1530 | + real(8) :: fp,sum,rpos(3,*),nfdistance,rij(3),r,avenfspheres,rmax, & | ||
1531 | + nfdistancei,aveffspheres | ||
1532 | + maxmemproc=maxmbperproc*1.d6 | ||
1533 | + call ms_mpi(mpi_command='size',mpi_size=numprocs) | ||
1534 | + call ms_mpi(mpi_command='rank',mpi_rank=rank) | ||
1535 | + call ms_mpi(mpi_command='group',mpi_group=base_group) | ||
1536 | + base_rank=rank | ||
1537 | + number_proc=numprocs | ||
1538 | + memrow=0.d0 | ||
1539 | + memtot=0.d0 | ||
1540 | +! | ||
1541 | +! compute the memory storage requirements | ||
1542 | +! | ||
1543 | + avenfspheres=0. | ||
1544 | + aveffspheres=0. | ||
1545 | + rmax=0. | ||
1546 | + if(1.eq.1) then | ||
1547 | + do i=1,nsphere | ||
1548 | + nfspheres=0 | ||
1549 | + do j=1,nsphere | ||
1550 | + rij(:)=rpos(:,i)-rpos(:,j) | ||
1551 | + if(j.ne.i) then | ||
1552 | + if(nfdistance.lt.0.) then | ||
1553 | + nfdistancei=(.5*dble(nodr(i)+nodr(j)))**2. | ||
1554 | + else | ||
1555 | + nfdistancei=nfdistance | ||
1556 | + endif | ||
1557 | + r=sqrt(dot_product(rij,rij)) | ||
1558 | + rmax=max(rmax,r) | ||
1559 | + if(r.le.nfdistancei) then | ||
1560 | + nfspheres=nfspheres+1 | ||
1561 | + nodrmax=max(nodr(j),nodr(i)) | ||
1562 | + nodrmin=min(nodr(j),nodr(i)) | ||
1563 | + memrow(i)=memrow(i)+(2*nodrmin+1)*(1+nodrmax*(nodrmax+2))*8.d0 | ||
1564 | + memrow(i)=memrow(i)+nodr(i)*nodr(j)*(nodr(j)+3)*16.d0 | ||
1565 | + memrow(i)=memrow(i)+(2*nodrmax+1)*16.d0 | ||
1566 | + endif | ||
1567 | + if(r.gt.nfdistancei.and.istore.eq.2) then | ||
1568 | + memrow(i)=memrow(i)+2*nodrmax*(nodrmax+2)*16.d0 | ||
1569 | + endif | ||
1570 | + endif | ||
1571 | + enddo | ||
1572 | + ffspheres=nsphere-1-nfspheres | ||
1573 | + avenfspheres=avenfspheres+nfspheres | ||
1574 | + aveffspheres=aveffspheres+ffspheres | ||
1575 | + memtot=memtot+memrow(i) | ||
1576 | + enddo | ||
1577 | + if(aveffspheres.eq.0) then | ||
1578 | + fftranpresent=0 | ||
1579 | + else | ||
1580 | + fftranpresent=1 | ||
1581 | + endif | ||
1582 | + proc_per_group=ceiling(memtot/maxmemproc) | ||
1583 | + proc_per_group=min(proc_per_group,numprocs) | ||
1584 | + proc_per_group=max(proc_per_group,1) | ||
1585 | + do | ||
1586 | + if(mod(numprocs,proc_per_group).eq.0) exit | ||
1587 | + if(proc_per_group.eq.numprocs) exit | ||
1588 | + proc_per_group=proc_per_group+1 | ||
1589 | + enddo | ||
1590 | + endif | ||
1591 | + avenfspheres=avenfspheres/dble(nsphere) | ||
1592 | + if(rank.eq.0) then | ||
1593 | + write(iunit,'('' average near field translations per sphere:'', f10.1)') avenfspheres | ||
1594 | + call flush(iunit) | ||
1595 | + endif | ||
1596 | +! | ||
1597 | +! no-store option | ||
1598 | +! | ||
1599 | + if(istore.eq.0) then | ||
1600 | + if(fixorran.eq.0) then | ||
1601 | + proc_per_group=max(floor(dble(numprocs)/2.),1) | ||
1602 | + else | ||
1603 | + proc_per_group=1 | ||
1604 | + endif | ||
1605 | + memrow=1.d0 | ||
1606 | + memtot=dble(nsphere) | ||
1607 | + else | ||
1608 | +! | ||
1609 | +! only one or two groups for fixed orientation | ||
1610 | +! | ||
1611 | + if(fixorran.eq.0) proc_per_group=max(floor(dble(numprocs)/2.),proc_per_group) | ||
1612 | + endif | ||
1613 | + number_groups=numprocs/proc_per_group | ||
1614 | + if(allocated(mpi_sphere_index)) deallocate(mpi_sphere_index) | ||
1615 | + if(allocated(mpi_sphere_number)) deallocate(mpi_sphere_number) | ||
1616 | + allocate(mpi_sphere_index(0:proc_per_group-1),mpi_sphere_number(0:proc_per_group-1), & | ||
1617 | + grouplist1(proc_per_group),grouplist2(number_groups)) | ||
1618 | + memperproc=memtot/dble(proc_per_group) | ||
1619 | +! | ||
1620 | +! associate the spheres with the processors in a group | ||
1621 | +! | ||
1622 | + mpi_sphere_index(0)=0 | ||
1623 | + do j=1,proc_per_group-1 | ||
1624 | + memtot=0.d0 | ||
1625 | + do i=1,nsphere | ||
1626 | + memtot=memtot+memrow(i) | ||
1627 | + if(memtot.gt.dble(j)*memperproc) then | ||
1628 | + mpi_sphere_index(j)=i-1 | ||
1629 | + exit | ||
1630 | + endif | ||
1631 | + enddo | ||
1632 | + enddo | ||
1633 | + do i=0,proc_per_group-2 | ||
1634 | + mpi_sphere_number(i)=mpi_sphere_index(i+1)-mpi_sphere_index(i) | ||
1635 | + enddo | ||
1636 | + mpi_sphere_number(proc_per_group-1)=nsphere-mpi_sphere_index(proc_per_group-1) | ||
1637 | +! | ||
1638 | +! assign the sphere-based groups | ||
1639 | +! | ||
1640 | + do i=0,number_groups-1 | ||
1641 | + do j=0,proc_per_group-1 | ||
1642 | + grouplist1(j+1)=i*proc_per_group+j | ||
1643 | + enddo | ||
1644 | + call ms_mpi(mpi_command='incl',mpi_group=base_group,mpi_size=proc_per_group, & | ||
1645 | + mpi_new_group_list=grouplist1,mpi_new_group=newgroup) | ||
1646 | + call ms_mpi(mpi_command='create',mpi_group=newgroup,mpi_new_comm=temp_comm) | ||
1647 | + if(rank.ge.grouplist1(1).and.rank.le.grouplist1(proc_per_group)) then | ||
1648 | + group_comm=temp_comm | ||
1649 | + endif | ||
1650 | + grouplist2(i+1)=i*proc_per_group | ||
1651 | + enddo | ||
1652 | +! | ||
1653 | +! make a group associated with the rank 0 members of the sphere groups | ||
1654 | +! | ||
1655 | + call ms_mpi(mpi_command='incl',mpi_group=base_group,mpi_size=number_groups, & | ||
1656 | + mpi_new_group_list=grouplist2,mpi_new_group=newgroup) | ||
1657 | + call ms_mpi(mpi_command='create',mpi_group=newgroup,mpi_new_comm=temp_comm) | ||
1658 | + group_rank=mod(rank,proc_per_group) | ||
1659 | + root_group_rank=floor(dble(rank)/dble(proc_per_group)) | ||
1660 | + if(group_rank.eq.0) root_group_comm=temp_comm | ||
1661 | + if(rank.eq.0) then | ||
1662 | + if(istore.ge.1) then | ||
1663 | + write(iunit,'('' number of processors, number groups, mb mem/processor:'',2i5,f9.3)') & | ||
1664 | + numprocs,number_groups,memperproc*1.d-6 | ||
1665 | + if(memperproc.gt.maxmemproc) then | ||
1666 | + write(iunit,'('' warning: set maximum memory/processor is exceeded!!'')') | ||
1667 | + endif | ||
1668 | + else | ||
1669 | + write(iunit,'('' number of processors, number groups:'',2i5)') & | ||
1670 | + numprocs,number_groups | ||
1671 | + endif | ||
1672 | + call flush(iunit) | ||
1673 | + endif | ||
1674 | + deallocate(grouplist1,grouplist2) | ||
1675 | + end subroutine mpisetup | ||
1676 | + | ||
1677 | + end module mpidata | ||
1678 | + | ||
1679 | +! | ||
1680 | +! module spheredata: used to 1) input sphere data, 2) dimension sphere data | ||
1681 | +! arrays, and 3) provide common access to the data in other subroutines. | ||
1682 | +! | ||
1683 | +! | ||
1684 | +! last revised: 15 January 2011 | ||
1685 | +! | ||
1686 | +! 30 March 2011: added optical activity | ||
1687 | +! | ||
1688 | + module spheredata | ||
1689 | + use specialfuncs | ||
1690 | + use mpidata | ||
1691 | + implicit none | ||
1692 | + integer, private :: numberspheres,numberiterations,fixedorrandom,numbertheta, & | ||
1693 | + calcnf,nfplane,calctmatrix,runprintunit,calcamn,maxmemperproc, & | ||
1694 | + trackiterations,nfoutdata,normalizesm,storetranmat,niterstep, & | ||
1695 | + fftranpresent | ||
1696 | + real(8), private :: lengthscalefactor,realriscalefactor,imriscalefactor,epsmie, & | ||
1697 | + epstran,epssoln,phideg,thetamindeg,thetamaxdeg,alphadeg, & | ||
1698 | + betadeg,epstcon,nfplanepos,nfplanevert(2,2),deltax,gammadeg,epspw, & | ||
1699 | + cgaussbeam,gaussbeamfocus(3),realchiralfactor,imchiralfactor,nfdistance | ||
1700 | + character(30), private :: positionfile,outputfile,nfoutputfile,tmatrixfile,printfile, & | ||
1701 | + amnfile | ||
1702 | + real(8), private :: xspmax,xvsp | ||
1703 | + real(8), private, allocatable :: rpos(:,:),xsp(:) | ||
1704 | + complex(8), private, allocatable :: ri(:,:) | ||
1705 | + data numberiterations,fixedorrandom,numbertheta/2000,0,181/ | ||
1706 | + data calcamn,trackiterations,niterstep/1,1,20/ | ||
1707 | + data lengthscalefactor,realriscalefactor,imriscalefactor,epsmie, & | ||
1708 | + epstran,epssoln,phideg,thetamindeg,thetamaxdeg,alphadeg, & | ||
1709 | + betadeg,epstcon/1.d0,1.d0,1.d0,1.d-4,1.d-6,1.d-10,0.d0,0.d0, & | ||
1710 | + 180.d0,0.d0,0.d0,1.d-6/ | ||
1711 | + data realchiralfactor,imchiralfactor/0.d0,0.d0/ | ||
1712 | + data normalizesm,storetranmat,nfdistance/0,1,-1.d0/ | ||
1713 | + data maxmemperproc/1500/ | ||
1714 | + data cgaussbeam/0.d0/ | ||
1715 | + data gaussbeamfocus/0.d0,0.d0,0.d0/ | ||
1716 | + data calcnf,calctmatrix,nfoutdata/0,1,1/ | ||
1717 | + data runprintunit/6/ | ||
1718 | + data positionfile,outputfile,tmatrixfile,printfile/'at_bottom','test.dat','tmatrix-temp.dat',' '/ | ||
1719 | + data nfoutputfile/'nf-temp.dat'/ | ||
1720 | + data amnfile/'amn-temp.dat'/ | ||
1721 | + | ||
1722 | + contains | ||
1723 | +! | ||
1724 | +! Find the number of data points in input unit iunit, and reposition the unit to the | ||
1725 | +! point after record containing parmid | ||
1726 | +! | ||
1727 | +! | ||
1728 | +! last revised: 15 January 2011 | ||
1729 | +! | ||
1730 | + subroutine numberinrecord(iunit,parmid,numrec) | ||
1731 | + implicit none | ||
1732 | + integer :: numrec,iunit | ||
1733 | + character*1 :: a | ||
1734 | + character*35 :: parmid | ||
1735 | + character*10 :: rec | ||
1736 | + numrec=0 | ||
1737 | + do | ||
1738 | + read(iunit,"(a)",advance="no",err=100,eor=100) a | ||
1739 | + if(a.ne.' '.and.a.ne.',') then | ||
1740 | +! | ||
1741 | +! start of a number | ||
1742 | +! | ||
1743 | + numrec=numrec+1 | ||
1744 | +! | ||
1745 | +! look for the delimeter | ||
1746 | +! | ||
1747 | + do | ||
1748 | + read(iunit,"(a)",advance="no",err=100,eor=100) a | ||
1749 | + if(a.eq.' '.or.a.eq.',') exit | ||
1750 | + enddo | ||
1751 | + endif | ||
1752 | + enddo | ||
1753 | +100 if(parmid.eq.'rewind') then | ||
1754 | + rewind(iunit) | ||
1755 | + else | ||
1756 | + backspace(iunit) | ||
1757 | + backspace(iunit) | ||
1758 | + backspace(iunit) | ||
1759 | + do | ||
1760 | + read(iunit,'(a10)') rec | ||
1761 | + if(rec.eq.parmid(1:10)) exit | ||
1762 | + enddo | ||
1763 | + endif | ||
1764 | + end subroutine numberinrecord | ||
1765 | +! | ||
1766 | +! inputdata: reads parameters from inputfile | ||
1767 | +! reads sphere data from position file | ||
1768 | +! | ||
1769 | +! | ||
1770 | +! original: 15 January 2011 | ||
1771 | +! revised: 21 February 2011: fix output file initialization. | ||
1772 | +! 30 March 2011: added optical activity | ||
1773 | +! | ||
1774 | +! | ||
1775 | + subroutine inputdata(inputfile,printdata) | ||
1776 | + integer :: imax,i,j,ierr,iunit,numrec,nsphere,printdata | ||
1777 | + real(8) :: rmax,rtoi,rposmean(3),rireal,riimag,dtemp,betareal,betaimag, & | ||
1778 | + rij,xij(3),rijmax | ||
1779 | + real(8), allocatable :: sdat(:) | ||
1780 | + complex(8) :: ribulk,beta | ||
1781 | + character*35 :: parmid | ||
1782 | + character*30 :: inputfile | ||
1783 | +! | ||
1784 | +! cycle through parameter input operations | ||
1785 | +! | ||
1786 | + open(1,file=inputfile) | ||
1787 | + do | ||
1788 | + read(1,'(a)',end=10) parmid | ||
1789 | + parmid=parmid(:index(parmid,' ')) | ||
1790 | + if(parmid.eq.'number_spheres') then | ||
1791 | + read(1,*) numberspheres | ||
1792 | + cycle | ||
1793 | + endif | ||
1794 | + if(parmid.eq.'sphere_position_file') then | ||
1795 | + read(1,'(a)') positionfile | ||
1796 | + positionfile=positionfile(:index(positionfile,' ')) | ||
1797 | + cycle | ||
1798 | + endif | ||
1799 | + if(parmid.eq.'output_file') then | ||
1800 | + read(1,'(a)') outputfile | ||
1801 | + outputfile=outputfile(:index(outputfile,' ')) | ||
1802 | + cycle | ||
1803 | + endif | ||
1804 | + if(parmid.eq.'run_print_file') then | ||
1805 | + read(1,'(a)') printfile | ||
1806 | + printfile=printfile(:index(printfile,' ')) | ||
1807 | + if(printdata.eq.1) then | ||
1808 | + if((printfile.eq.' '.or.printfile.eq.'console')) then | ||
1809 | + printfile=' ' | ||
1810 | + runprintunit=6 | ||
1811 | + else | ||
1812 | + runprintunit=4 | ||
1813 | + open(runprintunit,file=printfile) | ||
1814 | + endif | ||
1815 | + else | ||
1816 | + runprintunit=6 | ||
1817 | + endif | ||
1818 | + cycle | ||
1819 | + endif | ||
1820 | + if(parmid.eq.'length_scale_factor') then | ||
1821 | + read(1,*) lengthscalefactor | ||
1822 | + cycle | ||
1823 | + endif | ||
1824 | + if(parmid.eq.'real_ref_index_scale_factor') then | ||
1825 | + read(1,*) realriscalefactor | ||
1826 | + cycle | ||
1827 | + endif | ||
1828 | + if(parmid.eq.'imag_ref_index_scale_factor') then | ||
1829 | + read(1,*) imriscalefactor | ||
1830 | + cycle | ||
1831 | + endif | ||
1832 | + if(parmid.eq.'real_chiral_factor') then | ||
1833 | + read(1,*) realchiralfactor | ||
1834 | + cycle | ||
1835 | + endif | ||
1836 | + if(parmid.eq.'imag_chiral_factor') then | ||
1837 | + read(1,*) imchiralfactor | ||
1838 | + cycle | ||
1839 | + endif | ||
1840 | + if(parmid.eq.'mie_epsilon') then | ||
1841 | + read(1,*) epsmie | ||
1842 | + cycle | ||
1843 | + endif | ||
1844 | + if(parmid.eq.'translation_epsilon') then | ||
1845 | + read(1,*) epstran | ||
1846 | + cycle | ||
1847 | + endif | ||
1848 | + if(parmid.eq.'solution_epsilon') then | ||
1849 | + read(1,*) epssoln | ||
1850 | + cycle | ||
1851 | + endif | ||
1852 | + if(parmid.eq.'max_number_iterations') then | ||
1853 | + read(1,*) numberiterations | ||
1854 | + cycle | ||
1855 | + endif | ||
1856 | + if(parmid.eq.'max_memory_per_processor') then | ||
1857 | + read(1,*) maxmemperproc | ||
1858 | + cycle | ||
1859 | + endif | ||
1860 | + if(parmid.eq.'store_translation_matrix') then | ||
1861 | + read(1,*) storetranmat | ||
1862 | + cycle | ||
1863 | + endif | ||
1864 | + if(parmid.eq.'near_field_distance') then | ||
1865 | + read(1,*) nfdistance | ||
1866 | + cycle | ||
1867 | + endif | ||
1868 | + if(parmid.eq.'iterations_per_correction') then | ||
1869 | + read(1,*) niterstep | ||
1870 | + cycle | ||
1871 | + endif | ||
1872 | + if(parmid.eq.'fixed_or_random_orientation') then | ||
1873 | + read(1,*) fixedorrandom | ||
1874 | + cycle | ||
1875 | + endif | ||
1876 | + if(parmid.eq.'scattering_plane_angle_deg') then | ||
1877 | + read(1,*) phideg | ||
1878 | + cycle | ||
1879 | + endif | ||
1880 | + if(parmid.eq.'min_scattering_angle_deg') then | ||
1881 | + read(1,*) thetamindeg | ||
1882 | + cycle | ||
1883 | + endif | ||
1884 | + if(parmid.eq.'max_scattering_angle_deg') then | ||
1885 | + read(1,*) thetamaxdeg | ||
1886 | + cycle | ||
1887 | + endif | ||
1888 | + if(parmid.eq.'number_scattering_angles') then | ||
1889 | + read(1,*) numbertheta | ||
1890 | + cycle | ||
1891 | + endif | ||
1892 | + if(parmid.eq.'normalize_scattering_matrix') then | ||
1893 | + read(1,*) normalizesm | ||
1894 | + cycle | ||
1895 | + endif | ||
1896 | + if(parmid.eq.'incident_azimuth_angle_deg') then | ||
1897 | + read(1,*) alphadeg | ||
1898 | + cycle | ||
1899 | + endif | ||
1900 | + if(parmid.eq.'incident_polar_angle_deg') then | ||
1901 | + read(1,*) betadeg | ||
1902 | + cycle | ||
1903 | + endif | ||
1904 | + if(parmid.eq.'calculate_scattering_coefficients') then | ||
1905 | + read(1,*) calcamn | ||
1906 | + cycle | ||
1907 | + endif | ||
1908 | + if(parmid.eq.'scattering_coefficient_file') then | ||
1909 | + read(1,'(a)') amnfile | ||
1910 | + if(amnfile.eq.' ') then | ||
1911 | + amnfile='amn-temp.dat' | ||
1912 | + else | ||
1913 | + amnfile=amnfile(:index(amnfile,' ')) | ||
1914 | + endif | ||
1915 | + cycle | ||
1916 | + endif | ||
1917 | + if(parmid.eq.'track_iterations') then | ||
1918 | + read(1,*) trackiterations | ||
1919 | + cycle | ||
1920 | + endif | ||
1921 | + if(parmid.eq.'calculate_near_field') then | ||
1922 | + read(1,*) calcnf | ||
1923 | + cycle | ||
1924 | + endif | ||
1925 | + if(parmid.eq.'near_field_plane_coord') then | ||
1926 | + read(1,*) nfplane | ||
1927 | + cycle | ||
1928 | + endif | ||
1929 | + if(parmid.eq.'near_field_plane_position') then | ||
1930 | + read(1,*) nfplanepos | ||
1931 | + cycle | ||
1932 | + endif | ||
1933 | + if(parmid.eq.'near_field_plane_vertices') then | ||
1934 | + read(1,*) nfplanevert | ||
1935 | + cycle | ||
1936 | + endif | ||
1937 | + if(parmid.eq.'spacial_step_size') then | ||
1938 | + read(1,*) deltax | ||
1939 | + cycle | ||
1940 | + endif | ||
1941 | + if(parmid.eq.'polarization_angle_deg') then | ||
1942 | + read(1,*) gammadeg | ||
1943 | + cycle | ||
1944 | + endif | ||
1945 | + if(parmid.eq.'near_field_output_file') then | ||
1946 | + read(1,'(a)') nfoutputfile | ||
1947 | + if(nfoutputfile.eq.' ') then | ||
1948 | + nfoutputfile='nf-temp.dat' | ||
1949 | + else | ||
1950 | + nfoutputfile=nfoutputfile(:index(nfoutputfile,' ')) | ||
1951 | + endif | ||
1952 | + cycle | ||
1953 | + endif | ||
1954 | + if(parmid.eq.'near_field_output_data') then | ||
1955 | + read(1,*) nfoutdata | ||
1956 | + cycle | ||
1957 | + endif | ||
1958 | + if(parmid.eq.'plane_wave_epsilon') then | ||
1959 | + read(1,*) epspw | ||
1960 | + cycle | ||
1961 | + endif | ||
1962 | + if(parmid.eq.'gaussian_beam_constant') then | ||
1963 | + read(1,*) cgaussbeam | ||
1964 | + cycle | ||
1965 | + endif | ||
1966 | + if(parmid.eq.'gaussian_beam_focal_point') then | ||
1967 | + read(1,*) gaussbeamfocus | ||
1968 | + cycle | ||
1969 | + endif | ||
1970 | + if(parmid.eq.'t_matrix_convergence_epsilon') then | ||
1971 | + read(1,*) epstcon | ||
1972 | + cycle | ||
1973 | + endif | ||
1974 | + if(parmid.eq.'calculate_t_matrix') then | ||
1975 | + read(1,*) calctmatrix | ||
1976 | + cycle | ||
1977 | + endif | ||
1978 | + if(parmid.eq.'t_matrix_file') then | ||
1979 | + read(1,'(a)') tmatrixfile | ||
1980 | + if(tmatrixfile.eq.' ') then | ||
1981 | + tmatrixfile='tmatrix-temp.dat' | ||
1982 | + else | ||
1983 | + tmatrixfile=tmatrixfile(:index(tmatrixfile,' ')) | ||
1984 | + endif | ||
1985 | + cycle | ||
1986 | + endif | ||
1987 | + if(parmid.eq.'sphere_sizes_and_positions') exit | ||
1988 | + if(parmid.eq.'end_of_options') exit | ||
1989 | + write(*,'('' warning: unknown parameter ID:'',a35)') parmid | ||
1990 | + enddo | ||
1991 | +! | ||
1992 | +! end of parameter input options. Input of sphere data follows | ||
1993 | +! | ||
1994 | +10 write(runprintunit,'('' input file is '',a30)') inputfile | ||
1995 | + if(positionfile.ne.'at_bottom'.and.positionfile.ne.' ') then | ||
1996 | + close(1) | ||
1997 | + open(1,file=positionfile) | ||
1998 | + parmid='rewind' | ||
1999 | + endif | ||
2000 | +! | ||
2001 | +! find number of records in position file | ||
2002 | +! | ||
2003 | + call numberinrecord(1,parmid,numrec) | ||
2004 | + if(printdata.eq.1) write(runprintunit,'('' position data has '',i3,'' records'')') numrec | ||
2005 | + nsphere=numberspheres | ||
2006 | + iunit=1 | ||
2007 | + allocate(sdat(numrec)) | ||
2008 | + allocate(xsp(0:nsphere),rpos(3,0:nsphere),ri(2,0:nsphere),stat=ierr) | ||
2009 | + xvsp=0.d0 | ||
2010 | + do i=1,nsphere | ||
2011 | + read(iunit,*,end=20) sdat | ||
2012 | + xsp(i)=sdat(1)*lengthscalefactor | ||
2013 | + rpos(1:3,i)=sdat(2:4)*lengthscalefactor | ||
2014 | + if(numrec.gt.4) then | ||
2015 | + rireal=sdat(5)*realriscalefactor | ||
2016 | + riimag=sdat(6)*imriscalefactor | ||
2017 | + else | ||
2018 | + rireal=realriscalefactor | ||
2019 | + riimag=imriscalefactor | ||
2020 | + endif | ||
2021 | + if(numrec.gt.6) then | ||
2022 | + betareal=sdat(7)*realchiralfactor | ||
2023 | + betaimag=sdat(8)*imchiralfactor | ||
2024 | + else | ||
2025 | + betareal=realchiralfactor | ||
2026 | + betaimag=imchiralfactor | ||
2027 | + endif | ||
2028 | + ribulk=dcmplx(rireal,riimag) | ||
2029 | + beta=dcmplx(betareal,betaimag) | ||
2030 | + if(beta.eq.(0.d0,0.d0)) then | ||
2031 | + ri(1,i)=ribulk | ||
2032 | + ri(2,i)=ribulk | ||
2033 | + else | ||
2034 | + ri(1,i)=ribulk/(1.d0-beta*ribulk) | ||
2035 | + ri(2,i)=ribulk/(1.d0+beta*ribulk) | ||
2036 | + endif | ||
2037 | + xvsp=xvsp+xsp(i)**3.d0 | ||
2038 | + enddo | ||
2039 | +20 nsphere=min(nsphere,i-1) | ||
2040 | + close(iunit) | ||
2041 | + deallocate(sdat) | ||
2042 | + if(nsphere.ne.numberspheres.and.printdata.eq.1) then | ||
2043 | + write(runprintunit,'('' warning: insufficient position points in file.'')') | ||
2044 | + write(runprintunit,'('' number of spheres truncated to:'',i5)') nsphere | ||
2045 | + endif | ||
2046 | +! | ||
2047 | +! check for overlapping spheres, and find maximum translation | ||
2048 | +! | ||
2049 | + rijmax=0. | ||
2050 | + do i=1,nsphere | ||
2051 | + do j=i+1,nsphere | ||
2052 | + xij=rpos(:,i)-rpos(:,j) | ||
2053 | + rij=sqrt(dot_product(xij,xij)) | ||
2054 | + rijmax=max(rijmax,rij) | ||
2055 | + if(rij/(xsp(i)+xsp(j)).lt..999d0) then | ||
2056 | + write(runprintunit,'('' warning: spheres '',i4,'' and '',i4 '' overlap. '',& | ||
2057 | + & '' scaled distance:'' f8.4)') i,j,rij/(xsp(i)+xsp(j)) | ||
2058 | + endif | ||
2059 | + enddo | ||
2060 | + enddo | ||
2061 | + if(rijmax.gt.nfdistance) then | ||
2062 | + fftranpresent=1 | ||
2063 | + else | ||
2064 | + fftranpresent=0 | ||
2065 | + endif | ||
2066 | + numberspheres=nsphere | ||
2067 | + xvsp=xvsp**(1.d0/3.d0) | ||
2068 | + gaussbeamfocus=gaussbeamfocus*lengthscalefactor | ||
2069 | + if(nsphere.eq.1) then | ||
2070 | + rposmean=rpos(:,1) | ||
2071 | + rpos(:,1)=0.d0 | ||
2072 | + xspmax=xsp(1) | ||
2073 | + else | ||
2074 | + rposmean=0.d0 | ||
2075 | + do i=1,nsphere | ||
2076 | + rposmean=rposmean+rpos(:,i) | ||
2077 | + enddo | ||
2078 | + rposmean=rposmean/dble(nsphere) | ||
2079 | + rmax=0.d0 | ||
2080 | +! | ||
2081 | +! the target origin is defined as the GB focal point. | ||
2082 | +! | ||
2083 | + do i=1,nsphere | ||
2084 | +! rpos(1:3,i)=rpos(1:3,i)-rposmean(1:3) | ||
2085 | + rpos(1:3,i)=rpos(1:3,i)-gaussbeamfocus(1:3) | ||
2086 | + rtoi=dot_product(rpos(:,i),rpos(:,i)) | ||
2087 | + if(rtoi.gt.rmax) then | ||
2088 | + rmax=rtoi | ||
2089 | + imax=i | ||
2090 | + endif | ||
2091 | + enddo | ||
2092 | + xspmax=sqrt(rmax)+xsp(imax) | ||
2093 | + endif | ||
2094 | +! | ||
2095 | +! xsp(0) is the circumscribing sphere size parameter | ||
2096 | +! | ||
2097 | + xsp(0)=xspmax | ||
2098 | + ri(1,0)=(1.d0,0.d0) | ||
2099 | + ri(2,0)=(1.d0,0.d0) | ||
2100 | + rpos(:,0)=0.d0 | ||
2101 | +! | ||
2102 | +! write run data to run file and output file | ||
2103 | +! | ||
2104 | + if(printdata.eq.1) then | ||
2105 | + call writerundata(runprintunit) | ||
2106 | + call flush(runprintunit) | ||
2107 | + open(1,file=outputfile,status='replace',action='write') | ||
2108 | + call writerundata(1) | ||
2109 | + close(1) | ||
2110 | + endif | ||
2111 | + end subroutine inputdata | ||
2112 | +! | ||
2113 | +! writes run data to output unit iunit | ||
2114 | +! | ||
2115 | +! | ||
2116 | +! last revised: 15 January 2011 | ||
2117 | +! 30 March 2011: added optical activity | ||
2118 | +! | ||
2119 | + subroutine writerundata(iunit) | ||
2120 | + implicit none | ||
2121 | + integer :: iunit,i | ||
2122 | + character*1 :: lf | ||
2123 | + if(iunit.ne.1) then | ||
2124 | + lf = ' ' | ||
2125 | + else | ||
2126 | + lf = '/' | ||
2127 | + endif | ||
2128 | + write(iunit,'('' number of spheres, volume size parameter:'' '//lf//',i5,e13.5)') & | ||
2129 | + numberspheres,xvsp | ||
2130 | + write(iunit,'('' position file:'' '//lf//',a)') positionfile | ||
2131 | + write(iunit,'('' output file:'' '//lf//',a)') outputfile | ||
2132 | + write(iunit,'('' length, ref. indx. scale factors:'' '//lf//',3f8.3)') lengthscalefactor, & | ||
2133 | + realriscalefactor,imriscalefactor | ||
2134 | + write(iunit,'('' chiral factors:'' '//lf//',2e13.5)') & | ||
2135 | + realchiralfactor,imchiralfactor | ||
2136 | + write(iunit,'('' thetamin, thetamax, num. theta:'' '//lf//',2f9.1,i5)') & | ||
2137 | + thetamindeg,thetamaxdeg,numbertheta | ||
2138 | + write(iunit,'('' epsmie, epssoln, max number iterations:'' '//lf//',2e12.4,i5)') epsmie, & | ||
2139 | + epssoln, numberiterations | ||
2140 | + if(fftranpresent.eq.1) then | ||
2141 | + write(iunit,'('' far field kr, iterations/correction:'' '//lf//',e12.4,i5)') & | ||
2142 | + nfdistance,niterstep | ||
2143 | + else | ||
2144 | + write(iunit,'('' all translations computed exactly'' '//lf//')') | ||
2145 | + endif | ||
2146 | + if(cgaussbeam.ne.0.d0) then | ||
2147 | + write(iunit,'('' gaussian incident beam: 1/width:'' '//lf//',f9.4,)') cgaussbeam | ||
2148 | + write(iunit,'('' beam focal point:'' '//lf//',3f9.3,)') gaussbeamfocus | ||
2149 | + else | ||
2150 | + write(iunit,'('' plane wave incidence'')') | ||
2151 | + endif | ||
2152 | + if(fixedorrandom.eq.0) then | ||
2153 | + write(iunit,'('' fixed orientation calculations'')') | ||
2154 | + write(iunit,'('' scattering plane, incident alpha, beta:'' '//lf//',3f9.2)') & | ||
2155 | + phideg,alphadeg,betadeg | ||
2156 | + write(iunit,'('' common expansion epsilon:'' '//lf//',e12.4)') epstran | ||
2157 | + if(calcamn.eq.0) then | ||
2158 | + write(iunit,'('' scattering coefficients read from file '' '//lf//',a)') amnfile | ||
2159 | + else | ||
2160 | + write(iunit,'('' scattering coefficients calculated, stored in file '' '//lf//',a)') amnfile | ||
2161 | + endif | ||
2162 | + if(calcnf.eq.1) then | ||
2163 | + write(iunit,'('' near field calculated, stored in file '' '//lf//',a)') nfoutputfile | ||
2164 | + write(iunit,'('' near field data output option: '' '//lf//',i4)') nfoutdata | ||
2165 | + write(iunit,'('' near field plane, position: '' '//lf//', i4,f9.3)') nfplane, nfplanepos | ||
2166 | + write(iunit,'('' near field plane vertices: '' '//lf//',4f9.3)') nfplanevert | ||
2167 | + write(iunit,'('' spacial step size:'' '//lf//',f9.4)') deltax | ||
2168 | + write(iunit,'('' polarization angle, deg.:'' '//lf//',f9.2)') gammadeg | ||
2169 | + write(iunit,'('' plane wave epsilon:'' '//lf//',e13.5)') epspw | ||
2170 | + endif | ||
2171 | + else | ||
2172 | + write(iunit,'('' random orientation calculations'')') | ||
2173 | + if(calctmatrix.eq.0) then | ||
2174 | + write(iunit,'('' t matrix read from file '' '//lf//',a)') tmatrixfile | ||
2175 | + elseif(calctmatrix.eq.1) then | ||
2176 | + write(iunit,'('' t matrix calculated, stored in file '' '//lf//',a)') tmatrixfile | ||
2177 | + write(iunit,'('' t matrix convergence epsilon:'' '//lf//',e12.4)') epstcon | ||
2178 | + else | ||
2179 | + write(iunit,'('' t matrix calculated from end of file '' '//lf//',a)') tmatrixfile | ||
2180 | + write(iunit,'('' t matrix convergence epsilon:'' '//lf//',e12.4)') epstcon | ||
2181 | + endif | ||
2182 | + endif | ||
2183 | + end subroutine writerundata | ||
2184 | +! | ||
2185 | +! getspheredata: retrieves sphere data | ||
2186 | +! | ||
2187 | +! | ||
2188 | +! last revised: 15 January 2011 | ||
2189 | +! 30 March 2011: added optical activity | ||
2190 | +! | ||
2191 | + subroutine getspheredata(number_spheres, sphere_size_parameters, sphere_positions, & | ||
2192 | + sphere_refractive_indices, volume_size_parameter) | ||
2193 | + implicit none | ||
2194 | + integer, optional :: number_spheres | ||
2195 | + real(8), optional :: sphere_size_parameters(numberspheres), & | ||
2196 | + sphere_positions(3,numberspheres), volume_size_parameter | ||
2197 | + complex(8), optional :: sphere_refractive_indices(2,numberspheres) | ||
2198 | + if (present(number_spheres)) number_spheres=numberspheres | ||
2199 | + if (present(sphere_size_parameters)) sphere_size_parameters(1:numberspheres)=xsp(1:numberspheres) | ||
2200 | + if (present(sphere_positions)) sphere_positions(:,1:numberspheres)=rpos(:,1:numberspheres) | ||
2201 | + if (present(sphere_refractive_indices)) & | ||
2202 | + sphere_refractive_indices(:,1:numberspheres)=ri(:,1:numberspheres) | ||
2203 | + if (present(volume_size_parameter)) volume_size_parameter=xvsp | ||
2204 | + end subroutine getspheredata | ||
2205 | + | ||
2206 | + subroutine getspheredataone(sphere,sphere_size_parameter, sphere_position, & | ||
2207 | + sphere_refractive_index) | ||
2208 | + implicit none | ||
2209 | + integer :: sphere | ||
2210 | + real(8), optional :: sphere_size_parameter,sphere_position(3) | ||
2211 | + complex(8), optional :: sphere_refractive_index(2) | ||
2212 | + if (present(sphere_size_parameter)) sphere_size_parameter=xsp(sphere) | ||
2213 | + if (present(sphere_position)) sphere_position(:)=rpos(:,sphere) | ||
2214 | + if (present(sphere_refractive_index)) & | ||
2215 | + sphere_refractive_index(:)=ri(:,sphere) | ||
2216 | + end subroutine getspheredataone | ||
2217 | +! | ||
2218 | +! setspheredata: sets sphere data | ||
2219 | +! | ||
2220 | + subroutine setspheredata(number_spheres, sphere_size_parameters, sphere_positions, & | ||
2221 | + sphere_refractive_indices, volume_size_parameter) | ||
2222 | + implicit none | ||
2223 | + integer :: i | ||
2224 | + integer, optional :: number_spheres | ||
2225 | + real(8), optional :: sphere_size_parameters(*), & | ||
2226 | + sphere_positions(3,*), volume_size_parameter | ||
2227 | + complex(8), optional :: sphere_refractive_indices(2,*) | ||
2228 | + if (present(number_spheres)) then | ||
2229 | + numberspheres=number_spheres | ||
2230 | + if(allocated(xsp)) deallocate(xsp,rpos,ri) | ||
2231 | + allocate(xsp(0:numberspheres),rpos(3,0:numberspheres),ri(2,0:numberspheres)) | ||
2232 | + endif | ||
2233 | + if (present(sphere_size_parameters)) xsp(1:numberspheres) =sphere_size_parameters(1:numberspheres) | ||
2234 | + if (present(sphere_positions)) rpos(:,1:numberspheres) =sphere_positions(:,1:numberspheres) | ||
2235 | + if (present(sphere_refractive_indices)) ri(:,1:numberspheres) =sphere_refractive_indices(:,1:numberspheres) | ||
2236 | + if (present(volume_size_parameter)) xvsp =volume_size_parameter | ||
2237 | + end subroutine setspheredata | ||
2238 | +! | ||
2239 | +! getrunparameters: retrieves run parameters read from input file | ||
2240 | +! | ||
2241 | +! | ||
2242 | +! last revised: 15 January 2011 | ||
2243 | +! 30 March 2011: added optical activity | ||
2244 | +! | ||
2245 | + subroutine getrunparameters(number_spheres,sphere_position_file,output_file, & | ||
2246 | + length_scale_factor,real_ref_index_scale_factor, & | ||
2247 | + imag_ref_index_scale_factor,mie_epsilon,translation_epsilon,solution_epsilon, & | ||
2248 | + max_number_iterations,fixed_or_random_orientation,scattering_plane_angle_deg, & | ||
2249 | + min_scattering_angle_deg,max_scattering_angle_deg,number_scattering_angles, & | ||
2250 | + incident_azimuth_angle_deg,incident_polar_angle_deg,calculate_near_field, & | ||
2251 | + near_field_plane_coord,near_field_plane_position,near_field_plane_vertices, & | ||
2252 | + spacial_step_size,polarization_angle_deg,near_field_output_file, & | ||
2253 | + plane_wave_epsilon,t_matrix_convergence_epsilon,gaussian_beam_constant, & | ||
2254 | + gaussian_beam_focal_point,calculate_t_matrix,t_matrix_file,run_print_file, & | ||
2255 | + run_print_unit,calculate_scattering_coefficients,scattering_coefficient_file, & | ||
2256 | + max_memory_per_processor,track_iterations,near_field_output_data, & | ||
2257 | + real_chiral_factor,imag_chiral_factor,normalize_scattering_matrix, & | ||
2258 | + store_translation_matrix,near_field_distance, & | ||
2259 | + iterations_per_correction) | ||
2260 | + implicit none | ||
2261 | + integer, optional :: number_spheres,max_number_iterations,fixed_or_random_orientation, & | ||
2262 | + number_scattering_angles,calculate_near_field,near_field_plane_coord, & | ||
2263 | + calculate_t_matrix,run_print_unit,calculate_scattering_coefficients, & | ||
2264 | + max_memory_per_processor,track_iterations,near_field_output_data, & | ||
2265 | + normalize_scattering_matrix,store_translation_matrix, & | ||
2266 | + iterations_per_correction | ||
2267 | + real(8), optional :: length_scale_factor,real_ref_index_scale_factor, & | ||
2268 | + imag_ref_index_scale_factor,mie_epsilon,translation_epsilon,solution_epsilon, & | ||
2269 | + scattering_plane_angle_deg, & | ||
2270 | + min_scattering_angle_deg,max_scattering_angle_deg, & | ||
2271 | + incident_azimuth_angle_deg,incident_polar_angle_deg,t_matrix_convergence_epsilon, & | ||
2272 | + near_field_plane_position,near_field_plane_vertices(2,2),spacial_step_size, & | ||
2273 | + polarization_angle_deg,plane_wave_epsilon,gaussian_beam_constant, & | ||
2274 | + gaussian_beam_focal_point(3),real_chiral_factor,imag_chiral_factor, & | ||
2275 | + near_field_distance | ||
2276 | + character*30, optional :: sphere_position_file,output_file,near_field_output_file, & | ||
2277 | + t_matrix_file,run_print_file,scattering_coefficient_file | ||
2278 | + if(present(number_spheres)) number_spheres =numberspheres | ||
2279 | + if(present(sphere_position_file)) sphere_position_file =positionfile | ||
2280 | + if(present(output_file)) output_file =outputfile | ||
2281 | + if(present(length_scale_factor)) length_scale_factor =lengthscalefactor | ||
2282 | + if(present(real_ref_index_scale_factor)) real_ref_index_scale_factor =realriscalefactor | ||
2283 | + if(present(imag_ref_index_scale_factor)) imag_ref_index_scale_factor =imriscalefactor | ||
2284 | + if(present(mie_epsilon)) mie_epsilon =epsmie | ||
2285 | + if(present(translation_epsilon)) translation_epsilon =epstran | ||
2286 | + if(present(solution_epsilon)) solution_epsilon =epssoln | ||
2287 | + if(present(max_number_iterations)) max_number_iterations =numberiterations | ||
2288 | + if(present(track_iterations)) track_iterations =trackiterations | ||
2289 | + if(present(max_memory_per_processor)) max_memory_per_processor =maxmemperproc | ||
2290 | + if(present(fixed_or_random_orientation)) fixed_or_random_orientation =fixedorrandom | ||
2291 | + if(present(scattering_plane_angle_deg)) scattering_plane_angle_deg =phideg | ||
2292 | + if(present(min_scattering_angle_deg)) min_scattering_angle_deg =thetamindeg | ||
2293 | + if(present(max_scattering_angle_deg)) max_scattering_angle_deg =thetamaxdeg | ||
2294 | + if(present(number_scattering_angles)) number_scattering_angles =numbertheta | ||
2295 | + if(present(normalize_scattering_matrix)) normalize_scattering_matrix =normalizesm | ||
2296 | + if(present(incident_azimuth_angle_deg)) incident_azimuth_angle_deg =alphadeg | ||
2297 | + if(present(incident_polar_angle_deg)) incident_polar_angle_deg =betadeg | ||
2298 | + if(present(t_matrix_convergence_epsilon)) t_matrix_convergence_epsilon =epstcon | ||
2299 | + if(present(calculate_near_field)) calculate_near_field =calcnf | ||
2300 | + if(present(near_field_plane_coord)) near_field_plane_coord =nfplane | ||
2301 | + if(present(near_field_plane_position)) near_field_plane_position =nfplanepos | ||
2302 | + if(present(near_field_plane_vertices)) near_field_plane_vertices =nfplanevert | ||
2303 | + if(present(spacial_step_size)) spacial_step_size =deltax | ||
2304 | + if(present(polarization_angle_deg)) polarization_angle_deg =gammadeg | ||
2305 | + if(present(near_field_output_file)) near_field_output_file =nfoutputfile | ||
2306 | + if(present(near_field_output_data)) near_field_output_data =nfoutdata | ||
2307 | + if(present(plane_wave_epsilon)) plane_wave_epsilon =epspw | ||
2308 | + if(present(gaussian_beam_constant)) gaussian_beam_constant =cgaussbeam | ||
2309 | + if(present(gaussian_beam_focal_point)) gaussian_beam_focal_point =gaussbeamfocus | ||
2310 | + if(present(t_matrix_file)) t_matrix_file =tmatrixfile | ||
2311 | + if(present(calculate_t_matrix)) calculate_t_matrix =calctmatrix | ||
2312 | + if(present(run_print_file)) run_print_file =printfile | ||
2313 | + if(present(run_print_unit)) run_print_unit =runprintunit | ||
2314 | + if(present(calculate_scattering_coefficients)) calculate_scattering_coefficients =calcamn | ||
2315 | + if(present(scattering_coefficient_file)) scattering_coefficient_file =amnfile | ||
2316 | + if(present(real_chiral_factor)) real_chiral_factor =realchiralfactor | ||
2317 | + if(present(imag_chiral_factor)) imag_chiral_factor =imchiralfactor | ||
2318 | + if(present(store_translation_matrix)) store_translation_matrix =storetranmat | ||
2319 | + if(present(near_field_distance)) near_field_distance =nfdistance | ||
2320 | + if(present(iterations_per_correction)) iterations_per_correction =niterstep | ||
2321 | + end subroutine getrunparameters | ||
2322 | +! | ||
2323 | +! set run parameters: set run parameters | ||
2324 | +! | ||
2325 | +! | ||
2326 | +! last revised: 15 January 2011 | ||
2327 | +! 30 March 2011: added optical activity | ||
2328 | +! | ||
2329 | + subroutine setrunparameters(number_spheres,sphere_position_file,output_file, & | ||
2330 | + length_scale_factor,real_ref_index_scale_factor, & | ||
2331 | + imag_ref_index_scale_factor,mie_epsilon,translation_epsilon,solution_epsilon, & | ||
2332 | + max_number_iterations,fixed_or_random_orientation,scattering_plane_angle_deg, & | ||
2333 | + min_scattering_angle_deg,max_scattering_angle_deg,number_scattering_angles, & | ||
2334 | + incident_azimuth_angle_deg,incident_polar_angle_deg,calculate_near_field, & | ||
2335 | + near_field_plane_coord,near_field_plane_position,near_field_plane_vertices, & | ||
2336 | + spacial_step_size,polarization_angle_deg,near_field_output_file, & | ||
2337 | + plane_wave_epsilon,t_matrix_convergence_epsilon,gaussian_beam_constant, & | ||
2338 | + gaussian_beam_focal_point,calculate_t_matrix,t_matrix_file,run_print_file, & | ||
2339 | + run_print_unit,calculate_scattering_coefficients,scattering_coefficient_file, & | ||
2340 | + max_memory_per_processor,track_iterations,near_field_output_data, & | ||
2341 | + real_chiral_factor,imag_chiral_factor,store_translation_matrix, & | ||
2342 | + near_field_distance,iterations_per_correction) | ||
2343 | + implicit none | ||
2344 | + integer, optional :: number_spheres,max_number_iterations,fixed_or_random_orientation, & | ||
2345 | + number_scattering_angles,calculate_near_field,near_field_plane_coord, & | ||
2346 | + calculate_t_matrix,run_print_unit,calculate_scattering_coefficients, & | ||
2347 | + max_memory_per_processor,track_iterations,near_field_output_data, & | ||
2348 | + store_translation_matrix,iterations_per_correction | ||
2349 | + real(8), optional :: length_scale_factor,real_ref_index_scale_factor, & | ||
2350 | + imag_ref_index_scale_factor,mie_epsilon,translation_epsilon,solution_epsilon, & | ||
2351 | + scattering_plane_angle_deg,near_field_distance,& | ||
2352 | + min_scattering_angle_deg,max_scattering_angle_deg, & | ||
2353 | + incident_azimuth_angle_deg,incident_polar_angle_deg,t_matrix_convergence_epsilon, & | ||
2354 | + near_field_plane_position,near_field_plane_vertices(2,2),spacial_step_size, & | ||
2355 | + polarization_angle_deg,plane_wave_epsilon,gaussian_beam_constant, & | ||
2356 | + gaussian_beam_focal_point(3),real_chiral_factor,imag_chiral_factor | ||
2357 | + character*30, optional :: sphere_position_file,output_file,near_field_output_file, & | ||
2358 | + t_matrix_file,run_print_file,scattering_coefficient_file | ||
2359 | + | ||
2360 | + if(present(number_spheres)) numberspheres =number_spheres | ||
2361 | + if(present(sphere_position_file)) positionfile =sphere_position_file | ||
2362 | + if(present(output_file)) outputfile =output_file | ||
2363 | + if(present(length_scale_factor)) lengthscalefactor =length_scale_factor | ||
2364 | + if(present(real_ref_index_scale_factor)) realriscalefactor =real_ref_index_scale_factor | ||
2365 | + if(present(imag_ref_index_scale_factor)) imriscalefactor =imag_ref_index_scale_factor | ||
2366 | + if(present(mie_epsilon)) epsmie =mie_epsilon | ||
2367 | + if(present(translation_epsilon)) epstran =translation_epsilon | ||
2368 | + if(present(solution_epsilon)) epssoln =solution_epsilon | ||
2369 | + if(present(max_number_iterations)) numberiterations =max_number_iterations | ||
2370 | + if(present(track_iterations)) trackiterations =track_iterations | ||
2371 | + if(present(max_memory_per_processor)) maxmemperproc =max_memory_per_processor | ||
2372 | + if(present(fixed_or_random_orientation)) fixedorrandom =fixed_or_random_orientation | ||
2373 | + if(present(scattering_plane_angle_deg)) phideg =scattering_plane_angle_deg | ||
2374 | + if(present(min_scattering_angle_deg)) thetamindeg =min_scattering_angle_deg | ||
2375 | + if(present(max_scattering_angle_deg)) thetamaxdeg =max_scattering_angle_deg | ||
2376 | + if(present(number_scattering_angles)) numbertheta =number_scattering_angles | ||
2377 | + if(present(incident_azimuth_angle_deg)) alphadeg =incident_azimuth_angle_deg | ||
2378 | + if(present(incident_polar_angle_deg)) betadeg =incident_polar_angle_deg | ||
2379 | + if(present(t_matrix_convergence_epsilon)) epstcon =t_matrix_convergence_epsilon | ||
2380 | + if(present(calculate_near_field)) calcnf =calculate_near_field | ||
2381 | + if(present(near_field_plane_coord)) nfplane =near_field_plane_coord | ||
2382 | + if(present(near_field_plane_position)) nfplanepos =near_field_plane_position | ||
2383 | + if(present(near_field_plane_vertices)) nfplanevert =near_field_plane_vertices | ||
2384 | + if(present(spacial_step_size)) deltax =spacial_step_size | ||
2385 | + if(present(polarization_angle_deg)) gammadeg =polarization_angle_deg | ||
2386 | + if(present(near_field_output_file)) nfoutputfile =near_field_output_file | ||
2387 | + if(present(near_field_output_data)) nfoutdata =near_field_output_data | ||
2388 | + if(present(plane_wave_epsilon)) epspw =plane_wave_epsilon | ||
2389 | + if(present(gaussian_beam_constant)) cgaussbeam =gaussian_beam_constant | ||
2390 | + if(present(gaussian_beam_focal_point)) gaussbeamfocus =gaussian_beam_focal_point | ||
2391 | + if(present(t_matrix_file)) tmatrixfile =t_matrix_file | ||
2392 | + if(present(calculate_t_matrix)) calctmatrix =calculate_t_matrix | ||
2393 | + if(present(run_print_file)) printfile =run_print_file | ||
2394 | + if(present(run_print_unit)) runprintunit =run_print_unit | ||
2395 | + if(present(calculate_scattering_coefficients)) calcamn =calculate_scattering_coefficients | ||
2396 | + if(present(scattering_coefficient_file)) amnfile =scattering_coefficient_file | ||
2397 | + if(present(real_chiral_factor)) realchiralfactor =real_chiral_factor | ||
2398 | + if(present(imag_chiral_factor)) imchiralfactor =imag_chiral_factor | ||
2399 | + if(present(store_translation_matrix)) storetranmat =store_translation_matrix | ||
2400 | + if(present(near_field_distance)) nfdistance =near_field_distance | ||
2401 | + if(present(iterations_per_correction)) niterstep =iterations_per_correction | ||
2402 | + end subroutine setrunparameters | ||
2403 | + | ||
2404 | + end module spheredata | ||
2405 | +! | ||
2406 | +! module miecoefdata: used to 1) calculate single sphere mie coefficient values, | ||
2407 | +! 2) store values in an allocated array, 3) provide common access to values, and | ||
2408 | +! 4) perform multiplication of coefficient values with vectors containing VWH scattering | ||
2409 | +! coefficients. | ||
2410 | +! | ||
2411 | +! | ||
2412 | +! last revised: 15 January 2011 | ||
2413 | +! 30 March 2011: added optical activity | ||
2414 | +! | ||
2415 | + module miecoefdata | ||
2416 | + implicit none | ||
2417 | + integer, private :: numeqns,maxorder | ||
2418 | + integer, allocatable, private :: nodr(:),nodroffset(:),nblk(:),nblkoffset(:) | ||
2419 | + real(8), allocatable, private :: qextmie(:),qabsmie(:) | ||
2420 | + complex(8), allocatable, private :: anmie(:,:,:),cnmie(:,:,:) | ||
2421 | + interface getmiedata | ||
2422 | + module procedure getmiedataall, getmiedataone | ||
2423 | + end interface getmiedata | ||
2424 | + | ||
2425 | + contains | ||
2426 | +! | ||
2427 | +! calculation of the max order of sphere expansions and storage of mie coefficients | ||
2428 | +! | ||
2429 | +! | ||
2430 | +! last revised: 15 January 2011 | ||
2431 | +! 30 March 2011: added optical activity | ||
2432 | +! | ||
2433 | + subroutine miecoefcalc(nsphere,xsp,ri,qeps) | ||
2434 | + implicit none | ||
2435 | + integer :: n,nodrn,nsphere,nodrtot,ierr,nblktot | ||
2436 | + real(8) :: qext,qabs,qsca,qeps,xsp(nsphere) | ||
2437 | + complex(8) :: ri(2,nsphere) | ||
2438 | + complex(8), allocatable :: anp(:,:,:),cnp(:,:,:) | ||
2439 | + if(allocated(nodr)) deallocate(nodr,nodroffset,nblk, & | ||
2440 | + nblkoffset,qextmie,qabsmie) | ||
2441 | + allocate(nodr(nsphere),nodroffset(nsphere+1), & | ||
2442 | + nblk(nsphere),nblkoffset(nsphere+1), & | ||
2443 | + qextmie(nsphere),qabsmie(nsphere),stat=ierr) | ||
2444 | + if(ierr.ne.0) then | ||
2445 | + write(*,'('' bad allocation in nodr: stat:'',i4)') ierr | ||
2446 | + endif | ||
2447 | + nodrtot=0 | ||
2448 | + nblktot=0 | ||
2449 | + maxorder=0 | ||
2450 | +! | ||
2451 | +! calculate the order limits and efficiencies | ||
2452 | +! | ||
2453 | + do n=1,nsphere | ||
2454 | + call mieoa(xsp(n),ri(1,n),nodrn,qeps,qext,qsca) | ||
2455 | + nodroffset(n)=nodrtot | ||
2456 | + nblkoffset(n)=nblktot | ||
2457 | + nodr(n)=nodrn | ||
2458 | + maxorder=max(maxorder,nodrn) | ||
2459 | + nblk(n)=nodrn*(nodrn+2)*2 | ||
2460 | + nodrtot=nodrtot+nodrn | ||
2461 | + nblktot=nblktot+nblk(n) | ||
2462 | + qextmie(n)=qext | ||
2463 | + qabsmie(n)=qext-qsca | ||
2464 | + enddo | ||
2465 | + nodroffset(nsphere+1)=nodrtot | ||
2466 | + nblkoffset(nsphere+1)=nblktot | ||
2467 | + numeqns=nblktot | ||
2468 | +! | ||
2469 | +! calculate the mie coefficients, and store in memory | ||
2470 | +! | ||
2471 | + if(allocated(anmie)) deallocate(anmie,cnmie) | ||
2472 | + allocate(anmie(2,2,nodrtot),cnmie(2,2,nodrtot),stat=ierr) | ||
2473 | + if(ierr.ne.0) then | ||
2474 | + write(*,'('' bad allocation in anmie: stat:'',i4)') ierr | ||
2475 | + endif | ||
2476 | + do n=1,nsphere | ||
2477 | + if(abs(ri(1,n)-ri(2,n)).eq.0) then | ||
2478 | + allocate(anp(2,1,nodr(n)),cnp(2,1,nodr(n))) | ||
2479 | + call mieregular(xsp(n),ri(1,n),nodrn,qeps,qext,qsca,anp_mie=anp,cnp_mie=cnp) | ||
2480 | + anmie(1,1,nodroffset(n)+1:nodroffset(n+1))=anp(1,1,1:nodr(n)) | ||
2481 | + anmie(2,2,nodroffset(n)+1:nodroffset(n+1))=anp(2,1,1:nodr(n)) | ||
2482 | + anmie(1,2,nodroffset(n)+1:nodroffset(n+1))=0.d0 | ||
2483 | + anmie(2,1,nodroffset(n)+1:nodroffset(n+1))=0.d0 | ||
2484 | + cnmie(1,1,nodroffset(n)+1:nodroffset(n+1))=cnp(1,1,1:nodr(n)) | ||
2485 | + cnmie(2,2,nodroffset(n)+1:nodroffset(n+1))=cnp(2,1,1:nodr(n)) | ||
2486 | + cnmie(1,2,nodroffset(n)+1:nodroffset(n+1))=0.d0 | ||
2487 | + cnmie(2,1,nodroffset(n)+1:nodroffset(n+1))=0.d0 | ||
2488 | + deallocate(anp,cnp) | ||
2489 | + else | ||
2490 | + allocate(anp(2,2,nodr(n)),cnp(2,2,nodr(n))) | ||
2491 | + call mieoa(xsp(n),ri(1,n),nodrn,qeps,qext,qsca,anp_mie=anp,cnp_mie=cnp) | ||
2492 | + anmie(1:2,1:2,nodroffset(n)+1:nodroffset(n+1))=anp(1:2,1:2,1:nodr(n)) | ||
2493 | + cnmie(1:2,1:2,nodroffset(n)+1:nodroffset(n+1))=cnp(1:2,1:2,1:nodr(n)) | ||
2494 | + deallocate(anp,cnp) | ||
2495 | + endif | ||
2496 | + enddo | ||
2497 | + end subroutine miecoefcalc | ||
2498 | +! | ||
2499 | +! retrieve the array of mie data | ||
2500 | +! | ||
2501 | +! | ||
2502 | +! last revised: 15 January 2011 | ||
2503 | +! 30 March 2011: added optical activity | ||
2504 | +! | ||
2505 | + subroutine getmiedataall(sphere_order, sphere_block, & | ||
2506 | + sphere_order_offset, sphere_block_offset, sphere_qext, & | ||
2507 | + sphere_qabs, sphere_mie_coefficients, sphere_int_mie_coefficients, & | ||
2508 | + number_equations, max_order) | ||
2509 | + use spheredata | ||
2510 | + implicit none | ||
2511 | + integer, optional :: sphere_order(:), sphere_block(:), sphere_order_offset(:), & | ||
2512 | + sphere_block_offset(:),number_equations, max_order | ||
2513 | + integer :: i,nsphere | ||
2514 | + real(8), optional :: sphere_qext(:), sphere_qabs(:) | ||
2515 | + complex(8), optional :: sphere_mie_coefficients(:,:,:,:), & | ||
2516 | + sphere_int_mie_coefficients(:,:,:,:) | ||
2517 | + call getspheredata(number_spheres=nsphere) | ||
2518 | + if(present(sphere_order)) sphere_order=nodr | ||
2519 | + if(present(sphere_block)) sphere_block=nblk | ||
2520 | + if(present(sphere_order_offset)) sphere_order_offset=nodroffset | ||
2521 | + if(present(sphere_block_offset)) sphere_block_offset=nblkoffset | ||
2522 | + if(present(sphere_qext)) sphere_qext=qextmie | ||
2523 | + if(present(sphere_qabs)) sphere_qabs=qabsmie | ||
2524 | + if(present(number_equations)) number_equations=numeqns | ||
2525 | + if(present(max_order)) max_order=maxorder | ||
2526 | + if(present(sphere_mie_coefficients)) then | ||
2527 | + do i=1,nsphere | ||
2528 | + sphere_mie_coefficients(1:2,1:2,1:nodr(i),i) & | ||
2529 | + =anmie(1:2,1:2,nodroffset(i)+1:nodroffset(i+1)) | ||
2530 | + enddo | ||
2531 | + endif | ||
2532 | + if(present(sphere_int_mie_coefficients)) then | ||
2533 | + do i=1,nsphere | ||
2534 | + sphere_int_mie_coefficients(1:2,1:2,1:nodr(i),i) & | ||
2535 | + =cnmie(1:2,1:2,nodroffset(i)+1:nodroffset(i+1)) | ||
2536 | + enddo | ||
2537 | + endif | ||
2538 | + end subroutine getmiedataall | ||
2539 | +! | ||
2540 | +! retrieve mie data for a single sphere | ||
2541 | +! | ||
2542 | +! | ||
2543 | +! last revised: 15 January 2011 | ||
2544 | +! 30 March 2011: added optical activity | ||
2545 | +! | ||
2546 | + subroutine getmiedataone(which_sphere, sphere_order, sphere_block, & | ||
2547 | + sphere_order_offset, sphere_block_offset, sphere_qext, & | ||
2548 | + sphere_qabs, sphere_mie_coefficients, sphere_int_mie_coefficients, & | ||
2549 | + number_equations, max_order) | ||
2550 | + use spheredata | ||
2551 | + implicit none | ||
2552 | + integer, optional :: sphere_order, sphere_block, sphere_order_offset, & | ||
2553 | + sphere_block_offset, number_equations, max_order | ||
2554 | + integer :: which_sphere | ||
2555 | + integer :: i,nsphere | ||
2556 | + real(8), optional :: sphere_qext, sphere_qabs | ||
2557 | + complex(8), optional :: sphere_mie_coefficients(:,:,:), sphere_int_mie_coefficients(:,:,:) | ||
2558 | + i=which_sphere | ||
2559 | + if(present(sphere_order)) sphere_order=nodr(i) | ||
2560 | + if(present(sphere_block)) sphere_block=nblk(i) | ||
2561 | + if(present(sphere_order_offset)) sphere_order_offset=nodroffset(i) | ||
2562 | + if(present(sphere_block_offset)) sphere_block_offset=nblkoffset(i) | ||
2563 | + if(present(sphere_qext)) sphere_qext=qextmie(i) | ||
2564 | + if(present(sphere_qabs)) sphere_qabs=qabsmie(i) | ||
2565 | + if(present(number_equations)) number_equations=numeqns | ||
2566 | + if(present(max_order)) max_order=maxorder | ||
2567 | + if(present(sphere_mie_coefficients)) & | ||
2568 | + sphere_mie_coefficients(1:2,1:2,1:nodr(i)) & | ||
2569 | + =anmie(1:2,1:2,nodroffset(i)+1:nodroffset(i+1)) | ||
2570 | + if(present(sphere_int_mie_coefficients)) & | ||
2571 | + sphere_int_mie_coefficients(1:2,1:2,1:nodr(i)) & | ||
2572 | + =cnmie(1:2,1:2,nodroffset(i)+1:nodroffset(i+1)) | ||
2573 | + end subroutine getmiedataone | ||
2574 | +! | ||
2575 | +! retrieve mie coefficients for sphere n | ||
2576 | +! 30 March 2011: added optical activity | ||
2577 | +! | ||
2578 | + function miecoef(n) | ||
2579 | + implicit none | ||
2580 | + integer :: n | ||
2581 | + complex(8), dimension(2,2,nodr(n)) :: miecoef | ||
2582 | + miecoef=anmie(1:2,1:2,nodroffset(n)+1:nodroffset(n+1)) | ||
2583 | + end function miecoef | ||
2584 | + | ||
2585 | + function internalmiecoef(n) | ||
2586 | + implicit none | ||
2587 | + integer :: n | ||
2588 | + complex(8), dimension(2,2,nodr(n)) :: internalmiecoef | ||
2589 | + internalmiecoef=cnmie(1:2,1:2,nodroffset(n)+1:nodroffset(n+1)) | ||
2590 | + end function internalmiecoef | ||
2591 | +! | ||
2592 | +! multiples the solution vector cx by mie coefficients and returns in y | ||
2593 | +! i1: starting sphere, i2: ending sphere | ||
2594 | +! | ||
2595 | +! | ||
2596 | +! last revised: 15 January 2011 | ||
2597 | +! 30 March 2011: added optical activity | ||
2598 | +! | ||
2599 | + subroutine miecoeffmult(i1,i2,neqns,cx,cy) | ||
2600 | + implicit none | ||
2601 | + integer :: i1,i2,neqns,i,n,p,nodrvec(3),nodri,nblki,noffi,icon,q | ||
2602 | + complex(8) :: cx(neqns),cy(neqns) | ||
2603 | + complex(8), allocatable :: cxt(:,:,:),an1(:,:,:),cxtt(:,:,:) | ||
2604 | + | ||
2605 | + do i=i1,i2 | ||
2606 | + nodri=nodr(i) | ||
2607 | + nblki=nblk(i) | ||
2608 | + noffi=nblkoffset(i) | ||
2609 | + allocate(cxt(0:nodri+1,nodri,2),cxtt(0:nodri+1,nodri,2),an1(2,2,nodri)) | ||
2610 | + cxt=reshape(cx(noffi+1:noffi+nblki),(/nodri+2,nodri,2/)) | ||
2611 | + cxtt=0.d0 | ||
2612 | + an1=miecoef(i) | ||
2613 | + do n=1,nodri | ||
2614 | + do p=1,2 | ||
2615 | + cxtt(n+1,n:1:-1,p)=an1(p,1,n)*cxt(n+1,n:1:-1,1)+an1(p,2,n)*cxt(n+1,n:1:-1,2) | ||
2616 | + cxtt(0:n,n,p)=an1(p,1,n)*cxt(0:n,n,1)+an1(p,2,n)*cxt(0:n,n,2) | ||
2617 | + enddo | ||
2618 | + enddo | ||
2619 | + cy(noffi+1:noffi+nblki)=reshape(cxtt(0:nodri+1,1:nodri,1:2),(/nblki/)) | ||
2620 | + deallocate(cxt,cxtt,an1) | ||
2621 | + enddo | ||
2622 | + end subroutine miecoeffmult | ||
2623 | + | ||
2624 | + subroutine internalmiecoeffmult(i1,i2,neqns,cx,cy) | ||
2625 | + implicit none | ||
2626 | + integer :: i1,i2,neqns,i,n,p,nodrvec(3),nodri,nblki,noffi,icon,q | ||
2627 | + complex(8) :: cx(neqns),cy(neqns) | ||
2628 | + complex(8), allocatable :: cxt(:,:,:),an1(:,:,:),cxtt(:,:,:) | ||
2629 | + | ||
2630 | + do i=i1,i2 | ||
2631 | + nodri=nodr(i) | ||
2632 | + nblki=nblk(i) | ||
2633 | + noffi=nblkoffset(i) | ||
2634 | + allocate(cxt(0:nodri+1,nodri,2),cxtt(0:nodri+1,nodri,2),an1(2,2,nodri)) | ||
2635 | + cxt=reshape(cx(noffi+1:noffi+nblki),(/nodri+2,nodri,2/)) | ||
2636 | + cxtt=0.d0 | ||
2637 | + an1=internalmiecoef(n) | ||
2638 | + do n=1,nodri | ||
2639 | + do p=1,2 | ||
2640 | + cxtt(n+1,n:1:-1,p)=an1(p,1,n)*cxt(n+1,n:1:-1,1)+an1(p,2,n)*cxt(n+1,n:1:-1,2) | ||
2641 | + cxtt(0:n,n,p)=an1(p,1,n)*cxt(0:n,n,1)+an1(p,2,n)*cxt(0:n,n,2) | ||
2642 | + enddo | ||
2643 | + enddo | ||
2644 | + cy(noffi+1:noffi+nblki)=reshape(cxtt(0:nodri+1,1:nodri,1:2),(/nblki/)) | ||
2645 | + deallocate(cxt,cxtt,an1) | ||
2646 | + enddo | ||
2647 | + end subroutine internalmiecoeffmult | ||
2648 | +! | ||
2649 | +! single-sphere lorenz/mie coefficients | ||
2650 | +! | ||
2651 | +! | ||
2652 | +! last revised: 15 January 2011 | ||
2653 | +! | ||
2654 | + subroutine mieregular(x,ri,nstop,qeps,qext,qsca,anp_mie,cnp_mie) | ||
2655 | + use specialfuncs | ||
2656 | + implicit none | ||
2657 | + integer :: nstop,n,iancalc | ||
2658 | + real(8) :: x,qeps,qext,qsca,prn,prp,qext1,err | ||
2659 | + complex(8), optional :: anp_mie(2,*), cnp_mie(2,*) | ||
2660 | + complex(8) :: ri,y,pcp,xip,da,db,na,nb,an1,an2,cn1,cn2 | ||
2661 | + complex(8), allocatable :: pc(:),xi(:) | ||
2662 | +! | ||
2663 | +! modified LM criterion | ||
2664 | +! | ||
2665 | + if(qeps.gt.0.) nstop=nint(x+4.*x**(1./3.))+15 | ||
2666 | +! | ||
2667 | +! user-set order limit | ||
2668 | +! | ||
2669 | + if(qeps.lt.0) nstop=-qeps | ||
2670 | +! | ||
2671 | +! basic calculations follow | ||
2672 | +! | ||
2673 | + allocate(pc(0:nstop),xi(0:nstop)) | ||
2674 | + y=x*ri | ||
2675 | + call cricbessel(nstop,y,pc) | ||
2676 | + call richankel(nstop,x,xi) | ||
2677 | + qsca=0.0 | ||
2678 | + qext=0.0 | ||
2679 | + do n=1,nstop | ||
2680 | + prn=dble(xi(n)) | ||
2681 | + pcp=pc(n-1)-n*pc(n)/y | ||
2682 | + xip=xi(n-1)-n*xi(n)/x | ||
2683 | + prp=dble(xip) | ||
2684 | + da=ri*xip*pc(n)-xi(n)*pcp | ||
2685 | + db=ri*xi(n)*pcp-xip*pc(n) | ||
2686 | + na=ri*prp*pc(n)-prn*pcp | ||
2687 | + nb=ri*prn*pcp-prp*pc(n) | ||
2688 | + an1=-na/da | ||
2689 | + an2=-nb/db | ||
2690 | + cn1=-dcmplx(0.d0,1.d0)*ri/na | ||
2691 | + cn2=dcmplx(0.d0,1.d0)*ri/nb | ||
2692 | + if(present(anp_mie)) then | ||
2693 | + anp_mie(1,n)=an1 | ||
2694 | + anp_mie(2,n)=an2 | ||
2695 | + endif | ||
2696 | + if(present(cnp_mie)) then | ||
2697 | + cnp_mie(1,n)=cn1 | ||
2698 | + cnp_mie(2,n)=cn2 | ||
2699 | + endif | ||
2700 | + qsca=qsca+(n+n+1)*(cdabs(an1)*cdabs(an1) & | ||
2701 | + +cdabs(an2)*cdabs(an2)) | ||
2702 | + qext1=-(n+n+1)*dble(an1+an2) | ||
2703 | + qext=qext+qext1 | ||
2704 | + err=abs(qext1)/abs(qext) | ||
2705 | + if(err.lt.qeps.or.n.eq.nstop) exit | ||
2706 | + enddo | ||
2707 | + nstop=n | ||
2708 | + qsca=2./x/x*qsca | ||
2709 | + qext=2./x/x*qext | ||
2710 | + deallocate(pc,xi) | ||
2711 | + end subroutine mieregular | ||
2712 | +! | ||
2713 | +! optically active lorenz/mie coefficients | ||
2714 | +! 30 March 2011 | ||
2715 | +! | ||
2716 | + subroutine mieoa(x,ri,nstop,qeps,qext,qsca,anp_mie,cnp_mie) | ||
2717 | + use specialfuncs | ||
2718 | + implicit none | ||
2719 | + integer :: nstop | ||
2720 | + real(8) :: x,qeps,qext,qsca,fn1,err | ||
2721 | + complex(8) :: ri(2) | ||
2722 | + complex(8), optional :: anp_mie(2,2,*),cnp_mie(2,2,*) | ||
2723 | + integer :: n,i,p,q | ||
2724 | + real(8) :: psi,psip,qext1 | ||
2725 | + complex (8) :: xri(2),xip,psicp,psic,wn(2),vn(2),an(2),bn(2), & | ||
2726 | + den,xi,anct(2,2),cnct(2,2),ri0,ci | ||
2727 | + complex(8), allocatable :: psicn(:,:),xin(:) | ||
2728 | + data ci/(0.d0,1.d0)/ | ||
2729 | + | ||
2730 | + ri0=2.d0/(1.d0/ri(1)+1.d0/ri(2)) | ||
2731 | + if(qeps.ge.0.) then | ||
2732 | + nstop=nint(x+4.*x**(1./3.))+5. | ||
2733 | + else | ||
2734 | + nstop=-qeps | ||
2735 | + endif | ||
2736 | + allocate(psicn(0:nstop+1,2),xin(0:nstop+1)) | ||
2737 | + do i=1,2 | ||
2738 | + xri(i)=x*ri(i) | ||
2739 | + call cricbessel(nstop+1,xri(i),psicn(0,i)) | ||
2740 | + enddo | ||
2741 | + call richankel(nstop+1,x,xin) | ||
2742 | + qsca=0.0 | ||
2743 | + qext=0.0 | ||
2744 | + do n=1,nstop | ||
2745 | + do i=1,2 | ||
2746 | + psic=psicn(n,i) | ||
2747 | + psicp=psicn(n-1,i)-dble(n)*psic/xri(i) | ||
2748 | + xi=xin(n) | ||
2749 | + xip=xin(n-1)-dble(n)*xi/x | ||
2750 | + psi=dble(xi) | ||
2751 | + psip=dble(xip) | ||
2752 | + wn(i)=ri0*psic*xip-xi*psicp | ||
2753 | + vn(i)=psic*xip-ri0*xi*psicp | ||
2754 | + an(i)=ri0*psic*psip-psi*psicp | ||
2755 | + bn(i)=psic*psip-ri0*psi*psicp | ||
2756 | + enddo | ||
2757 | + den=wn(1)*vn(2)+wn(2)*vn(1) | ||
2758 | + anct(1,1)=-(vn(1)*an(2)+vn(2)*an(1))/den | ||
2759 | + anct(2,2)=-(wn(1)*bn(2)+wn(2)*bn(1))/den | ||
2760 | + anct(1,2)=(wn(1)*an(2)-wn(2)*an(1))/den | ||
2761 | + anct(2,1)=anct(1,2) | ||
2762 | + den=an(1)*bn(2)+an(2)*bn(1) | ||
2763 | + cnct(1,1)=-ci*ri(1)*bn(2)/den | ||
2764 | + cnct(1,2)=-ci*ri(1)*an(2)/den | ||
2765 | + cnct(2,1)=ri(2)*ri0*bn(1)/den | ||
2766 | + cnct(2,2)=-ri(2)*ri0*an(1)/den | ||
2767 | + if(present(anp_mie)) then | ||
2768 | + do p=1,2 | ||
2769 | + do q=1,2 | ||
2770 | + anp_mie(p,q,n)=anct(p,q) | ||
2771 | + cnp_mie(p,q,n)=cnct(p,q) | ||
2772 | + enddo | ||
2773 | + enddo | ||
2774 | + endif | ||
2775 | + qext1=0.d0 | ||
2776 | + fn1=n+n+1 | ||
2777 | + do p=1,2 | ||
2778 | + do q=1,2 | ||
2779 | + qsca=qsca+fn1*cdabs(anct(p,q))*cdabs(anct(p,q)) | ||
2780 | + enddo | ||
2781 | + qext1=qext1-fn1*dble(anct(p,p)) | ||
2782 | + enddo | ||
2783 | + qext=qext+qext1 | ||
2784 | + err=abs(qext1)/abs(qext) | ||
2785 | + if(err.lt.qeps.or.n.eq.nstop) exit | ||
2786 | + enddo | ||
2787 | + nstop=min(n,nstop) | ||
2788 | + qsca=2./x/x*qsca | ||
2789 | + qext=2./x/x*qext | ||
2790 | + return | ||
2791 | + end subroutine mieoa | ||
2792 | + | ||
2793 | + end module miecoefdata | ||
2794 | +! | ||
2795 | +! module translation contains subroutines for VSWF translation and rotation | ||
2796 | +! | ||
2797 | +! | ||
2798 | +! last revised: 15 January 2011 | ||
2799 | +! | ||
2800 | + module translation | ||
2801 | + implicit none | ||
2802 | + integer, private :: stored_max_order,store_tran_mat | ||
2803 | + integer, allocatable, private :: nsizerot(:,:),nsizetran(:,:),nsizeephi(:,:), & | ||
2804 | + noffrot(:,:),nofftran(:,:),noffephi(:,:) | ||
2805 | + real(8), private :: near_field_distance | ||
2806 | + real(8), allocatable, private :: sphere_position(:,:) | ||
2807 | + real(8), target, allocatable, private :: rotmatstore(:) | ||
2808 | + complex(8), target, allocatable, private :: tranmatstore(:), ephimatstore(:) | ||
2809 | + complex(8), allocatable, private :: rvec_temp(:,:),tvec_temp(:,:),c_temp(:,:,:), & | ||
2810 | + ct_temp(:,:,:),rvec2_temp(:,:),tvec2_temp(:,:),c2_temp(:,:,:), & | ||
2811 | + ct2_temp(:,:,:) | ||
2812 | + | ||
2813 | + contains | ||
2814 | +! | ||
2815 | +! rotation of expansion coefficients amn by euler angles alpha,beta,gamma | ||
2816 | +! idir=1: forward rotation, idir=-1, reverse rotation. | ||
2817 | +! | ||
2818 | +! | ||
2819 | +! last revised: 15 January 2011 | ||
2820 | +! | ||
2821 | + subroutine rotvec(alpha,beta,gamma,nmax,mmax,amn,idir) | ||
2822 | + use numconstants | ||
2823 | + use specialfuncs | ||
2824 | + implicit none | ||
2825 | + integer :: nmax,mmax,idir,k,n,m,in,kmax,kn,ka,na,p,im,m1 | ||
2826 | + real(8) :: dc(-nmax-1:nmax+1,-nmax-1:nmax+1),dk0(-nmax-1:nmax+1), & | ||
2827 | + dk01(-nmax-1:nmax+1),sbe,cbe,sbe2,cbe2,sben,dkt, & | ||
2828 | + fmn,dkm0,dkm1,alpha,beta,gamma | ||
2829 | + complex(8) :: ealpha,amn(0:nmax+1,nmax,2),ealpham(-nmax:nmax), & | ||
2830 | + amnt(2,-nmax:nmax),a,b,ci,egamma,egammam(-nmax:nmax) | ||
2831 | + data ci/(0.d0,1.d0)/ | ||
2832 | + call init(nmax) | ||
2833 | + dc=0.d0 | ||
2834 | + dk01=0.d0 | ||
2835 | + dk0=0.d0 | ||
2836 | + ealpha=cdexp(ci*alpha) | ||
2837 | + egamma=cdexp(ci*gamma) | ||
2838 | + cbe=cos(beta) | ||
2839 | + sbe=sqrt((1.d0+cbe)*(1.d0-cbe)) | ||
2840 | + cbe2=.5d0*(1.d0+cbe) | ||
2841 | + sbe2=.5d0*(1.d0-cbe) | ||
2842 | + call ephicoef(ealpha,nmax,ealpham) | ||
2843 | + call ephicoef(egamma,nmax,egammam) | ||
2844 | + in=1 | ||
2845 | + dk0(0)=1.d0 | ||
2846 | + sben=1.d0 | ||
2847 | + dk01(0)=0.d0 | ||
2848 | + do n=1,nmax | ||
2849 | + kmax=min(n,mmax) | ||
2850 | + do k=-kmax,kmax | ||
2851 | + if(k.le.-1) then | ||
2852 | + ka=n+1 | ||
2853 | + na=-k | ||
2854 | + else | ||
2855 | + ka=k | ||
2856 | + na=n | ||
2857 | + endif | ||
2858 | + if(idir.eq.1) then | ||
2859 | + amnt(1,k)=amn(ka,na,1)*ealpham(k) | ||
2860 | + amnt(2,k)=amn(ka,na,2)*ealpham(k) | ||
2861 | + else | ||
2862 | + amnt(1,-k)=amn(ka,na,1)*egammam(k) | ||
2863 | + amnt(2,-k)=amn(ka,na,2)*egammam(k) | ||
2864 | + endif | ||
2865 | + enddo | ||
2866 | + in=-in | ||
2867 | + sben=sben*sbe/2.d0 | ||
2868 | + dk0(n)=in*sben*bcof(n,n) | ||
2869 | + dk0(-n)=in*dk0(n) | ||
2870 | + dk01(n)=0.d0 | ||
2871 | + dk01(-n)=0.d0 | ||
2872 | + dc(0,n)=dk0(n) | ||
2873 | + dc(0,-n)=dk0(-n) | ||
2874 | + do k=-n+1,n-1 | ||
2875 | + dkt=dk01(k) | ||
2876 | + dk01(k)=dk0(k) | ||
2877 | + dk0(k)=(cbe*(n+n-1)*dk01(k)-fnr(n-k-1)*fnr(n+k-1)*dkt) & | ||
2878 | + /(fnr(n+k)*fnr(n-k)) | ||
2879 | + dc(0,k)=dk0(k) | ||
2880 | + enddo | ||
2881 | + im=1 | ||
2882 | + do m=1,kmax | ||
2883 | + im=-im | ||
2884 | + fmn=1./fnr(n-m+1)/fnr(n+m) | ||
2885 | + m1=m-1 | ||
2886 | + dkm0=0. | ||
2887 | + do k=-n,n | ||
2888 | + dkm1=dkm0 | ||
2889 | + dkm0=dc(m1,k) | ||
2890 | + dc(m,k)=(fnr(n+k)*fnr(n-k+1)*cbe2*dkm1 & | ||
2891 | + -fnr(n-k)*fnr(n+k+1)*sbe2*dc(m1,k+1) & | ||
2892 | + -k*sbe*dc(m1,k))*fmn | ||
2893 | + dc(-m,-k)=dc(m,k)*(-1)**(k)*im | ||
2894 | + enddo | ||
2895 | + enddo | ||
2896 | + do m=-n,n | ||
2897 | + if(m.le.-1) then | ||
2898 | + ka=n+1 | ||
2899 | + na=-m | ||
2900 | + else | ||
2901 | + ka=m | ||
2902 | + na=n | ||
2903 | + endif | ||
2904 | + a=0. | ||
2905 | + b=0. | ||
2906 | + do k=-kmax,kmax | ||
2907 | + a=a+dc(-k,-m)*amnt(1,k) | ||
2908 | + b=b+dc(-k,-m)*amnt(2,k) | ||
2909 | + enddo | ||
2910 | + if(idir.eq.1) then | ||
2911 | + amn(ka,na,1)=a*egammam(m) | ||
2912 | + amn(ka,na,2)=b*egammam(m) | ||
2913 | + else | ||
2914 | + amn(ka,na,1)=a*ealpham(m) | ||
2915 | + amn(ka,na,2)=b*ealpham(m) | ||
2916 | + endif | ||
2917 | + enddo | ||
2918 | + enddo | ||
2919 | + end subroutine rotvec | ||
2920 | +! | ||
2921 | +! sets up the stored translation matrices for mpi | ||
2922 | +! | ||
2923 | +! | ||
2924 | +! last revised: 15 January 2011 | ||
2925 | +! november 2011: added near and far field translation | ||
2926 | +! | ||
2927 | + subroutine mpirottranmtrxsetup(nsphere,nodr,rpos,ri,istore,nfdistance,& | ||
2928 | + runprintunit) | ||
2929 | + use mpidefs | ||
2930 | + use mpidata | ||
2931 | + use intrinsics | ||
2932 | + use numconstants | ||
2933 | + use specialfuncs | ||
2934 | + implicit none | ||
2935 | + integer :: nsphere,nodr(nsphere),i,j,nodrmax,nodrmin,n,ntotrot,ntottran,ntotephi, & | ||
2936 | + ierr,n1,n2,nt,rank,nsrank,runprintunit,isendok,tag,sendrank,numprocs,brank, & | ||
2937 | + nsend,istore | ||
2938 | + real(8) :: rpos(3,nsphere),xij(3),r,ct,memused(1),memusedmax(1),memusedmin(1), & | ||
2939 | + nfdistance,nfdistancei | ||
2940 | + real(8), allocatable :: rotmat(:,:) | ||
2941 | + complex(8) :: ri,ephi | ||
2942 | + complex(8), allocatable :: tranmat(:,:,:),ephimat(:),pivec(:,:,:) | ||
2943 | + data isendok,tag/0,1/ | ||
2944 | + numprocs=proc_per_group | ||
2945 | + rank=group_rank | ||
2946 | + brank=base_rank | ||
2947 | + nsrank=mpi_sphere_number(rank) | ||
2948 | + nodrmax=maxval(nodr) | ||
2949 | + call init(nodrmax) | ||
2950 | + store_tran_mat=istore | ||
2951 | + near_field_distance=nfdistance | ||
2952 | + if(allocated(sphere_position)) deallocate(sphere_position) | ||
2953 | + allocate(sphere_position(3,nsphere)) | ||
2954 | + sphere_position=rpos | ||
2955 | + if(istore.eq.0) then | ||
2956 | + return | ||
2957 | + endif | ||
2958 | + if(allocated(nsizerot)) deallocate(nsizerot,nsizetran,nsizeephi,noffrot,nofftran,noffephi) | ||
2959 | + allocate(nsizerot(nsphere,nsphere),nsizetran(nsphere,nsphere),nsizeephi(nsphere,nsphere), & | ||
2960 | + noffrot(nsphere,nsphere),nofftran(nsphere,nsphere),noffephi(nsphere,nsphere)) | ||
2961 | + if(allocated(rvec_temp)) deallocate(rvec_temp,tvec_temp,c_temp,ct_temp, & | ||
2962 | + rvec2_temp,tvec2_temp,c2_temp,ct2_temp) | ||
2963 | + allocate(rvec_temp(-nodrmax:nodrmax,2),tvec_temp(nodrmax,2), & | ||
2964 | + c_temp(-nodrmax:nodrmax,nodrmax,2),ct_temp(nodrmax,2,2), & | ||
2965 | + rvec2_temp(-nodrmax:nodrmax,2),tvec2_temp(nodrmax,2), & | ||
2966 | + c2_temp(-nodrmax:nodrmax,nodrmax,2),ct2_temp(nodrmax,2,2)) | ||
2967 | + stored_max_order=nodrmax | ||
2968 | +! | ||
2969 | +! determine the memory requirements | ||
2970 | +! | ||
2971 | + ntotrot=0 | ||
2972 | + ntottran=0 | ||
2973 | + ntotephi=0 | ||
2974 | + do i=mpi_sphere_index(rank)+1,mpi_sphere_index(rank)+nsrank | ||
2975 | + do j=1,nsphere | ||
2976 | + xij(:)=rpos(:,i)-rpos(:,j) | ||
2977 | + if(j.ne.i) then | ||
2978 | + if(nfdistance.lt.0.) then | ||
2979 | + nfdistancei=(.5*dble(nodr(i)+nodr(j)))**2. | ||
2980 | + else | ||
2981 | + nfdistancei=nfdistance | ||
2982 | + endif | ||
2983 | + r=sqrt(dot_product(xij,xij)) | ||
2984 | + if(r.le.nfdistancei) then | ||
2985 | + nodrmax=max(nodr(j),nodr(i)) | ||
2986 | + nodrmin=min(nodr(j),nodr(i)) | ||
2987 | + noffrot(i,j)=ntotrot | ||
2988 | + nofftran(i,j)=ntottran | ||
2989 | + noffephi(i,j)=ntotephi | ||
2990 | + nsizerot(i,j)=(2*nodrmin+1)*(1+nodrmax*(nodrmax+2)) | ||
2991 | + nsizetran(i,j)=nodr(i)*nodr(j)*(nodr(j)+3) | ||
2992 | + nsizeephi(i,j)=2*nodrmax+1 | ||
2993 | + ntotrot=ntotrot+nsizerot(i,j) | ||
2994 | + ntottran=ntottran+nsizetran(i,j) | ||
2995 | + ntotephi=ntotephi+nsizeephi(i,j) | ||
2996 | + endif | ||
2997 | + if(r.gt.nfdistancei.and.istore.eq.2) then | ||
2998 | + nodrmax=max(nodr(j),nodr(i)) | ||
2999 | + nofftran(i,j)=ntottran | ||
3000 | + nsizetran(i,j)=2*nodrmax*(nodrmax+2) | ||
3001 | + ntottran=ntottran+nsizetran(i,j) | ||
3002 | + endif | ||
3003 | + endif | ||
3004 | + enddo | ||
3005 | + enddo | ||
3006 | + memused(1)=dble(8*ntotrot+16*(ntottran+ntotephi))*1.d-6 | ||
3007 | + nsend=1 | ||
3008 | + call ms_mpi(mpi_command='reduce',mpi_send_buf_dp=memused,mpi_recv_buf_dp=memusedmax,& | ||
3009 | + mpi_number=1,mpi_rank=0,mpi_operation=ms_mpi_max) | ||
3010 | + call ms_mpi(mpi_command='reduce',mpi_send_buf_dp=memused,mpi_recv_buf_dp=memusedmin,& | ||
3011 | + mpi_number=1,mpi_rank=0,mpi_operation=ms_mpi_min) | ||
3012 | + call ms_mpi(mpi_command='barrier') | ||
3013 | + if(brank.eq.0) then | ||
3014 | + write(runprintunit,'('' maximum translation matrix storage:'',f9.4,'' MB'')') memusedmax | ||
3015 | + write(runprintunit,'('' minimum translation matrix storage:'',f9.4,'' MB'')') memusedmin | ||
3016 | + call flush(runprintunit) | ||
3017 | + endif | ||
3018 | +! | ||
3019 | +! calculate the matrices and store in memory | ||
3020 | +! | ||
3021 | + if(allocated(rotmatstore)) deallocate(rotmatstore,tranmatstore,ephimatstore) | ||
3022 | + allocate(rotmatstore(ntotrot),stat=ierr) | ||
3023 | + allocate(tranmatstore(ntottran),stat=ierr) | ||
3024 | + allocate(ephimatstore(ntotephi),stat=ierr) | ||
3025 | + do i=mpi_sphere_index(rank)+1,mpi_sphere_index(rank)+nsrank | ||
3026 | + do j=1,nsphere | ||
3027 | + if(j.ne.i) then | ||
3028 | + nodrmax=max(nodr(j),nodr(i)) | ||
3029 | + nodrmin=min(nodr(j),nodr(i)) | ||
3030 | + xij=rpos(:,i)-rpos(:,j) | ||
3031 | + call cartosphere(xij,r,ct,ephi) | ||
3032 | + if(nfdistance.lt.0.) then | ||
3033 | + nfdistancei=(.5*dble(nodr(i)+nodr(j)))**2. | ||
3034 | + else | ||
3035 | + nfdistancei=nfdistance | ||
3036 | + endif | ||
3037 | + if(r.le.nfdistancei) then | ||
3038 | +! | ||
3039 | +! rotation matrix | ||
3040 | +! | ||
3041 | + n1=noffrot(i,j)+1 | ||
3042 | + nt=nsizerot(i,j) | ||
3043 | + n2=n1+nt-1 | ||
3044 | + allocate(rotmat(-nodrmin:nodrmin,0:nodrmax*(nodrmax+2))) | ||
3045 | + call rotcoef(ct,nodrmin,nodrmax,rotmat) | ||
3046 | + rotmatstore(n1:n2)=reshape(rotmat,(/nt/)) | ||
3047 | + deallocate(rotmat) | ||
3048 | +! | ||
3049 | +! axial translation matrix | ||
3050 | +! | ||
3051 | + n1=nofftran(i,j)+1 | ||
3052 | + nt=nsizetran(i,j) | ||
3053 | + n2=n1+nt-1 | ||
3054 | + allocate(tranmat(nodr(i),nodr(j)*(nodr(j)+3)/2,2)) | ||
3055 | + call axialtrancoef(3,r,ri,nodr(i),nodr(j),tranmat) | ||
3056 | + tranmatstore(n1:n2)=reshape(tranmat,(/nt/)) | ||
3057 | + deallocate(tranmat) | ||
3058 | +! | ||
3059 | +! ephi matrix | ||
3060 | +! | ||
3061 | + n1=noffephi(i,j)+1 | ||
3062 | + nt=nsizeephi(i,j) | ||
3063 | + n2=n1+nt-1 | ||
3064 | + allocate(ephimat(-nodrmax:nodrmax)) | ||
3065 | + call ephicoef(ephi,nodrmax,ephimat) | ||
3066 | + ephimatstore(n1:n2)=ephimat(-nodrmax:nodrmax) | ||
3067 | + deallocate(ephimat) | ||
3068 | +! | ||
3069 | +! ff translation matrix storage | ||
3070 | +! | ||
3071 | + elseif(istore.eq.2) then | ||
3072 | + n1=nofftran(i,j)+1 | ||
3073 | + nt=nsizetran(i,j) | ||
3074 | + n2=n1+nt-1 | ||
3075 | + nodrmax=max(nodr(j),nodr(i)) | ||
3076 | + allocate(pivec(0:nodrmax+1,nodrmax,2)) | ||
3077 | + call pifunc(ct,ephi,nodrmax,nodrmax,pivec) | ||
3078 | + tranmatstore(n1:n2)=reshape(pivec,(/nt/)) | ||
3079 | + deallocate(pivec) | ||
3080 | + endif | ||
3081 | + endif | ||
3082 | + enddo | ||
3083 | + enddo | ||
3084 | + end subroutine mpirottranmtrxsetup | ||
3085 | +! | ||
3086 | +! clear the stored translation matrices | ||
3087 | +! | ||
3088 | +! | ||
3089 | +! last revised: 15 January 2011 | ||
3090 | +! | ||
3091 | + subroutine rottranmtrxclear() | ||
3092 | + implicit none | ||
3093 | + if(allocated(rotmatstore)) deallocate(rotmatstore,tranmatstore,ephimatstore) | ||
3094 | + if(allocated(sphere_position)) deallocate(sphere_position) | ||
3095 | + end subroutine rottranmtrxclear | ||
3096 | +! | ||
3097 | +! translation coefficient vector cx by xij in medium with ri by rotation-translation | ||
3098 | +! itype: 1 or 3 | ||
3099 | +! icalc: =1, calculate matrices; = 0, use stored matrix | ||
3100 | +! idir: =1, translation of xij, =-1, -xij (reverse) | ||
3101 | +! itran=1, A(i-j) a(j), = -1, a(j) A(i-j) | ||
3102 | +! | ||
3103 | +! | ||
3104 | +! last revised: 15 January 2011 | ||
3105 | +! | ||
3106 | + subroutine rottran(cx,cy,xij,ri,nodrx,nodry,itype,icalc,idir,itran) | ||
3107 | + use numconstants | ||
3108 | + use specialfuncs | ||
3109 | + implicit none | ||
3110 | + integer :: nodrx,nodry,itype,icalc,idir,itran,nmax,nmin,n,m,p,nblk | ||
3111 | + real(8) :: xij(3),r,ct | ||
3112 | + complex(8) :: ri,ephi,cx(0:nodrx+1,nodrx,2),cy(0:nodry+1,nodry,2) | ||
3113 | + real(8), allocatable, save :: rotmat(:,:) | ||
3114 | + complex(8), allocatable, save :: ephimat(:), tranmat(:,:,:) | ||
3115 | + if(icalc.eq.1) then | ||
3116 | + nmax=max(nodrx,nodry) | ||
3117 | + nmin=min(nodrx,nodry) | ||
3118 | + call cartosphere(xij,r,ct,ephi) | ||
3119 | + if(r.lt.1.d-4) then | ||
3120 | + do p=1,2 | ||
3121 | + do n=1,nmin | ||
3122 | + do m=0,nmin+1 | ||
3123 | + cy(m,n,p)=cy(m,n,p)+cx(m,n,p) | ||
3124 | + enddo | ||
3125 | + enddo | ||
3126 | + enddo | ||
3127 | + return | ||
3128 | + endif | ||
3129 | + if(allocated(ephimat)) deallocate(rotmat,ephimat,tranmat) | ||
3130 | + if(nmax.gt.stored_max_order) then | ||
3131 | + if(allocated(rvec_temp)) deallocate(rvec_temp,tvec_temp, & | ||
3132 | + c_temp,ct_temp,rvec2_temp,tvec2_temp, & | ||
3133 | + c2_temp,ct2_temp) | ||
3134 | + allocate(rvec_temp(-nmax:nmax,2),tvec_temp(nmax,2), & | ||
3135 | + c_temp(-nmax:nmax,nmax,2),ct_temp(nmax,2,2), & | ||
3136 | + rvec2_temp(-nmax:nmax,2),tvec2_temp(nmax,2), & | ||
3137 | + c2_temp(-nmax:nmax,nmax,2),ct2_temp(nmax,2,2)) | ||
3138 | + stored_max_order=nmax | ||
3139 | + endif | ||
3140 | + nblk=(nodrx*(nodrx+3))/2 | ||
3141 | + allocate(rotmat(-nmin:nmin,0:nmax*(nmax+2))) | ||
3142 | + allocate(ephimat(-nmax:nmax)) | ||
3143 | + allocate(tranmat(1:nodry,1:nblk,1:2)) | ||
3144 | + call rotcoef(ct,nmin,nmax,rotmat) | ||
3145 | +! call axialtrancoef(itype,r,ri,nodry,nodrx,tranmat) | ||
3146 | + call axialtrancoefrecurrence(itype,r,ri,nodry,nodrx,tranmat) | ||
3147 | + call ephicoef(ephi,nmax,ephimat) | ||
3148 | + endif | ||
3149 | + call rottranmtrx(cx,cy,idir,itran,nodrx,nodry,ephimat,rotmat,tranmat) | ||
3150 | + return | ||
3151 | + end subroutine rottran | ||
3152 | +! | ||
3153 | +! far field formula for outgoing SVWF translation | ||
3154 | +! October 2011 | ||
3155 | +! | ||
3156 | + subroutine farfieldtranslation(cx,cy,xij,ri,nodrx,nodry,icase, & | ||
3157 | + stored_pivec_matrix) | ||
3158 | + use numconstants | ||
3159 | + use specialfuncs | ||
3160 | + implicit none | ||
3161 | + integer :: nodrx,nodry,itype,icalc,icase,nmax,nmin,n,m,p,nblk,im | ||
3162 | + real(8) :: xij(3),r,ct,xijt(3) | ||
3163 | + complex(8) :: ri,ephi,cx(0:nodrx+1,nodrx,2),cy(0:nodry+1,nodry,2), & | ||
3164 | + cxt(0:nodrx+1,nodrx,2),cyt(0:nodry+1,nodry,2), & | ||
3165 | + sumx(2),c1,pivec(0:max(nodrx,nodry)+1,max(nodrx,nodry),2) | ||
3166 | + complex(8), optional :: stored_pivec_matrix(0:max(nodrx,nodry)+1,max(nodrx,nodry),2) | ||
3167 | + | ||
3168 | + call cartosphere(xij,r,ct,ephi) | ||
3169 | + nmax=max(nodrx,nodry) | ||
3170 | + if(present(stored_pivec_matrix)) then | ||
3171 | + pivec=stored_pivec_matrix | ||
3172 | + else | ||
3173 | + call pifunc(ct,ephi,nmax,nmax,pivec) | ||
3174 | + endif | ||
3175 | + if(icase.eq.1) then | ||
3176 | + sumx(1)=sum(pivec(0:nodrx+1,1:nodrx,1:2)*cx(0:nodrx+1,1:nodrx,1:2)) | ||
3177 | + sumx(2)=sum(pivec(0:nodrx+1,1:nodrx,2:1:-1)*cx(0:nodrx+1,1:nodrx,1:2)) | ||
3178 | + sumx=sumx*cdexp((0.d0,1.d0)*ri*r)/((0.d0,1.d0)*ri*r)*8.d0 | ||
3179 | + cyt(0:nodry+1,1:nodry,1) = conjg(pivec(0:nodry+1,1:nodry,1))*sumx(1) & | ||
3180 | + +conjg(pivec(0:nodry+1,1:nodry,2))*sumx(2) | ||
3181 | + cyt(0:nodry+1,1:nodry,2) = conjg(pivec(0:nodry+1,1:nodry,2))*sumx(1) & | ||
3182 | + +conjg(pivec(0:nodry+1,1:nodry,1))*sumx(2) | ||
3183 | + else | ||
3184 | + do n=1,nodrx | ||
3185 | + do p=1,2 | ||
3186 | + im=(-1)**(n+p) | ||
3187 | + cxt(n+1,1:n,p)=im*cx(n+1,1:n,p) | ||
3188 | + cxt(0:n,n,p)=im*cx(0:n,n,p) | ||
3189 | + enddo | ||
3190 | + enddo | ||
3191 | + sumx(1)=sum(conjg(pivec(0:nodrx+1,1:nodrx,1:2))*cxt(0:nodrx+1,1:nodrx,1:2)) | ||
3192 | + sumx(2)=sum(conjg(pivec(0:nodrx+1,1:nodrx,2:1:-1))*cxt(0:nodrx+1,1:nodrx,1:2)) | ||
3193 | + sumx=sumx*cdexp((0.d0,1.d0)*ri*r)/((0.d0,1.d0)*ri*r)*8.d0 | ||
3194 | + cyt(0:nodry+1,1:nodry,1) = pivec(0:nodry+1,1:nodry,1)*sumx(1) & | ||
3195 | + +pivec(0:nodry+1,1:nodry,2)*sumx(2) | ||
3196 | + cyt(0:nodry+1,1:nodry,2) = pivec(0:nodry+1,1:nodry,2)*sumx(1) & | ||
3197 | + +pivec(0:nodry+1,1:nodry,1)*sumx(2) | ||
3198 | + do n=1,nodry | ||
3199 | + do p=1,2 | ||
3200 | + im=(-1)**(n+p) | ||
3201 | + cyt(n+1,1:n,p)=im*cyt(n+1,1:n,p) | ||
3202 | + cyt(0:n,n,p)=im*cyt(0:n,n,p) | ||
3203 | + enddo | ||
3204 | + enddo | ||
3205 | + endif | ||
3206 | + cy=cy+cyt | ||
3207 | + end subroutine farfieldtranslation | ||
3208 | +! | ||
3209 | +! far field translation: normal and transpose, for bcgm solution | ||
3210 | +! october 2011 | ||
3211 | +! | ||
3212 | + subroutine farfieldtranslationtwovec(cx1,cx2,cy1,cy2,xij,ri,nodrx,nodry, & | ||
3213 | + stored_pivec_matrix) | ||
3214 | + use numconstants | ||
3215 | + use specialfuncs | ||
3216 | + implicit none | ||
3217 | + integer :: nodrx,nodry,itype,icalc,icase,nmax,nmin,n,m,p,nblk,im | ||
3218 | + real(8) :: xij(3),r,ct,xijt(3) | ||
3219 | + complex(8) :: ri,ephi,cx1(0:nodrx+1,nodrx,2),cy1(0:nodry+1,nodry,2), & | ||
3220 | + cx2(0:nodrx+1,nodrx,2),cy2(0:nodry+1,nodry,2), & | ||
3221 | + cxt(0:nodrx+1,nodrx,2),cyt1(0:nodry+1,nodry,2), & | ||
3222 | + cyt2(0:nodry+1,nodry,2), & | ||
3223 | + sumx(2),c1,phasefunc, & | ||
3224 | + pivec(0:max(nodrx,nodry)+1,max(nodrx,nodry),2) | ||
3225 | + complex(8), optional :: stored_pivec_matrix(0:max(nodrx,nodry)+1,max(nodrx,nodry),2) | ||
3226 | + | ||
3227 | + call cartosphere(xij,r,ct,ephi) | ||
3228 | + nmax=max(nodrx,nodry) | ||
3229 | + if(present(stored_pivec_matrix)) then | ||
3230 | + pivec=stored_pivec_matrix | ||
3231 | + else | ||
3232 | + call pifunc(ct,ephi,nmax,nmax,pivec) | ||
3233 | + endif | ||
3234 | + phasefunc=cdexp((0.d0,1.d0)*ri*r)/((0.d0,1.d0)*ri*r)*8.d0 | ||
3235 | + sumx(1)=sum(pivec(0:nodrx+1,1:nodrx,1:2)*cx1(0:nodrx+1,1:nodrx,1:2)) | ||
3236 | + sumx(2)=sum(pivec(0:nodrx+1,1:nodrx,2:1:-1)*cx1(0:nodrx+1,1:nodrx,1:2)) | ||
3237 | + sumx=sumx*phasefunc | ||
3238 | + cyt1(0:nodry+1,1:nodry,1) = conjg(pivec(0:nodry+1,1:nodry,1))*sumx(1) & | ||
3239 | + +conjg(pivec(0:nodry+1,1:nodry,2))*sumx(2) | ||
3240 | + cyt1(0:nodry+1,1:nodry,2) = conjg(pivec(0:nodry+1,1:nodry,2))*sumx(1) & | ||
3241 | + +conjg(pivec(0:nodry+1,1:nodry,1))*sumx(2) | ||
3242 | + do n=1,nodrx | ||
3243 | + do p=1,2 | ||
3244 | + im=(-1)**(n+p) | ||
3245 | + cxt(n+1,1:n,p)=im*cx2(n+1,1:n,p) | ||
3246 | + cxt(0:n,n,p)=im*cx2(0:n,n,p) | ||
3247 | + enddo | ||
3248 | + enddo | ||
3249 | + sumx(1)=sum(conjg(pivec(0:nodrx+1,1:nodrx,1:2))*cxt(0:nodrx+1,1:nodrx,1:2)) | ||
3250 | + sumx(2)=sum(conjg(pivec(0:nodrx+1,1:nodrx,2:1:-1))*cxt(0:nodrx+1,1:nodrx,1:2)) | ||
3251 | + sumx=sumx*phasefunc | ||
3252 | + cyt2(0:nodry+1,1:nodry,1) = pivec(0:nodry+1,1:nodry,1)*sumx(1) & | ||
3253 | + +pivec(0:nodry+1,1:nodry,2)*sumx(2) | ||
3254 | + cyt2(0:nodry+1,1:nodry,2) = pivec(0:nodry+1,1:nodry,2)*sumx(1) & | ||
3255 | + +pivec(0:nodry+1,1:nodry,1)*sumx(2) | ||
3256 | + do n=1,nodry | ||
3257 | + do p=1,2 | ||
3258 | + im=(-1)**(n+p) | ||
3259 | + cyt2(n+1,1:n,p)=im*cyt2(n+1,1:n,p) | ||
3260 | + cyt2(0:n,n,p)=im*cyt2(0:n,n,p) | ||
3261 | + enddo | ||
3262 | + enddo | ||
3263 | + cy1=cy1+cyt1 | ||
3264 | + cy2=cy2+cyt2 | ||
3265 | + end subroutine farfieldtranslationtwovec | ||
3266 | +! | ||
3267 | +! correction term for hybrid bcgm solution: difference between exact and | ||
3268 | +! ff translation field | ||
3269 | +! november 2011 | ||
3270 | +! | ||
3271 | + subroutine fftranslationerror(cx,cy,jx,iy,nodrx,nodry) | ||
3272 | + use numconstants | ||
3273 | + use specialfuncs | ||
3274 | + implicit none | ||
3275 | + integer :: nodrx,nodry,idir,itran,iy,jx,istore | ||
3276 | + integer :: nr1,nr2,nt1,nt2,ne1,ne2 | ||
3277 | + real(8) :: xj(3),xi(3),xij(3),rij,nfdist | ||
3278 | + complex(8) :: cx(0:nodrx+1,nodrx,2),cy(0:nodry+1,nodry,2), & | ||
3279 | + cyt(0:nodry+1,nodry,2) | ||
3280 | + xj(:)=sphere_position(:,jx) | ||
3281 | + xi(:)=sphere_position(:,iy) | ||
3282 | + xij=xi-xj | ||
3283 | + rij=sqrt(dot_product(xij,xij)) | ||
3284 | + if(near_field_distance.lt.0.) then | ||
3285 | + nfdist=(.5*(nodrx+nodry))**2. | ||
3286 | + else | ||
3287 | + nfdist=near_field_distance | ||
3288 | + endif | ||
3289 | + if(rij.gt.nfdist) then | ||
3290 | + cyt=0.d0 | ||
3291 | + call farfieldtranslation(cx,cyt,xij,(1.d0,0.d0),nodrx,nodry,1) | ||
3292 | + cyt=-cyt | ||
3293 | + call rottran(cx,cyt,xij,(1.d0,0.d0),nodrx,nodry,3,1,1,1) | ||
3294 | + cy=cy+cyt | ||
3295 | + endif | ||
3296 | + end subroutine fftranslationerror | ||
3297 | +! | ||
3298 | +! translation via stored or calculated matrices (replaces rottranstoredmatrix) | ||
3299 | +! | ||
3300 | +! 12 October 2011. | ||
3301 | +! if rij> near_field_distance, the far field formula is | ||
3302 | +! applied. | ||
3303 | +! | ||
3304 | + subroutine rottranjtoi(cx,cy,jx,iy,nodrx,nodry,idir,itran) | ||
3305 | + use numconstants | ||
3306 | + use specialfuncs | ||
3307 | + implicit none | ||
3308 | + integer :: nodrx,nodry,idir,itran,iy,jx,istore | ||
3309 | + integer :: nr1,nr2,nt1,nt2,ne1,ne2 | ||
3310 | + real(8) :: xj(3),xi(3),xij(3),rij,nfdist | ||
3311 | + complex(8) :: cx(0:nodrx+1,nodrx,2),cy(0:nodry+1,nodry,2) | ||
3312 | + xj(:)=sphere_position(:,jx) | ||
3313 | + xi(:)=sphere_position(:,iy) | ||
3314 | + xij=xi-xj | ||
3315 | + rij=sqrt(dot_product(xij,xij)) | ||
3316 | + if(near_field_distance.lt.0.) then | ||
3317 | + nfdist=(.5*(nodrx+nodry))**2. | ||
3318 | + else | ||
3319 | + nfdist=near_field_distance | ||
3320 | + endif | ||
3321 | + if(rij.gt.nfdist) then | ||
3322 | + if(store_tran_mat.eq.2) then | ||
3323 | + nt1=nofftran(iy,jx)+1 | ||
3324 | + nt2=nt1+nsizetran(iy,jx)-1 | ||
3325 | + call farfieldtranslation(cx,cy,xij,(1.d0,0.d0),nodrx,nodry,itran, & | ||
3326 | + stored_pivec_matrix=tranmatstore(nt1:nt2)) | ||
3327 | + else | ||
3328 | + call farfieldtranslation(cx,cy,xij,(1.d0,0.d0),nodrx,nodry,itran) | ||
3329 | + endif | ||
3330 | + else | ||
3331 | + if(store_tran_mat.eq.0) then | ||
3332 | + call rottran(cx,cy,xij,(1.d0,0.d0),nodrx,nodry,3,1,idir,itran) | ||
3333 | + else | ||
3334 | + nr1=noffrot(iy,jx)+1 | ||
3335 | + nr2=nr1+nsizerot(iy,jx)-1 | ||
3336 | + nt1=nofftran(iy,jx)+1 | ||
3337 | + nt2=nt1+nsizetran(iy,jx)-1 | ||
3338 | + ne1=noffephi(iy,jx)+1 | ||
3339 | + ne2=ne1+nsizeephi(iy,jx)-1 | ||
3340 | + call rottranmtrx(cx,cy,idir,itran,nodrx,nodry,ephimatstore(ne1:ne2), & | ||
3341 | + rotmatstore(nr1:nr2),tranmatstore(nt1:nt2)) | ||
3342 | + endif | ||
3343 | + endif | ||
3344 | + end subroutine rottranjtoi | ||
3345 | +! | ||
3346 | +! normal and transpose translation, for bcgm | ||
3347 | +! november 2011 | ||
3348 | +! | ||
3349 | + subroutine rottrantwojtoi(cx1,cx2,cy1,cy2,jx,iy,nodrx,nodry) | ||
3350 | + use numconstants | ||
3351 | + use specialfuncs | ||
3352 | + implicit none | ||
3353 | + integer :: nodrx,nodry,idir,itran,iy,jx,istore | ||
3354 | + integer :: nr1,nr2,nt1,nt2,ne1,ne2 | ||
3355 | + real(8) :: xj(3),xi(3),xij(3),rij,nfdist | ||
3356 | + complex(8) :: cx1(0:nodrx+1,nodrx,2),cy1(0:nodry+1,nodry,2), & | ||
3357 | + cx2(0:nodrx+1,nodrx,2),cy2(0:nodry+1,nodry,2) | ||
3358 | + xj(:)=sphere_position(:,jx) | ||
3359 | + xi(:)=sphere_position(:,iy) | ||
3360 | + xij=xi-xj | ||
3361 | + rij=sqrt(dot_product(xij,xij)) | ||
3362 | + if(near_field_distance.lt.0.) then | ||
3363 | + nfdist=(.5*(nodrx+nodry))**2. | ||
3364 | + else | ||
3365 | + nfdist=near_field_distance | ||
3366 | + endif | ||
3367 | + if(rij.gt.nfdist) then | ||
3368 | + if(store_tran_mat.eq.2) then | ||
3369 | + nt1=nofftran(iy,jx)+1 | ||
3370 | + nt2=nt1+nsizetran(iy,jx)-1 | ||
3371 | + call farfieldtranslationtwovec(cx1,cx2,cy1,cy2,xij,(1.d0,0.d0),nodrx,nodry, & | ||
3372 | + stored_pivec_matrix=tranmatstore(nt1:nt2)) | ||
3373 | + else | ||
3374 | + call farfieldtranslationtwovec(cx1,cx2,cy1,cy2,xij,(1.d0,0.d0),nodrx,nodry) | ||
3375 | + endif | ||
3376 | + else | ||
3377 | + if(store_tran_mat.eq.0) then | ||
3378 | + call rottran(cx1,cy1,xij,(1.d0,0.d0),nodrx,nodry,3,1,1,1) | ||
3379 | + call rottran(cx2,cy2,xij,(1.d0,0.d0),nodrx,nodry,3,0,-1,-1) | ||
3380 | + else | ||
3381 | + nr1=noffrot(iy,jx)+1 | ||
3382 | + nr2=nr1+nsizerot(iy,jx)-1 | ||
3383 | + nt1=nofftran(iy,jx)+1 | ||
3384 | + nt2=nt1+nsizetran(iy,jx)-1 | ||
3385 | + ne1=noffephi(iy,jx)+1 | ||
3386 | + ne2=ne1+nsizeephi(iy,jx)-1 | ||
3387 | + call rottranmtrxtwovec(cx1,cx2,cy1,cy2,nodrx,nodry,ephimatstore(ne1:ne2), & | ||
3388 | + rotmatstore(nr1:nr2),tranmatstore(nt1:nt2)) | ||
3389 | + endif | ||
3390 | + endif | ||
3391 | + end subroutine rottrantwojtoi | ||
3392 | +! | ||
3393 | +! the vectorized rotation-translation-rotation operation | ||
3394 | +! | ||
3395 | +! | ||
3396 | +! last revised: 15 January 2011 | ||
3397 | +! | ||
3398 | + subroutine rottranmtrx(cx,cy,idir,itran,nodrx,nodry,ephimat,rotmat,tranmat) | ||
3399 | + use numconstants | ||
3400 | + use specialfuncs | ||
3401 | + implicit none | ||
3402 | + integer :: nodrx,nodry,itype,icalc,idir,itran,nmax,nmin | ||
3403 | + integer :: m,n,k,l,nn1,nn2,ll1,mn,kl,m1,p,n1,addr(2) | ||
3404 | + real(8), target :: rotmat(-min(nodrx,nodry):min(nodrx,nodry), & | ||
3405 | + 0:max(nodrx,nodry)*(max(nodrx,nodry)+2)) | ||
3406 | + real(8), pointer :: rmat(:,:) | ||
3407 | + complex(8) :: cx(0:nodrx+1,nodrx,2),cy(0:nodry+1,nodry,2), & | ||
3408 | + ephimat(-max(nodrx,nodry):max(nodrx,nodry)) | ||
3409 | + complex(8), target :: tranmat(nodry,nodrx*(nodrx+3)/2,2) | ||
3410 | + complex(8), pointer :: tmat1(:,:),tmat2(:,:) | ||
3411 | + c_temp=(0.d0,0.d0) | ||
3412 | + nmin=min(nodrx,nodry) | ||
3413 | +! | ||
3414 | +! rotation to origin of target | ||
3415 | +! | ||
3416 | + do n=1,nodrx | ||
3417 | + nn1=n*(n+1)-n | ||
3418 | + nn2=nn1+(2*n+1)-1 | ||
3419 | + n1=min(n,nodry) | ||
3420 | + rmat=>rotmat(-n1:n1,nn1:nn2) | ||
3421 | + do p=1,2 | ||
3422 | + rvec_temp(-n:-1,p)=cx(n+1,n:1:-1,p) | ||
3423 | + rvec_temp(0:n,p)=cx(0:n,n,p) | ||
3424 | + if(itran.eq.1) then | ||
3425 | + rvec_temp(-n:n,p)=rvec_temp(-n:n,p)*ephimat(-n:n) | ||
3426 | + else | ||
3427 | + rvec_temp(-n:n,p)=rvec_temp(-n:n,p)*conjg(ephimat(-n:n)) | ||
3428 | + endif | ||
3429 | + enddo | ||
3430 | + c_temp(-n1:n1,n,1:2)=matmul(rmat,rvec_temp(-n:n,1:2)) | ||
3431 | + enddo | ||
3432 | +! | ||
3433 | +! axial translation to target | ||
3434 | +! | ||
3435 | + do m=0,nmin | ||
3436 | + m1=max(1,m) | ||
3437 | + nn1=atcadd(m,m1,nodrx) | ||
3438 | + nn2=atcadd(m,nodrx,nodrx) | ||
3439 | + tmat1=>tranmat(m1:nodry,nn1:nn2,1) | ||
3440 | + tmat2=>tranmat(m1:nodry,nn1:nn2,2) | ||
3441 | + tvec_temp(m1:nodrx,1)=idir*c_temp(m,m1:nodrx,1) | ||
3442 | + tvec_temp(m1:nodrx,2)=c_temp(m,m1:nodrx,2) | ||
3443 | + if(itran*idir.eq.-1) then | ||
3444 | + tvec_temp(m1:nodrx,1)=tvec_temp(m1:nodrx,1)*monen(m1:nodrx) | ||
3445 | + tvec_temp(m1:nodrx,2)=tvec_temp(m1:nodrx,2)*monen(m1:nodrx) | ||
3446 | + endif | ||
3447 | + ct_temp=(0.d0,0.d0) | ||
3448 | + ct_temp(m1:nodry,1,1:2)=matmul(tmat1,tvec_temp(m1:nodrx,1:2)) | ||
3449 | + ct_temp(m1:nodry,2,1:2)=matmul(tmat2,tvec_temp(m1:nodrx,1:2)) | ||
3450 | + c_temp(m,m1:nodry,1)=idir*(ct_temp(m1:nodry,1,1)+ct_temp(m1:nodry,2,2)) | ||
3451 | + c_temp(m,m1:nodry,2)=ct_temp(m1:nodry,2,1)+ct_temp(m1:nodry,1,2) | ||
3452 | + if(itran*idir.eq.-1) then | ||
3453 | + c_temp(m,m1:nodry,1)=c_temp(m,m1:nodry,1)*monen(m1:nodry) | ||
3454 | + c_temp(m,m1:nodry,2)=c_temp(m,m1:nodry,2)*monen(m1:nodry) | ||
3455 | + endif | ||
3456 | + if(m.gt.0) then | ||
3457 | + tvec_temp(m1:nodrx,1)=idir*c_temp(-m,m1:nodrx,1) | ||
3458 | + tvec_temp(m1:nodrx,2)=c_temp(-m,m1:nodrx,2) | ||
3459 | + if(itran*idir.eq.-1) then | ||
3460 | + tvec_temp(m1:nodrx,1)=tvec_temp(m1:nodrx,1)*monen(m1:nodrx) | ||
3461 | + tvec_temp(m1:nodrx,2)=tvec_temp(m1:nodrx,2)*monen(m1:nodrx) | ||
3462 | + endif | ||
3463 | + ct_temp=(0.d0,0.d0) | ||
3464 | + ct_temp(m1:nodry,1,1:2)=matmul(tmat1,tvec_temp(m1:nodrx,1:2)) | ||
3465 | + ct_temp(m1:nodry,2,1:2)=matmul(tmat2,tvec_temp(m1:nodrx,1:2)) | ||
3466 | + c_temp(-m,m1:nodry,1)=idir*(ct_temp(m1:nodry,1,1)-ct_temp(m1:nodry,2,2)) | ||
3467 | + c_temp(-m,m1:nodry,2)=-ct_temp(m1:nodry,2,1)+ct_temp(m1:nodry,1,2) | ||
3468 | + if(itran*idir.eq.-1) then | ||
3469 | + c_temp(-m,m1:nodry,1)=c_temp(-m,m1:nodry,1)*monen(m1:nodry) | ||
3470 | + c_temp(-m,m1:nodry,2)=c_temp(-m,m1:nodry,2)*monen(m1:nodry) | ||
3471 | + endif | ||
3472 | + endif | ||
3473 | + enddo | ||
3474 | +! | ||
3475 | +! rotation back to original frame | ||
3476 | +! | ||
3477 | + do n=1,nodry | ||
3478 | + rvec_temp=(0.d0,0.d0) | ||
3479 | + m1=min(n,nmin) | ||
3480 | + nn1=n*(n+1)-n | ||
3481 | + nn2=n*(n+1)+n | ||
3482 | + rmat=>rotmat(-m1:m1,nn1:nn2) | ||
3483 | + do p=1,2 | ||
3484 | + if(itran.eq.1) then | ||
3485 | + rvec_temp(-n:n,p)=matmul(c_temp(-m1:m1,n,p),rmat)*conjg(ephimat(-n:n)) | ||
3486 | + else | ||
3487 | + rvec_temp(-n:n,p)=matmul(c_temp(-m1:m1,n,p),rmat)*ephimat(-n:n) | ||
3488 | + endif | ||
3489 | + cy(n+1,n:1:-1,p)=cy(n+1,n:1:-1,p)+rvec_temp(-n:-1,p) | ||
3490 | + cy(0:n,n,p)=cy(0:n,n,p)+rvec_temp(0:n,p) | ||
3491 | + enddo | ||
3492 | + enddo | ||
3493 | + end subroutine rottranmtrx | ||
3494 | +! | ||
3495 | +! two vector rotation: normal and transpose | ||
3496 | +! november 2011 | ||
3497 | +! | ||
3498 | + subroutine rottranmtrxtwovec(cx1,cx2,cy1,cy2,nodrx,nodry, & | ||
3499 | + ephimat,rotmat,tranmat) | ||
3500 | + use numconstants | ||
3501 | + use specialfuncs | ||
3502 | + implicit none | ||
3503 | + integer :: nodrx,nodry,itype,icalc,idir,itran,nmax,nmin | ||
3504 | + integer :: m,n,k,l,nn1,nn2,ll1,mn,kl,m1,p,n1,addr(2) | ||
3505 | + real(8), target :: rotmat(-min(nodrx,nodry):min(nodrx,nodry), & | ||
3506 | + 0:max(nodrx,nodry)*(max(nodrx,nodry)+2)) | ||
3507 | + real(8), pointer :: rmat(:,:) | ||
3508 | + complex(8) :: cx1(0:nodrx+1,nodrx,2),cy1(0:nodry+1,nodry,2), & | ||
3509 | + cx2(0:nodrx+1,nodrx,2),cy2(0:nodry+1,nodry,2), & | ||
3510 | + ephimat(-max(nodrx,nodry):max(nodrx,nodry)) | ||
3511 | + complex(8), target :: tranmat(nodry,nodrx*(nodrx+3)/2,2) | ||
3512 | + complex(8), pointer :: tmat1(:,:),tmat2(:,:) | ||
3513 | + c_temp=(0.d0,0.d0) | ||
3514 | + nmin=min(nodrx,nodry) | ||
3515 | +! | ||
3516 | +! rotation to origin of target | ||
3517 | +! | ||
3518 | + do n=1,nodrx | ||
3519 | + nn1=n*(n+1)-n | ||
3520 | + nn2=nn1+(2*n+1)-1 | ||
3521 | + n1=min(n,nodry) | ||
3522 | + rmat=>rotmat(-n1:n1,nn1:nn2) | ||
3523 | + do p=1,2 | ||
3524 | + rvec_temp(-n:-1,p)=cx1(n+1,n:1:-1,p) | ||
3525 | + rvec_temp(0:n,p)=cx1(0:n,n,p) | ||
3526 | + rvec2_temp(-n:-1,p)=cx2(n+1,n:1:-1,p) | ||
3527 | + rvec2_temp(0:n,p)=cx2(0:n,n,p) | ||
3528 | + rvec_temp(-n:n,p)=rvec_temp(-n:n,p)*ephimat(-n:n) | ||
3529 | + rvec2_temp(-n:n,p)=rvec2_temp(-n:n,p)*conjg(ephimat(-n:n)) | ||
3530 | + enddo | ||
3531 | + c_temp(-n1:n1,n,1:2)=matmul(rmat,rvec_temp(-n:n,1:2)) | ||
3532 | + c2_temp(-n1:n1,n,1:2)=matmul(rmat,rvec2_temp(-n:n,1:2)) | ||
3533 | + enddo | ||
3534 | +! | ||
3535 | +! axial translation to target | ||
3536 | +! | ||
3537 | + do m=0,nmin | ||
3538 | + m1=max(1,m) | ||
3539 | + nn1=atcadd(m,m1,nodrx) | ||
3540 | + nn2=atcadd(m,nodrx,nodrx) | ||
3541 | + tmat1=>tranmat(m1:nodry,nn1:nn2,1) | ||
3542 | + tmat2=>tranmat(m1:nodry,nn1:nn2,2) | ||
3543 | + tvec_temp(m1:nodrx,1)=c_temp(m,m1:nodrx,1) | ||
3544 | + tvec_temp(m1:nodrx,2)=c_temp(m,m1:nodrx,2) | ||
3545 | + tvec2_temp(m1:nodrx,1)=-c2_temp(m,m1:nodrx,1) | ||
3546 | + tvec2_temp(m1:nodrx,2)=c2_temp(m,m1:nodrx,2) | ||
3547 | + ct_temp=(0.d0,0.d0) | ||
3548 | + ct2_temp=(0.d0,0.d0) | ||
3549 | + ct_temp(m1:nodry,1,1:2)=matmul(tmat1,tvec_temp(m1:nodrx,1:2)) | ||
3550 | + ct_temp(m1:nodry,2,1:2)=matmul(tmat2,tvec_temp(m1:nodrx,1:2)) | ||
3551 | + ct2_temp(m1:nodry,1,1:2)=matmul(tmat1,tvec2_temp(m1:nodrx,1:2)) | ||
3552 | + ct2_temp(m1:nodry,2,1:2)=matmul(tmat2,tvec2_temp(m1:nodrx,1:2)) | ||
3553 | + c_temp(m,m1:nodry,1)=(ct_temp(m1:nodry,1,1)+ct_temp(m1:nodry,2,2)) | ||
3554 | + c_temp(m,m1:nodry,2)=ct_temp(m1:nodry,2,1)+ct_temp(m1:nodry,1,2) | ||
3555 | + c2_temp(m,m1:nodry,1)=-(ct2_temp(m1:nodry,1,1)+ct2_temp(m1:nodry,2,2)) | ||
3556 | + c2_temp(m,m1:nodry,2)=ct2_temp(m1:nodry,2,1)+ct2_temp(m1:nodry,1,2) | ||
3557 | + if(m.gt.0) then | ||
3558 | + tvec_temp(m1:nodrx,1)=c_temp(-m,m1:nodrx,1) | ||
3559 | + tvec_temp(m1:nodrx,2)=c_temp(-m,m1:nodrx,2) | ||
3560 | + tvec2_temp(m1:nodrx,1)=-c2_temp(-m,m1:nodrx,1) | ||
3561 | + tvec2_temp(m1:nodrx,2)=c2_temp(-m,m1:nodrx,2) | ||
3562 | + ct_temp=(0.d0,0.d0) | ||
3563 | + ct2_temp=(0.d0,0.d0) | ||
3564 | + ct_temp(m1:nodry,1,1:2)=matmul(tmat1,tvec_temp(m1:nodrx,1:2)) | ||
3565 | + ct_temp(m1:nodry,2,1:2)=matmul(tmat2,tvec_temp(m1:nodrx,1:2)) | ||
3566 | + ct2_temp(m1:nodry,1,1:2)=matmul(tmat1,tvec2_temp(m1:nodrx,1:2)) | ||
3567 | + ct2_temp(m1:nodry,2,1:2)=matmul(tmat2,tvec2_temp(m1:nodrx,1:2)) | ||
3568 | + c_temp(-m,m1:nodry,1)=(ct_temp(m1:nodry,1,1)-ct_temp(m1:nodry,2,2)) | ||
3569 | + c_temp(-m,m1:nodry,2)=-ct_temp(m1:nodry,2,1)+ct_temp(m1:nodry,1,2) | ||
3570 | + c2_temp(-m,m1:nodry,1)=-(ct2_temp(m1:nodry,1,1)-ct2_temp(m1:nodry,2,2)) | ||
3571 | + c2_temp(-m,m1:nodry,2)=-ct2_temp(m1:nodry,2,1)+ct2_temp(m1:nodry,1,2) | ||
3572 | + endif | ||
3573 | + enddo | ||
3574 | +! | ||
3575 | +! rotation back to original frame | ||
3576 | +! | ||
3577 | + do n=1,nodry | ||
3578 | + rvec_temp=(0.d0,0.d0) | ||
3579 | + rvec2_temp=(0.d0,0.d0) | ||
3580 | + m1=min(n,nmin) | ||
3581 | + nn1=n*(n+1)-n | ||
3582 | + nn2=n*(n+1)+n | ||
3583 | + rmat=>rotmat(-m1:m1,nn1:nn2) | ||
3584 | + do p=1,2 | ||
3585 | + rvec_temp(-n:n,p)=matmul(c_temp(-m1:m1,n,p),rmat)*conjg(ephimat(-n:n)) | ||
3586 | + rvec2_temp(-n:n,p)=matmul(c2_temp(-m1:m1,n,p),rmat)*ephimat(-n:n) | ||
3587 | + cy1(n+1,n:1:-1,p)=cy1(n+1,n:1:-1,p)+rvec_temp(-n:-1,p) | ||
3588 | + cy1(0:n,n,p)=cy1(0:n,n,p)+rvec_temp(0:n,p) | ||
3589 | + cy2(n+1,n:1:-1,p)=cy2(n+1,n:1:-1,p)+rvec2_temp(-n:-1,p) | ||
3590 | + cy2(0:n,n,p)=cy2(0:n,n,p)+rvec2_temp(0:n,p) | ||
3591 | + enddo | ||
3592 | + enddo | ||
3593 | + end subroutine rottranmtrxtwovec | ||
3594 | +! | ||
3595 | +! GB coefficients for sphere-centered expansions, obtained via translation | ||
3596 | +! | ||
3597 | +! last revised: 15 January 2011 | ||
3598 | +! | ||
3599 | + subroutine spheregaussianbeamcoef(nsphere,neqns,nodr,alpha,beta,cbeam, & | ||
3600 | + rpos,rbeam,epstran,pmnp) | ||
3601 | + use specialfuncs | ||
3602 | + implicit none | ||
3603 | + integer :: m,n,p,nsphere,i,l,nodr(nsphere),nblk,noff,nodrgb,neqns,k | ||
3604 | + real(8) :: alpha,beta,cb,sb,ca,sa,rpos(3,nsphere),rmax,rbeam(3),xib(3),rib, & | ||
3605 | + cbeam,epstran | ||
3606 | + complex(8) :: pmnp(neqns,2) | ||
3607 | + complex(8), allocatable :: pmnp0(:,:,:,:) | ||
3608 | + nodrgb=0 | ||
3609 | + rmax=0.d0 | ||
3610 | + do i=1,nsphere | ||
3611 | + xib(:)=rpos(:,i)-rbeam(:) | ||
3612 | + rib=sqrt(dot_product(xib,xib)) | ||
3613 | + rmax=max(rmax,rib) | ||
3614 | + call tranordertest(rib,(1.d0,0.d0),nodr(i),epstran,n) | ||
3615 | + nodrgb=max(n,nodrgb) | ||
3616 | + enddo | ||
3617 | + allocate(pmnp0(0:nodrgb+1,nodrgb,2,2)) | ||
3618 | + call gaussianbeamcoef(alpha,beta,cbeam,nodrgb,pmnp0) | ||
3619 | + pmnp=0.d0 | ||
3620 | + noff=0 | ||
3621 | + do i=1,nsphere | ||
3622 | + nblk=2*nodr(i)*(nodr(i)+2) | ||
3623 | + xib(:)=rpos(:,i)-rbeam(:) | ||
3624 | + do k=1,2 | ||
3625 | + call rottran(pmnp0(0:nodrgb+1,1:nodrgb,1:2,k),pmnp(noff+1:noff+nblk,k),xib, & | ||
3626 | + (1.d0,0.d0),nodrgb,nodr(i),1,1,1,1) | ||
3627 | + enddo | ||
3628 | + noff=noff+nblk | ||
3629 | + enddo | ||
3630 | + deallocate(pmnp0) | ||
3631 | + end subroutine spheregaussianbeamcoef | ||
3632 | + | ||
3633 | + end module translation | ||
3634 | +! | ||
3635 | +! scatprops module: various subroutines for calculation of observables from the solution | ||
3636 | +! | ||
3637 | +! | ||
3638 | +! last revised: 15 January 2011 | ||
3639 | +! | ||
3640 | + module scatprops | ||
3641 | + implicit none | ||
3642 | + contains | ||
3643 | +! | ||
3644 | +! determination of maximum orders for target--based expansions | ||
3645 | +! | ||
3646 | +! | ||
3647 | +! last revised: 15 January 2011 | ||
3648 | +! | ||
3649 | + subroutine tranorders(nsphere,nodr,rpos,eps,ntran,nodrt) | ||
3650 | + use numconstants | ||
3651 | + use specialfuncs | ||
3652 | + use translation | ||
3653 | + implicit none | ||
3654 | + integer :: nsphere,nodr(nsphere),nodrt,ntran(nsphere),i | ||
3655 | + real(8) :: rpos(3,nsphere),r,eps | ||
3656 | + nodrt=0 | ||
3657 | + do i=1,nsphere | ||
3658 | + r=sqrt(dot_product(rpos(:,i),rpos(:,i))) | ||
3659 | + call tranordertest(r,(1.d0,0.d0),nodr(i),eps,ntran(i)) | ||
3660 | + if(print_intermediate_results.eq.1) & | ||
3661 | + write(*,'('' i, nodr, ntran:'',3i7)') i,nodr(i),ntran(i) | ||
3662 | + nodrt=max(nodrt,ntran(i)) | ||
3663 | + enddo | ||
3664 | + end subroutine tranorders | ||
3665 | +! | ||
3666 | +! translation of sphere-based expansions to common target origin | ||
3667 | +! | ||
3668 | +! | ||
3669 | +! last revised: 15 January 2011 | ||
3670 | +! | ||
3671 | + subroutine amncommonorigin(neqns,nsphere,nodr,ntran,nodrt,rpos,amnp,amnp0) | ||
3672 | + use specialfuncs | ||
3673 | + use translation | ||
3674 | + implicit none | ||
3675 | + integer :: neqns,nsphere,nodr(nsphere),nodrt,i,m,n,p,nblk,ntran(nsphere),noff | ||
3676 | + real(8) :: rpos(3,nsphere),r,eps,xij(3) | ||
3677 | + complex(8) :: amnp(neqns),amnp0(0:nodrt+1,nodrt,2) | ||
3678 | + complex(8), allocatable :: amnpt(:,:,:) | ||
3679 | + amnp0=(0.d0,0.d0) | ||
3680 | + noff=0 | ||
3681 | + do i=1,nsphere | ||
3682 | + allocate(amnpt(0:ntran(i)+1,ntran(i),2)) | ||
3683 | + amnpt=(0.d0,0.d0) | ||
3684 | + nblk=nodr(i)*(nodr(i)+2)*2 | ||
3685 | + xij=-rpos(:,i) | ||
3686 | + call rottran(amnp(noff+1:noff+nblk),amnpt,xij,(1.d0,0.d0), & | ||
3687 | + nodr(i),ntran(i),1,1,1,1) | ||
3688 | + do p=1,2 | ||
3689 | + do n=1,ntran(i) | ||
3690 | + do m=0,ntran(i)+1 | ||
3691 | + amnp0(m,n,p)=amnp0(m,n,p)+amnpt(m,n,p) | ||
3692 | + enddo | ||
3693 | + enddo | ||
3694 | + enddo | ||
3695 | + deallocate(amnpt) | ||
3696 | + noff=noff+nblk | ||
3697 | + enddo | ||
3698 | + end subroutine amncommonorigin | ||
3699 | +! | ||
3700 | +! sphereqeff computes the efficiency factors for the sphere, given an1: mie coefficients, | ||
3701 | +! anp: scattering coefficients, pnp: incident field coefficients. | ||
3702 | +! | ||
3703 | +! This subroutine is specific to the OA model for the sphere. | ||
3704 | +! | ||
3705 | +! | ||
3706 | +! original: 15 January 2011 | ||
3707 | +! revised: 21 February 2011: polarized and cross-polarized efficiency calculation | ||
3708 | +! 30 March 2011: added optical activity | ||
3709 | +! | ||
3710 | + subroutine sphereqeff(nsphere,neqns,nodr,nodrmax,xsp,anp1,anp2,& | ||
3711 | + pnp1,pnp2,qext,qabs,qsca) | ||
3712 | + use miecoefdata | ||
3713 | + use spheredata | ||
3714 | + implicit none | ||
3715 | + integer :: nsphere,m,n,p,i,nodr(nsphere),nblk,noff,neqns,nodrmax | ||
3716 | + real(8) :: xsp(nsphere),qext(nsphere),qabs(nsphere),qsca(nsphere), & | ||
3717 | + qe,qa,qs | ||
3718 | + complex(8) :: anp1(neqns),pnp1(neqns),anp2(neqns),pnp2(neqns) | ||
3719 | + complex(8) :: anmie(2,2,nodrmax) | ||
3720 | + qext=0.d0 | ||
3721 | + qabs=0.d0 | ||
3722 | + qsca=0.d0 | ||
3723 | + noff=0 | ||
3724 | + do i=1,nsphere | ||
3725 | + nblk=nodr(i)*(nodr(i)+2)*2 | ||
3726 | + call getmiedata(which_sphere=i,sphere_mie_coefficients=anmie) | ||
3727 | + call qeffcalc(nodr(i),anp1(noff+1:noff+nblk),anp2(noff+1:noff+nblk), & | ||
3728 | + pnp1(noff+1:noff+nblk),pnp2(noff+1:noff+nblk),anmie,qe,qa,qs) | ||
3729 | + noff=noff+nblk | ||
3730 | + qext(i)=2.d0*qe/xsp(i)/xsp(i) | ||
3731 | + qabs(i)=2.d0*qa/xsp(i)/xsp(i) | ||
3732 | + qsca(i)=2.d0*qs/xsp(i)/xsp(i) | ||
3733 | + enddo | ||
3734 | + end subroutine sphereqeff | ||
3735 | +! | ||
3736 | +! calculation of sphere efficiency factors for scattered and incident field | ||
3737 | +! coefficient anp1, pnp1, anp2, pnp2 and mie coefficients anmie | ||
3738 | +! | ||
3739 | +! original: 15 January 2011 | ||
3740 | +! revised: 21 February 2011: polarized and cross-polarized efficiency calculation | ||
3741 | +! 30 March 2011: added optical activity | ||
3742 | +! | ||
3743 | + subroutine qeffcalc(nodr,anp1,anp2,pnp1,pnp2,anmie,qe,qa,qs) | ||
3744 | + implicit none | ||
3745 | + integer :: nodr,m,n,p,q | ||
3746 | + real(8) :: qe,qa,qs,babs,aninv(2,2) | ||
3747 | + complex(8) :: anp1(0:nodr+1,nodr,2),pnp1(0:nodr+1,nodr,2), & | ||
3748 | + anp2(0:nodr+1,nodr,2),pnp2(0:nodr+1,nodr,2),anmie(2,2,nodr), & | ||
3749 | + a | ||
3750 | + qe=0.d0 | ||
3751 | + qa=0.d0 | ||
3752 | + qs=0.d0 | ||
3753 | + do n=1,nodr | ||
3754 | + a=anmie(1,1,n)*anmie(2,2,n)-anmie(1,2,n)*anmie(1,2,n) | ||
3755 | + do p=1,2 | ||
3756 | + do q=1,2 | ||
3757 | + aninv(p,q)=(-1)**(p+q)*anmie(3-p,3-q,n)/a | ||
3758 | + enddo | ||
3759 | + aninv(p,p)=aninv(p,p)+1.d0 | ||
3760 | + enddo | ||
3761 | + do p=1,2 | ||
3762 | +! babs=-(1.d0/anmie(p,n)+1.d0) | ||
3763 | + do m=-n,-1 | ||
3764 | + qe=qe-(anp1(n+1,-m,p)*conjg(pnp2(n+1,-m,p)) & | ||
3765 | + + anp2(n+1,-m,p)*conjg(pnp1(n+1,-m,p)))*.5d0 | ||
3766 | + qs=qs+anp1(n+1,-m,p)*conjg(anp2(n+1,-m,p)) | ||
3767 | + do q=1,2 | ||
3768 | + qa=qa-conjg(anp1(n+1,-m,p))*aninv(p,q)*anp2(n+1,-m,q) | ||
3769 | + enddo | ||
3770 | + enddo | ||
3771 | + do m=0,n | ||
3772 | + qe=qe-(anp1(m,n,p)*conjg(pnp2(m,n,p)) & | ||
3773 | + +anp2(m,n,p)*conjg(pnp1(m,n,p)))*.5d0 | ||
3774 | + qs=qs+anp1(m,n,p)*conjg(anp2(m,n,p)) | ||
3775 | + do q=1,2 | ||
3776 | + qa=qa-conjg(anp1(m,n,p))*aninv(p,q)*anp2(m,n,q) | ||
3777 | + enddo | ||
3778 | + enddo | ||
3779 | + enddo | ||
3780 | + enddo | ||
3781 | + end subroutine qeffcalc | ||
3782 | +! | ||
3783 | +! scattering amplitude sa and matrix sm calculation | ||
3784 | +! | ||
3785 | +! original: 15 January 2011 | ||
3786 | +! revised: 21 February 2011: S11 normalization changed | ||
3787 | +! | ||
3788 | + subroutine scatteringmatrix(amn0,nodrt,xv,ct,phi,sa,sm) | ||
3789 | + use specialfuncs | ||
3790 | + use numconstants | ||
3791 | + implicit none | ||
3792 | + integer :: nodrt,m,n,p,m1,n1,i,j | ||
3793 | + real(8) :: xv,ct,phi,sm(4,4),tau(0:nodrt+1,nodrt,2),cphi,sphi,qsca | ||
3794 | + complex(8) :: amn0(0:nodrt+1,nodrt,2,2),sa(4),ephi,ephim(-nodrt:nodrt), & | ||
3795 | + ci,cin,a,b,sp(4,4) | ||
3796 | + data ci/(0.d0,1.d0)/ | ||
3797 | + | ||
3798 | + | ||
3799 | + call taufunc(ct,nodrt,tau) | ||
3800 | + cphi=cos(phi) | ||
3801 | + sphi=sin(phi) | ||
3802 | + ephi=dcmplx(cphi,sphi) | ||
3803 | + call ephicoef(ephi,nodrt,ephim) | ||
3804 | + sa=(0.d0,0.d0) | ||
3805 | + qsca=0.d0 | ||
3806 | + do n=1,nodrt | ||
3807 | + cin=(-ci)**n | ||
3808 | + do m=-n,n | ||
3809 | + if(m.le.-1) then | ||
3810 | + m1=n+1 | ||
3811 | + n1=-m | ||
3812 | + else | ||
3813 | + m1=m | ||
3814 | + n1=n | ||
3815 | + endif | ||
3816 | + do p=1,2 | ||
3817 | + qsca=qsca+amn0(m1,n1,p,1)*dconjg(amn0(m1,n1,p,1)) & | ||
3818 | + + amn0(m1,n1,p,2)*dconjg(amn0(m1,n1,p,2)) | ||
3819 | + a=amn0(m1,n1,p,1)*cphi+amn0(m1,n1,p,2)*sphi | ||
3820 | + b=amn0(m1,n1,p,1)*sphi-amn0(m1,n1,p,2)*cphi | ||
3821 | + sa(1)=sa(1)+cin*tau(m1,n1,3-p)*b*ephim(m) | ||
3822 | + sa(2)=sa(2)+ci*cin*tau(m1,n1,p)*a*ephim(m) | ||
3823 | + sa(3)=sa(3)+ci*cin*tau(m1,n1,p)*b*ephim(m) | ||
3824 | + sa(4)=sa(4)+cin*tau(m1,n1,3-p)*a*ephim(m) | ||
3825 | + enddo | ||
3826 | + enddo | ||
3827 | + enddo | ||
3828 | + qsca=qsca*2.d0 | ||
3829 | + do i=1,4 | ||
3830 | + do j=1,4 | ||
3831 | + sp(i,j)=sa(i)*dconjg(sa(j))*16.d0/qsca | ||
3832 | + enddo | ||
3833 | + enddo | ||
3834 | + sm(1,1)=sp(1,1)+sp(2,2)+sp(3,3)+sp(4,4) | ||
3835 | + sm(1,2)=-sp(1,1)+sp(2,2)-sp(3,3)+sp(4,4) | ||
3836 | + sm(2,1)=-sp(1,1)+sp(2,2)+sp(3,3)-sp(4,4) | ||
3837 | + sm(2,2)=sp(1,1)+sp(2,2)-sp(3,3)-sp(4,4) | ||
3838 | + sm(3,3)=2.*(sp(1,2)+sp(3,4)) | ||
3839 | + sm(3,4)=-2.*dimag(sp(1,2)+sp(3,4)) | ||
3840 | + sm(4,3)=2.*dimag(sp(1,2)-sp(3,4)) | ||
3841 | + sm(4,4)=2.*(sp(1,2)-sp(3,4)) | ||
3842 | + sm(1,3)=2.*(sp(2,3)+sp(1,4)) | ||
3843 | + sm(3,1)=2.*(sp(2,4)+sp(1,3)) | ||
3844 | + sm(1,4)=2.*dimag(sp(2,3)-sp(1,4)) | ||
3845 | + sm(4,1)=-2.*dimag(sp(2,4)+sp(1,3)) | ||
3846 | + sm(2,3)=2.*(sp(2,3)-sp(1,4)) | ||
3847 | + sm(3,2)=2.*(sp(2,4)-sp(1,3)) | ||
3848 | + sm(2,4)=2.*dimag(sp(2,3)+sp(1,4)) | ||
3849 | + sm(4,2)=-2.*dimag(sp(2,4)-sp(1,3)) | ||
3850 | +! do i=1,4 | ||
3851 | +! do j=1,4 | ||
3852 | +! if(i.ne.1.or.j.ne.1) then | ||
3853 | +! sm(i,j)=sm(i,j)/sm(1,1) | ||
3854 | +! endif | ||
3855 | +! enddo | ||
3856 | +! enddo | ||
3857 | + end subroutine scatteringmatrix | ||
3858 | +! c c | ||
3859 | +! c subroutine scatexp(amn0,nodrt,nodrg,gmn) computes the expansion coefficients c | ||
3860 | +! c for the spherical harmonic expansion of the scattering phase function from c | ||
3861 | +! c the scattering coefficients amn0. For a complete expansion, the max. order c | ||
3862 | +! c of the phase function expansion (nodrg) will be 2*nodrt, where nodrt is c | ||
3863 | +! c the max. order of the scattered field expansion. In this code nodrg is c | ||
3864 | +! c typically set to 1, so that the subroutine returns the first moments c | ||
3865 | +! c of the phase function; gmn(1) and gmn(2). c | ||
3866 | +! c c | ||
3867 | +! c The expansion coefficients are normalized so that gmn(0)=1 c | ||
3868 | +! c c | ||
3869 | +! c gmn(1)/3 is the asymmetry parameter. c | ||
3870 | +! c c | ||
3871 | + subroutine s11expansion(amn0,nodrt,mmax,nodrg,gmn) | ||
3872 | + use specialfuncs | ||
3873 | + use numconstants | ||
3874 | + implicit none | ||
3875 | + integer :: nodrt,m,n,p,ma,na,mmax,nodrg,w,w1,w2,u,uw,ww1, & | ||
3876 | + l1,l2,ka,la,k,l,q,ik | ||
3877 | + real(8) :: vc1(0:nodrt*2+1),vc2(0:nodrt*2+1),g0 | ||
3878 | + complex(8) :: amn0(0:nodrt+1,nodrt,2,2),gmn(0:nodrg*(nodrg+3)/2), & | ||
3879 | + a(2,2),c,c2 | ||
3880 | + gmn=(0.d0,0.d0) | ||
3881 | + do n=1,nodrt | ||
3882 | + l1=max(1,n-nodrg) | ||
3883 | + l2=min(nodrt,n+nodrg) | ||
3884 | + do l=l1,l2 | ||
3885 | + c=sqrt(dble((n+n+1)*(l+l+1)))*dcmplx(0.d0,1.d0)**(l-n) | ||
3886 | + w2=min(n+l,nodrg) | ||
3887 | + call vcfunc(-1,l,1,n,vc2) | ||
3888 | + do m=-n,n | ||
3889 | + if(m.le.-1) then | ||
3890 | + ma=n+1 | ||
3891 | + na=-m | ||
3892 | + else | ||
3893 | + ma=m | ||
3894 | + na=n | ||
3895 | + endif | ||
3896 | + do k=-l,min(l,m) | ||
3897 | + if(k.le.-1) then | ||
3898 | + ka=l+1 | ||
3899 | + la=-k | ||
3900 | + else | ||
3901 | + ka=k | ||
3902 | + la=l | ||
3903 | + endif | ||
3904 | + u=m-k | ||
3905 | + if(u.le.mmax) then | ||
3906 | + ik=(-1)**k | ||
3907 | + c2=ik*c | ||
3908 | + do p=1,2 | ||
3909 | + do q=1,2 | ||
3910 | + a(p,q)=c2*(amn0(ma,na,p,1)*conjg(amn0(ka,la,q,1)) & | ||
3911 | + +amn0(ma,na,p,2)*conjg(amn0(ka,la,q,2))) | ||
3912 | + enddo | ||
3913 | + enddo | ||
3914 | + w1=max(abs(n-l),abs(u)) | ||
3915 | + w2=min(n+l,nodrg) | ||
3916 | + call vcfunc(-k,l,m,n,vc1) | ||
3917 | + do w=w1,w2 | ||
3918 | + uw=(w*(w+1))/2+u | ||
3919 | + do p=1,2 | ||
3920 | + if(mod(n+l+w,2).eq.0) then | ||
3921 | + q=p | ||
3922 | + else | ||
3923 | + q=3-p | ||
3924 | + endif | ||
3925 | + gmn(uw)=gmn(uw)-vc1(w)*vc2(w)*a(p,q) | ||
3926 | + enddo | ||
3927 | + enddo | ||
3928 | + endif | ||
3929 | + enddo | ||
3930 | + enddo | ||
3931 | + enddo | ||
3932 | + enddo | ||
3933 | + g0=dble(gmn(0)) | ||
3934 | + gmn(0)=1.d0 | ||
3935 | + do w=1,nodrg | ||
3936 | + ww1=(w*(w+1))/2 | ||
3937 | + gmn(ww1)=dcmplx(dble(gmn(ww1)),0.d0)/g0 | ||
3938 | + do u=1,min(mmax,w) | ||
3939 | + uw=ww1+u | ||
3940 | + gmn(uw)=(-1)**u*2.d0*gmn(uw)/g0 | ||
3941 | + enddo | ||
3942 | + enddo | ||
3943 | + end subroutine s11expansion | ||
3944 | +! | ||
3945 | +! calculate azimuth--averaged scattering matrix from expansion, for cos(theta) = ct | ||
3946 | +! | ||
3947 | +! | ||
3948 | +! original: 15 January 2011 | ||
3949 | +! revised: 21 February 2011: changed normalization on S11 | ||
3950 | +! | ||
3951 | + subroutine fosmcalc(ntot,s00,s02,sp22,sm22,ct,sm) | ||
3952 | + use numconstants | ||
3953 | + use specialfuncs | ||
3954 | + integer :: ntot,w,i,j,ww1 | ||
3955 | + real(8) :: s00(4,4,0:ntot*2),s02(4,4,0:ntot*2),sp22(4,4,0:ntot*2),sm22(4,4,0:ntot*2), & | ||
3956 | + sm(4,4),dc(-2:2,0:2*ntot*(2*ntot+2)),ct | ||
3957 | + call rotcoef(ct,2,2*ntot,dc) | ||
3958 | + sm=0.d0 | ||
3959 | + do w=0,2*ntot | ||
3960 | + ww1=w*(w+1) | ||
3961 | + sm(:,:)=sm(:,:)+s00(:,:,w)*dc(0,ww1)+s02(:,:,w)*dc(0,ww1+2) & | ||
3962 | + +sp22(:,:,w)*dc(2,ww1+2)+sm22(:,:,w)*dc(-2,ww1+2) | ||
3963 | + enddo | ||
3964 | + sm=sm/s00(1,1,0) | ||
3965 | +! do i=1,4 | ||
3966 | +! do j=1,4 | ||
3967 | +! if(i.ne.1.or.j.ne.1) then | ||
3968 | +! sm(i,j)=sm(i,j)/sm(1,1) | ||
3969 | +! endif | ||
3970 | +! enddo | ||
3971 | +! enddo | ||
3972 | + end subroutine fosmcalc | ||
3973 | +! | ||
3974 | +! determine the generalized spherical function expansion for the azimuth-averaged scattering matrix | ||
3975 | +! corresponding to the target-based scattering field expansion of amnp. | ||
3976 | +! | ||
3977 | +! | ||
3978 | +! original: 15 January 2011 | ||
3979 | +! revised: 21 February 2011: fixed flush call. | ||
3980 | +! | ||
3981 | + subroutine fosmexpansion(ntot,amnp,s00,s02,sp22,sm22) | ||
3982 | + use mpidefs | ||
3983 | + use mpidata | ||
3984 | + use specialfuncs | ||
3985 | + use numconstants | ||
3986 | + use spheredata | ||
3987 | + integer :: ntot,n,p,m,l,wmin,wmax,m1m,q,m1mq,m1mnpl,w,m1w,fe,fo,i,j,wtot | ||
3988 | + integer :: rank,numprocs,nl,nsend,runprintunit | ||
3989 | + integer, allocatable :: nlindex(:),nlnum(:) | ||
3990 | + real(8) :: s00(4,4,0:ntot*2),s02(4,4,0:ntot*2),sp22(4,4,0:ntot*2),sm22(4,4,0:ntot*2), & | ||
3991 | + cm1p1(0:ntot*2),cm1m1(0:ntot*2),cmmpm(0:ntot*2),cmmm2pm(0:ntot*2), & | ||
3992 | + cmmp2pm(0:ntot*2),sum,nlperproc | ||
3993 | + complex(8) :: amnp(0:ntot+1,ntot,2,2),a1(-ntot-2:ntot+2,ntot,2),a2(-ntot-2:ntot+2,ntot,2), & | ||
3994 | + ci,fnl,a1122,a2112,a1p2,a1m2 | ||
3995 | + data ci/(0.d0,1.d0)/ | ||
3996 | + call init(2*ntot) | ||
3997 | + call getrunparameters(run_print_unit=runprintunit) | ||
3998 | + call ms_mpi(mpi_command='rank',mpi_rank=rank) | ||
3999 | + call ms_mpi(mpi_command='size',mpi_size=numprocs) | ||
4000 | + allocate(nlindex(0:numprocs-1),nlnum(0:numprocs-1)) | ||
4001 | + nlperproc=dble(ntot*ntot)/dble(numprocs) | ||
4002 | + sum=0. | ||
4003 | + do i=0,numprocs-1 | ||
4004 | + nlindex(i)=floor(sum) | ||
4005 | + sum=sum+nlperproc | ||
4006 | + enddo | ||
4007 | + do i=0,numprocs-2 | ||
4008 | + nlnum(i)=nlindex(i+1)-nlindex(i) | ||
4009 | + enddo | ||
4010 | + nlnum(numprocs-1)=ntot*ntot-nlindex(numprocs-1) | ||
4011 | + if(rank.eq.0) then | ||
4012 | + write(runprintunit,'('' SM calc, orders per processor:'',f10.4)') nlperproc | ||
4013 | + call flush(runprintunit) | ||
4014 | + endif | ||
4015 | + a1=(0.d0,0.d0) | ||
4016 | + a2=(0.d0,0.d0) | ||
4017 | + s00=0.d0 | ||
4018 | + s02=0.d0 | ||
4019 | + sp22=0.d0 | ||
4020 | + sm22=0.d0 | ||
4021 | + wtot=ntot+ntot | ||
4022 | + do n=1,ntot | ||
4023 | + do p=1,2 | ||
4024 | + do m=-n,-1 | ||
4025 | + a1(m,n,p)=amnp(n+1,-m,p,1) | ||
4026 | + a2(m,n,p)=amnp(n+1,-m,p,2) | ||
4027 | + enddo | ||
4028 | + do m=0,n | ||
4029 | + a1(m,n,p)=amnp(m,n,p,1) | ||
4030 | + a2(m,n,p)=amnp(m,n,p,2) | ||
4031 | + enddo | ||
4032 | + enddo | ||
4033 | + enddo | ||
4034 | + do nl=nlindex(rank)+1,nlindex(rank)+nlnum(rank) | ||
4035 | + n=floor((nl-1)/dble(ntot))+1 | ||
4036 | + l=mod(nl-1,ntot)+1 | ||
4037 | + wmin=abs(n-l) | ||
4038 | + wmax=n+l | ||
4039 | + fnl=sqrt(dble((n+n+1)*(l+l+1)))*ci**(l-n) | ||
4040 | + call vcfunc(-1,n,1,l,cm1p1) | ||
4041 | + call vcfunc(-1,n,-1,l,cm1m1) | ||
4042 | + do m=-min(n,l+2),min(n,l+2) | ||
4043 | + m1m=(-1)**m | ||
4044 | + if(abs(m).le.l) then | ||
4045 | + call vcfunc(-m,n,m,l,cmmpm) | ||
4046 | + else | ||
4047 | + cmmpm=0.d0 | ||
4048 | + endif | ||
4049 | + if(abs(-2+m).le.l) then | ||
4050 | + call vcfunc(-m,n,-2+m,l,cmmm2pm) | ||
4051 | + else | ||
4052 | + cmmm2pm=0.d0 | ||
4053 | + endif | ||
4054 | + if(abs(2+m).le.l) then | ||
4055 | + call vcfunc(-m,n,2+m,l,cmmp2pm) | ||
4056 | + else | ||
4057 | + cmmp2pm=0.d0 | ||
4058 | + endif | ||
4059 | + do p=1,2 | ||
4060 | + do q=1,2 | ||
4061 | + m1mq=(-1)**(m+q) | ||
4062 | + m1mnpl=(-1)**(m+n+p+l) | ||
4063 | + a1122=(a1(m,n,p)*conjg(a1(m,l,q)) + a2(m,n,p)*conjg(a2(m,l,q))) | ||
4064 | + a2112=(a2(m,n,p)*conjg(a1(m,l,q)) - a1(m,n,p)*conjg(a2(m,l,q))) | ||
4065 | + a1p2=(a1(m,n,p)+ci*a2(m,n,p))*conjg(a1(m-2,l,q)-ci*a2(m-2,l,q)) | ||
4066 | + a1m2=(a1(m,n,p)-ci*a2(m,n,p))*conjg(a1(m+2,l,q)+ci*a2(m+2,l,q)) | ||
4067 | + do w=wmin,wmax | ||
4068 | + m1w=(-1)**w | ||
4069 | + if(mod(n+l+w+p+q,2).eq.0) then | ||
4070 | + fe=1 | ||
4071 | + fo=0 | ||
4072 | + else | ||
4073 | + fe=0 | ||
4074 | + fo=1 | ||
4075 | + endif | ||
4076 | + s00(1,1,w) = s00(1,1,w)-(m1m*fe*fnl*a1122*cm1p1(w)*cmmpm(w))/2. | ||
4077 | + s00(3,2,w) = s00(3,2,w)+ (ci/2.*m1m*fnl*fo*a1122*cm1p1(w)*cmmpm(w)) | ||
4078 | + s00(4,2,w) = s00(4,2,w)+ dimag(-ci/2.*m1m*fnl*fo*a1122*cm1p1(w)*cmmpm(w)) | ||
4079 | + s00(1,4,w) = s00(1,4,w)+ dimag(m1m*fe*fnl*(-a2112)*cm1p1(w)*cmmpm(w))/2. | ||
4080 | + s00(2,3,w) = s00(2,3,w)+ (m1m*fe*fnl*(-a2112)*cm1p1(w)*cmmpm(w))/2. | ||
4081 | + s00(4,3,w) = s00(4,3,w)+ dimag(ci/2.*m1m*fnl*fo*a2112*cm1p1(w)*cmmpm(w)) | ||
4082 | + s00(4,4,w) = s00(4,4,w)+ (ci/2.*m1m*fnl*fo*a2112*cm1p1(w)*cmmpm(w)) | ||
4083 | + | ||
4084 | + if(w.lt.2) cycle | ||
4085 | + | ||
4086 | + s02(2,1,w) = s02(2,1,w)-(m1mq*a1122*fe*fnl*cm1m1(w)*cmmpm(w))/2. | ||
4087 | + s02(3,1,w) = s02(3,1,w)+ (-ci/2.*m1mq*a1122*fnl*fo*cm1m1(w)*cmmpm(w)) | ||
4088 | + s02(4,1,w) = s02(4,1,w)+ dimag(ci/2.*m1mq*a1122*fnl*fo*cm1m1(w)*cmmpm(w)) | ||
4089 | + s02(1,3,w) = s02(1,3,w)-(m1mq*a2112*fe*fnl*cm1m1(w)*cmmpm(w))/2. | ||
4090 | + s02(2,4,w) = s02(2,4,w)-dimag(m1mq*a2112*fe*fnl*cm1m1(w)*cmmpm(w))/2. | ||
4091 | + s02(3,3,w) = s02(3,3,w)+ (ci/2.*m1mq*a2112*fnl*fo*cm1m1(w)*cmmpm(w)) | ||
4092 | + s02(3,4,w) = s02(3,4,w)+ dimag(-ci/2.*m1mq*a2112*fnl*fo*cm1m1(w)*cmmpm(w)) | ||
4093 | + | ||
4094 | + s02(1,2,w) = s02(1,2,w)-(m1m*a1p2*fe*fnl*cm1p1(w)*cmmm2pm(w))/4. | ||
4095 | + s02(1,3,w) = s02(1,3,w)+ (-ci/4.*m1m*a1p2*fe*fnl*cm1p1(w)*cmmm2pm(w)) | ||
4096 | + s02(2,4,w) = s02(2,4,w)+ dimag(-ci/4.*m1m*a1p2*fe*fnl*cm1p1(w)*cmmm2pm(w)) | ||
4097 | + s02(3,1,w) = s02(3,1,w)+ (ci/4.*m1m*a1p2*fnl*fo*cm1p1(w)*cmmm2pm(w)) | ||
4098 | + s02(4,1,w) = s02(4,1,w)+ dimag(-ci/4.*m1m*a1p2*fnl*fo*cm1p1(w)*cmmm2pm(w)) | ||
4099 | + s02(4,3,w) = s02(4,3,w)+ dimag(m1m*a1p2*fnl*fo*cm1p1(w)*cmmm2pm(w))/4. | ||
4100 | + s02(4,4,w) = s02(4,4,w)+ (m1m*a1p2*fnl*fo*cm1p1(w)*cmmm2pm(w))/4. | ||
4101 | + | ||
4102 | + sm22(1,4,w) = sm22(1,4,w)+ dimag(-ci/8.*m1mnpl*m1w*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4103 | + sm22(2,2,w) = sm22(2,2,w)-(m1mnpl*m1w*a1p2*fnl*cm1m1(w)*cmmm2pm(w))/8. | ||
4104 | + sm22(2,3,w) = sm22(2,3,w)+ (-ci/8.*m1mnpl*m1w*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4105 | + sm22(3,2,w) = sm22(3,2,w)+ (ci/8.*m1mnpl*m1w*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4106 | + sm22(3,3,w) = sm22(3,3,w)-(m1mnpl*m1w*a1p2*fnl*cm1m1(w)*cmmm2pm(w))/8. | ||
4107 | + sm22(3,4,w) = sm22(3,4,w)+ dimag(m1mnpl*m1w*a1p2*fnl*cm1m1(w)*cmmm2pm(w))/8. | ||
4108 | + sm22(4,2,w) = sm22(4,2,w)+ dimag(-ci/8.*m1mnpl*m1w*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4109 | + | ||
4110 | + sp22(1,4,w) = sp22(1,4,w)+ dimag(-ci/8.*m1mq*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4111 | + sp22(2,2,w) = sp22(2,2,w)-(m1mq*a1p2*fnl*cm1m1(w)*cmmm2pm(w))/8. | ||
4112 | + sp22(2,3,w) = sp22(2,3,w)+ (-ci/8.*m1mq*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4113 | + sp22(3,2,w) = sp22(3,2,w)+ (-ci/8.*m1mq*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4114 | + sp22(3,3,w) = sp22(3,3,w)+ (m1mq*a1p2*fnl*cm1m1(w)*cmmm2pm(w))/8. | ||
4115 | + sp22(3,4,w) = sp22(3,4,w)-dimag(m1mq*a1p2*fnl*cm1m1(w)*cmmm2pm(w))/8. | ||
4116 | + sp22(4,2,w) = sp22(4,2,w)+ dimag(ci/8.*m1mq*a1p2*fnl*cm1m1(w)*cmmm2pm(w)) | ||
4117 | + | ||
4118 | + s02(1,2,w) = s02(1,2,w)-(m1m*a1m2*fe*fnl*cm1p1(w)*cmmp2pm(w))/4. | ||
4119 | + s02(1,3,w) = s02(1,3,w)+ (ci/4.*m1m*a1m2*fe*fnl*cm1p1(w)*cmmp2pm(w)) | ||
4120 | + s02(2,4,w) = s02(2,4,w)+ dimag(ci/4.*m1m*a1m2*fe*fnl*cm1p1(w)*cmmp2pm(w)) | ||
4121 | + s02(3,1,w) = s02(3,1,w)+ (ci/4.*m1m*a1m2*fnl*fo*cm1p1(w)*cmmp2pm(w)) | ||
4122 | + s02(4,1,w) = s02(4,1,w)+ dimag(-ci/4.*m1m*a1m2*fnl*fo*cm1p1(w)*cmmp2pm(w)) | ||
4123 | + s02(4,3,w) = s02(4,3,w)-dimag(m1m*a1m2*fnl*fo*cm1p1(w)*cmmp2pm(w))/4. | ||
4124 | + s02(4,4,w) = s02(4,4,w)-(m1m*a1m2*fnl*fo*cm1p1(w)*cmmp2pm(w))/4. | ||
4125 | + | ||
4126 | + sm22(1,4,w) = sm22(1,4,w)+ dimag(ci/8.*m1mq*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4127 | + sm22(2,2,w) = sm22(2,2,w)-(m1mq*a1m2*fnl*cm1m1(w)*cmmp2pm(w))/8. | ||
4128 | + sm22(2,3,w) = sm22(2,3,w)+ (ci/8.*m1mq*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4129 | + sm22(3,2,w) = sm22(3,2,w)+ (-ci/8.*m1mq*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4130 | + sm22(3,3,w) = sm22(3,3,w)-(m1mq*a1m2*fnl*cm1m1(w)*cmmp2pm(w))/8. | ||
4131 | + sm22(3,4,w) = sm22(3,4,w)+ dimag(m1mq*a1m2*fnl*cm1m1(w)*cmmp2pm(w))/8. | ||
4132 | + sm22(4,2,w) = sm22(4,2,w)+ dimag(ci/8.*m1mq*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4133 | + | ||
4134 | + sp22(1,4,w) = sp22(1,4,w)+ dimag(ci/8.*m1mnpl*m1w*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4135 | + sp22(2,2,w) = sp22(2,2,w)-(m1mnpl*m1w*a1m2*fnl*cm1m1(w)*cmmp2pm(w))/8. | ||
4136 | + sp22(2,3,w) = sp22(2,3,w)+ (ci/8.*m1mnpl*m1w*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4137 | + sp22(3,2,w) = sp22(3,2,w)+ (ci/8.*m1mnpl*m1w*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4138 | + sp22(3,3,w) = sp22(3,3,w)+ (m1mnpl*m1w*a1m2*fnl*cm1m1(w)*cmmp2pm(w))/8. | ||
4139 | + sp22(3,4,w) = sp22(3,4,w)-dimag(m1mnpl*m1w*a1m2*fnl*cm1m1(w)*cmmp2pm(w))/8. | ||
4140 | + sp22(4,2,w) = sp22(4,2,w)+ dimag(-ci/8.*m1mnpl*m1w*a1m2*fnl*cm1m1(w)*cmmp2pm(w)) | ||
4141 | + enddo | ||
4142 | + enddo | ||
4143 | + enddo | ||
4144 | + enddo | ||
4145 | + enddo | ||
4146 | + call ms_mpi(mpi_command='barrier') | ||
4147 | + nsend=4*4*(2*ntot+1) | ||
4148 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dp=s00,& | ||
4149 | + mpi_number=nsend,mpi_operation=ms_mpi_sum) | ||
4150 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dp=s02,& | ||
4151 | + mpi_number=nsend,mpi_operation=ms_mpi_sum) | ||
4152 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dp=sp22,& | ||
4153 | + mpi_number=nsend,mpi_operation=ms_mpi_sum) | ||
4154 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dp=sm22,& | ||
4155 | + mpi_number=nsend,mpi_operation=ms_mpi_sum) | ||
4156 | +! | ||
4157 | +! a patch | ||
4158 | +! | ||
4159 | + do i=3,4 | ||
4160 | + do j=1,i | ||
4161 | + s00(j,i,0:wtot)=-s00(j,i,0:wtot) | ||
4162 | + s02(j,i,0:wtot)=-s02(j,i,0:wtot) | ||
4163 | + sm22(j,i,0:wtot)=-sm22(j,i,0:wtot) | ||
4164 | + sp22(j,i,0:wtot)=-sp22(j,i,0:wtot) | ||
4165 | + enddo | ||
4166 | + enddo | ||
4167 | + deallocate(nlindex,nlnum) | ||
4168 | + end subroutine fosmexpansion | ||
4169 | +! | ||
4170 | +! compute the coefficients for the GSF expansion of the random orientation | ||
4171 | +! scattering matrix. | ||
4172 | +! | ||
4173 | +! | ||
4174 | +! original: 15 January 2011 | ||
4175 | +! revised: 21 February 2011: changed normalization on S11 | ||
4176 | +! | ||
4177 | + subroutine ranorientscatmatrix(xv,nsphere,nodr,nodrw,cbeam,tmatrixfile,& | ||
4178 | + sm,qext,qabs,qsca) | ||
4179 | + use mpidefs | ||
4180 | + use mpidata | ||
4181 | + use intrinsics | ||
4182 | + use specialfuncs | ||
4183 | + use spheredata | ||
4184 | + use numconstants | ||
4185 | + implicit none | ||
4186 | + integer :: nodr,nodrw,nodr2,m,n,p,k,l,q,s,t,v,u,w,nblk,kl,mn,nn1,tn, & | ||
4187 | + lmax,ll1,tvl,ku,k1,ns,ik,ik1,m1,nu,n1s,n1e,nu1,p1,n1max, & | ||
4188 | + in,n1,i,lt,kt,qt,nt,mt,ikm,klm,mnm,nodrt,nsphere, & | ||
4189 | + rank,iunit,numprocs | ||
4190 | + real(8) :: sm(4,4,0:nodrw),fl,vc(0:4*nodr+2),xv,fl2,fc1,fc2,fc3,fc4, & | ||
4191 | + cbeam,gbn,qext(nsphere),qabs(nsphere),qsca(nsphere),qel, & | ||
4192 | + qal,qsl,fc(4),time1,time2,qsca0 | ||
4193 | + complex(8) :: ci,cin,a | ||
4194 | + complex(8) :: aw(0:2,-1:1,0:nodrw),bw(0:2,-1:1,0:nodrw),cw(0:nodrw), & | ||
4195 | + dw(0:nodrw),pp(nodr,2,2), & | ||
4196 | + bm(2,nodr*(nodr+2),2),am(2,nodr+1,2),fm(3,nodr,2,nodr,2) | ||
4197 | + complex(8), allocatable :: dm(:,:,:,:,:,:) | ||
4198 | + complex(4), allocatable :: tc(:,:,:,:) | ||
4199 | + integer :: nblkw,wv,sizedm,ierr,sizetm,nsend | ||
4200 | + integer, allocatable :: windex(:),vindex(:),wvindex(:),wvnum(:) | ||
4201 | + real(8) :: wvperproc,sum | ||
4202 | + character*30 :: tmatrixfile | ||
4203 | + data ci/(0.d0,1.d0)/ | ||
4204 | + call ms_mpi(mpi_command='rank',mpi_rank=rank) | ||
4205 | + call ms_mpi(mpi_command='size',mpi_size=numprocs) | ||
4206 | + call getrunparameters(run_print_unit=iunit) | ||
4207 | + if(rank.eq.0) time1=mytime() | ||
4208 | +! | ||
4209 | +! read the T matrix from the file | ||
4210 | +! | ||
4211 | + if(rank.eq.0) then | ||
4212 | + open(3,file=tmatrixfile) | ||
4213 | + read(3,*) nodrt | ||
4214 | + endif | ||
4215 | + nodrt=nodr | ||
4216 | + nblk=nodr*(nodr+2) | ||
4217 | + sizetm=4*nblk*nblk | ||
4218 | + allocate(tc(2,nblk,2,nblk)) | ||
4219 | + tc=(0.,0.) | ||
4220 | + if(rank.eq.0) then | ||
4221 | + qext=0.d0 | ||
4222 | + qabs=0.d0 | ||
4223 | + qsca=0.d0 | ||
4224 | + do l=1,nodr | ||
4225 | + gbn=dexp(-((dble(l)+.5d0)*cbeam)**2.) | ||
4226 | + do k=-l,l | ||
4227 | + kl=l*(l+1)+k | ||
4228 | + klm=l*(l+1)-k | ||
4229 | + do q=1,2 | ||
4230 | + read(3,*) lt,kt,qt | ||
4231 | + do n=1,l | ||
4232 | + do m=-n,n | ||
4233 | + mn=n*(n+1)+m | ||
4234 | + mnm=n*(n+1)-m | ||
4235 | + read(3,*) nt,mt,fc | ||
4236 | + tc(1,mn,q,kl)=cmplx(fc(1),fc(2)) | ||
4237 | + tc(2,mn,q,kl)=cmplx(fc(3),fc(4)) | ||
4238 | + if(n.lt.l) then | ||
4239 | + ikm=(-1)**(m+k) | ||
4240 | + do p=1,2 | ||
4241 | + tc(q,klm,p,mnm)=tc(p,mn,q,kl)*ikm | ||
4242 | + enddo | ||
4243 | + endif | ||
4244 | + enddo | ||
4245 | + enddo | ||
4246 | + enddo | ||
4247 | + enddo | ||
4248 | + do i=1,nsphere | ||
4249 | + read(3,*) n,qel,qal,qsl | ||
4250 | + qext(i)=qext(i)+qel*gbn*gbn | ||
4251 | + qabs(i)=qabs(i)+qal*gbn*gbn | ||
4252 | + qsca(i)=qsca(i)+qsl*gbn*gbn | ||
4253 | + enddo | ||
4254 | + enddo | ||
4255 | + close(3) | ||
4256 | + endif | ||
4257 | +! | ||
4258 | +! send to the other processors | ||
4259 | +! | ||
4260 | + if(numprocs.gt.1) then | ||
4261 | + call ms_mpi(mpi_command='barrier') | ||
4262 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qext,mpi_number=nsphere,mpi_rank=0) | ||
4263 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qabs,mpi_number=nsphere,mpi_rank=0) | ||
4264 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qsca,mpi_number=nsphere,mpi_rank=0) | ||
4265 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_c=tc,mpi_number=sizetm,mpi_rank=0) | ||
4266 | + endif | ||
4267 | + allocate(dm(-nodr-1:nodr+1,3,nodr,2,nodr,2)) | ||
4268 | + if(rank.eq.0) then | ||
4269 | + time2=mytime()-time1 | ||
4270 | + call timewrite(iunit,' t matrix read time:',time2) | ||
4271 | + time1=mytime() | ||
4272 | + endif | ||
4273 | + nodr2=nodr+nodr | ||
4274 | + nblk=nodr*(nodr+2) | ||
4275 | + dm=(0.d0,0.d0) | ||
4276 | + sizedm=size(dm) | ||
4277 | + call init(nodr2) | ||
4278 | +! | ||
4279 | +! compute the GB modified T matrix | ||
4280 | +! | ||
4281 | + do n=1,nodr | ||
4282 | + gbn=dexp(-((dble(n)+.5d0)*cbeam)**2.) | ||
4283 | + cin=ci**(n+1) | ||
4284 | + pp(n,1,1) =-.5d0*cin*fnr(n+n+1)*gbn | ||
4285 | + pp(n,2,1) =-pp(n,1,1) | ||
4286 | + pp(n,1,2)=-pp(n,1,1) | ||
4287 | + pp(n,2,2)=pp(n,2,1) | ||
4288 | + enddo | ||
4289 | + do n=1,nodr | ||
4290 | + nn1=n*(n+1) | ||
4291 | + do m=-n,n | ||
4292 | + mn=nn1+m | ||
4293 | + do p=1,2 | ||
4294 | + do l=1,nodr | ||
4295 | + do k=-l,l | ||
4296 | + kl=l*(l+1)+k | ||
4297 | + a=tc(p,mn,1,kl) | ||
4298 | + tc(p,mn,1,kl)=tc(p,mn,1,kl)*pp(l,1,1)& | ||
4299 | + +tc(p,mn,2,kl)*pp(l,1,2) | ||
4300 | + tc(p,mn,2,kl)=a*pp(l,2,1)+tc(p,mn,2,kl)*pp(l,2,2) | ||
4301 | + enddo | ||
4302 | + enddo | ||
4303 | + enddo | ||
4304 | + enddo | ||
4305 | + enddo | ||
4306 | +! | ||
4307 | +! determine the distribution of work load among the processors | ||
4308 | +! | ||
4309 | + nblkw=nodr2*(nodr2+2)+1 | ||
4310 | + allocate(windex(nblkw),vindex(nblkw),wvindex(0:numprocs-1),wvnum(0:numprocs-1)) | ||
4311 | + w=0 | ||
4312 | + do n=0,nodr2 | ||
4313 | + do m=-n,n | ||
4314 | + w=w+1 | ||
4315 | + windex(w)=n | ||
4316 | + vindex(w)=m | ||
4317 | + enddo | ||
4318 | + enddo | ||
4319 | + wvperproc=dble(nblkw)/dble(numprocs) | ||
4320 | + sum=0. | ||
4321 | + do i=0,numprocs-1 | ||
4322 | + wvindex(i)=floor(sum) | ||
4323 | + sum=sum+wvperproc | ||
4324 | + enddo | ||
4325 | + do i=0,numprocs-2 | ||
4326 | + wvnum(i)=wvindex(i+1)-wvindex(i) | ||
4327 | + enddo | ||
4328 | + wvnum(numprocs-1)=nblkw-wvindex(numprocs-1) | ||
4329 | + if(rank.eq.0) then | ||
4330 | + write(iunit,'('' d matrix calculation, order+degree per proc.:'',f9.2)') & | ||
4331 | + wvperproc | ||
4332 | + call flush(iunit) | ||
4333 | + endif | ||
4334 | +! | ||
4335 | +! the big loop | ||
4336 | +! | ||
4337 | + do wv=wvindex(rank)+1,wvindex(rank)+wvnum(rank) | ||
4338 | + w=windex(wv) | ||
4339 | + v=vindex(wv) | ||
4340 | + bm=(0.d0,0.d0) | ||
4341 | + do n=1,nodr | ||
4342 | + nn1=n*(n+1) | ||
4343 | + do l=max(1,abs(w-n)),min(nodr,w+n) | ||
4344 | + am(1,l,1)=0.d0 | ||
4345 | + am(1,l,2)=0.d0 | ||
4346 | + am(2,l,1)=0.d0 | ||
4347 | + am(2,l,2)=0.d0 | ||
4348 | + enddo | ||
4349 | + do t=-n,n | ||
4350 | + tn=nn1+t | ||
4351 | + lmax=min(nodr,w+n) | ||
4352 | + call vcfunc(v,w,-t,n,vc) | ||
4353 | + do l=max(1,abs(v-t),abs(n-w)),lmax | ||
4354 | + ll1=l*(l+1) | ||
4355 | + tvl=ll1+t-v | ||
4356 | + do k=1,2 | ||
4357 | + do p=1,2 | ||
4358 | + am(k,l,p)=am(k,l,p)+vc(l)*tc(p,tn,k,tvl) | ||
4359 | + enddo | ||
4360 | + enddo | ||
4361 | + enddo | ||
4362 | + enddo | ||
4363 | + do m=-n,n | ||
4364 | + mn=nn1+m | ||
4365 | + do k=1,2 | ||
4366 | + u=m-(-3+2*k) | ||
4367 | + if(abs(u).le.w) then | ||
4368 | + lmax=min(nodr,w+n) | ||
4369 | + call vcfunc(-u,w,m,n,vc) | ||
4370 | + do l=max(1,abs(w-n)),lmax | ||
4371 | + fl=-(-1)**l*vc(l)/dble(l+l+1) | ||
4372 | + do p=1,2 | ||
4373 | + bm(k,mn,p)=bm(k,mn,p)+am(k,l,p)*fl | ||
4374 | + enddo | ||
4375 | + enddo | ||
4376 | + endif | ||
4377 | + enddo | ||
4378 | + enddo | ||
4379 | + enddo | ||
4380 | + do u=-min(w,nodr+1),min(w,nodr+1) | ||
4381 | + do ku=1,3 | ||
4382 | + if(ku.eq.1) then | ||
4383 | + k=-1 | ||
4384 | + k1=-1 | ||
4385 | + elseif(ku.eq.2) then | ||
4386 | + k=1 | ||
4387 | + k1=1 | ||
4388 | + else | ||
4389 | + k=1 | ||
4390 | + k1=-1 | ||
4391 | + endif | ||
4392 | + m=u+k | ||
4393 | + ns=max(1,abs(m)) | ||
4394 | + ik=(k+1)/2+1 | ||
4395 | + ik1=(k1+1)/2+1 | ||
4396 | + m1=u+k1 | ||
4397 | + do n=ns,nodr | ||
4398 | + nu=n*(n+1)+m | ||
4399 | + n1s=max(1,abs(m1),n-nodrw) | ||
4400 | + n1e=min(nodr,n+nodrw) | ||
4401 | + do n1=n1s,n1e | ||
4402 | + cin=ci**(n-n1) | ||
4403 | + nu1=n1*(n1+1)+m1 | ||
4404 | + fl=-fnr(n+n+1)*fnr(n1+n1+1)*dble(w+w+1) | ||
4405 | + do p=1,2 | ||
4406 | + do p1=1,2 | ||
4407 | + a=bm(ik,nu,p)*cin*fl*conjg(bm(ik1,nu1,p1)) | ||
4408 | + dm(u,ku,n,p,n1,p1)=dm(u,ku,n,p,n1,p1)+a | ||
4409 | + enddo | ||
4410 | + enddo | ||
4411 | + enddo | ||
4412 | + enddo | ||
4413 | + enddo | ||
4414 | + enddo | ||
4415 | + enddo | ||
4416 | + deallocate(tc) | ||
4417 | + call ms_mpi(mpi_command='barrier') | ||
4418 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dc=dm,& | ||
4419 | + mpi_number=sizedm,mpi_operation=ms_mpi_sum) | ||
4420 | + if(rank.eq.0) then | ||
4421 | + time2=mytime()-time1 | ||
4422 | + call timewrite(iunit,' d matrix time:',time2) | ||
4423 | + time1=mytime() | ||
4424 | + endif | ||
4425 | +! | ||
4426 | +! compute the expansion coefficients | ||
4427 | +! | ||
4428 | + aw=0.d0 | ||
4429 | + bw=0.d0 | ||
4430 | + cw=0.d0 | ||
4431 | + dw=0.d0 | ||
4432 | + do w=0,nodrw | ||
4433 | + do n=1,nodr | ||
4434 | + n1s=max(1,abs(n-w)) | ||
4435 | + n1e=min(nodr,n+w) | ||
4436 | + do n1=n1s,n1e | ||
4437 | + do k=1,3 | ||
4438 | + do p=1,2 | ||
4439 | + do p1=1,2 | ||
4440 | + fm(k,n,p,n1,p1)=0. | ||
4441 | + enddo | ||
4442 | + enddo | ||
4443 | + enddo | ||
4444 | + enddo | ||
4445 | + enddo | ||
4446 | + do u=-nodr-1,nodr+1 | ||
4447 | + do k=-1,1,2 | ||
4448 | + m=u+k | ||
4449 | + ik=(k+1)/2+1 | ||
4450 | + ns=max(1,abs(m)) | ||
4451 | + do n=ns,nodr | ||
4452 | + n1max=min(w+n,nodr) | ||
4453 | + call vcfunc(m,n,0,w,vc) | ||
4454 | + do n1=ns,nodr | ||
4455 | + if((n+n1.lt.w).or.(abs(n-n1).gt.w)) cycle | ||
4456 | + fl=-(-1)**n*vc(n1)*fnr(w+w+1)/fnr(n1+n1+1) | ||
4457 | + do p=1,2 | ||
4458 | + do p1=1,2 | ||
4459 | + fm(ik,n,p,n1,p1)=fm(ik,n,p,n1,p1)+dm(u,ik,n,p,n1,p1)*fl | ||
4460 | + enddo | ||
4461 | + enddo | ||
4462 | + enddo | ||
4463 | + enddo | ||
4464 | + enddo | ||
4465 | + if(w.lt.2) cycle | ||
4466 | + m=u+1 | ||
4467 | + m1=u-1 | ||
4468 | + ns=max(1,abs(m)) | ||
4469 | + n1s=max(1,abs(m1)) | ||
4470 | + do n=ns,nodr | ||
4471 | + n1max=min(w+n,nodr) | ||
4472 | + call vcfunc(m,n,-2,w,vc) | ||
4473 | + do n1=n1s,nodr | ||
4474 | + if((n+n1.lt.w).or.(abs(n-n1).gt.w)) cycle | ||
4475 | + fl=-(-1)**n*vc(n1)*fnr(w+w+1)/fnr(n1+n1+1) | ||
4476 | + do p=1,2 | ||
4477 | + do p1=1,2 | ||
4478 | + fm(3,n,p,n1,p1)=fm(3,n,p,n1,p1)+dm(u,3,n,p,n1,p1)*fl | ||
4479 | + enddo | ||
4480 | + enddo | ||
4481 | + enddo | ||
4482 | + enddo | ||
4483 | + enddo | ||
4484 | + do n=1,nodr | ||
4485 | + n1s=max(1,abs(n-w)) | ||
4486 | + n1e=min(nodr,n+w) | ||
4487 | + in=(-1)**n | ||
4488 | + n1max=min(w+n,nodr) | ||
4489 | + call vcfunc(1,n,0,w,vc) | ||
4490 | + do n1=n1s,n1e | ||
4491 | + fl=2.d0*in*vc(n1)*fnr(w+w+1)/fnr(n1+n1+1) | ||
4492 | + i=mod(n+n1-w,2)+1 | ||
4493 | + do p=1,2 | ||
4494 | + p1=(2-i)*p+(i-1)*(3-p) | ||
4495 | + do k=-1,1,2 | ||
4496 | + ik=(k+1)/2+1 | ||
4497 | + aw(0,k,w)=aw(0,k,w)+fm(ik,n,p,n1,p1)*fl | ||
4498 | + bw(0,k,w)=bw(0,k,w)+fm(ik,n,p,n1,3-p1)*fl | ||
4499 | + enddo | ||
4500 | + bw(2,0,w)=bw(2,0,w)+fm(3,n,p,n1,3-p1)*fl | ||
4501 | + aw(2,0,w)=aw(2,0,w)+fm(3,n,p,n1,p1)*fl | ||
4502 | + enddo | ||
4503 | + enddo | ||
4504 | + if(w.lt.2) cycle | ||
4505 | + call vcfunc(1,n,-2,w,vc) | ||
4506 | + do n1=n1s,n1e | ||
4507 | + fl=2.d0*in*vc(n1)*fnr(w+w+1)/fnr(n1+n1+1) | ||
4508 | + i=mod(n+n1-w,2)+1 | ||
4509 | + do p=1,2 | ||
4510 | + p1=(2-i)*p+(i-1)*(3-p) | ||
4511 | + do k=-1,1,2 | ||
4512 | + ik=(k+1)/2+1 | ||
4513 | + aw(2,k,w)=aw(2,k,w)+fm(ik,n,p,n1,p1)*fl*(-1)**p1 | ||
4514 | + bw(2,k,w)=bw(2,k,w)+fm(ik,n,p,n1,3-p1)*fl*(-1)**(3-p1) | ||
4515 | + enddo | ||
4516 | + enddo | ||
4517 | + fl2=2.*(-1)**(n1+w)*vc(n1)*fnr(w+w+1)/fnr(n1+n1+1) | ||
4518 | + do p=1,2 | ||
4519 | + do p1=1,2 | ||
4520 | + cw(w)=cw(w)+fm(3,n,p,n1,p1)*fl*(-1)**p1 | ||
4521 | + dw(w)=dw(w)+fm(3,n,p,n1,p1)*fl2*(-1)**p | ||
4522 | + enddo | ||
4523 | + enddo | ||
4524 | + enddo | ||
4525 | + enddo | ||
4526 | + enddo | ||
4527 | + do w=0,nodrw | ||
4528 | + do k=-1,1 | ||
4529 | + do i=0,2 | ||
4530 | + aw(i,k,w)=aw(i,k,w)*2./xv/xv | ||
4531 | + bw(i,k,w)=bw(i,k,w)*2./xv/xv | ||
4532 | + enddo | ||
4533 | + enddo | ||
4534 | + cw(w)=cw(w)*2./xv/xv | ||
4535 | + dw(w)=dw(w)*2./xv/xv | ||
4536 | + enddo | ||
4537 | + do n=0,nodrw | ||
4538 | + sm(1,1,n)=aw(0,-1,n)+aw(0,1,n) | ||
4539 | + sm(1,2,n)=aw(2,-1,n)+aw(2,1,n) | ||
4540 | + sm(1,3,n)=2.d0*dimag(aw(2,0,n)) | ||
4541 | + sm(1,4,n)=aw(0,1,n)-aw(0,-1,n) | ||
4542 | + sm(2,2,n)=dw(n) | ||
4543 | + sm(2,3,n)=dimag(dw(n)) | ||
4544 | + sm(2,4,n)=aw(2,1,n)-aw(2,-1,n) | ||
4545 | + sm(3,2,n)=dimag(cw(n)) | ||
4546 | + sm(3,3,n)=cw(n) | ||
4547 | + sm(3,4,n)=dimag(bw(2,-1,n)-bw(2,1,n)) | ||
4548 | + sm(4,4,n)=bw(0,1,n)-bw(0,-1,n) | ||
4549 | + enddo | ||
4550 | +! | ||
4551 | +! normalization | ||
4552 | +! | ||
4553 | + qsca0=sm(1,1,0) | ||
4554 | + do n=0,nodrw | ||
4555 | + sm(1,1,n)=sm(1,1,n)/qsca0 | ||
4556 | + sm(1,2,n)=sm(1,2,n)/qsca0 | ||
4557 | + sm(1,3,n)=sm(1,3,n)/qsca0 | ||
4558 | + sm(1,4,n)=sm(1,4,n)/qsca0 | ||
4559 | + sm(2,2,n)=sm(2,2,n)/qsca0 | ||
4560 | + sm(2,3,n)=sm(2,3,n)/qsca0 | ||
4561 | + sm(2,4,n)=sm(2,4,n)/qsca0 | ||
4562 | + sm(3,2,n)=sm(3,2,n)/qsca0 | ||
4563 | + sm(3,3,n)=sm(3,3,n)/qsca0 | ||
4564 | + sm(3,4,n)=sm(3,4,n)/qsca0 | ||
4565 | + sm(4,4,n)=sm(4,4,n)/qsca0 | ||
4566 | + enddo | ||
4567 | + call ms_mpi(mpi_command='barrier') | ||
4568 | + if(rank.eq.0) then | ||
4569 | + time2=mytime()-time1 | ||
4570 | + call timewrite(iunit,' scat matrix coef time:',time2) | ||
4571 | + endif | ||
4572 | + deallocate(windex,vindex,wvindex,wvnum,dm) | ||
4573 | + end subroutine ranorientscatmatrix | ||
4574 | +! | ||
4575 | +! calculation of the RO scattering matrix from the GSF expansion | ||
4576 | +! | ||
4577 | +! | ||
4578 | +! original: 15 January 2011 | ||
4579 | +! revised: 21 February 2011: changed normalization on S11 | ||
4580 | +! | ||
4581 | + subroutine ranorienscatmatrixcalc(nt,tmin,tmax,iscale,smc,nodrexp,sm) | ||
4582 | + use specialfuncs | ||
4583 | + use numconstants | ||
4584 | + implicit none | ||
4585 | + integer :: nt,iscale,nodrexp,i,j,k,n,nn0,nnp2,nnm2 | ||
4586 | + real(8) :: tmin,tmax,smc(4,4,0:nodrexp),sm(4,4,nt),dc(-2:2,0:nodrexp*(nodrexp+2)), & | ||
4587 | + ct,th,qsca | ||
4588 | + do i=1,nt | ||
4589 | + if(nt.eq.1) then | ||
4590 | + th=tmin | ||
4591 | + else | ||
4592 | + th=tmin+(tmax-tmin)*dble(i-1)/dble(nt-1) | ||
4593 | + endif | ||
4594 | + ct=cos(th*pi/180.d0) | ||
4595 | +! | ||
4596 | +! dc is the normalized generalized spherical function | ||
4597 | +! dc(k,n*(n+1)+m) = ((n-k)!(n+m)!/(n+k)!/(n-m)!)^(1/2) D^k_{mn}, | ||
4598 | +! where D^k_{mn} is defined in M&M JOSA 96 | ||
4599 | +! | ||
4600 | + call rotcoef(ct,2,nodrexp,dc) | ||
4601 | + do j=1,4 | ||
4602 | + do k=j,4 | ||
4603 | + sm(j,k,i)=0.d0 | ||
4604 | + enddo | ||
4605 | + enddo | ||
4606 | + do n=0,nodrexp | ||
4607 | + nn0=n*(n+1) | ||
4608 | + nnp2=nn0+2 | ||
4609 | + nnm2=nn0-2 | ||
4610 | + sm(1,1,i)=sm(1,1,i)+dc(0,nn0)*smc(1,1,n) | ||
4611 | + sm(1,4,i)=sm(1,4,i)+dc(0,nn0)*smc(1,4,n) | ||
4612 | + sm(4,4,i)=sm(4,4,i)+dc(0,nn0)*smc(4,4,n) | ||
4613 | + if(n.ge.2) then | ||
4614 | + sm(1,2,i)=sm(1,2,i)+dc(2,nn0)*smc(1,2,n) | ||
4615 | + sm(2,4,i)=sm(2,4,i)+dc(2,nn0)*smc(2,4,n) | ||
4616 | + sm(3,4,i)=sm(3,4,i)+dc(2,nn0)*smc(3,4,n) | ||
4617 | + sm(1,3,i)=sm(1,3,i)+dc(2,nn0)*smc(1,3,n) | ||
4618 | + sm(2,2,i)=sm(2,2,i)+dc(2,nnm2)*smc(2,2,n)+dc(2,nnp2)*smc(3,3,n) | ||
4619 | + sm(2,3,i)=sm(2,3,i)+dc(2,nnp2)*smc(2,3,n)+dc(2,nnp2)*smc(3,2,n) | ||
4620 | + sm(3,3,i)=sm(3,3,i)-dc(2,nnm2)*smc(2,2,n)+dc(2,nnp2)*smc(3,3,n) | ||
4621 | + endif | ||
4622 | + enddo | ||
4623 | +! | ||
4624 | +! discontiued scaling option: now done in main program | ||
4625 | +! | ||
4626 | +! if(iscale.eq.1) then | ||
4627 | +! do j=1,4 | ||
4628 | +! do k=j,4 | ||
4629 | +! if(j.ne.1.or.k.ne.1) then | ||
4630 | +! sm(j,k,i)=sm(j,k,i)/sm(1,1,i) | ||
4631 | +! endif | ||
4632 | +! enddo | ||
4633 | +! enddo | ||
4634 | +! endif | ||
4635 | +! | ||
4636 | +! here are the VV and HH differential cross sections | ||
4637 | +! | ||
4638 | +! gvv=.25*(sm(1,1)+sm(2,2)-2.*sm(1,2)) | ||
4639 | +! ghh=.25*(sm(1,1)+sm(2,2)+2.*sm(1,2)) | ||
4640 | +! | ||
4641 | + enddo | ||
4642 | + return | ||
4643 | + end subroutine ranorienscatmatrixcalc | ||
4644 | + end module scatprops | ||
4645 | +! | ||
4646 | +! module nearfield contains local data and subroutines for near field calculation | ||
4647 | +! | ||
4648 | +! | ||
4649 | +! last revised: 15 January 2011 | ||
4650 | +! 30 March 2011: added optical activity | ||
4651 | +! | ||
4652 | + module nearfield | ||
4653 | + implicit none | ||
4654 | + integer, private :: axialinc,ndimpw,nodrpwmax | ||
4655 | + integer, private, allocatable :: nblk_nf(:),noff_nf(:) | ||
4656 | + real(8), private :: rplotmax | ||
4657 | + complex(8), allocatable, private :: amnp_nf(:),cmnp_nf(:),pmnp_nf(:), & | ||
4658 | + amn3mp_nf(:),cmn3mp_nf(:),pmn3mp_nf(:) | ||
4659 | + contains | ||
4660 | +! | ||
4661 | +! nearfieldspherepart calculates the field at point xg generated by the spheres | ||
4662 | +! | ||
4663 | +! | ||
4664 | +! last revised: 15 January 2011 | ||
4665 | +! 30 March 2011: added optical activity | ||
4666 | +! | ||
4667 | + subroutine nearfieldspherepart(xg,nsphere,xsp,rpos,ri,& | ||
4668 | + nodr,neqns,insphere,efield,hfield) | ||
4669 | + use specialfuncs | ||
4670 | + use numconstants | ||
4671 | + implicit none | ||
4672 | + integer :: nsphere,nodr(nsphere),neqns,i,insphere,nblki,n | ||
4673 | + real(8) :: xg(3),xsp(nsphere),rpos(3,nsphere),x(3),r | ||
4674 | + complex(8) :: ri(2,nsphere),vwh(3,neqns),efield(3),hfield(3),ri0,cn1,cn2 | ||
4675 | + complex(8), allocatable :: vwhleft(:,:,:),vwhright(:,:,:) | ||
4676 | + | ||
4677 | +! | ||
4678 | +! find if the point is inside a sphere | ||
4679 | +! | ||
4680 | + insphere=0 | ||
4681 | + do i=1,nsphere | ||
4682 | + x=xg(:)-rpos(:,i) | ||
4683 | + r=sqrt(dot_product(x,x)) | ||
4684 | + if(r.le.xsp(i)) then | ||
4685 | + insphere=i | ||
4686 | + exit | ||
4687 | + endif | ||
4688 | + enddo | ||
4689 | +! | ||
4690 | +! do the calculations | ||
4691 | +! | ||
4692 | + if(insphere.eq.0) then | ||
4693 | +! | ||
4694 | +! outside a sphere: field = scattered | ||
4695 | +! | ||
4696 | + do i=1,nsphere | ||
4697 | + x=xg(:)-rpos(:,i) | ||
4698 | + ri0=(1.d0,0.d0) | ||
4699 | + call vwhcalc(x,ri0,nodr(i),3,vwh(1:3,noff_nf(i)+1:noff_nf(i)+nblk_nf(i))) | ||
4700 | + enddo | ||
4701 | + efield(:)=matmul(vwh(:,1:neqns),amnp_nf(1:neqns)) | ||
4702 | + hfield(:)=matmul(vwh(:,1:neqns),amn3mp_nf(1:neqns))/dcmplx(0.d0,1.d0) | ||
4703 | + else | ||
4704 | +! | ||
4705 | +! inside a sphere: field = internal | ||
4706 | +! | ||
4707 | + i=insphere | ||
4708 | + if(abs(ri(1,i)-ri(2,i)).eq.0) then | ||
4709 | + x=xg(:)-rpos(:,i) | ||
4710 | + call vwhcalc(x,ri(1,i),nodr(i),1,vwh) | ||
4711 | + efield(:)=matmul(vwh(:,1:nblk_nf(i)), & | ||
4712 | + cmnp_nf(noff_nf(i)+1:noff_nf(i)+nblk_nf(i))) | ||
4713 | + hfield(:)=matmul(vwh(:,1:nblk_nf(i)), & | ||
4714 | + cmn3mp_nf(noff_nf(i)+1:noff_nf(i)+nblk_nf(i)))*ri(1,i)/dcmplx(0.d0,1.d0) | ||
4715 | + else | ||
4716 | + nblki=nodr(i)*(nodr(i)+2) | ||
4717 | + allocate(vwhleft(3,2,nblki),vwhright(3,2,nblki)) | ||
4718 | + x=xg(:)-rpos(:,i) | ||
4719 | + call vwhcalc(x,ri(1,i),nodr(i),1,vwhleft) | ||
4720 | + call vwhcalc(x,ri(2,i),nodr(i),1,vwhright) | ||
4721 | + efield=0.d0 | ||
4722 | + hfield=0.d0 | ||
4723 | + do n=1,nblki | ||
4724 | + cn1=cmnp_nf(noff_nf(i)+2*n-1) | ||
4725 | + cn2=cmnp_nf(noff_nf(i)+2*n) | ||
4726 | + efield(:)=efield(:)+(vwhleft(:,1,n)+vwhleft(:,2,n))*cn1 & | ||
4727 | + +(vwhright(:,1,n)-vwhright(:,2,n))*cn2 | ||
4728 | + hfield(:)=hfield(:)+((vwhleft(:,2,n)+vwhleft(:,1,n))*cn1*ri(1,i) & | ||
4729 | + +(vwhright(:,2,n)-vwhright(:,1,n))*cn2*ri(2,i))/dcmplx(0.d0,1.d0) | ||
4730 | + enddo | ||
4731 | + deallocate(vwhleft,vwhright) | ||
4732 | + endif | ||
4733 | + endif | ||
4734 | + end subroutine nearfieldspherepart | ||
4735 | +! | ||
4736 | +! nearfieldincidentpart calculates the incident field at point xg using a regular | ||
4737 | +! vswh expansion | ||
4738 | +! | ||
4739 | +! | ||
4740 | +! last revised: 15 January 2011 | ||
4741 | +! | ||
4742 | + subroutine nearfieldincidentpart(xg,nodrpw,efield,hfield) | ||
4743 | + use specialfuncs | ||
4744 | + use numconstants | ||
4745 | + implicit none | ||
4746 | + integer :: nblkpw,nodrpw | ||
4747 | + real(8) :: xg(3),r,epspw | ||
4748 | + complex(8) :: vwhpw(3,nodrpw*(nodrpw+2)*2),vwhpwaxial(3,4*nodrpw), & | ||
4749 | + efield(3),hfield(3) | ||
4750 | +! | ||
4751 | +! oblique incidence: use the full expansion | ||
4752 | +! | ||
4753 | + if(axialinc.eq.0) then | ||
4754 | + call vwhcalc(xg,(1.d0,0.d0),nodrpw,1,vwhpw) | ||
4755 | + nblkpw=nodrpw*(nodrpw+2)*2 | ||
4756 | + efield(:)=matmul(vwhpw(:,1:nblkpw),pmnp_nf(1:nblkpw)) | ||
4757 | + hfield(:)=matmul(vwhpw(:,1:nblkpw),pmn3mp_nf(1:nblkpw))/dcmplx(0.d0,1.d0) | ||
4758 | + else | ||
4759 | +! | ||
4760 | +! axial incidence: use the shortcut | ||
4761 | +! | ||
4762 | + call vwhaxialcalc(xg,(1.d0,0.d0),nodrpw,1,vwhpwaxial) | ||
4763 | + nblkpw=4*nodrpw | ||
4764 | + efield(:)=matmul(vwhpwaxial(:,1:nblkpw),pmnp_nf(1:nblkpw)) | ||
4765 | + hfield(:)=matmul(vwhpwaxial(:,1:nblkpw),pmn3mp_nf(1:nblkpw))/dcmplx(0.d0,1.d0) | ||
4766 | + endif | ||
4767 | + end subroutine nearfieldincidentpart | ||
4768 | +! | ||
4769 | +! nearfieldincidentcoef generates the reshaped array of incident field coefficients | ||
4770 | +! | ||
4771 | +! | ||
4772 | +! last revised: 15 January 2011 | ||
4773 | +! | ||
4774 | + subroutine nearfieldincidentcoef(nodrpw,alpha,beta,gamma,cbeam,epspw) | ||
4775 | + use specialfuncs | ||
4776 | + use spheredata | ||
4777 | + use miecoefdata | ||
4778 | + use numconstants | ||
4779 | + implicit none | ||
4780 | + integer :: m,n,p,nn1,mn,mnp,nodrpw | ||
4781 | + real (8) :: alpha,beta,cbeam,gamma,epspw,cgamma,sgamma | ||
4782 | + complex(8), allocatable :: pmnp0(:,:,:,:) | ||
4783 | + allocate(pmnp0(0:nodrpw+1,nodrpw,2,2)) | ||
4784 | + if(allocated(pmnp_nf)) deallocate(pmnp_nf,pmn3mp_nf) | ||
4785 | + if(beta.ne.0.d0) then | ||
4786 | + axialinc=0 | ||
4787 | + ndimpw=2*nodrpw*(nodrpw+2) | ||
4788 | + else | ||
4789 | + axialinc=1 | ||
4790 | + ndimpw=4*nodrpw | ||
4791 | + endif | ||
4792 | + allocate(pmnp_nf(ndimpw),pmn3mp_nf(ndimpw)) | ||
4793 | + if(cbeam.eq.0.d0) then | ||
4794 | + call planewavecoef(alpha,beta,nodrpw,pmnp0) | ||
4795 | + else | ||
4796 | + call gaussianbeamcoef(alpha,beta,cbeam,nodrpw,pmnp0) | ||
4797 | + endif | ||
4798 | + cgamma=cos(gamma) | ||
4799 | + sgamma=sin(gamma) | ||
4800 | + if(axialinc.eq.0) then | ||
4801 | + do n=1,nodrpw | ||
4802 | + nn1=n*(n+1) | ||
4803 | + do p=1,2 | ||
4804 | + do m=-n,-1 | ||
4805 | + mn=nn1+m | ||
4806 | + mnp=2*(mn-1)+p | ||
4807 | + pmnp_nf(mnp)=pmnp0(n+1,-m,p,1)*cgamma+pmnp0(n+1,-m,p,2)*sgamma | ||
4808 | + pmn3mp_nf(mnp)=pmnp0(n+1,-m,3-p,1)*cgamma+pmnp0(n+1,-m,3-p,2)*sgamma | ||
4809 | + enddo | ||
4810 | + do m=0,n | ||
4811 | + mn=nn1+m | ||
4812 | + mnp=2*(mn-1)+p | ||
4813 | + pmnp_nf(mnp)=pmnp0(m,n,p,1)*cgamma+pmnp0(m,n,p,2)*sgamma | ||
4814 | + pmn3mp_nf(mnp)=pmnp0(m,n,3-p,1)*cgamma+pmnp0(m,n,3-p,2)*sgamma | ||
4815 | + enddo | ||
4816 | + enddo | ||
4817 | + enddo | ||
4818 | + else | ||
4819 | + do n=1,nodrpw | ||
4820 | + do p=1,2 | ||
4821 | + mnp=4*(n-1)+p | ||
4822 | + pmnp_nf(mnp)=pmnp0(n+1,1,p,1)*cgamma+pmnp0(n+1,1,p,2)*sgamma | ||
4823 | + pmn3mp_nf(mnp)=pmnp0(n+1,1,3-p,1)*cgamma+pmnp0(n+1,1,3-p,2)*sgamma | ||
4824 | + pmnp_nf(mnp+2)=pmnp0(1,n,p,1)*cgamma+pmnp0(1,n,p,2)*sgamma | ||
4825 | + pmn3mp_nf(mnp+2)=pmnp0(1,n,3-p,1)*cgamma+pmnp0(1,n,3-p,2)*sgamma | ||
4826 | + enddo | ||
4827 | + enddo | ||
4828 | + endif | ||
4829 | + deallocate(pmnp0) | ||
4830 | + end subroutine nearfieldincidentcoef | ||
4831 | +! | ||
4832 | +! nearfieldpointcalc: if newcalc = 1, generates the reshaped incident, scattered, and | ||
4833 | +! internal field coefficients, and returns with newcalc=0 | ||
4834 | +! if newcalc = 0, generates the field at point xg | ||
4835 | +! | ||
4836 | +! | ||
4837 | +! last revised: 15 January 2011 | ||
4838 | +! 30 March 2011: added optical activity | ||
4839 | +! | ||
4840 | + subroutine nearfieldpointcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
4841 | + gamma,epspw,xg,newcalc,efield,hfield) | ||
4842 | + use specialfuncs | ||
4843 | + use spheredata | ||
4844 | + use miecoefdata | ||
4845 | + use numconstants | ||
4846 | + implicit none | ||
4847 | + integer :: nsphere,neqns,nodr(nsphere),i,j,k,m,n,p,nn1,mn,nodrpw,newcalc, & | ||
4848 | + insphere | ||
4849 | + real (8) :: alpha,beta,cbeam,xsp(nsphere),rpos(3,nsphere),xg(3),xgp(3), & | ||
4850 | + gamma,epspw,rplot,cgamma,sgamma | ||
4851 | + complex(8) :: amnp(neqns,2),ri(2,nsphere),efield(3),hfield(3),einc(3),hinc(3),ri0, & | ||
4852 | + ct1,ct2 | ||
4853 | + complex(8), allocatable :: pmnp0(:,:,:,:),cnmie(:,:,:),amnpt(:,:),cmnpt(:,:) | ||
4854 | +! | ||
4855 | +! initialization operations: newcalc=1 | ||
4856 | +! | ||
4857 | + if(newcalc.eq.1) then | ||
4858 | + if(allocated(amnp_nf)) deallocate(amnp_nf,cmnp_nf,amn3mp_nf,cmn3mp_nf, & | ||
4859 | + noff_nf,nblk_nf) | ||
4860 | + allocate(amnp_nf(neqns),cmnp_nf(neqns),amn3mp_nf(neqns),cmn3mp_nf(neqns), & | ||
4861 | + noff_nf(nsphere),nblk_nf(nsphere)) | ||
4862 | + noff_nf(1)=0 | ||
4863 | + do i=1,nsphere | ||
4864 | + nblk_nf(i)=2*nodr(i)*(nodr(i)+2) | ||
4865 | + if(i.lt.nsphere) noff_nf(i+1)=noff_nf(i)+nblk_nf(i) | ||
4866 | + enddo | ||
4867 | + cgamma=cos(gamma) | ||
4868 | + sgamma=sin(gamma) | ||
4869 | + do i=1,nsphere | ||
4870 | + ri0=2.d0/(1.d0/ri(1,i)+1.d0/ri(2,i)) | ||
4871 | + allocate(pmnp0(0:nodr(i)+1,nodr(i),2,2),cnmie(2,2,nodr(i)),& | ||
4872 | + amnpt(2,nodr(i)*(nodr(i)+2)),cmnpt(2,nodr(i)*(nodr(i)+2))) | ||
4873 | + call getmiedata(which_sphere=i,sphere_int_mie_coefficients=cnmie) | ||
4874 | + do p=1,2 | ||
4875 | + pmnp0(0:nodr(i)+1,1:nodr(i),1:2,p) & | ||
4876 | + =reshape(amnp(noff_nf(i)+1:noff_nf(i)+nblk_nf(i),p),(/nodr(i)+2,nodr(i),2/)) | ||
4877 | + enddo | ||
4878 | + if(abs(ri(1,i)-ri(2,i)).gt.1.d-10) then | ||
4879 | + do n=1,nodr(i) | ||
4880 | + nn1=n*(n+1) | ||
4881 | + do p=1,2 | ||
4882 | + do m=-n,-1 | ||
4883 | + mn=nn1+m | ||
4884 | + amnpt(p,mn)=pmnp0(n+1,-m,p,1)*cgamma+pmnp0(n+1,-m,p,2)*sgamma | ||
4885 | + enddo | ||
4886 | + do m=0,n | ||
4887 | + mn=nn1+m | ||
4888 | + amnpt(p,mn)=pmnp0(m,n,p,1)*cgamma+pmnp0(m,n,p,2)*sgamma | ||
4889 | + enddo | ||
4890 | + enddo | ||
4891 | + do m=-n,n | ||
4892 | + mn=nn1+m | ||
4893 | + ct1=amnpt(1,mn)*cnmie(1,1,n)+amnpt(2,mn)*cnmie(1,2,n) | ||
4894 | + ct2=amnpt(1,mn)*cnmie(2,1,n)+amnpt(2,mn)*cnmie(2,2,n) | ||
4895 | + cmnpt(1,mn)=ct1 | ||
4896 | + cmnpt(2,mn)=-(0.d0,1.d0)/ri0*ct2 | ||
4897 | + enddo | ||
4898 | + enddo | ||
4899 | + else | ||
4900 | + do n=1,nodr(i) | ||
4901 | + nn1=n*(n+1) | ||
4902 | + do p=1,2 | ||
4903 | + do m=-n,-1 | ||
4904 | + mn=nn1+m | ||
4905 | + amnpt(p,mn)=pmnp0(n+1,-m,p,1)*cgamma+pmnp0(n+1,-m,p,2)*sgamma | ||
4906 | + cmnpt(p,mn)=amnpt(p,mn)*cnmie(p,p,n) | ||
4907 | + enddo | ||
4908 | + do m=0,n | ||
4909 | + mn=nn1+m | ||
4910 | + amnpt(p,mn)=pmnp0(m,n,p,1)*cgamma+pmnp0(m,n,p,2)*sgamma | ||
4911 | + cmnpt(p,mn)=amnpt(p,mn)*cnmie(p,p,n) | ||
4912 | + enddo | ||
4913 | + enddo | ||
4914 | + enddo | ||
4915 | + endif | ||
4916 | + amnp_nf(noff_nf(i)+1:noff_nf(i)+nblk_nf(i))= & | ||
4917 | + reshape(amnpt(1:2,1:nodr(i)*(nodr(i)+2)),(/nblk_nf(i)/)) | ||
4918 | + cmnp_nf(noff_nf(i)+1:noff_nf(i)+nblk_nf(i))= & | ||
4919 | + reshape(cmnpt(1:2,1:nodr(i)*(nodr(i)+2)),(/nblk_nf(i)/)) | ||
4920 | + amn3mp_nf(noff_nf(i)+1:noff_nf(i)+nblk_nf(i))= & | ||
4921 | + reshape(amnpt(2:1:-1,1:nodr(i)*(nodr(i)+2)),(/nblk_nf(i)/)) | ||
4922 | + cmn3mp_nf(noff_nf(i)+1:noff_nf(i)+nblk_nf(i))= & | ||
4923 | + reshape(cmnpt(2:1:-1,1:nodr(i)*(nodr(i)+2)),(/nblk_nf(i)/)) | ||
4924 | + deallocate(pmnp0,cnmie,amnpt,cmnpt) | ||
4925 | + enddo | ||
4926 | + rplot=sqrt(dot_product(xg,xg)) | ||
4927 | + rplotmax=rplot | ||
4928 | + call planewavetruncationorder(rplot,epspw,nodrpw) | ||
4929 | + nodrpwmax=nodrpw | ||
4930 | + call nearfieldincidentcoef(nodrpw,alpha,beta,gamma,cbeam,epspw) | ||
4931 | + newcalc=0 | ||
4932 | + return | ||
4933 | + endif | ||
4934 | +! | ||
4935 | +! point calculation operations: newcalc=0 | ||
4936 | +! first determine the required order of the incident field expansion, and recalculate | ||
4937 | +! field coefficients, if necessary | ||
4938 | +! | ||
4939 | + rplot=sqrt(dot_product(xg,xg)) | ||
4940 | + rplotmax=max(rplot,rplotmax) | ||
4941 | + call planewavetruncationorder(rplot,epspw,nodrpw) | ||
4942 | + if(nodrpw.gt.nodrpwmax) then | ||
4943 | + nodrpwmax=nodrpw | ||
4944 | + call nearfieldincidentcoef(nodrpw,alpha,beta,gamma,cbeam,epspw) | ||
4945 | + endif | ||
4946 | + efield=0.d0 | ||
4947 | + hfield=0.d0 | ||
4948 | +! | ||
4949 | +! calculate the sphere contribution to the field | ||
4950 | +! | ||
4951 | + call nearfieldspherepart(xg,nsphere,xsp,rpos,ri,& | ||
4952 | + nodr,neqns,insphere,efield,hfield) | ||
4953 | +! | ||
4954 | +! if the point is external to the spheres, calculate the incident field | ||
4955 | +! | ||
4956 | + if(insphere.eq.0) then | ||
4957 | + call nearfieldincidentpart(xg,nodrpw,einc,hinc) | ||
4958 | + efield=efield+einc | ||
4959 | + hfield=hfield+hinc | ||
4960 | + endif | ||
4961 | + end subroutine nearfieldpointcalc | ||
4962 | +! | ||
4963 | +! nearfieldgridcalc is an MPI--enabled subroutine for calculating field points on a | ||
4964 | +! rectangular grid. Writes the data to nfoutunit. | ||
4965 | +! | ||
4966 | +! | ||
4967 | +! last revised: 15 January 2011 | ||
4968 | +! 30 March 2011: added optical activity | ||
4969 | +! changed so that input positions are defined relative to sphere position file origin, and | ||
4970 | +! not the gb focal point. | ||
4971 | +! | ||
4972 | + subroutine nearfieldgridcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
4973 | + nfplane,nfplanepos0,nfplanevert0,gbfocus,deltax,gamma,nfoutunit,epspw, & | ||
4974 | + nfoutdata,runprintunit) | ||
4975 | + use mpidefs | ||
4976 | + use mpidata | ||
4977 | + use intrinsics | ||
4978 | + use specialfuncs | ||
4979 | + use spheredata | ||
4980 | + use miecoefdata | ||
4981 | + use numconstants | ||
4982 | + implicit none | ||
4983 | + integer :: nsphere,neqns,nodr(nsphere),nfplane,runprintunit,npoints1,npoints2, & | ||
4984 | + npoints,i,j,k,np23,gcoord(3),rank,numprocs,nrowperproc,nrowrem, & | ||
4985 | + npoints1by5,plotincfield,nsp,nfoutunit,nfoutdata,newcalc | ||
4986 | + real (8) :: alpha,beta,cbeam,xsp(nsphere),rpos(3,nsphere),nfplanepos,& | ||
4987 | + nfplanevert(2,2),frowperproc,rowsum,xg(3),xgp(3),deltax,gamma,epspw, & | ||
4988 | + time1,time2,xplot(3,nsphere),xi0,ri0,esquare,xgpmax(3),rplot, & | ||
4989 | + gbfocus(3),nfplanepos0,nfplanevert0(2,2) | ||
4990 | + complex(8) :: amnp(neqns,2),ri(2,nsphere),efield(3),hfield(3) | ||
4991 | + integer, allocatable :: efindex(:),efnum(:) | ||
4992 | + complex(8), allocatable :: efieldrow(:,:),efieldrowt(:,:),hfieldrow(:,:),hfieldrowt(:,:) | ||
4993 | + call ms_mpi(mpi_command='size',mpi_size=numprocs) | ||
4994 | + call ms_mpi(mpi_command='rank',mpi_rank=rank) | ||
4995 | +! | ||
4996 | +! determine the plane | ||
4997 | +! | ||
4998 | + if(nfplane.eq.1) then | ||
4999 | + gcoord=(/2,3,1/) | ||
5000 | + elseif(nfplane.eq.2) then | ||
5001 | + gcoord=(/3,1,2/) | ||
5002 | + else | ||
5003 | + gcoord=(/1,2,3/) | ||
5004 | + endif | ||
5005 | +! | ||
5006 | +! shift the coordinates to gb focal origin | ||
5007 | +! | ||
5008 | + nfplanevert(1,1)=nfplanevert0(1,1)-gbfocus(gcoord(1)) | ||
5009 | + nfplanevert(1,2)=nfplanevert0(1,2)-gbfocus(gcoord(1)) | ||
5010 | + nfplanevert(2,1)=nfplanevert0(2,1)-gbfocus(gcoord(2)) | ||
5011 | + nfplanevert(2,2)=nfplanevert0(2,2)-gbfocus(gcoord(2)) | ||
5012 | + nfplanepos=nfplanepos0-gbfocus(gcoord(3)) | ||
5013 | + xg(gcoord(3))=nfplanepos | ||
5014 | +! | ||
5015 | +! determine the number of points | ||
5016 | +! | ||
5017 | + npoints1=nint((nfplanevert(1,2)-nfplanevert(1,1))/deltax)+1 | ||
5018 | + npoints2=nint((nfplanevert(2,2)-nfplanevert(2,1))/deltax)+1 | ||
5019 | + npoints=npoints1*npoints2 | ||
5020 | +! | ||
5021 | +! find the maximum point-to-target origin distance and initialize the field calculation | ||
5022 | +! | ||
5023 | + xgp(3)=nfplanepos | ||
5024 | + rplotmax=0.d0 | ||
5025 | + xgpmax=0.d0 | ||
5026 | + do i=1,npoints1 | ||
5027 | + xgp(1)=nfplanevert(1,1)+deltax*dble(i-1) | ||
5028 | + do j=1,npoints2 | ||
5029 | + xgp(2)=nfplanevert(2,1)+deltax*dble(j-1) | ||
5030 | + rplot=sqrt(dot_product(xgp,xgp)) | ||
5031 | + if(rplot.gt.rplotmax) then | ||
5032 | + rplotmax=rplot | ||
5033 | + xgpmax=xgp | ||
5034 | + endif | ||
5035 | + enddo | ||
5036 | + enddo | ||
5037 | + newcalc=1 | ||
5038 | + call nearfieldpointcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
5039 | + gamma,epspw,xgpmax,newcalc,efield,hfield) | ||
5040 | +! | ||
5041 | +! determine the intersecting spheres | ||
5042 | +! | ||
5043 | + nsp=0 | ||
5044 | + do i=1,nsphere | ||
5045 | + xi0=abs(rpos(gcoord(3),i)-xg(gcoord(3))) | ||
5046 | + if(xi0.le.xsp(i)) then | ||
5047 | + nsp=nsp+1 | ||
5048 | + xplot(1,nsp)=rpos(gcoord(1),i)+gbfocus(gcoord(1)) | ||
5049 | + xplot(2,nsp)=rpos(gcoord(2),i)+gbfocus(gcoord(2)) | ||
5050 | + ri0=xsp(i)*xsp(i)-xi0*xi0 | ||
5051 | + if(ri0.ne.0.) ri0=sqrt(ri0) | ||
5052 | + xplot(3,nsp)=ri0 | ||
5053 | + endif | ||
5054 | + enddo | ||
5055 | +! | ||
5056 | +! report to runprintunit | ||
5057 | +! | ||
5058 | + if(rank.eq.0) then | ||
5059 | + write(runprintunit,'('' near field calculations'')') | ||
5060 | + write(runprintunit,'('' plane, position:'',i5,f9.3)') nfplane,nfplanepos0 | ||
5061 | + write(runprintunit,'('' rectangular plot vertices:'')') | ||
5062 | + write(runprintunit,'('' min:'',3f9.3)') nfplanevert0(1:2,1) | ||
5063 | + write(runprintunit,'('' max:'',3f9.3)') nfplanevert0(1:2,2) | ||
5064 | + write(runprintunit,'('' number of plotting points, step size:'',i8,f8.3)') npoints, deltax | ||
5065 | + write(runprintunit,'('' max plane wave order:'',i5)') nodrpwmax | ||
5066 | + endif | ||
5067 | +! | ||
5068 | +! determine the distribution of work among the processors | ||
5069 | +! | ||
5070 | + allocate(efindex(0:numprocs-1),efnum(0:numprocs-1), & | ||
5071 | + efieldrow(3,npoints2),efieldrowt(3,npoints2), & | ||
5072 | + hfieldrow(3,npoints2),hfieldrowt(3,npoints2)) | ||
5073 | + np23=3*npoints2 | ||
5074 | + frowperproc=dble(npoints2)/dble(numprocs) | ||
5075 | + rowsum=0. | ||
5076 | + do i=0,numprocs-1 | ||
5077 | + efindex(i)=floor(rowsum) | ||
5078 | + rowsum=rowsum+frowperproc | ||
5079 | + enddo | ||
5080 | + do i=0,numprocs-2 | ||
5081 | + efnum(i)=efindex(i+1)-efindex(i) | ||
5082 | + enddo | ||
5083 | + efnum(numprocs-1)=npoints2-efindex(numprocs-1) | ||
5084 | + npoints1by5=int(npoints1/5.+.5) | ||
5085 | +! | ||
5086 | +! do the calculations and write the results to the file | ||
5087 | +! | ||
5088 | + if(rank.eq.0) then | ||
5089 | + write(nfoutunit,*) npoints1,npoints2 | ||
5090 | + write(nfoutunit,*) nsp | ||
5091 | + do i=1,nsp | ||
5092 | + write(nfoutunit,'(3e13.5)') xplot(1,i),xplot(2,i),xplot(3,i) | ||
5093 | + enddo | ||
5094 | + time1=mytime() | ||
5095 | + endif | ||
5096 | + xg(gcoord(3))=nfplanepos | ||
5097 | + newcalc=0 | ||
5098 | + do i=1,npoints1 | ||
5099 | + xg(gcoord(1))=nfplanevert(1,1)+deltax*dble(i-1) | ||
5100 | + xgp(gcoord(1))=nfplanevert0(1,1)+deltax*dble(i-1) | ||
5101 | + efieldrowt=0.d0 | ||
5102 | + efieldrow=0.d0 | ||
5103 | + hfieldrowt=0.d0 | ||
5104 | + hfieldrow=0.d0 | ||
5105 | + do j=efindex(rank)+1,efindex(rank)+efnum(rank) | ||
5106 | + xg(gcoord(2))=nfplanevert(2,1)+deltax*dble(j-1) | ||
5107 | + call nearfieldpointcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
5108 | + gamma,epspw,xg,newcalc,efieldrowt(:,j),hfieldrowt(:,j)) | ||
5109 | + enddo | ||
5110 | + call ms_mpi(mpi_command='barrier') | ||
5111 | + call ms_mpi(mpi_command='reduce',mpi_send_buf_dc=efieldrowt,mpi_recv_buf_dc=efieldrow,& | ||
5112 | + mpi_number=np23,mpi_rank=0,mpi_operation=ms_mpi_sum) | ||
5113 | + if(nfoutdata.ge.2) then | ||
5114 | + call ms_mpi(mpi_command='reduce',mpi_send_buf_dc=hfieldrowt,mpi_recv_buf_dc=hfieldrow,& | ||
5115 | + mpi_number=np23,mpi_rank=0,mpi_operation=ms_mpi_sum) | ||
5116 | + endif | ||
5117 | + if(rank.eq.0) then | ||
5118 | + do j=1,npoints2 | ||
5119 | + xgp(gcoord(2))=nfplanevert0(2,1)+deltax*dble(j-1) | ||
5120 | + if(nfoutdata.eq.0) then | ||
5121 | + esquare=dot_product(efieldrow(:,j),efieldrow(:,j)) | ||
5122 | + write(nfoutunit,'(2f9.4,e13.5)') xgp(gcoord(1)),xgp(gcoord(2)),esquare | ||
5123 | + elseif(nfoutdata.eq.1) then | ||
5124 | + write(nfoutunit,'(2f9.4,6e13.5)') xgp(gcoord(1)),xgp(gcoord(2)),efieldrow(:,j) | ||
5125 | + else | ||
5126 | + write(nfoutunit,'(2f9.4,12e13.5)') xgp(gcoord(1)),xgp(gcoord(2)),efieldrow(:,j), & | ||
5127 | + hfieldrow(:,j) | ||
5128 | + endif | ||
5129 | + enddo | ||
5130 | + if(mod(i,npoints1by5).eq.0) then | ||
5131 | + k=i/npoints1by5 | ||
5132 | + time2=(mytime()-time1)*dble(5-k)/dble(k) | ||
5133 | + call timewrite(runprintunit,' estimated time remaining:',time2) | ||
5134 | + endif | ||
5135 | + endif | ||
5136 | + enddo | ||
5137 | + deallocate(efindex,efnum,efieldrow,efieldrowt,hfieldrow,hfieldrowt) | ||
5138 | + end subroutine nearfieldgridcalc | ||
5139 | +! | ||
5140 | +! nearfieldaverage is an MPI--enabled subroutine for calculating average field | ||
5141 | +! values along a line. | ||
5142 | +! | ||
5143 | + subroutine nearfieldaverage(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
5144 | + nfplane,nfplaneposstart0,nfplaneposend0,numberplanes,nfplanevert0,gbfocus, & | ||
5145 | + deltax,gamma,epspw,runprintunit,efieldavez,hfieldavez,svecavez) | ||
5146 | + use mpidefs | ||
5147 | + use mpidata | ||
5148 | + use intrinsics | ||
5149 | + use specialfuncs | ||
5150 | + use spheredata | ||
5151 | + use miecoefdata | ||
5152 | + use numconstants | ||
5153 | + implicit none | ||
5154 | + integer :: nsphere,neqns,nodr(nsphere),nfplane,runprintunit,npoints1,npoints2, & | ||
5155 | + npoints,i,j,k,np23,gcoord(3),rank,numprocs,nrowperproc,nrowrem, & | ||
5156 | + npoints1by5,plotincfield,nsp,nfoutunit,nfoutdata,newcalc,nsend | ||
5157 | + integer :: numberplanes | ||
5158 | + real (8) :: alpha,beta,cbeam,xsp(nsphere),rpos(3,nsphere),nfplanepos,& | ||
5159 | + nfplanevert(2,2),frowperproc,rowsum,xg(3),xgp(3),deltax,gamma,epspw, & | ||
5160 | + time1,time2,xplot(3,nsphere),xi0,ri0,esquare,xgpmax(3),rplot, & | ||
5161 | + gbfocus(3),nfplanepos0,nfplanevert0(2,2),nfplaneposstart,nfplaneposend, & | ||
5162 | + deltanfplane,nfplaneposstart0,nfplaneposend0,svec(3),svecave(3) | ||
5163 | + real (8) :: svecavez(3,numberplanes) | ||
5164 | + real(8), allocatable :: xypoint(:,:) | ||
5165 | + complex(8) :: amnp(neqns,2),ri(2,nsphere),efield(3),hfield(3),hfieldave(3),efieldave(3) | ||
5166 | + complex(8) :: efieldavez(3,numberplanes),hfieldavez(3,numberplanes) | ||
5167 | + integer, allocatable :: efindex(:),efnum(:) | ||
5168 | + call ms_mpi(mpi_command='size',mpi_size=numprocs) | ||
5169 | + call ms_mpi(mpi_command='rank',mpi_rank=rank) | ||
5170 | +! | ||
5171 | +! determine the plane | ||
5172 | +! | ||
5173 | + if(nfplane.eq.1) then | ||
5174 | + gcoord=(/2,3,1/) | ||
5175 | + elseif(nfplane.eq.2) then | ||
5176 | + gcoord=(/3,1,2/) | ||
5177 | + else | ||
5178 | + gcoord=(/1,2,3/) | ||
5179 | + endif | ||
5180 | +! | ||
5181 | +! shift the coordinates to gb focal origin | ||
5182 | +! | ||
5183 | + nfplanevert(1,1)=nfplanevert0(1,1)-gbfocus(gcoord(1)) | ||
5184 | + nfplanevert(1,2)=nfplanevert0(1,2)-gbfocus(gcoord(1)) | ||
5185 | + nfplanevert(2,1)=nfplanevert0(2,1)-gbfocus(gcoord(2)) | ||
5186 | + nfplanevert(2,2)=nfplanevert0(2,2)-gbfocus(gcoord(2)) | ||
5187 | + nfplaneposstart=nfplaneposstart0-gbfocus(gcoord(3)) | ||
5188 | + nfplaneposend=nfplaneposend0-gbfocus(gcoord(3)) | ||
5189 | + xg(gcoord(3))=nfplanepos | ||
5190 | +! | ||
5191 | +! determine the number of points | ||
5192 | +! | ||
5193 | + npoints1=nint((nfplanevert(1,2)-nfplanevert(1,1))/deltax)+1 | ||
5194 | + npoints2=nint((nfplanevert(2,2)-nfplanevert(2,1))/deltax)+1 | ||
5195 | + npoints=npoints1*npoints2 | ||
5196 | + allocate(efindex(0:numprocs-1),efnum(0:numprocs-1),xypoint(2,npoints)) | ||
5197 | + frowperproc=dble(npoints)/dble(numprocs) | ||
5198 | + rowsum=0. | ||
5199 | + do i=0,numprocs-1 | ||
5200 | + efindex(i)=floor(rowsum) | ||
5201 | + rowsum=rowsum+frowperproc | ||
5202 | + enddo | ||
5203 | + do i=0,numprocs-2 | ||
5204 | + efnum(i)=efindex(i+1)-efindex(i) | ||
5205 | + enddo | ||
5206 | + efnum(numprocs-1)=npoints-efindex(numprocs-1) | ||
5207 | + | ||
5208 | + xgp(gcoord(3))=max(abs(nfplaneposstart),abs(nfplaneposend)) | ||
5209 | + rplotmax=0.d0 | ||
5210 | + xgpmax=0.d0 | ||
5211 | + k=0 | ||
5212 | + do i=1,npoints1 | ||
5213 | + xgp(gcoord(1))=nfplanevert(1,1)+deltax*dble(i-1) | ||
5214 | + do j=1,npoints2 | ||
5215 | + xgp(gcoord(2))=nfplanevert(2,1)+deltax*dble(j-1) | ||
5216 | + k=k+1 | ||
5217 | + xypoint(1,k)=xgp(gcoord(1)) | ||
5218 | + xypoint(2,k)=xgp(gcoord(2)) | ||
5219 | + rplot=sqrt(dot_product(xgp,xgp)) | ||
5220 | + if(rplot.gt.rplotmax) then | ||
5221 | + rplotmax=rplot | ||
5222 | + xgpmax=xgp | ||
5223 | + endif | ||
5224 | + enddo | ||
5225 | + enddo | ||
5226 | + newcalc=1 | ||
5227 | + call nearfieldpointcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
5228 | + gamma,epspw,xgpmax,newcalc,efield,hfield) | ||
5229 | + newcalc=0 | ||
5230 | + | ||
5231 | + do k=1,numberplanes | ||
5232 | + if(numberplanes.eq.1) then | ||
5233 | + nfplanepos=nfplaneposstart | ||
5234 | + else | ||
5235 | + nfplanepos=nfplaneposstart+(nfplaneposend-nfplaneposstart)*(k-1)/dble(numberplanes-1) | ||
5236 | + endif | ||
5237 | +! | ||
5238 | +! find the maximum point-to-target origin distance and initialize the field calculation | ||
5239 | +! | ||
5240 | + xg(3)=nfplanepos | ||
5241 | + efieldave=0. | ||
5242 | + hfieldave=0. | ||
5243 | + svecave=0. | ||
5244 | + do i=efindex(rank)+1,efindex(rank)+efnum(rank) | ||
5245 | + xg(gcoord(1))=xypoint(1,i) | ||
5246 | + xg(gcoord(2))=xypoint(2,i) | ||
5247 | + efield=0.d0 | ||
5248 | + hfield=0.d0 | ||
5249 | + call nearfieldpointcalc(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,ri,amnp, & | ||
5250 | + gamma,epspw,xg,newcalc,efield,hfield) | ||
5251 | + efieldave=efieldave+efield | ||
5252 | + hfieldave=hfieldave+hfield | ||
5253 | + hfield=conjg(hfield)/2.d0 | ||
5254 | + svec(1)=-efield(3)*hfield(2)+efield(2)*hfield(3) | ||
5255 | + svec(2)=efield(3)*hfield(1)-efield(1)*hfield(3) | ||
5256 | + svec(3)=-efield(2)*hfield(1)+efield(1)*hfield(2) | ||
5257 | + svecave=svecave+svec | ||
5258 | + enddo | ||
5259 | + call ms_mpi(mpi_command='barrier') | ||
5260 | + efield=0.d0 | ||
5261 | + hfield=0.d0 | ||
5262 | + svec=0.d0 | ||
5263 | + call ms_mpi(mpi_command='reduce',mpi_send_buf_dc=efieldave,mpi_recv_buf_dc=efield,& | ||
5264 | + mpi_number=3,mpi_rank=0,mpi_operation=ms_mpi_sum) | ||
5265 | + call ms_mpi(mpi_command='reduce',mpi_send_buf_dc=hfieldave,mpi_recv_buf_dc=hfield,& | ||
5266 | + mpi_number=3,mpi_rank=0,mpi_operation=ms_mpi_sum) | ||
5267 | + call ms_mpi(mpi_command='reduce',mpi_send_buf_dp=svecave,mpi_recv_buf_dp=svec,& | ||
5268 | + mpi_number=3,mpi_rank=0,mpi_operation=ms_mpi_sum) | ||
5269 | + call ms_mpi(mpi_command='barrier') | ||
5270 | + if(rank.eq.0) then | ||
5271 | + efield=efield/dble(npoints) | ||
5272 | + hfield=hfield/dble(npoints) | ||
5273 | + svec=svec/dble(npoints) | ||
5274 | + efieldavez(:,k)=efield | ||
5275 | + hfieldavez(:,k)=hfield | ||
5276 | + svecavez(:,k)=svec | ||
5277 | + i=gcoord(3) | ||
5278 | + write(runprintunit,'('' plane:'',i5,f9.3,2e12.4)') k,nfplanepos, & | ||
5279 | + svec(i) | ||
5280 | + call flush(runprintunit) | ||
5281 | + endif | ||
5282 | + enddo | ||
5283 | + nsend=3*numberplanes | ||
5284 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=efieldavez, & | ||
5285 | + mpi_number=nsend,mpi_rank=0) | ||
5286 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=hfieldavez, & | ||
5287 | + mpi_number=nsend,mpi_rank=0) | ||
5288 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=svecavez, & | ||
5289 | + mpi_number=nsend,mpi_rank=0) | ||
5290 | + call ms_mpi(mpi_command='barrier') | ||
5291 | + | ||
5292 | + deallocate(efindex,efnum,xypoint) | ||
5293 | + end subroutine nearfieldaverage | ||
5294 | + | ||
5295 | + | ||
5296 | + end module nearfield | ||
5297 | +! | ||
5298 | +! module solver: subroutines for solving interaction equations for fixed orientation | ||
5299 | +! and T matrix problems | ||
5300 | +! | ||
5301 | +! | ||
5302 | +! last revised: 15 January 2011 | ||
5303 | +! | ||
5304 | + module solver | ||
5305 | + implicit none | ||
5306 | + | ||
5307 | + contains | ||
5308 | +! | ||
5309 | +! tmatrixsoln: calculation of T matrix via solution of interaction equations for | ||
5310 | +! a generalized plane wave expansion | ||
5311 | +! | ||
5312 | +! | ||
5313 | +! original: 15 January 2011 | ||
5314 | +! revised: 21 February 2011: call for sphereqeff changed | ||
5315 | +! | ||
5316 | + subroutine tmatrixsoln(neqns,nsphere,nodr,nodrt,xsp,rpos,epssoln,epscon,niter,& | ||
5317 | + calctmatrix,tmatrixfile,fftranpresent,niterstep,qext,qabs,qsca,istat) | ||
5318 | + use mpidefs | ||
5319 | + use mpidata | ||
5320 | + use intrinsics | ||
5321 | + use numconstants | ||
5322 | + use specialfuncs | ||
5323 | + use miecoefdata | ||
5324 | + use spheredata | ||
5325 | + use translation | ||
5326 | + use scatprops | ||
5327 | + implicit none | ||
5328 | + integer :: iter,niter,neqns,nsphere,nodr(nsphere),ntran(nsphere),nodrt, & | ||
5329 | + nodrmax,i,ierr,istat,m,n,p,k,l,q,noff,nblk,ma,na,ka,la,mn,istart,iunit, & | ||
5330 | + rank,iexit(1),calctmatrix,lt,kt,qt,nt,mt,it,nodrtt,lstart(1),numsolns,isoln, & | ||
5331 | + isolnstart,igroup,ngroup,rgrank,lold,grank,nsend,nodrta(1), & | ||
5332 | + fftranpresent,niterstep | ||
5333 | + integer, allocatable :: lindex(:),kindex(:) | ||
5334 | + real(8) :: eps,err,qext(nsphere),qabs(nsphere),qsca(nsphere),xsp(nsphere),xv, & | ||
5335 | + rpos(3,nsphere),xij(3),qabsklq(nsphere),qscaklq(nsphere),qextklq(nsphere), & | ||
5336 | + f2,qexttot,qabstot,qscatot,qextold(1),qscaold(1),errqe,errqs, & | ||
5337 | + timetran,timesolve,time1,time2,epssoln,epscon,dtemp(4),timeorder,& | ||
5338 | + at1,at2,at3,at4 | ||
5339 | + real(8) :: qextl(nsphere),qabsl(nsphere),qscal(nsphere) | ||
5340 | + real(8), allocatable :: qextgroup(:,:),qabsgroup(:,:),qscagroup(:,:) | ||
5341 | + complex(8) :: amnp(neqns),pmnp(neqns),pmnpan(neqns) | ||
5342 | + complex(8), allocatable :: pmnp0(:,:,:),ac(:,:,:,:),pmnpt(:,:,:),amnp0(:,:,:), & | ||
5343 | + amnp0group(:,:,:) | ||
5344 | + character*30 :: tmatrixfile | ||
5345 | + character*4 :: timeunit | ||
5346 | + data istart,iexit/1,0/ | ||
5347 | + rank=base_rank | ||
5348 | + rgrank=root_group_rank | ||
5349 | + grank=group_rank | ||
5350 | + ngroup=number_groups | ||
5351 | + call getrunparameters(run_print_unit=iunit) | ||
5352 | + xv=(sum(xsp**3.d0))**(1.d0/3.d0) | ||
5353 | + nodrmax=maxval(nodr) | ||
5354 | + qext=0.d0 | ||
5355 | + qabs=0.d0 | ||
5356 | + qsca=0.d0 | ||
5357 | + qextold=0.d0 | ||
5358 | + qscaold=0.d0 | ||
5359 | +! | ||
5360 | +! perform T matrix file operations as needed | ||
5361 | +! | ||
5362 | + if(rank.eq.0) then | ||
5363 | + if(calctmatrix.eq.1) then | ||
5364 | + open(3,file=tmatrixfile) | ||
5365 | + write(3,'(i4)') nodrt | ||
5366 | + lstart(1)=1 | ||
5367 | + else | ||
5368 | + open(3,file=tmatrixfile) | ||
5369 | + write(iunit,'('' finding end of record to file '',a)') tmatrixfile | ||
5370 | + read(3,*) nodrtt | ||
5371 | + do l=1,nodrt | ||
5372 | + do k=-l,l | ||
5373 | + do q=1,2 | ||
5374 | + read(3,'(3i5)',end=20,err=20) lt,kt,qt | ||
5375 | + do n=1,l | ||
5376 | + do m=-n,n | ||
5377 | + read(3,'(2i5,4e17.9)',end=20,err=20) nt,mt,at1,at2,at3,at4 | ||
5378 | + enddo | ||
5379 | + enddo | ||
5380 | + enddo | ||
5381 | + enddo | ||
5382 | + do i=1,nsphere | ||
5383 | + read(3,'(i5,3e17.9)',end=20,err=20) it,qextl(i),qabsl(i),qscal(i) | ||
5384 | + enddo | ||
5385 | + qext=qext+qextl | ||
5386 | + qabs=qabs+qabsl | ||
5387 | + qsca=qsca+qscal | ||
5388 | + enddo | ||
5389 | +20 close(3) | ||
5390 | + open(3,file=tmatrixfile) | ||
5391 | + qextold(1)=0.d0 | ||
5392 | + qabstot=0.d0 | ||
5393 | + do i=1,nsphere | ||
5394 | + qextold=qextold+qext(i)*xsp(i)*xsp(i)/xv/xv | ||
5395 | + qabstot=qabstot+qabs(i)*xsp(i)*xsp(i)/xv/xv | ||
5396 | + enddo | ||
5397 | + qscaold(1)=qextold(1)-qabstot | ||
5398 | + lstart(1)=lt | ||
5399 | + read(3,*) nodrtt | ||
5400 | + write(iunit,'('' calculations begin with order '',i5)') lstart(1) | ||
5401 | + do l=1,lstart(1)-1 | ||
5402 | + do k=-l,l | ||
5403 | + do q=1,2 | ||
5404 | + read(3,'(3i5)') lt,kt,qt | ||
5405 | + do n=1,l | ||
5406 | + do m=-n,n | ||
5407 | + read(3,'(2i5,4e17.9)') nt,mt,at1,at2,at3,at4 | ||
5408 | + enddo | ||
5409 | + enddo | ||
5410 | + enddo | ||
5411 | + enddo | ||
5412 | + do i=1,nsphere | ||
5413 | + read(3,'(i5,3e17.9)') it,at1,at2,at3 | ||
5414 | + enddo | ||
5415 | + enddo | ||
5416 | + endif | ||
5417 | + endif | ||
5418 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_i=lstart,mpi_number=1,mpi_rank=0) | ||
5419 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qextold,mpi_number=1,mpi_rank=0) | ||
5420 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qscaold,mpi_number=1,mpi_rank=0) | ||
5421 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qext,mpi_number=nsphere,mpi_rank=0) | ||
5422 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qabs,mpi_number=nsphere,mpi_rank=0) | ||
5423 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dp=qsca,mpi_number=nsphere,mpi_rank=0) | ||
5424 | + call ms_mpi(mpi_command='barrier') | ||
5425 | + allocate(amnp0group(2,nodrt*(nodrt+2),0:ngroup-1),qextgroup(nsphere,0:ngroup-1), & | ||
5426 | + qabsgroup(nsphere,0:ngroup-1),qscagroup(nsphere,0:ngroup-1)) | ||
5427 | + numsolns=2*nodrt*(nodrt+2) | ||
5428 | + allocate(lindex(numsolns),kindex(numsolns)) | ||
5429 | +! | ||
5430 | +! find the starting point | ||
5431 | +! | ||
5432 | + i=0 | ||
5433 | + do l=1,nodrt | ||
5434 | + do k=-l,l | ||
5435 | + do q=1,2 | ||
5436 | + i=i+1 | ||
5437 | + lindex(i)=l | ||
5438 | + kindex(i)=k | ||
5439 | + enddo | ||
5440 | + enddo | ||
5441 | + enddo | ||
5442 | + do i=1,numsolns | ||
5443 | + if(lindex(i).eq.lstart(1).and.kindex(i).eq.-lstart(1)) exit | ||
5444 | + enddo | ||
5445 | + isolnstart=i | ||
5446 | + qextl=0.d0 | ||
5447 | + qabsl=0.d0 | ||
5448 | + qscal=0.d0 | ||
5449 | + lold=0 | ||
5450 | +! | ||
5451 | +! begin the loop over RHS of the interaction equations. The solutions are distributed | ||
5452 | +! among ngroup groups of processors | ||
5453 | +! | ||
5454 | + do isoln=isolnstart,numsolns,ngroup | ||
5455 | + if(rank.eq.0) timeorder=mytime() | ||
5456 | + do igroup=0,ngroup-1 | ||
5457 | + l=lindex(isoln+igroup) | ||
5458 | + k=kindex(isoln+igroup) | ||
5459 | + q=mod(isoln+igroup-1,2)+1 | ||
5460 | +! | ||
5461 | +! calculate the RHS | ||
5462 | +! | ||
5463 | + if(l.eq.-k.and.q.eq.1) then | ||
5464 | + if(allocated(ac)) deallocate(ac,amnp0) | ||
5465 | + allocate(ac(2,nodrmax*(nodrmax+2),-l:l,nsphere),amnp0(0:l+1,l,2)) | ||
5466 | + do i=1,nsphere | ||
5467 | + xij=rpos(:,i) | ||
5468 | + call gentrancoef(1,xij,(1.d0,0.d0),1,nodrmax,l,l,0,0,ac(1,1,-l,i)) | ||
5469 | + enddo | ||
5470 | + endif | ||
5471 | + if(igroup.eq.rgrank) then | ||
5472 | + if(k.le.-1) then | ||
5473 | + ka=l+1 | ||
5474 | + la=-k | ||
5475 | + else | ||
5476 | + ka=k | ||
5477 | + la=l | ||
5478 | + endif | ||
5479 | + noff=0 | ||
5480 | + do i=1,nsphere | ||
5481 | + nblk=nodr(i)*(nodr(i)+2)*2 | ||
5482 | + allocate(pmnp0(0:nodr(i)+1,nodr(i),2)) | ||
5483 | + do p=1,2 | ||
5484 | + do n=1,nodr(i) | ||
5485 | + do m=-n,n | ||
5486 | + mn=n*(n+1)+m | ||
5487 | + if(m.le.-1) then | ||
5488 | + ma=n+1 | ||
5489 | + na=-m | ||
5490 | + else | ||
5491 | + ma=m | ||
5492 | + na=n | ||
5493 | + endif | ||
5494 | + pmnp0(ma,na,p)=ac(abs(p-q)+1,mn,k,i) | ||
5495 | + enddo | ||
5496 | + enddo | ||
5497 | + enddo | ||
5498 | + pmnp(noff+1:noff+nblk)=reshape(pmnp0,(/nblk/)) | ||
5499 | + deallocate(pmnp0) | ||
5500 | + noff=noff+nblk | ||
5501 | + enddo | ||
5502 | +! | ||
5503 | +! multiply RHS by mie coefficients | ||
5504 | +! | ||
5505 | + call miecoeffmult(1,nsphere,neqns,pmnp,pmnpan) | ||
5506 | + amnp=pmnpan | ||
5507 | +! | ||
5508 | +! call the solver | ||
5509 | +! | ||
5510 | + if(fftranpresent.eq.1) then | ||
5511 | + call cbicgff(neqns,nsphere,niter,epssoln,pmnpan,amnp,0, & | ||
5512 | + niterstep,iter,err) | ||
5513 | + else | ||
5514 | + call cbicg(neqns,nsphere,niter,epssoln,pmnpan,amnp,0,iter,err) | ||
5515 | + endif | ||
5516 | + if(iter.gt.niter.or.err.gt.epssoln) istat=1 | ||
5517 | + call sphereqeff(nsphere,neqns,nodr,nodrmax,xsp,amnp,amnp, & | ||
5518 | + pmnp,pmnp,qextklq,qabsklq,qscaklq) | ||
5519 | + qextgroup(1:nsphere,igroup)=qextklq(1:nsphere) | ||
5520 | + qabsgroup(1:nsphere,igroup)=qabsklq(1:nsphere) | ||
5521 | + qscagroup(1:nsphere,igroup)=qscaklq(1:nsphere) | ||
5522 | +! | ||
5523 | +! compute the target-based expansion | ||
5524 | +! | ||
5525 | + ntran=l | ||
5526 | + amnp0=0.d0 | ||
5527 | + call amncommonorigin(neqns,nsphere,nodr,ntran,l,rpos, & | ||
5528 | + amnp,amnp0) | ||
5529 | + do n=1,l | ||
5530 | + do m=-n,n | ||
5531 | + if(m.le.-1) then | ||
5532 | + ma=n+1 | ||
5533 | + na=-m | ||
5534 | + else | ||
5535 | + ma=m | ||
5536 | + na=n | ||
5537 | + endif | ||
5538 | + mn=n*(n+1)+m | ||
5539 | + do p=1,2 | ||
5540 | + amnp0group(p,mn,igroup)=amnp0(ma,na,p) | ||
5541 | + enddo | ||
5542 | + enddo | ||
5543 | + enddo | ||
5544 | + endif | ||
5545 | + enddo | ||
5546 | +! | ||
5547 | +! send the solutions to the rank 0 processor | ||
5548 | +! | ||
5549 | + call ms_mpi(mpi_command='barrier') | ||
5550 | + if(grank.eq.0) then | ||
5551 | + if(rank.ne.0) then | ||
5552 | + l=lindex(isoln+rgrank) | ||
5553 | + nblk=l*(l+2) | ||
5554 | + nsend=2*nblk | ||
5555 | + call ms_mpi(mpi_command='send',mpi_send_buf_dc=amnp0group(1,1,rgrank),& | ||
5556 | + mpi_number=nsend,mpi_rank=0,mpi_comm=root_group_comm) | ||
5557 | + call ms_mpi(mpi_command='send',mpi_send_buf_dp=qextgroup(1,rgrank),& | ||
5558 | + mpi_number=nsphere,mpi_rank=0,mpi_comm=root_group_comm) | ||
5559 | + call ms_mpi(mpi_command='send',mpi_send_buf_dp=qabsgroup(1,rgrank),& | ||
5560 | + mpi_number=nsphere,mpi_rank=0,mpi_comm=root_group_comm) | ||
5561 | + call ms_mpi(mpi_command='send',mpi_send_buf_dp=qscagroup(1,rgrank),& | ||
5562 | + mpi_number=nsphere,mpi_rank=0,mpi_comm=root_group_comm) | ||
5563 | + else | ||
5564 | + do igroup=1,ngroup-1 | ||
5565 | + l=lindex(isoln+igroup) | ||
5566 | + nblk=l*(l+2) | ||
5567 | + nsend=2*nblk | ||
5568 | + call ms_mpi(mpi_command='recv',mpi_recv_buf_dc=amnp0group(1,1,igroup),& | ||
5569 | + mpi_number=nsend,mpi_rank=igroup,mpi_comm=root_group_comm) | ||
5570 | + call ms_mpi(mpi_command='recv',mpi_recv_buf_dp=qextgroup(1,igroup),& | ||
5571 | + mpi_number=nsphere,mpi_rank=igroup,mpi_comm=root_group_comm) | ||
5572 | + call ms_mpi(mpi_command='recv',mpi_recv_buf_dp=qabsgroup(1,igroup),& | ||
5573 | + mpi_number=nsphere,mpi_rank=igroup,mpi_comm=root_group_comm) | ||
5574 | + call ms_mpi(mpi_command='recv',mpi_recv_buf_dp=qscagroup(1,igroup),& | ||
5575 | + mpi_number=nsphere,mpi_rank=igroup,mpi_comm=root_group_comm) | ||
5576 | + enddo | ||
5577 | + endif | ||
5578 | + endif | ||
5579 | + call ms_mpi(mpi_command='barrier') | ||
5580 | +! | ||
5581 | +! write results, check for convergence | ||
5582 | +! | ||
5583 | + if(rank.eq.0) then | ||
5584 | + do igroup=0,ngroup-1 | ||
5585 | + l=lindex(isoln+igroup) | ||
5586 | + k=kindex(isoln+igroup) | ||
5587 | + q=mod(isoln+igroup-1,2)+1 | ||
5588 | + qextl=qextl+qextgroup(1:nsphere,igroup) | ||
5589 | + qabsl=qabsl+qabsgroup(1:nsphere,igroup) | ||
5590 | + qscal=qscal+qscagroup(1:nsphere,igroup) | ||
5591 | + qext=qext+qextgroup(1:nsphere,igroup) | ||
5592 | + qabs=qabs+qabsgroup(1:nsphere,igroup) | ||
5593 | + qsca=qsca+qscagroup(1:nsphere,igroup) | ||
5594 | + write(3,'(3i5)') l,k,q | ||
5595 | + do n=1,l | ||
5596 | + do m=-n,n | ||
5597 | + mn=n*(n+1)+m | ||
5598 | + write(3,'(2i5,4e17.9)') n,m,amnp0group(1,mn,igroup), & | ||
5599 | + amnp0group(2,mn,igroup) | ||
5600 | + enddo | ||
5601 | + enddo | ||
5602 | + if(istart.eq.1.and.igroup.eq.0) then | ||
5603 | + time1=mytime()-timeorder | ||
5604 | + call timewrite(iunit,' time per group solution:',time1) | ||
5605 | + time2=time1*dble(numsolns-isolnstart)/dble(ngroup) | ||
5606 | + call timewrite(iunit,' estimated t matrix calcuation time:',time2) | ||
5607 | + write(iunit,'('' n # its qext qabs'',& | ||
5608 | + &'' qsca error est. time rem.'')') | ||
5609 | + call flush(iunit) | ||
5610 | + istart=0 | ||
5611 | + endif | ||
5612 | + if(igroup.eq.0) then | ||
5613 | + timeorder=mytime()-timeorder | ||
5614 | + time2=timeorder*dble(numsolns-isoln)/dble(ngroup) | ||
5615 | + if(time2.gt.3600.d0) then | ||
5616 | + time2=time2/3600.d0 | ||
5617 | + timeunit=' hrs' | ||
5618 | + elseif(time2.gt.60.d0) then | ||
5619 | + time2=time2/60.d0 | ||
5620 | + timeunit=' min' | ||
5621 | + else | ||
5622 | + timeunit=' sec' | ||
5623 | + endif | ||
5624 | + endif | ||
5625 | + iexit(1)=0 | ||
5626 | + if(k.eq.l.and.q.eq.2) then | ||
5627 | + qexttot=0.d0 | ||
5628 | + qabstot=0.d0 | ||
5629 | + do i=1,nsphere | ||
5630 | + qexttot=qexttot+qext(i)*xsp(i)*xsp(i)/xv/xv | ||
5631 | + qabstot=qabstot+qabs(i)*xsp(i)*xsp(i)/xv/xv | ||
5632 | + write(3,'(i5,3e17.9)') i,qextl(i),qabsl(i),qscal(i) | ||
5633 | + enddo | ||
5634 | + qextl=0.d0 | ||
5635 | + qabsl=0.d0 | ||
5636 | + qscal=0.d0 | ||
5637 | + qscatot=qexttot-qabstot | ||
5638 | + errqe=qexttot-qextold(1) | ||
5639 | + errqs=qscatot-qscaold(1) | ||
5640 | + err=max(errqe,errqs) | ||
5641 | + write(iunit,'(i4,i5,4e13.5,f8.2,a4)') l,iter,qexttot,qabstot, & | ||
5642 | + qscatot,err,time2,timeunit | ||
5643 | + call flush(iunit) | ||
5644 | + qextold(1)=qexttot | ||
5645 | + qscaold(1)=qscatot | ||
5646 | + if(err.le.epscon) iexit(1)=1 | ||
5647 | + endif | ||
5648 | + if(iexit(1).eq.1) then | ||
5649 | + nodrt=l | ||
5650 | + exit | ||
5651 | + endif | ||
5652 | + enddo | ||
5653 | + endif | ||
5654 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_i=iexit,mpi_number=1,mpi_rank=0) | ||
5655 | + call ms_mpi(mpi_command='barrier') | ||
5656 | + if(iexit(1).eq.1) then | ||
5657 | +! | ||
5658 | +! solution has converged | ||
5659 | +! | ||
5660 | + deallocate(amnp0group,qextgroup,qabsgroup,qscagroup,lindex,kindex,ac,amnp0) | ||
5661 | + nodrta(1)=nodrt | ||
5662 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_i=nodrta,mpi_number=1,mpi_rank=0) | ||
5663 | + nodrt=nodrta(1) | ||
5664 | + if(rank.eq.0) then | ||
5665 | + write(iunit,'('' T matrix converged, order:'',i5)') nodrt | ||
5666 | + close(3) | ||
5667 | + open(3,file=tmatrixfile,form='formatted',access='direct',recl=4) | ||
5668 | + write(3,'(i4)',rec=1) nodrt | ||
5669 | + close(3) | ||
5670 | + endif | ||
5671 | + return | ||
5672 | + endif | ||
5673 | + enddo | ||
5674 | + deallocate(amnp0group,qextgroup,qabsgroup,qscagroup,lindex,kindex,ac,amnp0) | ||
5675 | + if(rank.eq.0) then | ||
5676 | + write(*,'('' T matrix did not converge to set epsilon'')') | ||
5677 | + close(3) | ||
5678 | + endif | ||
5679 | + end subroutine tmatrixsoln | ||
5680 | +! | ||
5681 | +! solution of interaction equations for a fixed orientation | ||
5682 | +! | ||
5683 | +! | ||
5684 | +! original: 15 January 2011 | ||
5685 | +! revised: 21 February 2011: modification of efficiency calculation, to calculate | ||
5686 | +! polarized components | ||
5687 | +! 30 March 2011: took out gbfocus argument: this is not needed since positions are defined | ||
5688 | +! relative to the gb focus. | ||
5689 | +! 20 April 2011: used 2-group MPI formulation | ||
5690 | +! | ||
5691 | + subroutine fixedorsoln(neqns,nsphere,nodr,alpha,beta,cbeam,xsp,rpos,& | ||
5692 | + eps,epstran,niter,amnp,qext,qabs,qsca,maxerr,maxiter,iterwrite, & | ||
5693 | + fftranpresent,niterstep,istat) | ||
5694 | + use mpidefs | ||
5695 | + use mpidata | ||
5696 | + use intrinsics | ||
5697 | + use numconstants | ||
5698 | + use specialfuncs | ||
5699 | + use miecoefdata | ||
5700 | + use translation | ||
5701 | + use scatprops | ||
5702 | + implicit none | ||
5703 | + integer :: iter,niter,neqns,nodrmax,k,nsphere,i,ierr,istat,rank,maxiter,iterwrite | ||
5704 | + integer :: nodr(nsphere),m1,n1,p,rgrank,grank,ngroup,sendrank,numprocs, & | ||
5705 | + fftranpresent,niterstep | ||
5706 | + real(8) :: alpha,beta,eps,err,qext(nsphere,3),maxerr,& | ||
5707 | + qabs(nsphere,3),qsca(nsphere,3),cbeam,gbfocus(3),epstran | ||
5708 | + real(8) :: xsp(nsphere), rpos(3,nsphere),maxerra(1) | ||
5709 | + complex(8) :: amnp(neqns,2) | ||
5710 | + complex(8), allocatable :: pmnp(:,:),pmnpan(:) | ||
5711 | + rank=base_rank | ||
5712 | + rgrank=root_group_rank | ||
5713 | + grank=group_rank | ||
5714 | + ngroup=number_groups | ||
5715 | + numprocs=number_proc | ||
5716 | + sendrank=numprocs/2 | ||
5717 | + nodrmax=maxval(nodr) | ||
5718 | + allocate(pmnp(neqns,2)) | ||
5719 | + gbfocus=0.d0 | ||
5720 | + if(cbeam.eq.0.d0) then | ||
5721 | + call sphereplanewavecoef(nsphere,neqns,nodr,nodrmax,alpha,beta,rpos,pmnp) | ||
5722 | + else | ||
5723 | + call spheregaussianbeamcoef(nsphere,neqns,nodr,alpha,beta,cbeam, & | ||
5724 | + rpos,gbfocus,epstran,pmnp) | ||
5725 | + endif | ||
5726 | + istat=0 | ||
5727 | + maxiter=0 | ||
5728 | + maxerr=0. | ||
5729 | +! | ||
5730 | +! calculate the two solutions | ||
5731 | +! | ||
5732 | + allocate(pmnpan(neqns)) | ||
5733 | + if(ngroup.eq.1) then | ||
5734 | + do k=1,2 | ||
5735 | + call miecoeffmult(1,nsphere,neqns,pmnp(1,k),pmnpan) | ||
5736 | + amnp(1:neqns,k)=pmnpan(1:neqns) | ||
5737 | + if(fftranpresent.eq.1) then | ||
5738 | + call cbicgff(neqns,nsphere,niter,eps,pmnpan,amnp(1,k),iterwrite, & | ||
5739 | + niterstep,iter,err) | ||
5740 | + else | ||
5741 | + call cbicg(neqns,nsphere,niter,eps,pmnpan,amnp(1,k),iterwrite, & | ||
5742 | + iter,err) | ||
5743 | + endif | ||
5744 | + maxiter=max(iter,maxiter) | ||
5745 | + maxerr=max(err,maxerr) | ||
5746 | + if(iter.gt.niter.or.err.gt.eps) istat=1 | ||
5747 | + call ms_mpi(mpi_command='barrier') | ||
5748 | + enddo | ||
5749 | + else | ||
5750 | + k=rgrank+1 | ||
5751 | + call miecoeffmult(1,nsphere,neqns,pmnp(1,k),pmnpan) | ||
5752 | + amnp(1:neqns,k)=pmnpan(1:neqns) | ||
5753 | + if(fftranpresent.eq.1) then | ||
5754 | + call cbicgff(neqns,nsphere,niter,eps,pmnpan,amnp(1,k),iterwrite, & | ||
5755 | + niterstep,iter,err) | ||
5756 | + else | ||
5757 | + call cbicg(neqns,nsphere,niter,eps,pmnpan,amnp(1,k),iterwrite, & | ||
5758 | + iter,err) | ||
5759 | + endif | ||
5760 | + maxiter=max(iter,maxiter) | ||
5761 | + maxerr=max(err,maxerr) | ||
5762 | + call ms_mpi(mpi_command='barrier') | ||
5763 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=amnp(1,2),& | ||
5764 | + mpi_number=neqns,mpi_rank=sendrank) | ||
5765 | + endif | ||
5766 | + deallocate(pmnpan) | ||
5767 | +! | ||
5768 | +! efficiency factor calculations | ||
5769 | +! | ||
5770 | + call sphereqeff(nsphere,neqns,nodr,nodrmax,xsp,amnp(1,1),amnp(1,1), & | ||
5771 | + pmnp(1,1),pmnp(1,1),qext(1,1),qabs(1,1),qsca(1,1)) | ||
5772 | + call sphereqeff(nsphere,neqns,nodr,nodrmax,xsp,amnp(1,2),amnp(1,2), & | ||
5773 | + pmnp(1,2),pmnp(1,2),qext(1,2),qabs(1,2),qsca(1,2)) | ||
5774 | + call sphereqeff(nsphere,neqns,nodr,nodrmax,xsp,amnp(1,1),amnp(1,2), & | ||
5775 | + pmnp(1,1),pmnp(1,2),qext(1,3),qabs(1,3),qsca(1,3)) | ||
5776 | + call ms_mpi(mpi_command='barrier') | ||
5777 | + deallocate(pmnp) | ||
5778 | + end subroutine fixedorsoln | ||
5779 | +! | ||
5780 | +! hybrid bcgm, using far field translation | ||
5781 | +! november 2011 | ||
5782 | +! | ||
5783 | + subroutine cbicgff(neqns,nsphere,niter,eps,pnp,anp,iterwrite,niterstep,iter,err) | ||
5784 | + use mpidefs | ||
5785 | + use mpidata | ||
5786 | + use intrinsics | ||
5787 | + use spheredata | ||
5788 | + use miecoefdata | ||
5789 | + use numconstants | ||
5790 | + use specialfuncs | ||
5791 | + use translation | ||
5792 | + implicit none | ||
5793 | + integer :: neqns,niter,iter,nsphere,writetime,nodr(nsphere),noff(nsphere+1),& | ||
5794 | + nblk(nsphere),rank,ierr,iexit,i,j,m,n,p,iunit,iterwrite,ip1,ip2, & | ||
5795 | + np1,np2,nsend,numprocs,grank,istore,itermax,istep,niterstep | ||
5796 | + real(8) :: eps,err,erra(1),enorm,time1,time2,epsstep,errstep | ||
5797 | + complex(8) :: pnp(neqns),anp(neqns),gnp(neqns),gnpold(neqns),pgnp(neqns), & | ||
5798 | + cr(neqns) | ||
5799 | + data writetime/0/ | ||
5800 | + rank=base_rank | ||
5801 | + grank=group_rank | ||
5802 | + numprocs=proc_per_group | ||
5803 | + call getmiedata(sphere_order=nodr,sphere_block=nblk,sphere_block_offset=noff) | ||
5804 | + if(rank.eq.0) then | ||
5805 | + call getrunparameters(run_print_unit=iunit) | ||
5806 | + endif | ||
5807 | + err=0.d0 | ||
5808 | + iter=0 | ||
5809 | + enorm=dot_product(pnp,pnp) | ||
5810 | + gnpold=0.d0 | ||
5811 | + if(enorm.eq.0.d0) return | ||
5812 | + gnp=0.d0 | ||
5813 | + ip1=mpi_sphere_index(grank)+1 | ||
5814 | + ip2=mpi_sphere_index(grank)+mpi_sphere_number(grank) | ||
5815 | + do i=ip1,ip2 | ||
5816 | + do j=1,nsphere | ||
5817 | + if(i.ne.j) then | ||
5818 | + call fftranslationerror(anp(noff(j)+1:noff(j)+nblk(j)), & | ||
5819 | + gnp(noff(i)+1:noff(i)+nblk(i)),j,i,nodr(j),nodr(i)) | ||
5820 | + endif | ||
5821 | + enddo | ||
5822 | + enddo | ||
5823 | + do i=0,numprocs-1 | ||
5824 | + ip1=mpi_sphere_index(i)+1 | ||
5825 | + ip2=mpi_sphere_index(i)+mpi_sphere_number(i) | ||
5826 | + np1=noff(ip1)+1 | ||
5827 | + np2=noff(ip2)+nblk(ip2) | ||
5828 | + nsend=np2-np1+1 | ||
5829 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=gnp(np1:np2),mpi_number=nsend, & | ||
5830 | + mpi_rank=i,mpi_comm=group_comm) | ||
5831 | + enddo | ||
5832 | + call miecoeffmult(1,nsphere,neqns,gnp,gnp) | ||
5833 | + | ||
5834 | + iter=0 | ||
5835 | + epsstep=eps | ||
5836 | + istep=0 | ||
5837 | + do | ||
5838 | + istep=istep+1 | ||
5839 | + gnpold=gnp | ||
5840 | + pgnp=pnp+gnp | ||
5841 | + call cbicg(neqns,nsphere,niterstep,epsstep,pgnp,anp,0,itermax,errstep) | ||
5842 | + iter=iter+min(itermax,niterstep) | ||
5843 | + gnp=0.d0 | ||
5844 | + ip1=mpi_sphere_index(grank)+1 | ||
5845 | + ip2=mpi_sphere_index(grank)+mpi_sphere_number(grank) | ||
5846 | + do i=ip1,ip2 | ||
5847 | + do j=1,nsphere | ||
5848 | + if(i.ne.j) then | ||
5849 | + call fftranslationerror(anp(noff(j)+1:noff(j)+nblk(j)), & | ||
5850 | + gnp(noff(i)+1:noff(i)+nblk(i)),j,i,nodr(j),nodr(i)) | ||
5851 | + endif | ||
5852 | + enddo | ||
5853 | + enddo | ||
5854 | + do i=0,numprocs-1 | ||
5855 | + ip1=mpi_sphere_index(i)+1 | ||
5856 | + ip2=mpi_sphere_index(i)+mpi_sphere_number(i) | ||
5857 | + np1=noff(ip1)+1 | ||
5858 | + np2=noff(ip2)+nblk(ip2) | ||
5859 | + nsend=np2-np1+1 | ||
5860 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=gnp(np1:np2),mpi_number=nsend, & | ||
5861 | + mpi_rank=i,mpi_comm=group_comm) | ||
5862 | + enddo | ||
5863 | + call miecoeffmult(1,nsphere,neqns,gnp,gnp) | ||
5864 | + err=dot_product(gnp-gnpold,gnp-gnpold)/enorm | ||
5865 | + if(rank.eq.0.and.iterwrite.eq.1) then | ||
5866 | + write(iunit,'('' step,iteration,bcgm err,correc err:'',2i5,2e13.5)') & | ||
5867 | + istep,iter,errstep,err | ||
5868 | + call flush(iunit) | ||
5869 | + endif | ||
5870 | + epsstep=eps | ||
5871 | + err=max(err,errstep) | ||
5872 | + if((err.lt.eps).or.iter.gt.niter) exit | ||
5873 | + enddo | ||
5874 | + end subroutine cbicgff | ||
5875 | + | ||
5876 | +! | ||
5877 | +! iteration solver | ||
5878 | +! generalized complex biconjugate gradient method | ||
5879 | +! original code: Piotr Flatau, although not much remains. | ||
5880 | +! specialized to the multiple sphere problem | ||
5881 | +! | ||
5882 | +! | ||
5883 | +! last revised: 15 January 2011 | ||
5884 | +! october 2011: translation calls modified | ||
5885 | +! | ||
5886 | + subroutine cbicg(neqns,nsphere,niter,eps,pnp,anp,iterwrite,iter,err) | ||
5887 | + use mpidefs | ||
5888 | + use mpidata | ||
5889 | + use intrinsics | ||
5890 | + use spheredata | ||
5891 | + use miecoefdata | ||
5892 | + use numconstants | ||
5893 | + use specialfuncs | ||
5894 | + use translation | ||
5895 | + implicit none | ||
5896 | + integer :: neqns,niter,iter,nsphere,writetime,nodr(nsphere),noff(nsphere+1),& | ||
5897 | + nblk(nsphere),rank,ierr,iexit,i,j,m,n,p,iunit,iterwrite,ip1,ip2, & | ||
5898 | + np1,np2,nsend,numprocs,grank,istore | ||
5899 | + real(8) :: eps,err,erra(1),enorm,time1,time2 | ||
5900 | + complex(8) :: pnp(neqns),anp(neqns) | ||
5901 | + complex(8) :: cak(1),csk,cbk,csk2(1) | ||
5902 | + complex(8) :: cr(neqns),cp(neqns),cw(neqns),cq(neqns),cap(neqns),caw(neqns), & | ||
5903 | + crt(neqns),capt(neqns),cawt(neqns),ccw(neqns) | ||
5904 | + data writetime/0/ | ||
5905 | + rank=base_rank | ||
5906 | + grank=group_rank | ||
5907 | + numprocs=proc_per_group | ||
5908 | + call getmiedata(sphere_order=nodr,sphere_block=nblk,sphere_block_offset=noff) | ||
5909 | + ip1=mpi_sphere_index(grank)+1 | ||
5910 | + ip2=mpi_sphere_index(grank)+mpi_sphere_number(grank) | ||
5911 | + np1=noff(ip1)+1 | ||
5912 | + np2=noff(ip2)+nblk(ip2) | ||
5913 | + nsend=np2-np1+1 | ||
5914 | + crt=0.d0 | ||
5915 | + iexit=0 | ||
5916 | + if(rank.eq.0) then | ||
5917 | + call getrunparameters(run_print_unit=iunit) | ||
5918 | + endif | ||
5919 | + err=0.d0 | ||
5920 | + iter=0 | ||
5921 | + enorm=dot_product(pnp,pnp) | ||
5922 | + cr=0.d0 | ||
5923 | + if(enorm.eq.0.d0) return | ||
5924 | + do i=ip1,ip2 | ||
5925 | + do j=1,nsphere | ||
5926 | + if(i.ne.j) then | ||
5927 | + call rottranjtoi(anp(noff(j)+1:noff(j)+nblk(j)), & | ||
5928 | + cr(noff(i)+1:noff(i)+nblk(i)),j,i,nodr(j),nodr(i),1,1) | ||
5929 | + endif | ||
5930 | + enddo | ||
5931 | + enddo | ||
5932 | + do i=0,numprocs-1 | ||
5933 | + ip1=mpi_sphere_index(i)+1 | ||
5934 | + ip2=mpi_sphere_index(i)+mpi_sphere_number(i) | ||
5935 | + np1=noff(ip1)+1 | ||
5936 | + np2=noff(ip2)+nblk(ip2) | ||
5937 | + nsend=np2-np1+1 | ||
5938 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=cr(np1:np2),mpi_number=nsend, & | ||
5939 | + mpi_rank=i,mpi_comm=group_comm) | ||
5940 | + enddo | ||
5941 | + call miecoeffmult(1,nsphere,neqns,cr,cr) | ||
5942 | + cr=pnp-anp+cr | ||
5943 | + cq=conjg(cr) | ||
5944 | + cw=cq | ||
5945 | + cp=cr | ||
5946 | + csk=dot_product(conjg(cr),cr) | ||
5947 | + if(cdabs(csk).eq.0.d0) return | ||
5948 | +! | ||
5949 | +! here starts the main iteration loop | ||
5950 | +! | ||
5951 | + do iter=1,niter | ||
5952 | + ip1=mpi_sphere_index(grank)+1 | ||
5953 | + ip2=mpi_sphere_index(grank)+mpi_sphere_number(grank) | ||
5954 | + np1=noff(ip1)+1 | ||
5955 | + np2=noff(ip2)+nblk(ip2) | ||
5956 | + nsend=np2-np1+1 | ||
5957 | + cak(1)=(0.d0,0.d0) | ||
5958 | + cawt=(0.d0,0.d0) | ||
5959 | + capt=(0.d0,0.d0) | ||
5960 | + if(rank.eq.0) then | ||
5961 | + if(writetime.eq.0) time1=mytime() | ||
5962 | + endif | ||
5963 | + ccw=conjg(cw) | ||
5964 | + cap=0.d0 | ||
5965 | + caw=0.d0 | ||
5966 | + call miecoeffmult(1,nsphere,neqns,ccw,ccw) | ||
5967 | + do i=ip1,ip2 | ||
5968 | + do j=1,nsphere | ||
5969 | + if(i.ne.j) then | ||
5970 | + call rottrantwojtoi(cp(noff(j)+1:noff(j)+nblk(j)), & | ||
5971 | + ccw(noff(j)+1:noff(j)+nblk(j)), & | ||
5972 | + cap(noff(i)+1:noff(i)+nblk(i)), & | ||
5973 | + caw(noff(i)+1:noff(i)+nblk(i)), & | ||
5974 | + j,i,nodr(j),nodr(i)) | ||
5975 | +! call rottranjtoi(cp(noff(j)+1:noff(j)+nblk(j)), & | ||
5976 | +! cap(noff(i)+1:noff(i)+nblk(i)),j,i,nodr(j),nodr(i),1,1) | ||
5977 | +! call rottranjtoi(ccw(noff(j)+1:noff(j)+nblk(j)), & | ||
5978 | +! caw(noff(i)+1:noff(i)+nblk(i)),j,i,nodr(j),nodr(i),-1,-1) | ||
5979 | + endif | ||
5980 | + enddo | ||
5981 | + enddo | ||
5982 | + call miecoeffmult(ip1,ip2,neqns,cap,cap) | ||
5983 | + cap(np1:np2)=cp(np1:np2)-cap(np1:np2) | ||
5984 | + caw(np1:np2)=cw(np1:np2)-conjg(caw(np1:np2)) | ||
5985 | + cak(1)=dot_product(cw(np1:np2),cap(np1:np2)) | ||
5986 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dc=cak,mpi_number=1, & | ||
5987 | + mpi_operation=ms_mpi_sum,mpi_comm=group_comm) | ||
5988 | + cak(1)=csk/cak(1) | ||
5989 | + anp(np1:np2)=anp(np1:np2)+cak(1)*cp(np1:np2) | ||
5990 | + cr(np1:np2)=cr(np1:np2)-cak(1)*cap(np1:np2) | ||
5991 | + cq(np1:np2)=cq(np1:np2)-conjg(cak(1))*caw(np1:np2) | ||
5992 | + csk2(1)=dot_product(cq(np1:np2),cr(np1:np2)) | ||
5993 | + err=dot_product(cr(np1:np2),cr(np1:np2)) | ||
5994 | + erra(1)=err | ||
5995 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dc=csk2,mpi_number=1, & | ||
5996 | + mpi_operation=ms_mpi_sum,mpi_comm=group_comm) | ||
5997 | + call ms_mpi(mpi_command='allreduce',mpi_recv_buf_dp=erra,mpi_number=1, & | ||
5998 | + mpi_operation=ms_mpi_sum,mpi_comm=group_comm) | ||
5999 | + err=erra(1) | ||
6000 | + err=err/enorm | ||
6001 | + if(err.lt. eps) exit | ||
6002 | + cbk=csk2(1)/csk | ||
6003 | + cp(np1:np2)=cr(np1:np2)+cbk*cp(np1:np2) | ||
6004 | + cw(np1:np2)=cq(np1:np2)+conjg(cbk)*cw(np1:np2) | ||
6005 | + csk=csk2(1) | ||
6006 | + do i=0,numprocs-1 | ||
6007 | + ip1=mpi_sphere_index(i)+1 | ||
6008 | + ip2=mpi_sphere_index(i)+mpi_sphere_number(i) | ||
6009 | + np1=noff(ip1)+1 | ||
6010 | + np2=noff(ip2)+nblk(ip2) | ||
6011 | + nsend=np2-np1+1 | ||
6012 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=cp(np1:np2),mpi_number=nsend, & | ||
6013 | + mpi_rank=i,mpi_comm=group_comm) | ||
6014 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=cw(np1:np2),mpi_number=nsend, & | ||
6015 | + mpi_rank=i,mpi_comm=group_comm) | ||
6016 | + enddo | ||
6017 | + if(rank.eq.0.and.iter.eq.1.and.writetime.eq.0) then | ||
6018 | + time2=mytime()-time1 | ||
6019 | + call timewrite(iunit,' time per iteration:',time2) | ||
6020 | + writetime=1 | ||
6021 | + endif | ||
6022 | + if(rank.eq.0.and.iterwrite.eq.1) then | ||
6023 | + write(iunit,'('' iter, err:'',i5,e13.5)') iter,err | ||
6024 | + call flush(iunit) | ||
6025 | + endif | ||
6026 | + enddo | ||
6027 | +! | ||
6028 | +! arrive here with a converged solution | ||
6029 | +! | ||
6030 | + do i=0,numprocs-1 | ||
6031 | + ip1=mpi_sphere_index(i)+1 | ||
6032 | + ip2=mpi_sphere_index(i)+mpi_sphere_number(i) | ||
6033 | + np1=noff(ip1)+1 | ||
6034 | + np2=noff(ip2)+nblk(ip2) | ||
6035 | + nsend=np2-np1+1 | ||
6036 | + call ms_mpi(mpi_command='bcast',mpi_send_buf_dc=anp(np1:np2),mpi_number=nsend, & | ||
6037 | + mpi_rank=i,mpi_comm=group_comm) | ||
6038 | + enddo | ||
6039 | + end subroutine cbicg | ||
6040 | + | ||
6041 | + end module solver |
No preview for this file type
1 | +++ a/mstm_guiwindow.ui | ||
1 | +<?xml version="1.0" encoding="UTF-8"?> | ||
2 | +<ui version="4.0"> | ||
3 | + <class>mstmGui</class> | ||
4 | + <widget class="QMainWindow" name="mstmGui"> | ||
5 | + <property name="geometry"> | ||
6 | + <rect> | ||
7 | + <x>0</x> | ||
8 | + <y>0</y> | ||
9 | + <width>599</width> | ||
10 | + <height>418</height> | ||
11 | + </rect> | ||
12 | + </property> | ||
13 | + <property name="windowTitle"> | ||
14 | + <string>Spectral Multi-Sphere T-Matrix Simulation</string> | ||
15 | + </property> | ||
16 | + <widget class="QWidget" name="centralwidget"> | ||
17 | + <widget class="QPushButton" name="btnSimulate"> | ||
18 | + <property name="geometry"> | ||
19 | + <rect> | ||
20 | + <x>400</x> | ||
21 | + <y>70</y> | ||
22 | + <width>89</width> | ||
23 | + <height>23</height> | ||
24 | + </rect> | ||
25 | + </property> | ||
26 | + <property name="text"> | ||
27 | + <string>Simulate</string> | ||
28 | + </property> | ||
29 | + </widget> | ||
30 | + <widget class="QLabel" name="label_7"> | ||
31 | + <property name="geometry"> | ||
32 | + <rect> | ||
33 | + <x>0</x> | ||
34 | + <y>20</y> | ||
35 | + <width>111</width> | ||
36 | + <height>21</height> | ||
37 | + </rect> | ||
38 | + </property> | ||
39 | + <property name="text"> | ||
40 | + <string>Material</string> | ||
41 | + </property> | ||
42 | + <property name="alignment"> | ||
43 | + <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set> | ||
44 | + </property> | ||
45 | + </widget> | ||
46 | + <widget class="QLineEdit" name="txtMaterial"> | ||
47 | + <property name="geometry"> | ||
48 | + <rect> | ||
49 | + <x>120</x> | ||
50 | + <y>20</y> | ||
51 | + <width>211</width> | ||
52 | + <height>21</height> | ||
53 | + </rect> | ||
54 | + </property> | ||
55 | + <property name="readOnly"> | ||
56 | + <bool>true</bool> | ||
57 | + </property> | ||
58 | + </widget> | ||
59 | + <widget class="QGroupBox" name="groupBox"> | ||
60 | + <property name="geometry"> | ||
61 | + <rect> | ||
62 | + <x>10</x> | ||
63 | + <y>50</y> | ||
64 | + <width>361</width> | ||
65 | + <height>91</height> | ||
66 | + </rect> | ||
67 | + </property> | ||
68 | + <property name="title"> | ||
69 | + <string>Spectral Parameters</string> | ||
70 | + </property> | ||
71 | + <widget class="QDoubleSpinBox" name="spinStartLambda"> | ||
72 | + <property name="geometry"> | ||
73 | + <rect> | ||
74 | + <x>130</x> | ||
75 | + <y>30</y> | ||
76 | + <width>91</width> | ||
77 | + <height>22</height> | ||
78 | + </rect> | ||
79 | + </property> | ||
80 | + <property name="decimals"> | ||
81 | + <number>3</number> | ||
82 | + </property> | ||
83 | + <property name="singleStep"> | ||
84 | + <double>0.100000000000000</double> | ||
85 | + </property> | ||
86 | + </widget> | ||
87 | + <widget class="QSpinBox" name="spinNumSamples"> | ||
88 | + <property name="geometry"> | ||
89 | + <rect> | ||
90 | + <x>130</x> | ||
91 | + <y>60</y> | ||
92 | + <width>55</width> | ||
93 | + <height>22</height> | ||
94 | + </rect> | ||
95 | + </property> | ||
96 | + </widget> | ||
97 | + <widget class="QLabel" name="label_3"> | ||
98 | + <property name="geometry"> | ||
99 | + <rect> | ||
100 | + <x>10</x> | ||
101 | + <y>60</y> | ||
102 | + <width>111</width> | ||
103 | + <height>21</height> | ||
104 | + </rect> | ||
105 | + </property> | ||
106 | + <property name="text"> | ||
107 | + <string># Samples</string> | ||
108 | + </property> | ||
109 | + <property name="alignment"> | ||
110 | + <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set> | ||
111 | + </property> | ||
112 | + </widget> | ||
113 | + <widget class="QLabel" name="label_2"> | ||
114 | + <property name="geometry"> | ||
115 | + <rect> | ||
116 | + <x>10</x> | ||
117 | + <y>30</y> | ||
118 | + <width>111</width> | ||
119 | + <height>21</height> | ||
120 | + </rect> | ||
121 | + </property> | ||
122 | + <property name="text"> | ||
123 | + <string>Wavelengths(um)</string> | ||
124 | + </property> | ||
125 | + <property name="alignment"> | ||
126 | + <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set> | ||
127 | + </property> | ||
128 | + </widget> | ||
129 | + <widget class="QLabel" name="label"> | ||
130 | + <property name="geometry"> | ||
131 | + <rect> | ||
132 | + <x>230</x> | ||
133 | + <y>30</y> | ||
134 | + <width>21</width> | ||
135 | + <height>21</height> | ||
136 | + </rect> | ||
137 | + </property> | ||
138 | + <property name="text"> | ||
139 | + <string>to</string> | ||
140 | + </property> | ||
141 | + </widget> | ||
142 | + <widget class="QDoubleSpinBox" name="spinEndLambda"> | ||
143 | + <property name="geometry"> | ||
144 | + <rect> | ||
145 | + <x>250</x> | ||
146 | + <y>30</y> | ||
147 | + <width>91</width> | ||
148 | + <height>22</height> | ||
149 | + </rect> | ||
150 | + </property> | ||
151 | + <property name="decimals"> | ||
152 | + <number>3</number> | ||
153 | + </property> | ||
154 | + <property name="singleStep"> | ||
155 | + <double>0.100000000000000</double> | ||
156 | + </property> | ||
157 | + </widget> | ||
158 | + </widget> | ||
159 | + <widget class="QGroupBox" name="groupBox_2"> | ||
160 | + <property name="geometry"> | ||
161 | + <rect> | ||
162 | + <x>10</x> | ||
163 | + <y>150</y> | ||
164 | + <width>361</width> | ||
165 | + <height>91</height> | ||
166 | + </rect> | ||
167 | + </property> | ||
168 | + <property name="title"> | ||
169 | + <string>Spheres (currently only dimers)</string> | ||
170 | + </property> | ||
171 | + <widget class="QLabel" name="label_6"> | ||
172 | + <property name="geometry"> | ||
173 | + <rect> | ||
174 | + <x>220</x> | ||
175 | + <y>60</y> | ||
176 | + <width>31</width> | ||
177 | + <height>21</height> | ||
178 | + </rect> | ||
179 | + </property> | ||
180 | + <property name="text"> | ||
181 | + <string>um</string> | ||
182 | + </property> | ||
183 | + </widget> | ||
184 | + <widget class="QLabel" name="label_5"> | ||
185 | + <property name="geometry"> | ||
186 | + <rect> | ||
187 | + <x>0</x> | ||
188 | + <y>60</y> | ||
189 | + <width>111</width> | ||
190 | + <height>21</height> | ||
191 | + </rect> | ||
192 | + </property> | ||
193 | + <property name="text"> | ||
194 | + <string>Sphere Spacing</string> | ||
195 | + </property> | ||
196 | + <property name="alignment"> | ||
197 | + <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set> | ||
198 | + </property> | ||
199 | + </widget> | ||
200 | + <widget class="QLabel" name="label_4"> | ||
201 | + <property name="geometry"> | ||
202 | + <rect> | ||
203 | + <x>0</x> | ||
204 | + <y>30</y> | ||
205 | + <width>111</width> | ||
206 | + <height>21</height> | ||
207 | + </rect> | ||
208 | + </property> | ||
209 | + <property name="text"> | ||
210 | + <string># Spheres</string> | ||
211 | + </property> | ||
212 | + <property name="alignment"> | ||
213 | + <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set> | ||
214 | + </property> | ||
215 | + </widget> | ||
216 | + <widget class="QDoubleSpinBox" name="spinSpacing"> | ||
217 | + <property name="geometry"> | ||
218 | + <rect> | ||
219 | + <x>120</x> | ||
220 | + <y>60</y> | ||
221 | + <width>91</width> | ||
222 | + <height>22</height> | ||
223 | + </rect> | ||
224 | + </property> | ||
225 | + <property name="decimals"> | ||
226 | + <number>4</number> | ||
227 | + </property> | ||
228 | + <property name="singleStep"> | ||
229 | + <double>0.001000000000000</double> | ||
230 | + </property> | ||
231 | + </widget> | ||
232 | + <widget class="QSpinBox" name="spinNumSpheres"> | ||
233 | + <property name="enabled"> | ||
234 | + <bool>false</bool> | ||
235 | + </property> | ||
236 | + <property name="geometry"> | ||
237 | + <rect> | ||
238 | + <x>120</x> | ||
239 | + <y>30</y> | ||
240 | + <width>55</width> | ||
241 | + <height>22</height> | ||
242 | + </rect> | ||
243 | + </property> | ||
244 | + </widget> | ||
245 | + </widget> | ||
246 | + <widget class="QGroupBox" name="groupBox_3"> | ||
247 | + <property name="geometry"> | ||
248 | + <rect> | ||
249 | + <x>10</x> | ||
250 | + <y>250</y> | ||
251 | + <width>361</width> | ||
252 | + <height>111</height> | ||
253 | + </rect> | ||
254 | + </property> | ||
255 | + <property name="title"> | ||
256 | + <string>Incident Light Parameters</string> | ||
257 | + </property> | ||
258 | + <widget class="QLabel" name="label_8"> | ||
259 | + <property name="geometry"> | ||
260 | + <rect> | ||
261 | + <x>20</x> | ||
262 | + <y>20</y> | ||
263 | + <width>91</width> | ||
264 | + <height>21</height> | ||
265 | + </rect> | ||
266 | + </property> | ||
267 | + <property name="text"> | ||
268 | + <string>alpha (deg.)</string> | ||
269 | + </property> | ||
270 | + <property name="alignment"> | ||
271 | + <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set> | ||
272 | + </property> | ||
273 | + </widget> | ||
274 | + <widget class="QDoubleSpinBox" name="spinAlpha"> | ||
275 | + <property name="geometry"> | ||
276 | + <rect> | ||
277 | + <x>120</x> | ||
278 | + <y>20</y> | ||
279 | + <width>91</width> | ||
280 | + <height>22</height> | ||
281 | + </rect> | ||
282 | + </property> | ||
283 | + <property name="decimals"> | ||
284 | + <number>3</number> | ||
285 | + </property> | ||
286 | + <property name="singleStep"> | ||
287 | + <double>0.100000000000000</double> | ||
288 | + </property> | ||
289 | + </widget> | ||
290 | + <widget class="QLabel" name="label_9"> | ||
291 | + <property name="geometry"> | ||
292 | + <rect> | ||
293 | + <x>20</x> | ||
294 | + <y>50</y> | ||
295 | + <width>91</width> | ||
296 | + <height>21</height> | ||
297 | + </rect> | ||
298 | + </property> | ||
299 | + <property name="text"> | ||
300 | + <string>beta (deg.)</string> | ||
301 | + </property> | ||
302 | + <property name="alignment"> | ||
303 | + <set>Qt::AlignRight|Qt::AlignTrailing|Qt::AlignVCenter</set> | ||
304 | + </property> | ||
305 | + </widget> | ||
306 | + <widget class="QDoubleSpinBox" name="spinBeta"> | ||
307 | + <property name="geometry"> | ||
308 | + <rect> | ||
309 | + <x>120</x> | ||
310 | + <y>50</y> | ||
311 | + <width>91</width> | ||
312 | + <height>22</height> | ||
313 | + </rect> | ||
314 | + </property> | ||
315 | + <property name="decimals"> | ||
316 | + <number>3</number> | ||
317 | + </property> | ||
318 | + <property name="singleStep"> | ||
319 | + <double>0.100000000000000</double> | ||
320 | + </property> | ||
321 | + </widget> | ||
322 | + </widget> | ||
323 | + </widget> | ||
324 | + <widget class="QMenuBar" name="menubar"> | ||
325 | + <property name="geometry"> | ||
326 | + <rect> | ||
327 | + <x>0</x> | ||
328 | + <y>0</y> | ||
329 | + <width>599</width> | ||
330 | + <height>22</height> | ||
331 | + </rect> | ||
332 | + </property> | ||
333 | + <widget class="QMenu" name="menuFile"> | ||
334 | + <property name="title"> | ||
335 | + <string>File</string> | ||
336 | + </property> | ||
337 | + <addaction name="mnuSaveResults"/> | ||
338 | + <addaction name="mnuLoadMaterial"/> | ||
339 | + </widget> | ||
340 | + <addaction name="menuFile"/> | ||
341 | + </widget> | ||
342 | + <widget class="QStatusBar" name="statusbar"/> | ||
343 | + <action name="mnuSaveResults"> | ||
344 | + <property name="enabled"> | ||
345 | + <bool>true</bool> | ||
346 | + </property> | ||
347 | + <property name="text"> | ||
348 | + <string>Save Results</string> | ||
349 | + </property> | ||
350 | + </action> | ||
351 | + <action name="mnuLoadMaterial"> | ||
352 | + <property name="text"> | ||
353 | + <string>Load Material</string> | ||
354 | + </property> | ||
355 | + </action> | ||
356 | + </widget> | ||
357 | + <resources/> | ||
358 | + <connections/> | ||
359 | +</ui> |
1 | +++ a/mstm_materials.py | ||
1 | +class MaterialSampleClass: | ||
2 | + | ||
3 | + #constructor | ||
4 | + def __init__(self, l, n): | ||
5 | + self.l = l | ||
6 | + self.n = n | ||
7 | + | ||
8 | + #string conversion | ||
9 | + def __str__(self): | ||
10 | + result = "" | ||
11 | + result += str(self.l) + 'um: ' + str(self.n) | ||
12 | + return result | ||
13 | + | ||
14 | +class MaterialClass: | ||
15 | + materialList = [] | ||
16 | + | ||
17 | + def __init__(self, fileName=""): | ||
18 | + if fileName == "": | ||
19 | + materialList = [] | ||
20 | + else: | ||
21 | + self.loadFile(fileName) | ||
22 | + | ||
23 | + #when the material is cast to a string, create the list of refractive indices | ||
24 | + def __str__(self): | ||
25 | + nSamples = len(self.materialList) | ||
26 | + result = "" | ||
27 | + for i in range(nSamples): | ||
28 | + result += str(self.materialList[i]) + '\n' | ||
29 | + return result | ||
30 | + | ||
31 | + def __len__(self): | ||
32 | + return len(self.materialList) | ||
33 | + | ||
34 | + def __getitem__(self, l): | ||
35 | + bigI = smallI = 0; | ||
36 | + bigV = 999; | ||
37 | + smallV = 0; | ||
38 | + #find the smallest sample larger than l | ||
39 | + for i in range(len(self.materialList)): | ||
40 | + if self.materialList[i].l > l and self.materialList[i].l < bigV: | ||
41 | + bigI = i | ||
42 | + bigV = self.materialList[i].l | ||
43 | + if self.materialList[i].l < l and self.materialList[i].l > smallV: | ||
44 | + smallI = i | ||
45 | + smallV = self.materialList[i].l | ||
46 | + | ||
47 | + a = (l - smallV)/(bigV - smallV) | ||
48 | + | ||
49 | + bigN = self.materialList[bigI].n | ||
50 | + smallN = self.materialList[smallI].n | ||
51 | + | ||
52 | + n = a * bigN + (1 - a) * smallN | ||
53 | + | ||
54 | + return MaterialSampleClass(l, n) | ||
55 | + | ||
56 | + | ||
57 | + #print(str(self.materialList[smallI].l) + "---" + str(self.materialList[bigI].l)) | ||
58 | + | ||
59 | + return self.materialList[smallI] | ||
60 | + | ||
61 | + def add(self, l, n): | ||
62 | + m = MaterialSampleClass(l, n) | ||
63 | + self.materialList.append(m) | ||
64 | + | ||
65 | + def clip(self, minLambda, maxLambda): | ||
66 | + #this function clips all material samples to the range [minLambda, maxLambda] | ||
67 | + self.materialList = list(filter(lambda m: m.l > minLambda, self.materialList)) | ||
68 | + self.materialList = list(filter(lambda m: m.l < maxLambda, self.materialList)) | ||
69 | + | ||
70 | + | ||
71 | + def addSolution(self, n): | ||
72 | + #places the material in a solution (divide by the solution's n) | ||
73 | + for i in range(len(self.materialList)): | ||
74 | + self.materialList[i].n = self.materialList[i].n / n | ||
75 | + | ||
76 | + | ||
77 | + | ||
78 | + def loadFile(self, fileName): | ||
79 | + #open the real refractive index file | ||
80 | + irFID = open(fileName, 'r') | ||
81 | + #read the first line to get the units (wavelength (um) or wavenumber (cm^2)) | ||
82 | + lightUnits = irFID.readline().split('\t', 1)[0] | ||
83 | + | ||
84 | + #load the material | ||
85 | + for line in irFID: | ||
86 | + l, n, k = map(float, line.split("\t")) | ||
87 | + | ||
88 | + #if units are in wavenumber, convert to wavelength | ||
89 | + if lightUnits == "nu": | ||
90 | + l = l/10000 | ||
91 | + | ||
92 | + self.add(l, complex(n, k)) | ||
93 | + | ||
94 | + #close the file | ||
95 | + irFID.close() |
1 | +++ a/mstm_parameters.py | ||
1 | +class ParameterClass: | ||
2 | + #minimum and maximum wavelengths for the simulation | ||
3 | + minLambda = 0.300 | ||
4 | + maxLambda = 0.700 | ||
5 | + #number of spectral samples | ||
6 | + nSamples = 40 | ||
7 | + | ||
8 | + #material file name | ||
9 | + matFilename = 'etaSilver.txt' | ||
10 | + #are the sphere's in water? | ||
11 | + inWater = False | ||
12 | + | ||
13 | + paramDict = {} | ||
14 | + sphereList = [] | ||
15 | + | ||
16 | + sphereParamNames = ['radius', 'X', 'Y', 'Z', 'n', 'k', 'Xr', 'Xi'] | ||
17 | + | ||
18 | + def __init__(self, fileName): | ||
19 | + self.loadFile(fileName) | ||
20 | + | ||
21 | + def __getitem__(self, key): | ||
22 | + return self.paramDict[key]; | ||
23 | + | ||
24 | + def __setitem__(self, key, value): | ||
25 | + self.paramDict[key] = str(value); | ||
26 | + | ||
27 | + def clearSpheres(self): | ||
28 | + self.sphereList = [] | ||
29 | + | ||
30 | + def addSphere(self, a, x, y, z, n = 1.0, k=1.0): | ||
31 | + s = [a, x, y, z, n, k] | ||
32 | + self.sphereList.append(s) | ||
33 | + | ||
34 | + def loadFile(self, fileName): | ||
35 | + inpFID = open(fileName, 'r') | ||
36 | + selfparamDict = {} | ||
37 | + | ||
38 | + while 1: | ||
39 | + key = inpFID.readline().strip() | ||
40 | + | ||
41 | + #deal with sphere sizes and positions | ||
42 | + if key == 'sphere_sizes_and_positions': | ||
43 | + | ||
44 | + while True: | ||
45 | + #load the parameters for a sphere | ||
46 | + value = inpFID.readline().strip() | ||
47 | + if value == 'end_of_options': | ||
48 | + break | ||
49 | + | ||
50 | + self.sphereList.append(value.split(' ')) | ||
51 | + | ||
52 | + | ||
53 | + elif not key: | ||
54 | + break | ||
55 | + elif key == 'end_of_options': | ||
56 | + break | ||
57 | + else: | ||
58 | + value = inpFID.readline().strip() | ||
59 | + self.paramDict[key] = value | ||
60 | + | ||
61 | + inpFID.close() | ||
62 | + | ||
63 | + def saveFile(self, fileName): | ||
64 | + | ||
65 | + #open the output file | ||
66 | + outFID = open(fileName, 'w') | ||
67 | + | ||
68 | + #write the parameters | ||
69 | + for key in self.paramDict.keys(): | ||
70 | + outFID.write(key + '\n') | ||
71 | + outFID.write(self.paramDict[key] + '\n') | ||
72 | + | ||
73 | + #write the spheres | ||
74 | + outFID.write("sphere_sizes_and_positions\n") | ||
75 | + for s in self.sphereList: | ||
76 | + for p in s: | ||
77 | + outFID.write(str(p) + ' ') | ||
78 | + outFID.write('\n') | ||
79 | + outFID.write("end_of_options") | ||
80 | + | ||
81 | + | ||
82 | + def __str__(self): | ||
83 | + #print(self.paramDict) | ||
84 | + result = "" | ||
85 | + for key in self.paramDict.keys(): | ||
86 | + result += key + ": " + self.paramDict[key] + '\n' | ||
87 | + | ||
88 | + result += "\n" | ||
89 | + result += "Spheres:\n" | ||
90 | + #iterate through each sphere | ||
91 | + for s in self.sphereList: | ||
92 | + result += "------------------\n" | ||
93 | + for i in range(len(s)): | ||
94 | + result += self.sphereParamNames[i] + ": " + str(s[i]) + '\n' | ||
95 | + | ||
96 | + return result |
1 | +++ a/mstm_simparser.py | ||
1 | +class SimParserClass: | ||
2 | + | ||
3 | + simResults = dict() | ||
4 | + | ||
5 | + def __init__(self): | ||
6 | + self.simResults['lambda'] = list() | ||
7 | + self.simResults['extinction_unpolarized'] = list() | ||
8 | + self.simResults['extinction_parallel'] = list() | ||
9 | + self.simResults['extinction_perpendicular'] = list() | ||
10 | + | ||
11 | + def parseSimFile(self, l, fileName): | ||
12 | + self.simResults['lambda'].append(l) | ||
13 | + inFile = open(fileName, 'r') | ||
14 | + | ||
15 | + while True: | ||
16 | + line = inFile.readline().strip() | ||
17 | + | ||
18 | + if line == 'scattering matrix elements': | ||
19 | + break | ||
20 | + elif line == 'unpolarized total ext, abs, scat efficiencies, w.r.t. xv, and asym. parm': | ||
21 | + values = inFile.readline().strip().split(' ') | ||
22 | + self.simResults['extinction_unpolarized'].append(values[0]) | ||
23 | + elif line == 'parallel total ext, abs, scat efficiencies': | ||
24 | + values = inFile.readline().strip().split(' ') | ||
25 | + self.simResults['extinction_parallel'].append(values[0]) | ||
26 | + elif line == 'perpendicular total ext, abs, scat efficiencies': | ||
27 | + values = inFile.readline().strip().split(' ') | ||
28 | + self.simResults['extinction_perpendicular'].append(values[0]) | ||
29 | + | ||
30 | + def saveFile(self, fileName): | ||
31 | + outFile = open(fileName, 'w') | ||
32 | + outFile.write(str(self)) | ||
33 | + | ||
34 | + def __getitem__(self, key): | ||
35 | + return self.simResults[key]; | ||
36 | + | ||
37 | + def __str__(self): | ||
38 | + result = ''; | ||
39 | + | ||
40 | + for i in range(len(self.simResults['lambda'])): | ||
41 | + result += str(self.simResults['lambda'][i]) + '\t' | ||
42 | + result += str(self.simResults['extinction_unpolarized'][i]) + '\t' | ||
43 | + result += str(self.simResults['extinction_parallel'][i]) + '\t' | ||
44 | + result += str(self.simResults['extinction_perpendicular'][i]) + '\n' | ||
45 | + | ||
46 | + return result |
1 | +++ a/spectralOut.txt |